Makefile
Makefile.old
blib/*
+/cover_db
doc/.ikiwiki/*
html/*
ikiwiki.out
ikiwiki-calendar.out
pm_to_blib
*.man
+/po/cover_db
po/po2wiki_stamp
po/underlays/*/*.mdwn
po/underlays/basewiki/*/*.mdwn
CGI
Data::Dumper
YAML
+JSON
+RPC::XML
=head1 AUTHOR
Authen::Passphrase
Search::Xapian
-RPC::XML
File::MimeInfo
Locale::gettext
Net::OpenID::Consumer
html5 => {
type => "boolean",
default => 0,
- description => "generate HTML5? (experimental)",
- advanced => 1,
+ description => "generate HTML5?",
+ advanced => 0,
safe => 1,
rebuild => 1,
},
sub isinlinableimage ($) {
my $file=shift;
- return $file =~ /\.(png|gif|jpg|jpeg)$/i;
+ return $file =~ /\.(png|gif|jpg|jpeg|svg)$/i;
}
sub pagetitle ($;$) {
$cgilink = "<a href=\"".
cgiurl(
do => "create",
- page => lc($link),
+ page => $link,
from => $lpage
)."\" rel=\"nofollow\">?</a>";
}
|
'''(.*?)''' # 4: triple-single-quote
|
- <<(?<start>[a-zA-Z]+)\n(?<heredoc>.*?)\n\k<start> # 5, 6: heredoc'd value.
+ <<([a-zA-Z]+)\n # 5: heredoc start
+ (.*?)\n\5 # 6: heredoc value
|
(\S+) # 7: unquoted value
)
elsif (defined $7) {
$val=$7;
}
- elsif (defined $+{heredoc}) {
- $val=$+{heredoc};
+ elsif (defined $6) {
+ $val=$6;
}
if (defined $key) {
|
"[^"]*?" # single-quoted value
|
- <<(?<start>[a-zA-Z]+)\n(?<heredoc>.*?)\n\k<start> # heredoc'd value.
+ '''.*?''' # triple-single-quote
|
- '''.*?''' # triple-single-quoted value
+ <<([a-zA-Z]+)\n # 5: heredoc start
+ (?:.*?)\n\5 # heredoc value
|
[^"\s\]]+ # unquoted value
)
|
"[^"]*?" # single-quoted value
|
- '''.*?''' # triple-single-quoted value
+ '''.*?''' # triple-single-quote
|
- <<(?<start>[a-zA-Z]+)\n(?<heredoc>.*?)\n\k<start> # heredoc'd value.
+ <<([a-zA-Z]+)\n # 5: heredoc start
+ (?:.*?)\n\5 # heredoc value
|
[^"\s\]]+ # unquoted value
)
$form->tmpl_param("attachments-class" => "toggleable-open");
}
- # Save attachments in holding area before previewing so
- # they can be seen in the preview.
- if ($form->submitted eq "Preview") {
+ # Save attachments in holding area before previewing and
+ # saving.
+ if ($form->submitted eq "Preview" ||
+ $form->submitted eq "Save Page") {
attachments_save($form, $params{session});
}
}
$filename=IkiWiki::basename($filename);
$filename=~s/.*\\+(.+)/$1/; # hello, windows
$filename=IkiWiki::possibly_foolish_untaint(linkpage($filename));
+ my $dest=attachment_holding_location($form->field('page'));
# Check that the user is allowed to edit the attachment.
my $final_filename=
linkpage(IkiWiki::possibly_foolish_untaint(
attachment_location($form->field('page')))).
$filename;
- if (IkiWiki::file_pruned($final_filename)) {
- error(gettext("bad attachment filename"));
+ eval {
+ if (IkiWiki::file_pruned($final_filename)) {
+ error(gettext("bad attachment filename"));
+ }
+ IkiWiki::check_canedit($final_filename, $q, $session);
+ # And that the attachment itself is acceptable.
+ check_canattach($session, $final_filename, $tempfile);
+ };
+ if ($@) {
+ json_response($q, $form, $dest."/".$filename, $@);
+ error $@;
}
- IkiWiki::check_canedit($final_filename, $q, $session);
- # And that the attachment itself is acceptable.
- check_canattach($session, $final_filename, $tempfile);
# Move the attachment into holding directory.
# Try to use a fast rename; fall back to copying.
- my $dest=attachment_holding_location($form->field('page'));
IkiWiki::prep_writefile($filename, $dest);
unlink($dest."/".$filename);
if (rename($tempfile, $dest."/".$filename)) {
});
}
- # Return JSON response for the jquery file upload widget.
- if ($q->Accept("application/json") >= 1.0 &&
- grep { /application\/json/i } $q->Accept) {
- eval q{use JSON};
- error $@ if $@;
- print "Content-type: application/json\n\n";
- my $size=-s $dest."/".$filename;
- print to_json([
- {
- name => $filename,
- size => $size,
- humansize => IkiWiki::Plugin::filecheck::humansize($size),
- stored_msg => stored_msg(),
-
- }
- ]);
- exit 0;
- }
+ json_response($q, $form, $dest."/".$filename, stored_msg());
}
# Save all stored attachments for a page.
my $dir=attachment_holding_location($form->field('page'));
foreach my $filename (glob("$dir/*")) {
next unless -f $filename;
- my $dest=$config{srcdir}."/".
+ my $destdir=$config{srcdir}."/".
linkpage(IkiWiki::possibly_foolish_untaint(
- attachment_location($form->field('page')))).
- IkiWiki::basename($filename);
+ attachment_location($form->field('page'))));
+ my $destfile=IkiWiki::basename($filename);
+ my $dest=$destdir.$destfile;
unlink($dest);
+ IkiWiki::prep_writefile($destfile, $destdir);
rename($filename, $dest);
push @attachments, $dest;
}
my $page=shift;
# Put the attachment in a subdir of the page it's attached
- # to, unless that page is an "index" page.
- $page=~s/(^|\/)index//;
+ # to, unless that page is the "index" page.
+ return "" if $page eq 'index';
$page.="/" if length $page;
return $page;
gettext("just uploaded");
}
+sub json_response ($$$$) {
+ my $q=shift;
+ my $form=shift;
+ my $filename=shift;
+ my $stored_msg=shift;
+
+ if (! defined $form->submitted ||
+ $form->submitted ne "Upload Attachment") {
+ eval q{use JSON};
+ error $@ if $@;
+ print "Content-type: text/html\n\n";
+ my $size=-s $filename;
+ print to_json([
+ {
+ name => IkiWiki::basename($filename),
+ size => $size,
+ humansize => IkiWiki::Plugin::filecheck::humansize($size),
+ stored_msg => $stored_msg,
+
+ }
+ ]);
+ exit 0;
+ }
+}
+
1
sub import {
hook(type => "checkconfig", id => 'comments', call => \&checkconfig);
hook(type => "getsetup", id => 'comments', call => \&getsetup);
- hook(type => "preprocess", id => 'comment', call => \&preprocess);
+ hook(type => "preprocess", id => 'comment', call => \&preprocess,
+ scan => 1);
hook(type => "preprocess", id => 'commentmoderation', call => \&preprocess_moderation);
# here for backwards compatability with old comments
hook(type => "preprocess", id => '_comment', call => \&preprocess);
}
$content =~ s/\\"/"/g;
- if ($config{comments_allowdirectives}) {
- $content = IkiWiki::preprocess($page, $params{destpage},
- $content);
- }
+ if (defined wantarray) {
+ if ($config{comments_allowdirectives}) {
+ $content = IkiWiki::preprocess($page, $params{destpage},
+ $content);
+ }
- # no need to bother with htmlize if it's just HTML
- $content = IkiWiki::htmlize($page, $params{destpage}, $format, $content)
- if defined $format;
+ # no need to bother with htmlize if it's just HTML
+ $content = IkiWiki::htmlize($page, $params{destpage}, $format, $content)
+ if defined $format;
- IkiWiki::run_hooks(sanitize => sub {
- $content = shift->(
- page => $page,
- destpage => $params{destpage},
- content => $content,
- );
- });
+ IkiWiki::run_hooks(sanitize => sub {
+ $content = shift->(
+ page => $page,
+ destpage => $params{destpage},
+ content => $content,
+ );
+ });
+ }
+ else {
+ IkiWiki::preprocess($page, $params{destpage}, $content, 1);
+ }
# set metadata, possibly overriding [[!meta]] directives from the
# comment itself
$absolute ||
$form->submitted) {
@page_locs=$best_loc=$page;
+ unshift @page_locs, lc($page)
+ if ! $form->submitted && lc($page) ne $page;
+ }
+ elsif (lc $page eq lc $config{discussionpage}) {
+ @page_locs=$best_loc=$page="$from/".lc($page);
}
else {
my $dir=$from."/";
$dir=~s![^/]+/+$!!;
if ((defined $form->field('subpage') &&
- length $form->field('subpage')) ||
- $page eq lc($config{discussionpage})) {
+ length $form->field('subpage'))) {
$best_loc="$from/$page";
}
else {
$best_loc=$dir.$page;
}
+ my $mixedcase=lc($page) ne $page;
+
+ push @page_locs, $dir.lc($page) if $mixedcase;
push @page_locs, $dir.$page;
- push @page_locs, "$from/$page";
+ push @page_locs, $from."/".lc($page) if $mixedcase;
+ push @page_locs, $from."/".$page;
while (length $dir) {
$dir=~s![^/]+/+$!!;
+ push @page_locs, $dir.lc($page) if $mixedcase;
push @page_locs, $dir.$page;
}
-
+
my $userpage=IkiWiki::userpage($page);
push @page_locs, $userpage
if ! grep { $_ eq $userpage } @page_locs;
}
sub git_parse_changes {
+ my $reverted = shift;
my @changes = @_;
my ($subdir, $rootdir) = git_find_root();
$mode=$detail->{'mode_to'};
}
elsif ($detail->{'status'} =~ /^[AM]+\d*$/) {
- $action="add";
+ $action= $reverted ? "remove" : "add";
$mode=$detail->{'mode_to'};
}
elsif ($detail->{'status'} =~ /^[DAM]+\d*/) {
- $action="remove";
+ $action= $reverted ? "add" : "remove";
$mode=$detail->{'mode_from'};
}
else {
# it and only see changes in it.)
# The pre-receive hook already puts us in the right place.
$git_dir=".";
- push @rets, git_parse_changes(git_commit_info($oldrev."..".$newrev));
+ push @rets, git_parse_changes(0, git_commit_info($oldrev."..".$newrev));
$git_dir=undef;
}
error gettext("you are not allowed to revert a merge");
}
- my @ret=git_parse_changes(@commits);
+ my @ret=git_parse_changes(1, @commits);
$git_dir=undef;
return @ret;
--- /dev/null
+#!/usr/bin/perl
+# quick HTML heading id adder by Paul Wise
+package IkiWiki::Plugin::headinganchors;
+
+use warnings;
+use strict;
+use IkiWiki 3.00;
+use URI::Escape;
+
+sub import {
+ hook(type => "getsetup", id => "headinganchors", call => \&getsetup);
+ hook(type => "sanitize", id => "headinganchors", call => \&headinganchors);
+}
+
+sub getsetup () {
+ return
+ plugin => {
+ safe => 1,
+ rebuild => undef,
+ section => "widget",
+ },
+}
+
+sub text_to_anchor {
+ my $str = shift;
+ $str =~ s/^\s+//;
+ $str =~ s/\s+$//;
+ $str =~ s/\s/_/g;
+ $str =~ s/"//g;
+ $str =~ s/^[^a-zA-Z]/z-/; # must start with an alphabetical character
+ $str = uri_escape_utf8($str);
+ $str =~ s/%/./g;
+ return $str;
+}
+
+sub headinganchors (@) {
+ my %params=@_;
+ my $content=$params{content};
+ $content=~s{<h([0-9])>([^>]*)</h([0-9])>}{'<h'.$1.' id="'.text_to_anchor($2).'">'.$2.'</h'.$3.'>'}gie;
+ return $content;
+}
+
+1
}
sub checkconfig () {
-
eval q{use highlight};
- if ($@) {
- print STDERR "Failed to load highlight. Configuring anyway.\n";
- };
-
if (highlight::DataDir->can('new')){
$data_dir=new highlight::DataDir();
$data_dir->searchDataDir("");
my $dir = $params{page};
my $base = IkiWiki::basename($file);
+ my $issvg = $base=~s/\.svg$/.png/i;
eval q{use Image::Magick};
error gettext("Image::Magick is not installed") if $@;
- my $im = Image::Magick->new;
+ my $im = Image::Magick->new($issvg ? (magick => "png") : ());
my $imglink;
my $r = $im->Read($srcfile);
error sprintf(gettext("failed to read %s: %s"), $file, $r) if $r;
if (isinternal($page)) {
# make inlined text of internal pages searchable
run_hooks(indexhtml => sub {
- shift->(page => $page, destpage => $page,
+ shift->(page => $page, destpage => $destpage,
content => $ret);
});
}
next unless $v_offset; # 0 v_offset means no value
my $v = substr($text, $v_offset, $v_len);
$v =~ s/^([\'\"])(.*)\1$/$2/;
- if ($v=~/^#/) {
+ eval q{use HTML::Entities};
+ my $dv = decode_entities($v);
+ if ($dv=~/^#/) {
$v=$baseurl.$v; # anchor
}
- elsif ($v=~/^(?!\w+:)[^\/]/) {
+ elsif ($dv=~/^(?!\w+:)[^\/]/) {
$v=$url.$v; # relative url
}
- elsif ($v=~/^\//) {
+ elsif ($dv=~/^\//) {
if (! defined $urltop) {
# what is the non path part of the url?
my $top_uri = URI->new($url);
my $link_regexp;
-my $email_regexp = qr/^.+@.+$/;
+my $email_regexp = qr/^.+@.+\..+$/;
my $url_regexp = qr/^(?:[^:]+:\/\/|mailto:).*/i;
sub import {
}
}
-sub is_externallink ($$;$$) {
+sub is_externallink ($$;$) {
my $page = shift;
my $url = shift;
my $anchor = shift;
- my $force = shift;
if (defined $anchor) {
$url.="#".$anchor;
}
- if (! $force && $url =~ /$email_regexp/) {
- # url looks like an email address, so we assume it
- # is supposed to be an external link if there is no
- # page with that name.
- return (! (bestlink($page, linkpage($url))))
- }
-
- return ($url =~ /$url_regexp/)
+ return ($url =~ /$url_regexp|$email_regexp/)
}
sub externallink ($$;$) {
my $content=$params{content};
while ($content =~ /(?<!\\)$link_regexp/g) {
- if (! is_externallink($page, $2, $3, 1)) {
+ if (! is_externallink($page, $2, $3)) {
add_link($page, linkpage($2));
}
}
},
}
+sub safe_hg (&@) {
+ # Start a child process safely without resorting to /bin/sh.
+ # Returns command output (in list content) or success state
+ # (in scalar context), or runs the specified data handler.
+
+ my ($error_handler, $data_handler, @cmdline) = @_;
+
+ my $pid = open my $OUT, "-|";
+
+ error("Cannot fork: $!") if !defined $pid;
+
+ if (!$pid) {
+ # In child.
+ # hg commands want to be in wc.
+ chdir $config{srcdir}
+ or error("cannot chdir to $config{srcdir}: $!");
+
+ exec @cmdline or error("Cannot exec '@cmdline': $!");
+ }
+ # In parent.
+
+ my @lines;
+ while (<$OUT>) {
+ chomp;
+
+ if (! defined $data_handler) {
+ push @lines, $_;
+ }
+ else {
+ last unless $data_handler->($_);
+ }
+ }
+
+ close $OUT;
+
+ $error_handler->("'@cmdline' failed: $!") if $? && $error_handler;
+
+ return wantarray ? @lines : ($? == 0);
+}
+# Convenient wrappers.
+sub run_or_die ($@) { safe_hg(\&error, undef, @_) }
+sub run_or_cry ($@) { safe_hg(sub { warn @_ }, undef, @_) }
+sub run_or_non ($@) { safe_hg(undef, undef, @_) }
+
sub mercurial_log ($) {
my $out = shift;
my @infos;
}
sub rcs_update () {
- my @cmdline = ("hg", "-q", "-R", "$config{srcdir}", "update");
- if (system(@cmdline) != 0) {
- warn "'@cmdline' failed: $!";
- }
+ run_or_cry('hg', '-q', 'update');
}
sub rcs_prepedit ($) {
sub rcs_commit (@) {
my %params=@_;
+ return rcs_commit_helper(@_);
+}
+
+sub rcs_commit_helper (@) {
+ my %params=@_;
+
+ my %env=%ENV;
+ $ENV{HGENCODING} = 'utf-8';
+
my $user="Anonymous";
if (defined $params{session}) {
if (defined $params{session}->param("name")) {
$user = $params{session}->param("name");
}
elsif (defined $params{session}->remote_addr()) {
- $user = "Anonymous from ".$params{session}->remote_addr();
+ $user = $params{session}->remote_addr();
+ }
+
+ my $nickname=$user;
+ if (defined $params{session}->param("nickname")) {
+ $nickname=encode_utf8($params{session}->param("nickname"));
+ $nickname=~s/\s+/_/g;
+ $nickname=~s/[^-_0-9[:alnum:]]+//g;
}
+ $ENV{HGUSER} = encode_utf8($user . ' <' . $nickname . '@web>');
}
if (! length $params{message}) {
$params{message} = "no message given";
}
- my @cmdline = ("hg", "-q", "-R", $config{srcdir}, "commit",
- "-m", IkiWiki::possibly_foolish_untaint($params{message}),
- "-u", IkiWiki::possibly_foolish_untaint($user));
- if (system(@cmdline) != 0) {
- warn "'@cmdline' failed: $!";
+ $params{message} = IkiWiki::possibly_foolish_untaint($params{message});
+
+ my @opts;
+
+ if (exists $params{file}) {
+ push @opts, '--', $params{file};
}
+ # hg commit returns non-zero if nothing really changed.
+ # So we should ignore its exit status (hence run_or_non).
+ run_or_non('hg', 'commit', '-m', $params{message}, '-q', @opts);
+ %ENV=%env;
return undef; # success
}
sub rcs_commit_staged (@) {
# Commits all staged changes. Changes can be staged using rcs_add,
# rcs_remove, and rcs_rename.
- my %params=@_;
-
- error("rcs_commit_staged not implemented for mercurial"); # TODO
+ return rcs_commit_helper(@_);
}
sub rcs_add ($) {
my ($file) = @_;
- my @cmdline = ("hg", "-q", "-R", "$config{srcdir}", "add", "$config{srcdir}/$file");
- if (system(@cmdline) != 0) {
- warn "'@cmdline' failed: $!";
- }
+ run_or_cry('hg', 'add', $file);
}
sub rcs_remove ($) {
+ # Remove file from archive.
my ($file) = @_;
- error("rcs_remove not implemented for mercurial"); # TODO
+ run_or_cry('hg', 'remove', '-f', $file);
}
sub rcs_rename ($$) {
my ($src, $dest) = @_;
- error("rcs_rename not implemented for mercurial"); # TODO
+ run_or_cry('hg', 'rename', '-f', $src, $dest);
}
sub rcs_recentchanges ($) {
my ($num) = @_;
+ my %env=%ENV;
+ $ENV{HGENCODING} = 'utf-8';
+
my @cmdline = ("hg", "-R", $config{srcdir}, "log", "-v", "-l", $num,
"--style", "default");
open (my $out, "@cmdline |");
foreach my $info (mercurial_log($out)) {
my @pages = ();
my @message = ();
-
+
foreach my $msgline (split(/\n/, $info->{description})) {
push @message, { line => $msgline };
}
};
}
+ #"user <email@domain.net>": parse out "user".
my $user = $info->{"user"};
$user =~ s/\s*<.*>\s*$//;
$user =~ s/^\s*//;
+ #"user <nickname@web>": if "@web" hits, set $web_commit=true.
+ my $web_commit = ($info->{'user'} =~ /\@web>/);
+
+ #"user <nickname@web>": if user is a URL (hits "://") and "@web"
+ #was present, parse out nick.
+ my $nickname;
+ if ($user =~ /:\/\// && $web_commit) {
+ $nickname = $info->{'user'};
+ $nickname =~ s/^[^<]*<([^\@]+)\@web>\s*$/$1/;
+ }
+
push @ret, {
rev => $info->{"changeset"},
user => $user,
- committype => "hg",
+ nickname => $nickname,
+ committype => $web_commit ? "web" : "hg",
when => str2time($info->{"date"}),
message => [@message],
pages => [@pages],
};
}
+ %ENV=%env;
+
return @ret;
}
sub rcs_diff ($;$) {
- # TODO
+ my $rev=shift;
+ my $maxlines=shift;
+ my @lines;
+ my $addlines=sub {
+ my $line=shift;
+ return if defined $maxlines && @lines == $maxlines;
+ push @lines, $line."\n"
+ if (@lines || $line=~/^diff --git/);
+ return 1;
+ };
+ safe_hg(undef, $addlines, "hg", "diff", "-c", $rev, "-g");
+ if (wantarray) {
+ return @lines;
+ }
+ else {
+ return join("", @lines);
+ }
}
-sub rcs_getctime ($) {
- my ($file) = @_;
+{
+my %time_cache;
+
+sub findtimes ($$) {
+ my $file=shift;
+ my $id=shift; # 0 = mtime ; 1 = ctime
+
+ if (! keys %time_cache) {
+ my $date;
+
+ # It doesn't seem possible to specify the format wanted for the
+ # changelog (same format as is generated in git.pm:findtimes(),
+ # though the date differs slightly) without using a style
+ # _file_. There is a "hg log" switch "--template" to directly
+ # control simple output formatting, but in this case, the
+ # {file} directive must be redefined, which can only be done
+ # with "--style".
+ #
+ # If {file} is not redefined, all files are output on a single
+ # line separated with a space. It is not possible to conclude
+ # if the space is part of a filename or just a separator, and
+ # thus impossible to use in this case.
+ #
+ # Some output filters are available in hg, but they are not fit
+ # for this cause (and would slow down the process
+ # unnecessarily).
+
+ eval q{use File::Temp};
+ error $@ if $@;
+ my ($tmpl_fh, $tmpl_filename) = File::Temp::tempfile(UNLINK => 1);
+
+ print $tmpl_fh 'changeset = "{date}\\n{files}\\n"' . "\n";
+ print $tmpl_fh 'file = "{file}\\n"' . "\n";
+
+ foreach my $line (run_or_die('hg', 'log', '--style', $tmpl_filename)) {
+ if (! defined $date && $line =~ /^(\d+)/) {
+ $date=$1;
+ }
+ elsif (! length $line) {
+ $date=undef;
+ }
+ else {
+ my $f=$line;
- my @cmdline = ("hg", "-R", $config{srcdir}, "log", "-v",
- "--style", "default", "$config{srcdir}/$file");
- open (my $out, "-|", @cmdline);
+ if (! $time_cache{$f}) {
+ $time_cache{$f}[0]=$date; # mtime
+ }
+ $time_cache{$f}[1]=$date; # ctime
+ }
+ }
+ }
- my @log = (mercurial_log($out));
+ return exists $time_cache{$file} ? $time_cache{$file}[$id] : 0;
+}
- if (@log < 1) {
- return 0;
- }
+}
- eval q{use Date::Parse};
- error($@) if $@;
-
- my $ctime = str2time($log[$#log]->{"date"});
- return $ctime;
+sub rcs_getctime ($) {
+ my $file = shift;
+
+ return findtimes($file, 1);
}
sub rcs_getmtime ($) {
- error "rcs_getmtime is not implemented for mercurial\n"; # TODO
+ my $file = shift;
+
+ return findtimes($file, 0);
}
1
$template->param(title_overridden => 1);
}
- foreach my $field (qw{author authorurl permalink}) {
+ foreach my $field (qw{author authorurl}) {
$template->param($field => $pagestate{$page}{meta}{$field})
if exists $pagestate{$page}{meta}{$field} && $template->query(name => $field);
}
foreach my $field (qw{permalink}) {
- $template->param($field => IkiWiki::urlabs($pagestate{$page}{meta}{$field}, $config{url}))
- if exists $pagestate{$page}{meta}{$field} && $template->query(name => $field);
+ if (exists $pagestate{$page}{meta}{$field} && $template->query(name => $field)) {
+ eval q{use HTML::Entities};
+ $template->param($field => HTML::Entities::encode_entities(IkiWiki::urlabs($pagestate{$page}{meta}{$field}, $config{url})));
+ }
}
foreach my $field (qw{description}) {
if ($template->query(name => "istranslatable")) {
$template->param(istranslatable => istranslatable($page));
}
+ my $lang_code = istranslation($page) ? lang($page) : $master_language_code;
+ if ($template->query(name => "lang_code")) {
+ $template->param(lang_code => $lang_code);
+ }
+ if ($template->query(name => "lang_name")) {
+ $template->param(lang_name => languagename($lang_code));
+ }
if ($template->query(name => "HOMEPAGEURL")) {
$template->param(homepageurl => homepageurl($page));
}
# Special case for unsaved attachments.
foreach my $page (@pages) {
- if (IkiWiki::Plugin::attachment->can("is_held_attachment")) {
+ if ($attachment && IkiWiki::Plugin::attachment->can("is_held_attachment")) {
my $f=IkiWiki::Plugin::attachment::is_held_attachment($page);
if (defined $f) {
- print STDERR "!! remove $f\n";
require IkiWiki::Render;
IkiWiki::prune($f);
}
my $held=$attachment &&
IkiWiki::Plugin::attachment->can("is_held_attachment") &&
IkiWiki::Plugin::attachment::is_held_attachment($page);
- if (! defined $held) {
+ if (! $held) {
check_canrename($page, $pagesources{$page}, undef, undef,
$q, $session);
}
my $held=$q->param("attachment") &&
IkiWiki::Plugin::attachment->can("is_held_attachment") &&
IkiWiki::Plugin::attachment::is_held_attachment($src);
- if (defined $held) {
+ if ($held) {
rename($held, IkiWiki::Plugin::attachment::attachment_holding_location($dest));
postrename($session, $src, $dest, $q->param("attachment"))
unless defined $srcfile;
hook(type => "cgi", id => "search", call => \&cgi);
hook(type => "disable", id => "search", call => \&disable);
hook(type => "needsbuild", id => "search", call => \&needsbuild);
+
+ eval q{ use Search::Xapian }; # load early to work around #622591
}
sub getsetup () {
# 240 is the number used by omindex to decide when to hash an
# overlong term. This does not use a compatible hash method though.
- if (length $page > 240) {
+ eval q{use Encode};
+ if (length encode_utf8($page) > 240) {
eval q{use Digest::SHA};
if ($@) {
debug("search: ".sprintf(gettext("need Digest::SHA to index %s"), $page)) if $@;
}
sub rcs_update () {
- if (-d "$config{srcdir}/.svn") {
- if (system("svn", "update", "--quiet", $config{srcdir}) != 0) {
- warn("svn update failed\n");
- }
+ if (system("svn", "update", "--quiet", $config{srcdir}) != 0) {
+ warn("svn update failed\n");
}
}
# The file is relative to the srcdir.
my $file=shift;
- if (-d "$config{srcdir}/.svn") {
- # For subversion, return the revision of the file when
- # editing begins.
- my $rev=svn_info("Revision", "$config{srcdir}/$file");
- return defined $rev ? $rev : "";
- }
+ # For subversion, return the revision of the file when
+ # editing begins.
+ my $rev=svn_info("Revision", "$config{srcdir}/$file");
+ return defined $rev ? $rev : "";
}
sub commitmessage (@) {
# The file is relative to the srcdir.
my %params=@_;
- if (-d "$config{srcdir}/.svn") {
- # Check to see if the page has been changed by someone
- # else since rcs_prepedit was called.
- my ($oldrev)=$params{token}=~/^([0-9]+)$/; # untaint
- my $rev=svn_info("Revision", "$config{srcdir}/$params{file}");
- if (defined $rev && defined $oldrev && $rev != $oldrev) {
- # Merge their changes into the file that we've
- # changed.
- if (system("svn", "merge", "--quiet", "-r$oldrev:$rev",
- "$config{srcdir}/$params{file}", "$config{srcdir}/$params{file}") != 0) {
- warn("svn merge -r$oldrev:$rev failed\n");
- }
+ # Check to see if the page has been changed by someone
+ # else since rcs_prepedit was called.
+ my ($oldrev)=$params{token}=~/^([0-9]+)$/; # untaint
+ my $rev=svn_info("Revision", "$config{srcdir}/$params{file}");
+ if (defined $rev && defined $oldrev && $rev != $oldrev) {
+ # Merge their changes into the file that we've
+ # changed.
+ if (system("svn", "merge", "--quiet", "-r$oldrev:$rev",
+ "$config{srcdir}/$params{file}", "$config{srcdir}/$params{file}") != 0) {
+ warn("svn merge -r$oldrev:$rev failed\n");
}
+ }
- if (system("svn", "commit", "--quiet",
- "--encoding", "UTF-8", "-m",
- IkiWiki::possibly_foolish_untaint(commitmessage(%params)),
- $config{srcdir}) != 0) {
- my $conflict=readfile("$config{srcdir}/$params{file}");
- if (system("svn", "revert", "--quiet", "$config{srcdir}/$params{file}") != 0) {
- warn("svn revert failed\n");
- }
- return $conflict;
+ if (system("svn", "commit", "--quiet",
+ "--encoding", "UTF-8", "-m",
+ IkiWiki::possibly_foolish_untaint(commitmessage(%params)),
+ $config{srcdir}) != 0) {
+ my $conflict=readfile("$config{srcdir}/$params{file}");
+ if (system("svn", "revert", "--quiet", "$config{srcdir}/$params{file}") != 0) {
+ warn("svn revert failed\n");
}
+ return $conflict;
}
+
return undef # success
}
# filename is relative to the root of the srcdir
my $file=shift;
- if (-d "$config{srcdir}/.svn") {
- my $parent=IkiWiki::dirname($file);
- while (! -d "$config{srcdir}/$parent/.svn") {
- $file=$parent;
- $parent=IkiWiki::dirname($file);
- }
-
- if (system("svn", "add", "--quiet", "$config{srcdir}/$file") != 0) {
- warn("svn add failed\n");
- }
+ if (system("svn", "add", "--parents", "--quiet", "$config{srcdir}/$file") != 0) {
+ warn("svn add failed\n");
}
}
# filename is relative to the root of the srcdir
my $file=shift;
- if (-d "$config{srcdir}/.svn") {
- if (system("svn", "rm", "--force", "--quiet", "$config{srcdir}/$file") != 0) {
- warn("svn rm failed\n");
- }
+ if (system("svn", "rm", "--force", "--quiet", "$config{srcdir}/$file") != 0) {
+ warn("svn rm failed\n");
}
}
# filenames relative to the root of the srcdir
my ($src, $dest)=@_;
- if (-d "$config{srcdir}/.svn") {
- # Add parent directory for $dest
- my $parent=IkiWiki::dirname($dest);
- if (! -d "$config{srcdir}/$parent/.svn") {
- while (! -d "$config{srcdir}/$parent/.svn") {
- $parent=IkiWiki::dirname($dest);
- }
- if (system("svn", "add", "--quiet", "$config{srcdir}/$parent") != 0) {
- warn("svn add $parent failed\n");
- }
- }
-
- if (system("svn", "mv", "--force", "--quiet",
- "$config{srcdir}/$src", "$config{srcdir}/$dest") != 0) {
- warn("svn rename failed\n");
- }
+ if (system("svn", "mv", "--parents", "--force", "--quiet",
+ "$config{srcdir}/$src", "$config{srcdir}/$dest") != 0) {
+ warn("svn rename failed\n");
}
}
my $num=shift;
my @ret;
- return unless -d "$config{srcdir}/.svn";
-
eval q{
use Date::Parse;
use XML::SAX;
if ($template->query(name => "categories")) {
# It's an rss/atom template. Add any categories.
if (defined $tags && %$tags) {
- $template->param(categories => [map { category => tagname($_) },
- sort keys %$tags]);
+ eval q{use HTML::Entities};
+ $template->param(categories =>
+ [map { category => HTML::Entities::encode_entities(tagname($_)) },
+ sort keys %$tags]);
}
}
}
--- /dev/null
+#!/usr/bin/perl
+# Copyright © 2008-2011 Joey Hess
+# Copyright © 2009-2011 Simon McVittie <http://smcv.pseudorandom.co.uk/>
+# Licensed under the GNU GPL, version 2, or any later version published by the
+# Free Software Foundation
+package IkiWiki::Plugin::trail;
+
+use warnings;
+use strict;
+use IkiWiki 3.00;
+
+sub import {
+ hook(type => "getsetup", id => "trail", call => \&getsetup);
+ hook(type => "needsbuild", id => "trail", call => \&needsbuild);
+ hook(type => "preprocess", id => "trail", call => \&preprocess_trail, scan => 1);
+ hook(type => "preprocess", id => "trailinline", call => \&preprocess_trailinline, scan => 1);
+ hook(type => "preprocess", id => "trailitem", call => \&preprocess_trailitem, scan => 1);
+ hook(type => "preprocess", id => "traillink", call => \&preprocess_traillink, scan => 1);
+ hook(type => "pagetemplate", id => "trail", call => \&pagetemplate);
+}
+
+=head1 Page state
+
+If a page C<$T> is a trail, then it can have
+
+=over
+
+=item * C<$pagestate{$T}{trail}{contents}>
+
+Reference to an array of pagespecs or links in the trail.
+
+=item * C<$pagestate{$T}{trail}{sort}>
+
+A [[ikiwiki/pagespec/sorting]] order; if absent or undef, the trail is in
+the order given by the links that form it
+
+=item * C<$pagestate{$T}{trail}{circular}>
+
+True if this trail is circular (i.e. going "next" from the last item is
+allowed, and takes you back to the first)
+
+=item * C<$pagestate{$T}{trail}{reverse}>
+
+True if C<sort> is to be reversed.
+
+=back
+
+If a page C<$M> is a member of a trail C<$T>, then it has
+
+=over
+
+=item * C<$pagestate{$M}{trail}{item}{$T}[0]>
+
+The page before this one in C<$T> at the last rebuild, or undef.
+
+=item * C<$pagestate{$M}{trail}{item}{$T}[1]>
+
+The page after this one in C<$T> at the last refresh, or undef.
+
+=back
+
+=cut
+
+sub getsetup () {
+ return
+ plugin => {
+ safe => 1,
+ rebuild => undef,
+ },
+}
+
+sub needsbuild (@) {
+ my $needsbuild=shift;
+ foreach my $page (keys %pagestate) {
+ if (exists $pagestate{$page}{trail}) {
+ if (exists $pagesources{$page} &&
+ grep { $_ eq $pagesources{$page} } @$needsbuild) {
+ # Remove state, it will be re-added
+ # if the preprocessor directive is still
+ # there during the rebuild. {item} is the
+ # only thing that's added for items, not
+ # trails, and it's harmless to delete that -
+ # the item is being rebuilt anyway.
+ delete $pagestate{$page}{trail};
+ }
+ }
+ }
+ return $needsbuild;
+}
+
+=for wiki
+
+The `trail` directive is supplied by the [[plugins/contrib/trail]]
+plugin. It sets options for the trail represented by this page. Example usage:
+
+ \[[!trail sort="meta(date)" circular="no" pages="blog/posts/*"]]
+
+The available options are:
+
+* `sort`: sets a [[ikiwiki/pagespec/sorting]] order; if not specified, the
+ items of the trail are ordered according to the first link to each item
+ found on the trail page
+
+* `circular`: if set to `yes` or `1`, the trail is made into a loop by
+ making the last page's "next" link point to the first page, and the first
+ page's "previous" link point to the last page
+
+* `pages`: add the given pages to the trail
+
+=cut
+
+sub preprocess_trail (@) {
+ my %params = @_;
+
+ if (exists $params{circular}) {
+ $pagestate{$params{page}}{trail}{circular} =
+ IkiWiki::yesno($params{circular});
+ }
+
+ if (exists $params{sort}) {
+ $pagestate{$params{page}}{trail}{sort} = $params{sort};
+ }
+
+ if (exists $params{reverse}) {
+ $pagestate{$params{page}}{trail}{reverse} = $params{reverse};
+ }
+
+ if (exists $params{pages}) {
+ push @{$pagestate{$params{page}}{trail}{contents}}, "pagespec $params{pages}";
+ }
+
+ if (exists $params{pagenames}) {
+ my @list = map { "link $_" } split ' ', $params{pagenames};
+ push @{$pagestate{$params{page}}{trail}{contents}}, @list;
+ }
+
+ return "";
+}
+
+=for wiki
+
+The `trailinline` directive is supplied by the [[plugins/contrib/trail]]
+plugin. It behaves like the [[trail]] and [[inline]] directives combined.
+Like [[inline]], it includes the selected pages into the page with the
+directive and/or an RSS or Atom feed; like [[trail]], it turns the
+included pages into a "trail" in which each page has a link to the
+previous and next pages.
+
+ \[[!inline sort="meta(date)" circular="no" pages="blog/posts/*"]]
+
+All the options for the [[inline]] and [[trail]] directives are valid.
+
+The `show`, `skip` and `feedshow` options from [[inline]] do not apply
+to the trail.
+
+* `sort`: sets a [[ikiwiki/pagespec/sorting]] order; if not specified, the
+ items of the trail are ordered according to the first link to each item
+ found on the trail page
+
+* `circular`: if set to `yes` or `1`, the trail is made into a loop by
+ making the last page's "next" link point to the first page, and the first
+ page's "previous" link point to the last page
+
+* `pages`: add the given pages to the trail
+
+=cut
+
+sub preprocess_trailinline (@) {
+ preprocess_trail(@_);
+ return unless defined wantarray;
+
+ if (IkiWiki->can("preprocess_inline")) {
+ return IkiWiki::preprocess_inline(@_);
+ }
+ else {
+ error("trailinline directive requires the inline plugin");
+ }
+}
+
+=for wiki
+
+The `trailitem` directive is supplied by the [[plugins/contrib/trail]] plugin.
+It is used like this:
+
+ \[[!trailitem some_other_page]]
+
+to add `some_other_page` to the trail represented by this page, without
+generating a visible hyperlink.
+
+=cut
+
+sub preprocess_trailitem (@) {
+ my $link = shift;
+ shift;
+
+ my %params = @_;
+ my $trail = $params{page};
+
+ $link = linkpage($link);
+
+ add_link($params{page}, $link, 'trail');
+ push @{$pagestate{$params{page}}{trail}{contents}}, "link $link";
+
+ return "";
+}
+
+=for wiki
+
+The `traillink` directive is supplied by the [[plugins/contrib/trail]] plugin.
+It generates a visible [[ikiwiki/WikiLink]], and also adds the linked page to
+the trail represented by the page containing the directive.
+
+In its simplest form, the first parameter is like the content of a WikiLink:
+
+ \[[!traillink some_other_page]]
+
+The displayed text can also be overridden, either with a `|` symbol or with
+a `text` parameter:
+
+ \[[!traillink Click_here_to_start_the_trail|some_other_page]]
+ \[[!traillink some_other_page text="Click here to start the trail"]]
+
+=cut
+
+sub preprocess_traillink (@) {
+ my $link = shift;
+ shift;
+
+ my %params = @_;
+ my $trail = $params{page};
+
+ $link =~ qr{
+ (?:
+ ([^\|]+) # 1: link text
+ \| # followed by |
+ )? # optional
+
+ (.+) # 2: page to link to
+ }x;
+
+ my $linktext = $1;
+ $link = linkpage($2);
+
+ add_link($params{page}, $link, 'trail');
+ push @{$pagestate{$params{page}}{trail}{contents}}, "link $link";
+
+ if (defined $linktext) {
+ $linktext = pagetitle($linktext);
+ }
+
+ if (exists $params{text}) {
+ $linktext = $params{text};
+ }
+
+ if (defined $linktext) {
+ return htmllink($trail, $params{destpage},
+ $link, linktext => $linktext);
+ }
+
+ return htmllink($trail, $params{destpage}, $link);
+}
+
+# trail => [member1, member2]
+my %trail_to_members;
+# member => { trail => [prev, next] }
+# e.g. if %trail_to_members = (
+# trail1 => ["member1", "member2"],
+# trail2 => ["member0", "member1"],
+# )
+#
+# then $member_to_trails{member1} = {
+# trail1 => [undef, "member2"],
+# trail2 => ["member0", undef],
+# }
+my %member_to_trails;
+
+# member => 1
+my %rebuild_trail_members;
+
+sub trails_differ {
+ my ($old, $new) = @_;
+
+ foreach my $trail (keys %$old) {
+ if (! exists $new->{$trail}) {
+ return 1;
+ }
+ my ($old_p, $old_n) = @{$old->{$trail}};
+ my ($new_p, $new_n) = @{$new->{$trail}};
+ $old_p = "" unless defined $old_p;
+ $old_n = "" unless defined $old_n;
+ $new_p = "" unless defined $new_p;
+ $new_n = "" unless defined $new_n;
+ if ($old_p ne $new_p) {
+ return 1;
+ }
+ if ($old_n ne $new_n) {
+ return 1;
+ }
+ }
+
+ foreach my $trail (keys %$new) {
+ if (! exists $old->{$trail}) {
+ return 1;
+ }
+ }
+
+ return 0;
+}
+
+my $done_prerender = 0;
+
+my %origsubs;
+
+sub prerender {
+ return if $done_prerender;
+
+ $origsubs{render_backlinks} = \&IkiWiki::render_backlinks;
+ inject(name => "IkiWiki::render_backlinks", call => \&render_backlinks);
+
+ %trail_to_members = ();
+ %member_to_trails = ();
+
+ foreach my $trail (keys %pagestate) {
+ next unless exists $pagestate{$trail}{trail}{contents};
+
+ my $members = [];
+ my @contents = @{$pagestate{$trail}{trail}{contents}};
+
+
+ foreach my $c (@contents) {
+ if ($c =~ m/^pagespec (.*)$/) {
+ push @$members, pagespec_match_list($trail, $1);
+ }
+ elsif ($c =~ m/^link (.*)$/) {
+ my $best = bestlink($trail, $1);
+ push @$members, $best if length $best;
+ }
+ }
+
+ if (defined $pagestate{$trail}{trail}{sort}) {
+ # re-sort
+ @$members = pagespec_match_list($trail, 'internal(*)',
+ list => $members,
+ sort => $pagestate{$trail}{trail}{sort});
+ }
+
+ if (IkiWiki::yesno $pagestate{$trail}{trail}{reverse}) {
+ @$members = reverse @$members;
+ }
+
+ # uniquify
+ my %seen;
+ my @tmp;
+ foreach my $member (@$members) {
+ push @tmp, $member unless $seen{$member};
+ $seen{$member} = 1;
+ }
+ $members = [@tmp];
+
+ for (my $i = 0; $i <= $#$members; $i++) {
+ my $member = $members->[$i];
+ my $prev;
+ $prev = $members->[$i - 1] if $i > 0;
+ my $next = $members->[$i + 1];
+
+ add_depends($member, $trail);
+
+ $member_to_trails{$member}{$trail} = [$prev, $next];
+ }
+
+ if ((scalar @$members) > 1 && $pagestate{$trail}{trail}{circular}) {
+ $member_to_trails{$members->[0]}{$trail}[0] = $members->[$#$members];
+ $member_to_trails{$members->[$#$members]}{$trail}[1] = $members->[0];
+ }
+
+ $trail_to_members{$trail} = $members;
+ }
+
+ foreach my $member (keys %pagestate) {
+ if (exists $pagestate{$member}{trail}{item} &&
+ ! exists $member_to_trails{$member}) {
+ $rebuild_trail_members{$member} = 1;
+ delete $pagestate{$member}{trailitem};
+ }
+ }
+
+ foreach my $member (keys %member_to_trails) {
+ if (! exists $pagestate{$member}{trail}{item}) {
+ $rebuild_trail_members{$member} = 1;
+ }
+ else {
+ if (trails_differ($pagestate{$member}{trail}{item},
+ $member_to_trails{$member})) {
+ $rebuild_trail_members{$member} = 1;
+ }
+ }
+
+ $pagestate{$member}{trail}{item} = $member_to_trails{$member};
+ }
+
+ $done_prerender = 1;
+}
+
+# This is called at about the right time that we can hijack it to render
+# extra pages.
+sub render_backlinks ($) {
+ my $blc = shift;
+
+ foreach my $member (keys %rebuild_trail_members) {
+ next unless exists $pagesources{$member};
+
+ IkiWiki::render($pagesources{$member}, sprintf(gettext("building %s, its previous or next page has changed"), $member));
+ }
+
+ $origsubs{render_backlinks}($blc);
+}
+
+sub title_of ($) {
+ my $page = shift;
+ if (defined ($pagestate{$page}{meta}{title})) {
+ return $pagestate{$page}{meta}{title};
+ }
+ return pagetitle(IkiWiki::basename($page));
+}
+
+my $recursive = 0;
+
+sub pagetemplate (@) {
+ my %params = @_;
+ my $page = $params{page};
+ my $template = $params{template};
+
+ if ($template->query(name => 'trails') && ! $recursive) {
+ prerender();
+
+ $recursive = 1;
+ my $inner = template("trails.tmpl", blind_cache => 1);
+ IkiWiki::run_hooks(pagetemplate => sub {
+ shift->(%params, template => $inner)
+ });
+ $template->param(trails => $inner->output);
+ $recursive = 0;
+ }
+
+ if ($template->query(name => 'trailloop')) {
+ prerender();
+
+ my @trails;
+
+ # sort backlinks by page name to have a consistent order
+ foreach my $trail (sort keys %{$member_to_trails{$page}}) {
+
+ my $members = $trail_to_members{$trail};
+ my ($prev, $next) = @{$member_to_trails{$page}{$trail}};
+ my ($prevurl, $nexturl, $prevtitle, $nexttitle);
+
+ if (defined $prev) {
+ add_depends($params{destpage}, $prev);
+ $prevurl = urlto($prev, $page);
+ $prevtitle = title_of($prev);
+ }
+
+ if (defined $next) {
+ add_depends($params{destpage}, $next);
+ $nexturl = urlto($next, $page);
+ $nexttitle = title_of($next);
+ }
+
+ push @trails, {
+ prevpage => $prev,
+ prevtitle => $prevtitle,
+ prevurl => $prevurl,
+ nextpage => $next,
+ nexttitle => $nexttitle,
+ nexturl => $nexturl,
+ trailpage => $trail,
+ trailtitle => title_of($trail),
+ trailurl => urlto($trail, $page),
+ };
+ }
+
+ $template->param(trailloop => \@trails);
+ }
+}
+
+1;
$pagemtime{$page}=$stat[9];
if (isinternal($page)) {
+ my $content = readfile($srcfile);
+
# Preprocess internal page in scan-only mode.
- preprocess($page, $page, readfile($srcfile), 1);
+ preprocess($page, $page, $content, 1);
+
+ run_hooks(scan => sub {
+ shift->(
+ page => $page,
+ content => $content,
+ );
+ });
+
push @internal_changed, $file;
}
else {
sub import (@) {
my $this=shift;
- $config{setuptype}='Standard';
+ $config{setuptype}='Yaml';
IkiWiki::Setup::merge({@_});
if (! $config{force_overwrite}) {
# IKIWIKI_CGILOCK_FD so unlockwiki can close it.
$pre_exec=<<"EOF";
lockfd=open("$config{wikistatedir}/cgilock", O_CREAT | O_RDWR, 0666);
- if (lockfd != -1 && flock(lockfd, LOCK_EX) == 0) {
+ if (lockfd != -1 && lockf(lockfd, F_LOCK, 0) == 0) {
char *fd_s=malloc(8);
sprintf(fd_s, "%i", lockfd);
setenv("IKIWIKI_CGILOCK_FD", fd_s, 1);
install -d $(DESTDIR)$(PREFIX)/share/ikiwiki
for dir in `cd underlays && $(FIND) . -follow -type d`; do \
install -d $(DESTDIR)$(PREFIX)/share/ikiwiki/$$dir; \
- for file in `$(FIND) underlays/$$dir -follow -maxdepth 1 -type f`; do \
+ for file in `$(FIND) underlays/$$dir -follow -maxdepth 1 -type f -not -name \\*.full.js -not -name \\*.full.css`; do \
cp -aL $$file $(DESTDIR)$(PREFIX)/share/ikiwiki/$$dir 2>/dev/null || \
install -m 644 $$file $(DESTDIR)$(PREFIX)/share/ikiwiki/$$dir; \
done; \
-install -m 0644 wikilist $(DESTDIR)/etc/ikiwiki
-install -m 0644 auto.setup $(DESTDIR)/etc/ikiwiki
-install -m 0644 auto-blog.setup $(DESTDIR)/etc/ikiwiki
+
+# The git/hg plugins want to chdir; so does Devel::Cover. Skip those tests
+# to stop them hurting each other.
+coverage:
+ cover -delete
+ $(MAKE) test PERL5OPT=-MDevel::Cover PERL5LIB=. TEST_FILES="$(filter-out t/git.t t/mercurial.t,$(wildcard t/*.t))"
+ cover
}
}
-ikiwiki (3.20110609) UNRELEASED; urgency=low
+ikiwiki (3.20111106) unstable; urgency=low
+
+ * searchquery.tmpl: Track escaping change in upstream template.
+ Thanks Olly Betts for review.
+ * svn: Support subversion 1.7, which does not have .svn in each
+ subdirectory.
+ * rst: import docutils lazily, to avoid errors during ikiwiki --setup.
+ Closes: #637604 (Thanks, smcv)
+ * Make the setup automator create YAML formatted files.
+ * Fix handling of discussion page creation links to make discussion pages
+ in the right place and with the right case. Broken by page case
+ preservation feature added in 3.20110707.
+
+ -- Joey Hess <joeyh@debian.org> Sun, 06 Nov 2011 16:27:29 -0400
+
+ikiwiki (3.20110905) unstable; urgency=low
+
+ * mercurial: Openid nicknames are now used when committing. (Daniel Andersson)
+ * mercurial: Implement rcs_commit_staged so comments, attachments, etc
+ can be used. (Daniel Andersson)
+ * mercurial: Implement rcs_rename, rcs_remove. (Daniel Andersson)
+ * mercurial: Fix viewing of a diff containing non-utf8 changes.
+ (Daniel Andersson)
+ * mercurial: Make both rcs_getctime and rcs_getmtime fast. (Daniel Andersson)
+ * mercurial: Implement rcs_diff. (Daniel Andersson)
+ * po: Add `LANG_CODE` and `LANG_NAME` template variables. (intrigeri)
+ * Fix typo in Danish translation of shortcuts page that caused exponential
+ regexp blowup.
+ * Fix escaping of html entities in permalinks.
+ * Fix escaping of html entities in tag names.
+ * Avoid using named capture groups in heredoc code for oldperl compatibility.
+ * Put in a workaround for #622591, by ensuring Search::Xapian gets loaded
+ before Image::Magick.
+ * Add unminified jquery js and css files to source.
+ * Update to jquery 1.6.2, and jquery-ui 1.8.14.
+ * Use lockf rather than flock when taking the cgilock, for better
+ portability.
+ * search: Fix encoding bug in calculation of maximum term size.
+ * inline: When indexing internal pages for searching, use the url of
+ the inlining page.
+ * Fix comments testsuite to not rely on Date::Parse's ability to
+ parse the date Columbus discovered America. Closes: #640350
+ * Avoid warning message when generating setup file if highlight
+ is not installed. Closes: #637606
+ * Promote RPC::XML to a Recommends, since it's used by auto-blog.setup.
+ Closes: #637603
+ * Fix web revert of a file deletion.
+
+ -- Joey Hess <joeyh@debian.org> Mon, 05 Sep 2011 14:53:00 -0400
+
+ikiwiki (3.20110715) unstable; urgency=low
+
+ * rename: Fix logic error that broke renaming pages when the attachment
+ plugin was disabled.
+ * rename: Fix logic error that bypassed the usual pagespec checks.
+
+ -- Joey Hess <joeyh@debian.org> Fri, 15 Jul 2011 18:36:29 -0400
+
+ikiwiki (3.20110712) unstable; urgency=low
+
+ * attachment: Bugfix to create directory when moving attachment out of
+ holding area.
+ * Display attachment manipulation links always, since attachments can be
+ uploaded via javascript.
+
+ -- Joey Hess <joeyh@debian.org> Tue, 12 Jul 2011 00:41:26 -0400
+
+ikiwiki (3.20110711) unstable; urgency=low
+
+ * Add build dep on python-support. Closes: #633536
+ * attachment: Bugfix to move upload attachments out of holding area
+ when saving.
+ * attachment: Bugfix for trying to attach files to a subpage of the index
+ page.
+
+ -- Joey Hess <joeyh@debian.org> Mon, 11 Jul 2011 13:03:04 -0400
+
+ikiwiki (3.20110707) unstable; urgency=low
* userlist: New plugin, lets admins see a list of users and their info.
* aggregate: Improve checking for too long aggregated filenames.
* attachment: Speed up multiple file uploads by storing uploaded files
in a staging area until the page is saved/previewed, rather than
refreshing the site after each upload.
+ (Sponsored by The TOVA Company.)
* attachment: Files can be dragged into the edit page to upload them.
- Multiple file upload support. Upload progress bars.
- Impemented using the jQuery-File-Upload widget.
-
- -- Joey Hess <joeyh@debian.org> Thu, 09 Jun 2011 10:06:44 -0400
+ Multiple file batch upload support. Upload progress bars.
+ AJAX special effects. Impemented using the jQuery-File-Upload widget.
+ (If you don't have javascript don't worry, I kept that working too.)
+ (Sponsored by The TOVA Company.)
+ * Add libtext-multimarkdown-perl to Suggests. Closes: #630705
+ * headinganchors: Plugin by Paul Wise that adds ids to <hn> headings.
+ * html5 is not experimental anymore. But not the default either, quite yet.
+ * Support svg as a inlinable image type; svg images can be included on a
+ page by simply linking to them, or by using the img directive.
+ Note that sanitizing svg files is still not addressed.
+ * img: Generate png format thumbnails for svg images.
+ * Preserve mixed case in page creation links, and when creating a page
+ whose title is mixed case, allow selecting between the mixed case and
+ all lower-case names.
+ * Fix ikiwiki-update-wikilist -r to actually work.
+ * comments: collect metadata in a scan-phase preprocess hook, which
+ fixes sorting comments by date. (smcv)
+ * Run scan hooks for internal pages (preprocess hooks already run in scan
+ mode) (smcv)
+ * inline: Handle obfuscated urls, such as the mailto urls generated by
+ markdown when forcing urls absolute.
+ * Bugfix for wikilink containing an email address not showing up in
+ brokenlinks list.
+ * Bugfix for trying to attach files to a subpage of the index page.
+
+ -- Joey Hess <joeyh@debian.org> Thu, 07 Jul 2011 20:38:31 -0400
ikiwiki (3.20110608) unstable; urgency=high
libtimedate-perl, libhtml-template-perl,
libhtml-scrubber-perl, wdg-html-validator,
libhtml-parser-perl, liburi-perl (>= 1.36), perlmagick, po4a (>= 0.34),
- libfile-chdir-perl, libyaml-perl
+ libfile-chdir-perl, libyaml-perl, python-support
Maintainer: Joey Hess <joeyh@debian.org>
Uploaders: Josh Triplett <josh@freedesktop.org>
-Standards-Version: 3.9.1
+Standards-Version: 3.9.2
Homepage: http://ikiwiki.info/
Vcs-Git: git://git.ikiwiki.info/
Vcs-Browser: http://git.ikiwiki.info/?p=ikiwiki
Depends: ${misc:Depends}, ${perl:Depends}, ${python:Depends},
libtext-markdown-perl | markdown,
libhtml-scrubber-perl, libhtml-template-perl,
- libhtml-parser-perl, liburi-perl (>= 1.36), libyaml-perl
+ libhtml-parser-perl, liburi-perl (>= 1.36), libyaml-perl, libjson-perl
Recommends: gcc | c-compiler,
libc6-dev | libc-dev,
subversion | git-core (>= 1:1.5.0) | git (>= 1:1.7) | tla | bzr (>= 0.91) | mercurial | monotone (>= 0.38) | darcs,
liblwpx-paranoidagent-perl, libtimedate-perl,
libcgi-formbuilder-perl (>= 3.05), libcgi-session-perl (>= 4.14-1),
libmail-sendmail-perl, libauthen-passphrase-perl, libterm-readline-gnu-perl,
- libgravatar-url-perl
+ libgravatar-url-perl, librpc-xml-perl,
Suggests: viewvc | gitweb | viewcvs, libsearch-xapian-perl,
- xapian-omega (>= 1.0.5), librpc-xml-perl, libtext-wikiformat-perl,
+ xapian-omega (>= 1.0.5), libtext-wikiformat-perl,
python, python-docutils, polygen, tidy, libhtml-tree-perl,
libxml-feed-perl, libmailtools-perl, perlmagick,
libfile-mimeinfo-perl, file,
libtext-csv-perl, graphviz, libnet-amazon-s3-perl,
libsparkline-php, texlive, dvipng, libtext-wikicreole-perl,
libsort-naturally-perl, libtext-textile-perl, libhighlight-perl,
- po4a (>= 0.35-1), gettext, libnet-inet6glue-perl
+ po4a (>= 0.35-1), gettext, libnet-inet6glue-perl,
+ libtext-multimarkdown-perl
Conflicts: ikiwiki-plugin-table
Replaces: ikiwiki-plugin-table
Provides: ikiwiki-plugin-table
resolution, and page locking.
.
Ikiwiki also supports generating news feeds (RSS and Atom) and blogging.
- ikiwiki provides a plugin system which allows many other features to be
+ Ikiwiki provides a plugin system which allows many other features to be
added. Some of the plugins have additional dependencies, found among the
Recommends and Suggests of this package.
© 2011 the jQuery UI Authors (http://jqueryui.com/about)
License: GPL-2
-Files: underlays/attachments/ikiwiki/jquery.tmpl.min.js
+Files: underlays/attachments/ikiwiki/jquery.tmpl*
Copyright: © Boris Moore
License: GPL-2
--- /dev/null
+Wikis are great tools for collaborative content of all types, but the choice for website creators who want a level of collaboration seem to have to choose between a static website, a wiki that anyone (or all members) can edit, or an overkill customized web app.
+
+A simple innovation that needs to propagate through wiki software is adding the ability to suggest edits and accept those edits. Perhaps you want a wiki that anyone can suggest and edit, but only registered users can edit freely or accept edits. Or you want anyone, including members, to only be able to suggest edits, and only have moderators able to approve edits and edit freely. Etc, etc.
+
+> Ikiwiki always has some work in this area; there is
+> the moderatedcomments plugin and the `checkcontent` hook.
+> The hook allows, for example a plugin to reject changes
+> with spam links or swear words. A plugin could also use
+> it to save the diff for later moderation.
+>
+> I think the difficulty
+> is in the moderation interface, which would need to apply the diff
+> and show the resulting page with the changes somehow evident (for users
+> who can't just read diffs), and would have to deal with conflicting
+> edits, etc. --[[Joey]]
in the scan phase; my branch fixes that, streamlines that hook a bit
when run in the scan phase (so it doesn't htmlize, and only runs nested
directives in scan mode), and adds a regression test. --[[smcv]]
+
+[[!tag patch]]
+
+> Thanks.. I am not 100% sure if I just forgot to scan internal pages
+> or left it out as some kind of optimisation since none needed to be
+> scanned. Anyway, if it was an optimisation it was not much of one
+> since they were preprocessed. All applied, [[done]]. --[[Joey]]
--- /dev/null
+While working on our forum I was surprised to see that some of the comments were not appearing in the RSS feed created by `!inline pages="forum/* or comment(forum/*)" feedonly="yes" show="25"`.
+
+> I'm seeing some comments in the rss feed. The feed is limited to the 25
+> most recent items, you can increase that with feedshow. --[[Joey]]
+
+>> Of course, but in the feed, some of the new comments don't show up.
+>> Most does but not all. For example, none of the comments of this thread
+>> appears in the RSS, even though they should according to the « 25 most
+>> recent items » criteria:
+>> <https://tails.boum.org/forum/Security_Updates:_apt-get_Sufficient__63__/> --sajolida
+
+>>> Of course this is a moving target, so I checked out
+>>> 4a787aecb142f346190ddaef59938799818c964b, which is from the same day
+>>> the above was written.. The comments in question appeared in
+>>> the rss feed when I ran `ikiwiki -setup ikiwiki.setup -gettime`
+>>> (after configuring the setup file to use git and rss and setting
+>>> `gitorigin_branch: ''`)
+>>>
+>>> So I suppose I'd need a testcase in a tarball to reproduce
+>>> any problem. --[[Joey]]
+
+>>>> Once I set `rcs: git` and `gitorigin_branch: ''`, I also get a
+>>>> perfect RSS feed that contains the items git log makes me expect,
+>>>> in the correct order. So this is not a ikiwiki bug after all,
+>>>> sorry for the annoyance. (For the record, I think we have two
+>>>> problems: first, our ikiwiki.setup does not enable a RCS, mainly
+>>>> to avoid local refresh to create ugly "updated PO files" Git
+>>>> commits; this explains the issue sajolida noticed while locally
+>>>> building the wiki. Second, the RSS feed on our online ikiwiki is
+>>>> correct right now, was probably cured by a rebuild at some point.
+>>>> --[[intrigeri]]
+
+Then I found out that a map directive such as `!map pages="forum/* or
+comment(forum/*)"` was bringing a weird result too. The output is a map
+with quite a few broken links.
+
+> This is the same as if you tried to link to a comment page or other
+> internal page with a [[ikiwiki/WikiLink]] -- you'd get a broken link
+> or a create link because these are not true wiki pages. --[[Joey]]
+
+>> So I don't understand why 90 % of the comments are linked well and 10 %
+>> are broken links. Why does this map behave differently for only a few comments? --sajolida
+
+>>> I checked the first 50% or so of the comments, and every one was a
+>>> broken link. --[[Joey]]
+
+>>>> I now observe the same behaviour as Joey, which seems totally
+>>>> logical to me after all given that `forum/*/comment_*.html` are
+>>>> not generated. I wonder how we could have observed map generating
+>>>> working links to comments in the first place; sajolida, can you
+>>>> please try reproducing it? If you cannot reproduce it, I think we
+>>>> can close this bug. --[[intrigeri]]
+
+>>>>> Closing as apparently operator error (and while it's a bit confiusing
+>>>>> that map generates broken links for internal pages, it is *sorta* was
+>>>>> was requested by the pagespec, so I don't see a real reason to change
+>>>>> it). Please reopen if new data emerges. [[done]] --[[Joey]]
+
+Plus, some broken links in the map do match the comments missing on the RSS feed but some others do not.
+
+Unfortunately, I couldn't find an obvious pattern for this failure.
+
+We think it's a bug in ikiwiki. Our git repo is publicly available at
+`git://git.immerda.ch/amnesia.git` (the ikiwiki source is in `/wiki/src`)
+and the corresponding online version is available at
+<https://tails.boum.org/forum/>. The buggy `!inline` is already included in
+the original `forum.mdwn`. The buggy `!map` is not but the bug can be
+reproduced by just including it in the source of the forum.
> image (png). The img plugin could probably do that fairly simply.
> --[[Joey]]
+>> This seems to have improved since; at least chromium can display svg
+>> images from `<img>` tags. Firefox 3.5.19 did not in my testing.
+>>
+>> So, svgs can now be included on pages by linking to them, or by using
+>> the img directive. The most portable thing is to use the img directive
+>> plus some size, which forces them to be resized and a png to actually
+>> be displayed.
+>>
+>> I have not yet tried to do anything with sanitizing them. --[[Joey]]
+
>> I'm working on inline SVG and MathML support in ikiwiki and I've
>> modified my htmlscrubber to sanitize SVG and MathML using the
>> whitelists from html5lib. Here's a [patch][]. I've also made some
--- /dev/null
+I have a part of a template that looks like:
+
+ <TMPL_VAR level> <TMPL_VAR string>
+
+Calling the template with:
+
+\[[!template id=templateid string="some string" level="##"]]
+
+Results in:
+
+ <h1 id="z-">#</h1>
+
+ <p>some string</p>
+
+While I expected:
+
+ <h2 id="some_string">some string</h2>
+
+>> Have you tried TMPL_VAR raw_level, raw_string? — [[Jon]]
+
+> Thanks. I should read the docs more closely the next time.
+
+[[not a bug|done]]
> Then, which one is the default wouldn't much matter. (The non-lower cased
> one would probably be the best choice.) --[[Joey]]
>> Either of your proposed solutions (make it the default or include both in the pop-up menu) sounds fine to me. Which one is easier? :) --[[sabr]]
+
+>>> [[Done]]; it now defaults to the mixed case title and provides
+>>> the lower-case one as an option in the select box. --[[Joey]]
Optimally, UTF-16 (which is ubiquitous in the Windows world) and UTF-32 should be fully supported, probably by converting to mostly-UTF-8 and using `&#xXXXX;` or `&#DDDDD;` XML escapes where necessary.
Suboptimally, UTF-16 and UTF-32 should be converted to UTF-8 where cleanly possible and a warning printed where impossible.
+
+----
+Reading the wikipedia pages about [[!wikipedia UTF-8]] and [[!wikipedia UTF-16]], all valid Unicode characters are representable in UTF-8, UTF-16 and UTF-32, and the only errors possible with UTF-16/32 -> UTF-8 translation are when there are encoding errors in the original document.
+
+Of course, it's entirely possible that not all browsers support utf-8 correctly, and we might need to support the option of encoding into [[!wikipedia CESU-8]] instead, which has the side-effect of allowing the transcription of UTF-16 or UTF-32 encoding errors into the output byte-stream, rather than pedantically removing those bytes.
+
+An interesting question would be how to determine the character set of an arbitrary new file added to the repository, unless the repository itself handles character-encoding, in which case, we can just ask the repository to hand us a UTF-8 encoded version of the file.
+
+-- [[Martin Rudat|http://www.toraboka.com/~mrudat]]
--- /dev/null
+I can add attachment to some pages within an ikiwiki site. ( for example the index page ), but I'm unable to add attachments to other child pages.
+
+When I try I get the error message "Error: bad attachment filename". I can successfully attach the same file to the index page.
+
+I'm running
+
+ikiwiki version 3.20100815.7 on Debian Squeeze.
+
+Please advise.
+
+
+> I get the following error in apache error.log
+> Died at /usr/share/perl5/IkiWiki/CGI.pm line 466.
+> -- [[aland]]
+
+> Well, what subpages are you trying to add it to? What is your
+> `allowed_attachments` PageSpec set to in your setup file? --[[Joey]]
+
+>> I can reproduce this by creating a new ikiwiki using the auto.setup
+
+>> I create a subpage of index called "projects" and a subpage of projects called "Firewall Replacement 2010-2011"
+>> and when I add attachment to the subpages I get the error.
+
+>> I dont have an `allowed_attachments` section in my setup file
+>> But I've set an `allowed_attachments` like `allowed_attachments => 'maxsize(40000kb) and mimetype(*)',` and I still get the error.
+>> Thanks --[[aland]]
+
+>>> Being the subpage of index is the problem. It's not usual to have
+>>> any other page as a subpage of index; as there's really no reason to do
+>>> that, so some code broke in that special case. [[fixed|done]]
+>>> --[[Joey]]
--- /dev/null
+I am trying to do an !inline and sort the pages after meta(date)
+
+ \[[!inline pages="blog/* and !*/Discussion" sort="meta(date)" show="0" rootpage="blog" archive="yes"]]
+
+There are a few pages inside blog/* and I would like to give the !meta line as example for two of them:
+
+page 1: blog/get_http.mdwn
+
+ \[[!meta title="HTTP GET method" date="2010-09-17 00:00:00"]]
+
+page 2: blog/nagios.mdwn
+
+ \[[!meta title="Nagios 3" date="2010-09-09 00:00:00"]]
+
+page 3: blog/using_macos.mdwn
+
+ \[[!meta title="How I am using Mac OS X" date="2010-06-10 00:00:00"]]
+
+The ordering which is created can be seen at <http://www.michael-hammer.at/blog_all> and is
+
+page 1 -> page 3 -> page 2
+
+which is obviously not correct. I can say that the ordering is regardless of the sort="" argument inside !inline done by the ctime. This is really annoying as ctime is hard to recover if one has to move the blog from one machine to another.
+
+- What am I doing wrong?
+- Is this a bug? If not: Why is meta(date) ignored?
+
+% ikiwiki --version
+
+ikiwiki version 3.20100815.7
+
+> You're not using the [[meta directive|ikiwiki/directive/meta]] correctly.
+> As it says at the top of that page,
+
+>> You can have only one field
+>> per `meta` directive, use more directives if you want to specify more fields.
+
+> So, \[[!meta title="Nagios 3"]] \[[!meta date="2010-09-09 00:00:00"]]
+> and you should be good to go. --[[Joey]] [[done]]
+
+>> Thank you for your help. Sometimes the solution is to easy. Sorry for PEBKAC bug report. --mueli
--- /dev/null
+When the [[plugins/aggregate]] plugin was used for a feed and this is removed (or the
+same feed name given a different rss feed), the old entries don't
+automatically vanish.
+
+I think that if it was just removed, they are never GC'd, because the
+expiry code works on the basis of existing feeds. And if it was replaced,
+old items won't go away until expirecount or expireage is met.
+
+To fix it probably needs an explicit check for items aggregated by feeds
+that no longer provide them, Catching old items for feeds that were changed
+to a different url may be harder yet. --[[Joey]]
--- /dev/null
+Hi, I created \[[sandbox/subpage]] then I deleted it with the "remove" button.
+After confirmation there was a message about a xapian error (My bad, I did not write down the exact error message).
+Now, accessing [[sandbox/subpage|sandbox/subpage]] leads my browser complains about a redirect loop. [[JeanPrivat]]
+>Uh. Now the bug of redirect loop seems to have solved itself. However, I don't know if the xapian error need to be investigated. But I found another [[bug|cannot revert page deletion]]. [[JeanPrivat]]
--- /dev/null
+After deleting a page with the "remove" button, it seems that the page deletion cannot be reverted using the "revert" icon in [[RecentChanges]].
+It ironically says that "Error: ?$pagename does not exist". See [[http://ikiwiki.info/ikiwiki.cgi?rev=860c2c84d98ea0a38a4f91dacef6d4e09f6e6c2e&do=revert]]. [[JeanPrivat]]
+
+> And it only gets that far if the remove plugin is enabled. Otherwise it
+> complains that you cannot change $pagename.
+>
+> The root bug is that git's `rcs_preprevert` creates a structure that
+> shows the change that was made (which includes a file deletion),
+> not the change that would be made if it was reverted (which includes a
+> file addition). [[Fixed|done]]. --[[Joey]]
--- /dev/null
+[[!template id=gitbranch branch=GiuseppeBilotta/scanif author="Giuseppe Bilotta"]]
+
+When a directive that should be run during scan preprocessing is inside
+an if directive, it doesn't get called because the if preprocessing does
+not run during scan.
+
+I've written a simple [[patch]] to fix the issue, currently hosted on the
+scanif branch of my repository. The patch also passes the preview option
+back to the Ikiwiki::preprocess call, making sure that whatever is being
+reprocessed is done so in the same conditions as the original call.
+
+> One problem with this is that it has the same dependency-ordering problems
+> as inline-based or pagespec-based trails with my [[plugins/contrib/trail]]
+> plugin: `if` takes a pagespec, but pagespecs aren't guaranteed to match
+> correctly until everything has been scanned (for instance, `link()` might
+> give the wrong results because a page that added or deleted a link hasn't
+> been scanned yet). If you have a clever idea for how to fix this, I'd love
+> to hear it - being able to specify a [[plugins/contrib/trail]] in terms
+> of a sorted pagespec would be useful. --[[smcv]]
+
+>> I have a solution to the dependency-ordering problem in a different
+>> branch of my repository, with a post_scan hook mechanism which I use to
+>> be able to sort outer inline pages according to the last modification
+>> date of their nested inline pages. The way I implemented it currently,
+>> though, doesn't use the existing hooks mechanism of ikiwiki (because
+>> it's something which I believe to be more efficiently done the way I
+>> implemented it) so I don't know how likely it is to be included
+>> upstream.
+
+>> For what it's worth, I think that my post_scan hook mechanism would work
+>> rather fine with your trail plugin. However, the case of the if
+>> directive is considerably more complicated, because the conditional
+>> can introduce a much stronger feedback effect in the pre/post scanning
+>> dependency. In fact, it's probably possible to build a couple of pages
+>> with vicious conditional dependency circles that would break/unbreak
+>> depending on which pass we are in. And I believe this is an intrinsic
+>> limitation of the system, which cannot be solved at all.
--- /dev/null
+As it says on the tin. I think $page might need to be lowercased in editpage.pm. Workaround until then is to change the setting to 'discussion'.
+
+> [[news/version_20111106]] says: "Fix handling of discussion page creation
+> links to make discussion pages in the right place and with the right case.
+> Broken by page case preservation feature added in 3.20110707." So I think
+> this is probably [[done]]? --[[smcv]]
--- /dev/null
+The [[ikiwiki/directive/brokenlinks]] directive lists emails when used inside [[ikiwiki/wikilink]]s: \[[john.doo@example.com\]] -> [[john.doo@example.com]]. Obviously its is a bug since 1) there is a link generated in the page; 2) "fixing" the broken link in the brokenlinks page may yield to stange results [[http://ikiwiki.info/ikiwiki.cgi?page=john.doo__64__example.com&do=create]]. [[JeanPrivat]]
+
+[[!brokenlinks pages="*@* and !recentchanges"]]
+
+> Weird. The bug, imho, is that `\[[email-address]]` results in a marked-up email address. I think marking up email addresses into hyperlinks should be handled by a markup plugin (e.g. markdown), not by the wikilink parser. I feel the same way for external links, but it appears [this is all by design](http://source.ikiwiki.branchable.com/?p=source.git;a=commitdiff;h=07a08122d926ab6b7741c94bc6c0038ffe0113fb). — [[Jon]]
+
+>> I belive this was done for compatability with the wikicreole plugin.
+>> Since in creole, a wikilink can contain an email or full html link,
+>> and it was easier to make ikiwiki's wikilinks do so too, rather
+>> than put entirely different link handling into creole.
+>>
+>> Anyway, I've fixed this. [[done]] --[[Joey]]
--- /dev/null
+Though [[htmlscrubber|plugins/htmlscrubber]] is disabled on the Branchable site <http://geekout.org.uk/> , [HTML embedded](http://source.geekout-org-uk.branchable.com/?p=source.git;a=blob_plain;f=actual_route.mdwn;hb=HEAD) (Flickr badge thing) in a markdown page is scrubbed.
+
+<http://geekout.org.uk/actual_route/>
+
+I assumed one can mix and match HTML in markdown?
+
+> I checked, htmlscrubber is really disabled. So it's not scrubbing
+> anything. Really.
+>
+> What is going on is you have found a bug in markdown. If you feed the
+> file into markdown directly you will see a bunch of weird hashes
+> like 67255d9b2a988139c95269498399f10a in place of your html,
+> so this is like [[!debbug 380212]] but that was with the other version of
+> markdown; I have not seen the current version behave this way before.
+>
+> One workaround is to wrap the html in a span tag. Another is to switch
+> the page from .mdwn to .html and enable the html plugin. I guess I'd pick
+> the first if I were you.
+>
+> I've filed [[!debbug 647128]] about this. Since it's not really an ikiwiki
+> bug, I'll close this one. [[done]] --[[Joey]]
>> Use $ua->env_proxy() to get it to read the environment variables. Then http:// does work.
>>
>> Unfortunately this breaks https:// even more - but nothing I do seems to make https:// work anymore.
+
+
+>>> LWP::UserAgent defaults to not caring about proxy settings in
+>>> the environment. (To give control over the result, I guess?)
+>>> To get it to care, pass `env_proxy => 1` to the constructor. Affected
+>>> plugins: aggregate, openid, pinger. This probably wants to be on
+>>> by default, and might not need to be configurable. --[[schmonz]]
+
+>>>> Okay, in a real-world scenario it does need to be
+>>>> configurable. A working implementation (tested with aggregate,
+>>>> not tested with the other two plugins) is in my git, commit
+>>>> 91c46819dee237a281909b0c7e65718eb43f4119. --[[schmonz]]
+
+>>>>> Oh, and according to the LWPx::ParanoidAgent docs, "proxy support is
+>>>>> explicitly removed", so if ikiwiki can preferentially find that
+>>>>> installed, even with the above commit, `openid` won't be able to
+>>>>> traverse a proxy. --[[schmonz]]
--- /dev/null
+when enabling the cgi wrapper I get,
+
+
+generating wrappers..
+"/var/www/cgi-bin/ikiwiki.cgi.c", line 91: warning: implicit function declaration: flock
+"/var/www/cgi-bin/ikiwiki.cgi.c", line 91: undefined symbol: LOCK_EX
+cc: acomp failed for /var/www/cgi-bin/ikiwiki.cgi.c
+failed to compile /var/www/cgi-bin/ikiwiki.cgi.c
+
+
+ cc -V
+cc: Sun C 5.9 SunOS_i386 Patch 124868-01 2007/07/12
+
+
+I don't know enough C to provide a patch, but from googling it, people seem to be suggesting fcntl has an alternative.
+
+
+-----
+
+
+changing
+
+ if (lockfd != -1 && flock(lockfd, LOCK_EX) == 0) {
+
+
+to read
+
+ if (lockfd != -1 && lockf(lockfd, F_LOCK,0) == 0) {
+
+
+in IkiWiki/Wrapper.pm lets it compile, according to
+http://man-wiki.net/index.php/3:lockf "On Linux, this call is just an
+interface for fcntl(2)" does this seem like a sensible fix?a
+
+> Don't see why not. flock was used only because it's being used
+> in the same file for testing some other locks.
+>
+> While lockf's fcntl locks are not inherited across a fork,
+> that doesn't matter for this lock, which is only used to
+> prevent more than one ikiwiki perl process being run at a time.
+> Nor is there any need to be compatible with some other user of this
+> lock; it's only checked in one place. [[applied|done]]
+> --[[Joey]]
A link like \[this](mailto:foo@bar.org) will not be converted correctly to a mailto link in the rss/atom feeds, but an absolute link instead. See e.g. the logitech post on http://madduck.net/blog/feeds/planet-lca2008/index.rss
> fixed --[[Joey]] [[!tag done]]
+
+This still happens for auto-generated mailto: links that are [garbled](http://daringfireball.net/projects/markdown/syntax#autolink) by Markdown, so that
+
+ <matthias@rampke.de>
+is turned into
+
+ <a href="mailto:matthias@rampke.de">matthias@rampke.de</a>
+
+for HTML, but
+
+ <a href="http://rampke.de/m&#97;&#105;&#x6C;t&#111;:&#109;&#x61;&#116;&#x74;&#x68;&#105;a&#x73;&#64;&#x72;&#x61;&#109;&#x70;&#x6B;&#101;&#46;&#100;&#x65;">&#109;&#x61;&#116;&#x74;&#x68;&#105;a&#x73;&#64;&#x72;&#x61;&#109;&#x70;&#x6B;&#101;&#46;&#100;&#x65;</a></p>
+
+for Atom and RSS.
+
+> This garbling is provably pointless. Proof: For $1000 I will take off my
+> white hat, put on my black hat, and implement support for it in any
+> spammer's email address extraction tool. Money will be donated to a
+> spam-fighting organisation of my choice.
+>
+> So, in leu of money, it seems best to find a way to disable it in
+> markdown.
+>
+> Anyway, I've fixed this, at the expense of additional total worldwide
+> power usage, etc. --[[Joey]]
--- /dev/null
+Two examples of encoding breakage observed in the wild. In both cases
+the ampersand needs to be escaped.
+--[[Joey]]
+
+ <link href="http://www.youtube.com/watch?v=Z9hP9lhBDsI&feature=youtube_gdata"/>
+
+ <category term="vicky&alice" />
+
--- /dev/null
+When I create a new page and upload an attachment all is fine.
+
+If I try to upload a second attachment (or remove the previously uploaded attachment), no upload happens. Instead the page gets created. No matter what I typed in, I just get a map to show the attachment. Now I can edit this page and everything is fine again.
+
+Another workaround is to first save the text and then edit and upload the rest.
+
+Is this a problem on my site or does anyone else see this?
+
+(If it's my fault feel free to move this to [[forum]].)
+
+> I don't see a behavior like that.
+> I don't know what you mean when you say "I just get a map to show the
+> attachment" A map?
+>
+> What version of ikiwiki? What browser? Is javascript enabled? --[[Joey]]
+
+>> I mean the [[ikiwiki/directive/map]] directive.
+>> It was ikiwiki 3.20110430.
+>> Tried Firefox and uzbl (webkit) with or without javascript.
+>>
+>> Just updated to 3.20110905. Now the problem has changed. Instead of saving the page with the second upload and leading me to it, it leaves me in the editform but creates the page anyway.
+>> When saving I get informed, that someone else created the page. Obviously it was ikiwiki itself with the mentioned map:
+>> \[[!map pages="path/to/page/* and ! ...
+>>
+>> This told me that [[plugins/autoindex]] is the bad guy. Deactivating this plugin helps out. Don't know if this is worth fixing... I can live without that plugin. --bacuh
--- /dev/null
+ikiwiki 3.20110712: A try to rename a page through the web interface without plugin `attachment` enabled renders:
+
+ Error: Undefined subroutine &IkiWiki::Plugin::attachment::attachment_holding_location called at /usr/share/perl5/IkiWiki/Plugin/rename.pm line 326.
+
+Enabling `attachment` makes it work. Some check if `attachment` is enabled before running that code path would solve it. Not sure of the best way to check it. --[[Daniel Andersson]]
+
+> [[fixed|done]] --[[Joey]]
--- /dev/null
+I'm using the most recent release of ikiwiki (3.20110905), the Perl shipped with SuSE 11.4 (v5.12.3), and built and installed xapian 1.2.7 from source, as it seems the current stable version that's encouraged for use by xapian.
+
+After enabling the search plugin and pointing ikiwiki to the omega program, rerunning ikiwiki --setup, and attempting a search, all searches return 0 results. No errors are reported by omindex or ikiwiki while producing the indexes in .ikiwiki/xapian/*, and the files appear to contain the indexed data. I don't think it's a problem in indexing.
+
+When running omega by hand in the .ikiwiki/xapian directory, providing queries on the command-line, runs correctly but again provides no results.
+
+I found that Debian stable is currently shipping 1.2.3, and on a hunch, I built that version, and searching now works fine. This looks like the usage of xapian's query template has changed somewhere between 1.2.3 and 1.2.7. Someone more familiar with xapian's query template language should be able to figure out what needs to be changed more specifically.
+
+> Debian has 1.2.7 now, and I have it installed and searching is working
+> fine with it. --[[Joey]]
--- /dev/null
+I just tried to clone the git repo onto a windows machine to test things out a bit and it turns out i cannot even successfully checkout the code because of those colons. Would a patch changing those to underscores be accepted? --Mithaldu
+
+> Well, this is a difficult thing. Ikiwiki has a configuration setting to
+> prevent it writing filenames with colons, but for backwards compatability
+> that is not enabled by default. Also nothing would stop people from
+> making commits that added filenames with colons even if it were disabled
+> in ikiwiki. I don't know that trying to work around obscure limitations
+> in OSs that I've never heard of ikiwiki being used on is worth the bother
+> TBH, but have not really made up my mind. --[[Joey]]
+
+>> I'm not trying to run it there. Ikiwiki is way too friggin' weird to try that. I just want to be able to check out the main repo so i can work in a native editor. Right now your core repository is downright hostile to cross-platform development in any way, shape or form. (Just plain splitting the docs from the code would work too.) --Mithaldu
+
+>>> Does(n't) cygwin handle the filename limitation/translations? If so, can you check out via git inside a cygwin environment? — [[Jon]]
+
+>>>> That actually allows me to check things out, but the resulting repo isn't compatible with most of the rest of my system, so it's extremely painful. --Mithaldu
The table plugin seems to be unable to read a CSV file that uses \r\n for line delimiters.
The same file with \r works fine. The error message is "Empty data".
--liw
+
+I was seeing this as well on an Ubuntu 11.04 system with Ubuntu 11.04, Perl 5.10.1, IkiWiki 3.20110124ubuntu1, and libtext-csv-perl 1.21-1, all installed from APT. However, when I removed libtext-csv-perl from APT and installed it from CPAN, the problem went away. FWIW, what CPAN grabbed was MAKAMAKA/Text-CSV-1.21.tar.gz. --micahrl
--- /dev/null
+I originally set up ikiwiki by using the debian package, but had some odd issues, so i figured i'd try installing from git. To do that i uninstalled the debian package and then did the Makefile dance from the git dir. In that process the original dirs configured in templatedir underlaydir in my wiki were deleted; HOWEVER when rebuilding the script just went ahead and did not even note the lack of those dirs. It would be nice if it threw errors if the dirs were configured, but non-existant.
+
+> Hmm. This behavior was explicitly coded into ikiwiki for underlay dirs:
+> [commit](http://source.ikiwiki.branchable.com/?p=source.git;a=commitdiff;h=cb4b99929757f970d5ae697f0d09514ad624ed46).
+> Pity I didn't say why, but presumably there are cases
+> where one of the underlaydirs is expected to be missing, or where
+> this robustness of not crashing is needed.
+>
+> The situation with missing templatedirs is more clear: When
+> it's looking for a given template file it just tries to open it in each
+> directory in turn, and uses the first file found; checking that a
+> directory exists would be extra work and there's a nice error message if
+> a template cannot be found. --[[Joey]]
+
+>> I'd agree with the thought behind that ... if it actually had thrown an error. However it did not. How about just checking the config variables when the template and/or config is set up? --Mithaldu
--- /dev/null
+Using ikiwiki 3.20100815.7 on Debian Squeeze or ikiwiki 3.20100815~bpo50+1 on Debian Lenny, the [[attachments|plugins/attachment] list on an edit page all show the same (wrong) file size, which is the size of one of the files.
+You can see the phenomenon on this wiki page:
+<http://tools.ipol.im/ikiwiki.cgi?page=sandbox&do=edit>.
+
+-- [[nil|users/nil]]
+
+> This bug was fixed in version 3.20100926: "attachment: Fix attachment file size
+> display." [[done]] --[[Joey]]
--- /dev/null
+I seem to have broken Discussion page creation links. --[[Joey]]
+
+For the toplevel, it needs to save to index/discussion. index/Discussion
+or Discussion won't work. It defaults to Discussion on the toplevel.
+And this is particularly bad as it breaks all other discussion links on
+other pages.
+
+For other pages, it should save to page/discussion. page/Discussion does
+not work. And it defaults to Discussion which is just *wrong*.
+
+> This was broken by [[Titles_are_lower-cased_when_creating_a_page]].
+> Added a fix. [[done]] --[[Joey]]
--- /dev/null
+in ikiwiki instances that don't reside in the git root directory (the only ones i know of are ikiwiki itself), reverts show the wrong link in the recentchanges (for example, in the ikiwiki main repository's 4530430 and its revert, the main index page was edited, but the revert shows doc/index as a link).
+
+the expected behavior is to compensate for the modified root directory (i.e., show index instead of doc/index).
Thanks to subpages, every page can easily and automatically have a
/Discussion subpage. By default, these links are included in the
-[[templates]] for each page. If you prefer blog-syle
+[[templates]] for each page. If you prefer blog-style
[[plugins/comments]], that is available too.
### Edit controls
--- /dev/null
+How do I allow only specific OpenIDs to log in to ikiwiki? I found a way to only allow edits from specific OpenIDs, but I would like to restrict the logins and not the edits. Currently I've disabled the passwordauth plugin, locked all pages, and set the allowed OpenIDs as adminuser:
+
+ adminuser => [qw{MY_OPENIDS}],
+ disable_plugins => [qw{passwordauth}],
+ locked_pages => '*',
+
+The problem with this solution is that every OpenID that logs in is saved in ikiwiki's `userdb` file, which I'd like to avoid. Pointers to the documentation or a sample setup are very welcome. Thanks!
--- /dev/null
+I'm looking for a way to change the RecentChanges, Preferences, Branchable, Comment menu items from my wiki page. I can see that the value for these items are set in template variables. Is there a way I can change these variables? If so can you tell me how?
+
+Thanks,
+
+Maria
+
--- /dev/null
+[[!comment format=mdwn
+ username="http://jmtd.livejournal.com/"
+ ip="188.222.50.68"
+ subject="comment 2"
+ date="2011-10-30T21:23:03Z"
+ content="""
+You need to define a `templatedir` and put a copy of your current version of ikiwiki's `page.tmpl` file into that directory. Then, edit around line 62 or thereabouts, e.g.
+
+ <li><a href=\"<TMPL_VAR EDITURL>\" rel=\"nofollow\">Edit</a></li>
+ </TMPL_IF>
+ <TMPL_IF RECENTCHANGESURL>
+ -<li><a href=\"<TMPL_VAR RECENTCHANGESURL>\">RecentChanges</a></li>
+ +<li><a href=\"<TMPL_VAR RECENTCHANGESURL>\">Recent Changes</a></li>
+ </TMPL_IF>
+ <TMPL_IF HISTORYURL>
+ -<li><a href=\"<TMPL_VAR HISTORYURL>\">History</a></li>
+ +<li><a href=\"<TMPL_VAR HISTORYURL>\">Site history</a></li>
+ </TMPL_IF>
+ <TMPL_IF GETSOURCEURL>
+ -<li><a href=\"<TMPL_VAR GETSOURCEURL>\">Source</a></li>
+ +<li><a href=\"<TMPL_VAR GETSOURCEURL>\">View Source</a></li>
+ </TMPL_IF>
+ <TMPL_IF PREFSURL>
+ -<li><a href=\"<TMPL_VAR PREFSURL>\">Preferences</a></li>
+ +<li><a href=\"<TMPL_VAR PREFSURL>\">Your Preferences</a></li>
+ </TMPL_IF>
+ <TMPL_IF ACTIONS>
+ <TMPL_LOOP ACTIONS>
+
+— [[Jon]]
+"""]]
--- /dev/null
+In the plugin interface, there are hooks for "deleted" and "changed" and the "changed" interfaces includes files which are *either* changed or added. Is there any way of telling that a file has been added rather than changed? With some plugins (for example, [[plugins/sidebar]]) if a new page (of a certain sort) is added, the only way one can fix up the dependencies is to rebuild the whole site from scratch. This is Not Good. Now, one could do something in the "changed" hook, but since one can't tell if a file has been changed or added, if one did something for every changed file, one would be doing a lot of needless work (so one might as well rebuild the site when one *knows* that a new (relevant) page has been added).
+
+But I really would like to be able to do things just to the *new* files, so is there any way that one can distinguish the changed files from the added files?
+
+-- [[KathrynAndersen]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-06-20T00:22:54Z"
+ content="""
+I think that presence dependencies mostly cover this case. But no, there is not currently a hook that gets information about which files changed vs were added. The information is available at the time the hooks are called so some new ones could be added.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="202.173.183.92"
+ subject="comment 2"
+ date="2011-06-20T03:24:49Z"
+ content="""
+If new hooks could be added, that would be greatly appreciated. Perhaps two new hooks: `added` and `updated` (the \"updated\" hook would be for files which were already-existing files which were changed).
+
+--[[KathrynAndersen]]
+"""]]
--- /dev/null
+I added a file with Chinese file name, and committed and pushed it to my Ikiwiki instance on Web. It displays correctly in browser. But, the file name shows up like
+
+http://i53.tinypic.com/2cikb9y.png
+
+Is there a way to fix it?
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-08-05T21:03:11Z"
+ content="""
+It's hard to tell from this small screenshot what I'm supposed to be looking at, but the \"Parent directory\" and date suggests this is an apache dirindex listing, which has nothing to do with ikiwiki.
+
+Ikiwiki is (or attempts to be) utf-8 clean on filenames and content, so as long as you use that encoding and have the requisite fonts your chinese filenames will display ok in ikiwiki. Apache probably doesn't try to get this right at all, or needs some more configuration.
+"""]]
--- /dev/null
+
+May anyone explain what's the intended use of --cgi option ?
+
+I understand you may run the cgi wrapper from command line using --cgi, but what is this option useful for ?. Perhaps for use with SSI pages ?. Any example ?
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 1"
+ date="2011-10-05T11:10:26Z"
+ content="""
+The `--cgi` option is for internal use (the compiled CGI wrapper
+basically cleans the environment, and runs `ikiwiki --cgi ...`
+to do the real work). It isn't useful from a command line unless
+you're doing something extremely strange.
+"""]]
--- /dev/null
+Is it possible to define custom "commands" in ikiwiki? For example if I write &%test&% in the source of a wiki-page in markdown, the word "test" should be displayed red, bold and italic.
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-09-05T17:33:51Z"
+ content="""
+Plugins can be written that do this kind of arbitrary transformation. For
+example, the smiley plugin does.
+
+However, this is not usual in ikiwiki, instead there is a specific syntax for a [[ikiwiki/directive]] that is used consistently for a great many things of this sort.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="Sphynkx"
+ ip="85.238.106.185"
+ subject="Videoplugin"
+ date="2011-06-27T02:27:19Z"
+ content="""
+Hello!!
+Test my [videoplugin](http://ikiwiki.info/plugins/contrib/video/)!!
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://mcfrisk.myopenid.com/"
+ nickname="mikko.rapeli"
+ subject="Bad html"
+ date="2011-07-02T19:09:22Z"
+ content="""
+My problems on the aggregate pages were resolved by checking and fixing html validation problems with the embedded video stuff. I will have look at the video plugin later, and maybe html5 and `<video>` tag as well.
+"""]]
--- /dev/null
+I use ikiwiki for my blog, and I'd like the creation page of each page to be the one registered in the VCS. However, the only way to get that is really with the --gettime flag, which gets ALL the timestamps from the VCS... which take quite some time after a few years of writing ;-)
+
+So I'd like to suggest that ikiwiki could fetch ctime through rcs_getctime() by default when it finds a new page...
+
+mtime is a different matter, not so important to me...
+
+-- [Richard Levitte](http://journal.richard.levitte.org/)
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-07-19T15:50:41Z"
+ content="""
+This is not done for reasons of speed. `rcs_getctime` is for many VCSs still slow, requiring a new svn or whatever to be forked off (and in the case of svn, possibly make a network connection). In the case where a commit comes in that adds multiple pages, that would be a lot of work. And for the VCSs where it's not slow, it manages to not be slow by optimising for the case where *all* the times for all pages are looked up in one go .. which is still rather a lot to do when only a single new page has been added. So we lose either way, and it's not suitable for being run all the time, unfortunately.
+"""]]
--- /dev/null
+I want to make a kind of puzzle page with ikiwiki. For that I want to have the solution text hidden directly below the puzzle which appears if I click a button.
+
+Is it possible to do this in ikiwiki?
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-09-07T20:58:18Z"
+ content="""
+Sounds like you want [[ikiwiki/directive/toggle]]
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk_MMtLPS7osC5MjX00q2ATjvvXPWqm0ik"
+ nickname="micheal"
+ subject="comment 2"
+ date="2011-09-11T11:59:35Z"
+ content="""
+Thanks, that's exactly what I wanted!
+"""]]
--- /dev/null
+Hi,
+
+I'm wondering how is TITLE evaluated in inline archive templates?
+
+Needless to say, I don't know much perl except the code that looks similar to other languages like bash.
+
+I found this line:
+
+$template->param(title => pagetitle(basename($page)));
+
+It seems to return a page name (pagetitle having no effect). Or maybe I'm not testing this the right way!
--- /dev/null
+Normally if i indent by 4 spaces, the text will format as computer code, for example,
+
+ int main () {
+ ...
+ }
+
+but it doesn't work for [ [ foobar ] ] (remove the space between the two square brackets). It will expose code like:
+
+ [[foobar]]
--- /dev/null
+How to list all pages in a wiki instance?
+
+
+
+How to list all pages in a wiki instance? I basically need an index of all existing pages.
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="202.173.183.92"
+ subject="comment 1"
+ date="2011-08-17T23:36:56Z"
+ content="""
+Use the [[plugins/map]] plugin.
+"""]]
--- /dev/null
+How to migrate multiple pages in root directory into a new subdirectory?
+
+I have multiple pages in the root directory of my website:
+
+ $ pwd
+ /home/doss/public_html
+ $ ls
+ a. mdwn b.mdwn section.mdwn subdir
+
+What's the procedures to migrate a.mdwn and b.mdwn to subdir and keep correct links to them that might exist in other pages like section.mdwn?
--- /dev/null
+[[!comment format=mdwn
+ username="http://jmtd.livejournal.com/"
+ ip="94.65.111.123"
+ subject="comment 1"
+ date="2011-08-22T12:53:03Z"
+ content="""
+If you use the [[plugins/rename]] plugin and go page-by-page, it will update backlinks for you.
+
+If you want to move a lot of files, such that it is impractical to do one at a time, you could write a script that
+
+ * moved each page to the new location
+ * replaced the old page with one containing a [[plugins/meta]] redirect to the new location.
+
+-- [[Jon]]
+"""]]
--- /dev/null
+I am using toc plugin, and it gives me
+
+ 1. Section1
+ 2. Section2
+ a. subsection21
+ b. subsection22
+
+How do I make a. and b. as 2.1 and 2.2, respectively?
--- /dev/null
+How can I make a link to a local file (for example a pdf file) in ikiwiki?
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-08-05T21:09:21Z"
+ content="""
+Typically this is done using standard markdown html linking.
+"""]]
--- /dev/null
+When i login my Ikiwiki instance using Google, it issues error
+
+ url_fetch_error: Error fetching URL: Internal Server Error
+
+then fail. How to fix it?
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-08-05T20:54:02Z"
+ content="""
+This error suggests that ikiwiki's attempt to contact google to check your openid is failing.
+
+What version on [[!cpan Openid::Consumer]] is that? Version 1.03 has a slightly different error message, perhaps you have an old version that is somehow broken.
+"""]]
--- /dev/null
+In other wikis [[for example|http://en.wikipedia.org/w/index.php?title=Main_Page&action=history]] in mediawiki there is a revision history of every single page (and not only of the whole wiki).
+
+Is it possible to have this in ikiwiki, too?
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="202.173.183.92"
+ subject="comment 1"
+ date="2011-09-26T22:52:07Z"
+ content="""
+Er, but IkiWiki does have this. Click on \"History\" and you get the revision history of that page.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk_MMtLPS7osC5MjX00q2ATjvvXPWqm0ik"
+ nickname="micheal"
+ subject="comment 2"
+ date="2011-09-27T17:49:15Z"
+ content="""
+Hm. I overlooked that ikiwiki.info has this. However my own wiki doesn't. Do I have adjust any settings to get this?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 3"
+ date="2011-09-29T16:10:22Z"
+ content="""
+`historyurl` is the setting in the `.setup` file: it just links to an external history viewer, which is likely to be more advanced and better-suited to your [[RCS]] than anything built into ikiwiki would be. Use your favourite viewer for the RCS you're using - ikiwiki.info uses gitweb, you could also use something like cgit - and write `\[[file]]` where you want the filename to appear.
+"""]]
--- /dev/null
+Is ist possible to set a template variable from the config file?
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="202.173.183.92"
+ subject="comment 1"
+ date="2011-08-29T23:07:21Z"
+ content="""
+With the [[plugins/contrib/field]] plugin one can; set the `field_allow_config` config value to 1, and the config variables are accessible with a \"CONFIG-\" prefix. That is, if you set a value \"foo\" in the config file, then you would access it in in the template as `<TMPL_VAR CONFIG-FOO>`.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawm_oOJLk8xnq4K5yRKzEoPPr9dMAFjiSi4"
+ nickname="Bayle"
+ subject="how to fix '"do" parameter missing' on nginx-fcgi?"
+ date="2011-10-31T05:57:43Z"
+ content="""
+I also get \"Error: \"do\" parameter missing\" and am using nginx with fcgi. What was the problem with the environment variables and how should i fix it? thanks,
+ bayle
+
+"""]]
--- /dev/null
+If I want to make a link to a local pdf-file I put the file into my scrdir and use the usual wikilink syntax. However if I put only a symbolic link into the scrdir instead of the actual file, it doesn't work. Is there a way to make that ikiwiki handles symbolic links in this situation?
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="202.173.183.92"
+ subject="comment 1"
+ date="2011-09-27T21:00:16Z"
+ content="""
+No, because disallowing symbolic links is a security feature which can't be disabled.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk_MMtLPS7osC5MjX00q2ATjvvXPWqm0ik"
+ nickname="micheal"
+ subject="comment 2"
+ date="2011-09-28T17:14:11Z"
+ content="""
+I use ikiwiki only locally for my personal use. So it wouldn't be a security issue for me. Perhaps there is some \"hack\" to achieve what I want?
+"""]]
--- /dev/null
+Is it possible to link directly to a specific section of another ikiwiki-page?
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-09-07T20:58:46Z"
+ content="""
+Quoting [[ikiwiki/wikilink]]:
+
+> To link to an anchor inside a page, you can use something like
+> `\[[WikiLink#foo]]` .
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk_MMtLPS7osC5MjX00q2ATjvvXPWqm0ik"
+ nickname="micheal"
+ subject="comment 2"
+ date="2011-09-11T12:00:08Z"
+ content="""
+Thanks!
+"""]]
--- /dev/null
+Thank you very much for ikiwiki. I successfully started using it.
+Now I have a simple question that I am not able to answer myself at the moment:
+
+In the directory structure of ikiwiki I placed a file (in this case a video). In an ikiwiki page I would like to create a link to this file, so that the user can download it. Of course I can do this using a link to the absolute url, including hostname and the full path. But when I move the wiki to another host, this will not be valid anymore. Therefore my question: Is there a way to automatically create a link to a file by relatively specifying the destination? Say, I have a directory foo with a page foo/bar.mdwn and a folder foo/downloads with a file foo/downloads/video.mp4, I would like to refer to this file using "downloads/video.mp4" or something similar. Is there such a possibility?
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 1"
+ date="2011-09-11T10:20:14Z"
+ content="""
+You could use a relative URL in a standard [[ikiwiki/MarkDown]] link:
+
+ [download the video](../downloads/video.mp4)
+
+or an ikiwiki [[ikiwiki/WikiLink]] to the file (just like you would for a page):
+
+ \[[download the video|foo/bar/downloads/video.mp4]]
+"""]]
--- /dev/null
+I have an [IkiWiki site](http://ocikbapps.uzh.ch/gc3wiki), which works
+fine, except for one page which I cannot edit with the CGI. Only this
+single page is failing, editing every other works as expected.
+
+When clicking every button (well, except "Cancel") on the edit form, I
+get a "302 Found" page in the browser; the Apache logs show:
+
+ [client XXX] malformed header from script. Bad header=according%20to%20the%20availab: ikiwiki.cgi
+
+Capturing the output from `ikiwiki.cgi`, I see that just these two
+lines are sent:
+
+ Status: 302 Found
+ Location: https://ocikbapps.uzh.ch/gc3wiki/ikiwiki.auth.cgi?_submitted=1;do=edit;..;_submit=Preview;attachment=
+
+The total size in bytes of the reply is 16189; I thought this might be
+an issue with Apache imposing some limit on the header size; indeed,
+`tcpflow` shows that the "302 Found" message is encapsulated into an
+HTTP 500 "internal server error" response.
+
+So I added this to Apache's config (std Debian 6.0):
+
+ # cat /etc/apache2/conf.d/limits.conf
+ LimitRequestFieldSize 65534
+ LimitRequestLine 65534
+
+But I'm still getting the same error.
+
+Any suggestions?
+
+
+**Update 2011-08-16:**
+[This bug report](https://bugzilla.mozilla.org/show_bug.cgi?id=513989)
+shows the exact same symptoms; the solution they adopted is to not
+perform the redirect when the URL length exceeds the default Apache
+value of 8190.
+
+Regarding Apache limits: apparently, Apache (as of version 2.2.17)
+only applies the `LimitRequestLine` and `LimitRequestFiledsize` in
+client HTTP transactions; when dealing with the HTTP responses
+generated by CGI scripts, the code from `server/util_script.c`
+applies: (function `ap_scan_script_header_err_core`, lines 403--433)
+
+ char x[MAX_STRING_LEN];
+ char *w, *l;
+ [...]
+ if (buffer) {
+ *buffer = '\0';
+ }
+ w = buffer ? buffer : x;
+ [...]
+ while (1) {
+ int rv = (*getsfunc) (w, MAX_STRING_LEN - 1, getsfunc_data);
+
+where `MAX_STRING_LEN` is defined in `httpd.h` to be equal to
+`HUGE_STRING_LEN`, that is, 8192.
+
+> This has been filed as [[!debbug 638009]], so let's only
+> discuss it in one place (ie, there) --[[Joey]]
--- /dev/null
+Hey There.
+
+I'm using the [[plugins/contrib/field]] plugin together with [[plugins/contrib/ftemplate/ikiwiki/directive/ftemplate]] and [[plugins/contrib/ymlfront]]. Everything looks good, but there are no links created as defined in field_tags. I hope it's just a mistake by me and someone can help me.
+
+All three plugins are activated and ikiwiki's setup file reads
+
+ # field plugin
+ # simple registration
+ field_register => [qw{meta}],
+
+ # allow the config to be queried as a field
+ field_allow_config => 1,
+
+ # flag certain fields as "tags"
+ field_tags => {
+ Autor => '/users',
+ Rubrik => '/rubriken',
+ Themen => '/themen',
+ BuchTitel => 'rezensionen/titel',
+ BuchAutor => '/rezensionen/autoren',
+ Verlag => 'rezensionen/verlage',
+ },
+
+I use this template to ask the users for the fields:
+
+ ---
+ Autor:
+ BuchTitel:
+ BuchUntertitel:
+ BuchAutor:
+ Verlag:
+ ISBN:
+ Seiten:
+ Preis:
+ Rubrik: Rezensionen
+ Themen:
+ - (Anti-)Repression
+ - Aktion
+ - ...
+ ---
+ [[!ftemplate id="rezi"]]
+
+And this one tells what to do with them:
+
+ \[[!meta author="<TMPL_VAR AUTOR>"]]
+ \[[!meta title="<TMPL_VAR BUCHAUTOR>: <TMPL_VAR BUCHTITEL>"]]
+
+ <span class="infobox">
+ <TMPL_VAR BUCHAUTOR>:</br>
+ **<TMPL_VAR BUCHTITEL>**</br>
+ -<TMPL_IF BUCHUNTERTITEL><TMPL_VAR BUCHUNTERTITEL></TMPL_IF></br>
+ *rezensiert von <TMPL_VAR AUTOR>*</br></br>
+ * Verlag: <TMPL_VAR VERLAG></br>
+ * ISBN: <TMPL_VAR ISBN></br>
+ * Seiten: <TMPL_VAR SEITEN></br>
+ * Preis: <TMPL_VAR PREIS></br></br>
+ Rubrik: <TMPL_VAR RUBRIK></br>
+ Themen:
+ <TMPL_LOOP THEMEN_LOOP><TMPL_VAR THEMEN>
+ <TMPL_UNLESS __last__>, </TMPL_UNLESS>
+ </TMPL_LOOP>
+ </span>
+
+ <TMPL_VAR RUBRIK> # just for testing if infobox is the problem
+
+Do I have to register another plugin with field or what is wrong here?
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 10"
+ date="2011-09-06T02:31:13Z"
+ content="""
+Hmmm. They are the latest versions.
+
+So what do you get when you use `<TMPL_VAR AUTOR>`? Is that blank?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 11"
+ date="2011-09-06T02:41:24Z"
+ content="""
+No. This gives the expected result.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 12"
+ date="2011-09-06T02:53:39Z"
+ content="""
+Okay, I'm going to release the latest version from another branch. Give me an hour.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 13"
+ date="2011-09-06T03:07:10Z"
+ content="""
+There's no rush. But please don't forget to document this -TAGPAGE thing. ;) I can't find any reference to it. Should be mentioned in the manpage.
+
+Thanks for your help.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 14"
+ date="2011-09-06T03:42:22Z"
+ content="""
+Releases done. And, yes, updating the docs was one of the things I did.
+
+So, if you can try again with the latest version...
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 15"
+ date="2011-09-06T04:07:12Z"
+ content="""
+Great. This works.
+
+Thanks again.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 16"
+ date="2011-09-06T06:55:43Z"
+ content="""
+Yay!
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="202.173.183.92"
+ subject="comment 1"
+ date="2011-09-05T22:23:17Z"
+ content="""
+The `field_tags` option behaves like \[[!tag ]] rather than \[[!taglink ]] - that is, it flags the page as being linked to the tag page. In order to have an actual link, you have to put a link in the template, and use the \"tagpage\" variable suffix.
+
+For example:
+
+ *rezensiert von \[[<TMPL_VAR AUTOR-TAGPAGE>]]*
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 2"
+ date="2011-09-05T23:18:34Z"
+ content="""
+This doesn't work. Even with a exact copy of your code it just get
+
+ [[]]
+
+where the \"taglinks\" should be.
+
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 3"
+ date="2011-09-05T23:46:40Z"
+ content="""
+BTW: The PageSpecs provided by field are working.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 4"
+ date="2011-09-06T01:31:25Z"
+ content="""
+Hmmm.
+What happens when you just have `<TMPL_VAR AUTOR-tagpage>`? Is that blank too?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 5"
+ date="2011-09-06T01:40:46Z"
+ content="""
+It makes no difference. Neither with a capitalized nor with an uncapitalized \"-tagpage\".
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 6"
+ date="2011-09-06T01:56:22Z"
+ content="""
+I meant, if you just have `<TMPL_VAR AUTOR-tagpage>` without the square brackets `[[` around it, is that blank too?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 7"
+ date="2011-09-06T02:02:39Z"
+ content="""
+Sorry for being unclear; I tried exactly that. It's still blank.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://kerravonsen.dreamwidth.org/"
+ ip="60.241.8.244"
+ subject="comment 8"
+ date="2011-09-06T02:13:06Z"
+ content="""
+Which versions of field and ftemplate are you using?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://xlogon.net/bacuh"
+ ip="209.234.253.228"
+ subject="comment 9"
+ date="2011-09-06T02:27:47Z"
+ content="""
+* field: 1.20110610
+* ftemplate: 1.20100519
+
+Both were downloaded two days ago from their git repositorie's master branch.
+"""]]
--- /dev/null
+Hi,
+
+I'm thinking about running my wiki with cgi disabled. I already did the gitweb setup.
+
+Is it possible to use gitweb to give me what getsource gives me. You know, like the History item but with:
+http://127.0.0.1/gitweb/gitweb.cgi?p=wiki.git;a=blob_plain;f=\[[file]];hb=HEAD
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawnQs9icnfI79gWOQY_Yxv2XmYI3z703PrQ"
+ nickname="misc"
+ subject="Solved - patched source"
+ date="2011-07-21T15:36:47Z"
+ content="""
+Ok, I implemented sourceurl and it worked. I didn't want to touch the source code at first but it turned out to be very easy to work with.
+
+Thank you for your excellent and creative work on ikiwiki.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 2"
+ date="2011-07-23T11:07:27Z"
+ content="""
+Could you attach the patch here, please? That sounds like a useful feature to have.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawnQs9icnfI79gWOQY_Yxv2XmYI3z703PrQ"
+ nickname="misc"
+ subject="patch - getsource from gitweb"
+ date="2011-07-24T23:50:07Z"
+ content="""
+> Could you attach the patch here, please? That sounds like a useful feature to have.
+
+<https://gitorious.org/ikiwiki-nezmer/ikiwiki-nezmer/commit/71fd3bda5cd7e8b0d3e403b2e9ba51889329b60d?format=patch>
+"""]]
--- /dev/null
+Is there a way to make nice printable pages out of ikiwiki? Preferably pdfs.
+
+marius
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk_MMtLPS7osC5MjX00q2ATjvvXPWqm0ik"
+ nickname="micheal"
+ subject="comment 1"
+ date="2011-11-05T09:35:40Z"
+ content="""
+I have the same question. Any ideas?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk_MMtLPS7osC5MjX00q2ATjvvXPWqm0ik"
+ nickname="micheal"
+ subject="Tutorial?"
+ date="2011-07-30T20:14:34Z"
+ content="""
+Would be nice to have a little tutorial. I don't know how to set up mathjax.
+"""]]
--- /dev/null
+Hi there,
+
+I tried yesterday to make a slide-show for my frontpage. I enabled the [[!iki plugins/meta desc=meta]] and the [[!iki plugins/html desc=html]] plugins, then, on my frontpage, I pointed to the .js files that do the trick and I added the html code to actually run the slide-show. I also set [[!iki plugins/htmlscrubber desc=htmlscrubber]] to skip everything except the Discussion pages. I used this code [[http://www.dynamicdrive.com/dynamicindex14/fadeinslideshow.htm]].
+
+In theory this should have worked but unfortunately it didn't worked at all. I know I can use [[!iki plugins/rawhtml desc=rawhtml]] plugin but with this I get a page that is treated as data, I need the page to be treated as source so I can use directives. I'm now wondering if this is even possible in ikiwiki...
+
+Anyway, I thought to check with you guys. The main idea is to have a simple slide-show with 4 or 5 slides that change every 3 seconds and each slide should link to a different page. Any ideas are extremely welcomed!
+
+Thanks
+
+Marius
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 1"
+ date="2011-06-23T07:52:04Z"
+ content="""
+See [[tips/embedding_content]], which applies equally to any scripting or other \"unsafe\" markup.
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 2"
+ date="2011-06-23T07:54:06Z"
+ content="""
+Oh, sorry, you already said you disabled the htmlscrubber. In that case,
+please define \"doesn't work\" - it might be helpful to compare the IkiWiki
+output with similar code that you've added to a static copy of the HTML?
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk3MUhMRflE8-Vg4fevsT1sadSetiAxVKg"
+ nickname="Marius"
+ subject="IT WORKS!!! Ikiwiki rules!"
+ date="2011-06-23T09:42:00Z"
+ content="""
+Well, surprise, I tried a different approach and this time it worked perfectly. So, how I did it?...
+
+I created externally a html file with the slid-show I wanted and then put it (along with the javascript files and the images) in the source directory. I rebuilt the wiki and then inlined that html page in the wiki page where I wanted the slide-show.
+
+So, from now on my wiki will look like any wordpress or drupal eye-candy website but without all that bloat.
+
+Short outline:
+
+- put the slid-show files in the source directory
+- rebuild the wiki
+- on the wiki page you want some eye-candy inline the html page that contains the slid-show
+- that's it ;)
+
+Marius
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawk3MUhMRflE8-Vg4fevsT1sadSetiAxVKg"
+ nickname="Marius"
+ subject="comment 4"
+ date="2011-06-23T09:49:29Z"
+ content="""
+Oh, I forgot to mention. It seems that you have to have both [[!iki plugins/html desc=html]] and [[!iki plugins/rawhtml desc=rawhtml]] plugins enabled for this to work.
+
+Marius
+"""]]
--- /dev/null
+How to move pages in ikiwiki?
--- /dev/null
+[[!comment format=mdwn
+ username="http://smcv.pseudorandom.co.uk/"
+ nickname="smcv"
+ subject="comment 1"
+ date="2011-08-05T13:57:09Z"
+ content="""
+Enable the [[plugins/rename]] plugin and ensure that you have permission to edit the page.
+Edit the page and press the Rename button.
+
+\"Following Unix tradition, renaming also allows moving to a different directory.\" —from its documentation
+"""]]
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 2"
+ date="2011-08-05T20:55:07Z"
+ content="""
+Or just make a checkout of the site using version control and move files there. :)
+"""]]
Might this be a mistake by me or does anyone know a workaround to get the 404 plugin working with nginx? --[[bacuh]]
-
+
+
--- /dev/null
+[[!comment format=mdwn
+ username="https://www.google.com/accounts/o8/id?id=AItOawl981Fi5YVeEC_ncO9cJTfkPyyy2A_-tG8"
+ nickname="Mick"
+ subject="comment 5"
+ date="2011-06-25T12:00:24Z"
+ content="""
+Is [[this|missing_pages_redirected_to_search-SOLVED]] what you are after ? --[Mick](http://www.lunix.com.au)
+"""]]
--- /dev/null
+Is [[Section editing|http://www.wikimatrix.org/wiki/feature:Section%20Editing]] possible in ikiwiki? Is there a plugin?
--- /dev/null
+[[!comment format=mdwn
+ username="http://joey.kitenet.net/"
+ nickname="joey"
+ subject="comment 1"
+ date="2011-08-05T21:00:56Z"
+ content="""
+Not exactly the same, but a large document is sometimes stiched together by inlining smaller sections. The sections can then be clicked on to go to their page and edited. For example, see <http://git-annex.branchable.com/walkthrough/>. A side benefit of this is that users can post comments on each section of the page, which are visible when viewing the page for that section, but not at the top level.
+
+I suspect section editing is necessary on eg, Wikipedia because it reduces the change for conflicts when multiple people are editing different parts of the page. Ikiwiki instead avoids conflicts by harnessing the merging power of a version control system such as git, so multiple edits to different sections of a page can be made and each saved without manual conflict resolution.
+
+I'm happy that modern web browsers allow searching inside text edit boxes, so when I want to jump to a given part of a large page I'm editing, I just search for the text.
+"""]]
--- /dev/null
+I use the wmd editor in my ikiwiki. However live preview seems not to be a fully correct preview so nevertheless I have to hit the preview button to get a correct preview. However then I have two previews so that I have to scroll down to see the correct one.
+
+Is it possible to disable the live preview or to *replace* the live preview with the correct one after pressing the preview button?
* [[davrieb|David_Riebenbauer]] `git://git.liegesta.at/git/ikiwiki`
([browse](http://git.liegesta.at/?p=ikiwiki.git;a=summary))
* [[GustafThorslund]] `http://gustaf.thorslund.org/src/ikiwiki.git`
-* [[peteg]] `git://git.hcoop.net/git/peteg/ikiwiki.git`
+* [[users/peteg]] `git://git.hcoop.net/git/peteg/ikiwiki.git`
* [[privat]] `git://github.com/privat/ikiwiki.git`
* [[blipvert]] `git://github.com/blipvert/ikiwiki.git`
* [[bzed|BerndZeimetz]] `git://git.recluse.de/users/bzed/ikiwiki.git`
* jo `git://git.debian.org/users/jo-guest/ikiwiki.git`
([browse](http://git.debian.org/?p=users/jo-guest/ikiwiki.git;a=summary))
* [[timonator]] `git://github.com/timo/ikiwiki.git`
+* [[sajolida]] `http://un.poivron.org/~sajolida/ikiwiki.git/`
+* nezmer `git://gitorious.org/ikiwiki-nezmer/ikiwiki-nezmer.git`
+* [[yds]] `git://github.com/yds/ikiwiki.git`
## branches
> Unlike wikilinks, pagespecs match relative to the top of the wiki by
> default. So lose the "/" and it will work. --[[Joey]]
+
+
+----
+
+I'd like to create a collapsable tree with a map, eg
+
+* top level item
+
+* * second level item1
+
+* * * content 1
+
+* * * content 2
+
+* * * content 3
+
+* * second level item2
+
+* * second level item3
+
+
+but I can't work out how to specify "all items at this level, and all directories at ../ and all the other directories to the root
+
+any ideas?
+
+> I don't think pagespecs currently support that. How would such a made-up
+> pagespec look? I can imagine it supporting something like `glob(../*) and not
+> glob(../*/*)` to match all "directories" of the parent page, and so on up
+> to the root. --[[Joey]]
+
+>> I don't know, perhaps some way of nesting pagespecs
+>>> glob(../* unless $_ eq 'second level item'{ glob 'second level item'/*})
+
+>> but that could get messy, perhaps a new cmd 'pagetree' or something
+>> might be better? --Colin
+
+>>> You could probably do a lot worse than stealing terminology from
+>>> [XPath Axes](http://www.w3.org/TR/xpath/#axes),
+>>> passing the "argument" through `bestlink` if there is one, and
+>>> treating an empty argument as "this page", something like:
+>>>
+>>> * `ancestor(/plugins/contrib/album)` matches `plugins` or
+>>> `plugins/contrib`
+>>> but not `plugins/map` or `plugins/contrib/album`
+>>> (does it match `index`? answers on a postcard)
+>>> * `descendant(/plugins)` is basically `plugins/*`
+>>> * `child(/plugins)` is basically `plugins/* and !plugins/*/*`
+>>> * `self(/plugins)` is just `plugins` but without interpreting
+>>> globs
+>>> * `ancestor-or-self(/plugins)`, `descendant-or-self(/plugins)`
+>>> are syntactic sugar for e.g. `ancestor(/plugins) or self(/plugins)`
+>>> * `self()` always matches the current page (not destpage)
+>>> * `ancestor-or-self()` always matches the current pages and all
+>>> pages that would go in its [[plugins/parentlinks]]
+>>>
+>>> XPath has `following-sibling` and `preceding-sibling` axes for
+>>> siblings, but pagespecs are unordered, so we'd probably want
+>>> to invent `sibling()` - so `sibling(/plugins/map)` matches
+>>> `plugins/inline` but not `plugins/map` or `plugins/contrib/album`.
+>>>
+>>> Then, the requested functionality would be `sibling() or ancestor()`,
+>>> or possibly `sibling() or ancestor() or self()`?
+>>> --[[smcv]]
+
+>>>> I like that idea! --[[KathrynAndersen]]
>> Fixed that --[[Joey]]
+>>> Sorry to bring this up (1 year since last change in this page) but what is the status of this? Can we use anchors like it's in [[wikilink]]? This discusion is tagged as wishlist, but isn't listed in [[wishlist]]. What is "fixed that" then? Again, sorry if this is a dead issue, but I have a tendency to create big wiki pages, and anchors are very needed for me, but I've spent all morning trying to make it work and it just doesn't. TY. --rbern
+
The 'name' attribute of the 'a' element is a depracated way to create a named anchor. The right way to do that is using the 'id' attribute of any element. This is because an anchor may refer to a complete element rather than some point in the page.
Standard purity aside, if you define an anchor (using either 'a name' or 'id') to a single point in the document but refer to a complete section, the browser may just show that specific point at the bottom of the page rather than trying to show all the section.
* [Schabis blaue Seite](http://schabi.de) - I abuse ikiwiki as blog/cms combo, and will migrate all existing content into ikiwiki eventually.
* [Ben Coffey's blog and personal site](http://inelegant.org/).
* [blog of LukClaes](http://zomers.be/~luk/blog/).
-* [Per Olofsson](http://people.dsv.su.se/~pelle/)
* [Effective Programming](http://effectiveprogramming.com/)
* [Embedded Moose](http://embeddedmoose.com), Andrew Greenberg's personal and consulting page.
* [Chez Fred](http://fred.ccheznous.org)
* [Per Bothner's blog](http://per.bothner.com/blog/)
* [Bernd Zeimetz (bzed)](http://bzed.de/)
* [Gaudenz Steinlin](http://gaudenz.durcheinandertal.ch)
-* [Simon Kjika'qawej C.](http://simonraven.kisikew.org/) - several other sites, too.
+* [Simon C.](http://simon.kisikew.org/) - several other sites, too.
* [NeoCarz Wiki](http://www.neocarz.com/wiki/) Yes - its actually Ikiwiki behind that! I'm using Nginx and XSL to transform the ikiwiki renderings thanks to the valid XHTML output of ikiwiki. Great work Joey!!
* [Natalian - Kai Hendry's personal blog](http://natalian.org/)
* [Mick Pollard aka \_lunix_ - Personal sysadmin blog and wiki](http://www.lunix.com.au)
* [Jonas Smedegaard](http://dr.jones.dk/) multilingual "classic" website w/ blog
* [Siri Reiter](http://sirireiter.dk/) portfolio website with a blog (in danish)
* [L'Altro Wiki](http://laltromondo.dynalias.net/~iki/) Tutorials, reviews, miscellaneus articles in English and Italian, from the IRC network syrolnet.org
+* [STUPiD](http://lhzhang.com/)
+* gregoa's [p.r. - political rants](http://info.comodo.priv.at/pr/)
+* [Michael Hammer](http://www.michael-hammer.at/)
+* [Richardson Family Wiki](http://the4richardsons.com) A wiki, blog or some such nonsense for the family home page or something or other... I will eventually move the rest of my sites to ikiwiki. The source of the site is in git.
+* [The personal website of Andrew Back](http://carrierdetect.com)
+* [SolderPad Documentation](http://docs.solderpad.com)
+++ /dev/null
-ikiwiki 3.20110321 released with [[!toggle text="these changes"]]
-[[!toggleable text="""
- * comment: Don't show comments of subpages on parent pages.
- (Fixes bug introduced in version 3.20100505.)
- * darcs: Fix multiple issues preventing rcs\_diff from working.
- * aggregate: Read cookies from ~/.ikiwiki/cookies by default.
- Also, the cookiejar configuration setting can be used by
- other plugins to provide a custom `cookie\_jar` object for LWP::UserAgent.
- (Thanks, schmonz)
- * Avoid escaping / characters in filenames when building the cgiurl,
- as this confuses eg, cvsweb."""]]
\ No newline at end of file
+++ /dev/null
-ikiwiki 3.20110328 released with [[!toggle text="these changes"]]
-[[!toggleable text="""
- * Yaml formatted setup files are now produced by default.
- (Perl formatted setup files can still be used.)
- * Add timezone setting in setup file. This alows time zone to be configured
- via the web.
- * comment: Better fix to avoid showing comments of subpages, while
- not breaking manual inlining of comments.
- * meta: Security fix; don't allow alternative stylesheets to be added
- on pages where the htmlscrubber is enabled."""]]
\ No newline at end of file
+++ /dev/null
-ikiwiki 3.20110430 released with [[!toggle text="these changes"]]
-[[!toggleable text="""
- * meta: Allow adding javascript to pages. Only when htmlscrubber is
- disabled, naturally. (Thanks, Giuseppe Bilotta) Closes: #[623154](http://bugs.debian.org/623154)
- * comments: Add avatar picture of comment author, using Libravatar::URL
- when available. The avatar is looked up based on the user's openid,
- or email address. (Thanks, Francois Marier)
- * Recommend libgravatar-url-perl, which contains Libravatar::URL.
- * monotone: Implement rcs\_getmtime, and work around a problem with monotone
- 0.48 that affects rcs\_getctime. (Thanks, Richard Levitte)
- * meta: Fix bug in loading of HTML::Entities that can break inline
- archive=yes (mostly masked by other plugins that load the module).
- * Be quiet about updating wrappers, except in verbose mode. (jmtd)
- * meta: Add FOAF support. Closes: #[623156](http://bugs.debian.org/623156) (Jonas Smedegaard)
- * Promote Crypt::SSLeay to Recommends; needed for https openid auth.
- * tag: Avoid autocreating multiple tag pages that vary only in
- capitalization. The first capitalization seen of a tag will be used
- for the tag page.
- * Fix yaml build dep. Closes: #[624712](http://bugs.debian.org/624712)"""]]
\ No newline at end of file
+++ /dev/null
-ikiwiki 3.20110431 released with [[!toggle text="these changes"]]
-[[!toggleable text="""
- * Danish translation update. Closes: #[625721](http://bugs.debian.org/625721)
- * Danish underlay translation update. Closes: #[625765](http://bugs.debian.org/625765)
- (Thanks, Jonas Smedegaard)
- * Support YAML::XS by not passing decoded unicode to Load. Closes: #[625713](http://bugs.debian.org/625713)
- * openid, aggregate, pinger: Use Net::INET6Glue if available to
- support making ipv6 connections. (Note that if LWPx::ParanoidAgent
- is installed, it defeats this for openid.)
- * Add additional directive quoting styles, to better support nested
- directives. Both triple-single-quote and heredoc quotes can be used.
- (Thanks, Timo Paulssen)
- * Changed license of madduck's python plugins from GPL-2 to BSD-2-clause.
- * po: support language codes in the form of 'es\_AR', and 'arn'. (intrigeri)
- Closes: #[627844](http://bugs.debian.org/627844)
- * po: Make po4a warn, not error on a malformed document. (intrigeri)
- * Support the Hiawatha web server which sets HTTPS=off rather than not
- setting it. (There does not seem to be a standard here.)"""]]
\ No newline at end of file
+++ /dev/null
-ikiwiki 3.20110608 released with [[!toggle text="these changes"]]
-[[!toggleable text="""
- * ikiwiki-mass-rebuild: Fix tty hijacking vulnerability by using su.
- (Once su's related bug #628843 is fixed.) Thanks, Ludwig Nussel.
- (CVE-2011-1408)
- * search: Update search page when page.tmpl or searchquery.tmpl are locally
- modified."""]]
\ No newline at end of file
--- /dev/null
+ikiwiki 3.20110711 released with [[!toggle text="these changes"]]
+[[!toggleable text="""
+ * Add build dep on python-support. Closes: #[633536](http://bugs.debian.org/633536)
+ * attachment: Bugfix to move upload attachments out of holding area
+ when saving.
+ * attachment: Bugfix for trying to attach files to a subpage of the index
+ page."""]]
\ No newline at end of file
--- /dev/null
+ikiwiki 3.20110712 released with [[!toggle text="these changes"]]
+[[!toggleable text="""
+ * attachment: Bugfix to create directory when moving attachment out of
+ holding area.
+ * Display attachment manipulation links always, since attachments can be
+ uploaded via javascript."""]]
\ No newline at end of file
--- /dev/null
+ikiwiki 3.20110715 released with [[!toggle text="these changes"]]
+[[!toggleable text="""
+ * rename: Fix logic error that broke renaming pages when the attachment
+ plugin was disabled.
+ * rename: Fix logic error that bypassed the usual pagespec checks."""]]
\ No newline at end of file
--- /dev/null
+ikiwiki 3.20110905 released with [[!toggle text="these changes"]]
+[[!toggleable text="""
+ * mercurial: Openid nicknames are now used when committing. (Daniel Andersson)
+ * mercurial: Implement rcs\_commit\_staged so comments, attachments, etc
+ can be used. (Daniel Andersson)
+ * mercurial: Implement rcs\_rename, rcs\_remove. (Daniel Andersson)
+ * mercurial: Fix viewing of a diff containing non-utf8 changes.
+ (Daniel Andersson)
+ * mercurial: Make both rcs\_getctime and rcs\_getmtime fast. (Daniel Andersson)
+ * mercurial: Implement rcs\_diff. (Daniel Andersson)
+ * po: Add `LANG\_CODE` and `LANG\_NAME` template variables. (intrigeri)
+ * Fix typo in Danish translation of shortcuts page that caused exponential
+ regexp blowup.
+ * Fix escaping of html entities in permalinks.
+ * Fix escaping of html entities in tag names.
+ * Avoid using named capture groups in heredoc code for oldperl compatibility.
+ * Put in a workaround for #622591, by ensuring Search::Xapian gets loaded
+ before Image::Magick.
+ * Add unminified jquery js and css files to source.
+ * Update to jquery 1.6.2, and jquery-ui 1.8.14.
+ * Use lockf rather than flock when taking the cgilock, for better
+ portability.
+ * search: Fix encoding bug in calculation of maximum term size.
+ * inline: When indexing internal pages for searching, use the url of
+ the inlining page.
+ * Fix comments testsuite to not rely on Date::Parse's ability to
+ parse the date Columbus discovered America. Closes: #[640350](http://bugs.debian.org/640350)
+ * Avoid warning message when generating setup file if highlight
+ is not installed. Closes: #[637606](http://bugs.debian.org/637606)
+ * Promote RPC::XML to a Recommends, since it's used by auto-blog.setup.
+ Closes: #[637603](http://bugs.debian.org/637603)
+ * Fix web revert of a file deletion."""]]
\ No newline at end of file
--- /dev/null
+ikiwiki 3.20111106 released with [[!toggle text="these changes"]]
+[[!toggleable text="""
+ * searchquery.tmpl: Track escaping change in upstream template.
+ Thanks Olly Betts for review.
+ * svn: Support subversion 1.7, which does not have .svn in each
+ subdirectory.
+ * rst: import docutils lazily, to avoid errors during ikiwiki --setup.
+ Closes: #[637604](http://bugs.debian.org/637604) (Thanks, smcv)
+ * Make the setup automator create YAML formatted files.
+ * Fix handling of discussion page creation links to make discussion pages
+ in the right place and with the right case. Broken by page case
+ preservation feature added in 3.20110707."""]]
\ No newline at end of file
* some way to deep-link to memes/badger.jpg with a wikilink, without knowing a
priori that it's secretly a JPEG (probably harder than it looks - you'd
have to make a directive for it and it's probably not worth it)
+
+----
+
+Hi smcv, great plugin. I am an ikiwiki newbie but so far I've had success using your plugin.
+I've integrated the jquery masonry plugin into the albumitem template and it works great.
+But is there a way to create thumnails of different sizes? I've passed thumnailsize option
+and value to album directive and while it does create the new thumbnail sizes it doesn't use them,
+The 96x96 thumbnails still appear on the page no matter what I do. - jaime
--- /dev/null
+[[!template id=plugin name=bibtex author="[[Matthias]]"]]
+
+# bibtex for ikiwiki #
+
+(get me at [github]!)
+
+[github]: https://github.com/ihrke/iki-bibtex
+
+This [ikiwiki]-plugin provides a
+
+ [[!bibtex ]]
+
+directive for [ikiwiki].
+
+So far, it can display a raw or formatted bibtex-entry from a
+bibtex-file (either checked into ikiwiki, or not) and display a
+list of all bibtex-keys used on a key.
+
+[ikiwiki]: http://ikiwiki.info/
+
+Features:
+
+* three different output formats for citations:
+ + cite - Author (year)
+ + citation - Author1, Author2 (year): **Title.** *Journal*
+ vol(num). pp.
+ + raw - raw bibtex-entry preformatted
+* supports websetup
+* bibliography
+
+
+## Requirements ##
+
+* [Text::BibTeX] - available from CPAN
+
+[Text::BibTeX]: http://search.cpan.org/~ambs/Text-BibTeX-0.61/lib/Text/BibTeX.pm
+
+## Examples ##
+
+Output from file mybib.bib, bibtex key 'key1' in a citation-like
+format (authors (year): journal. volume (number), pages.).
+
+ [[!bibtex file="mybib.bib" key="key1" format="citation"]]
+
+Combine with toggle-plugin to optionally display the raw bibtex
+
+ [[!bibtex key="Ihrke2011"]] \[[!toggle id="bibtexentry" text="(entry)"]]
+ \[[!toggleable id="bibtexentry" text="""
+ [[!bibtex key="Ihrke2011" format="raw"]]
+ \[[!toggle id="bibtexentry" text="(hide)"]]
+ """]]
+
+Add a bibliography that includes all bibtex-directives from that page
+
+
+ ## Bibliography ##
+ [[!bibtex_bibliography ]]
+
+ ----
Someone was just asking for it and I had written these two plugins already some months ago,
so I'm now publishing them here.
-[`copyright.pm`](http://schwinge.homeip.net/~thomas/tmp/copyright.pm)
+[`copyright.pm`](http://git.savannah.gnu.org/cgit/hurd/web.git/plain/.library/IkiWiki/Plugin/copyright.pm)
and
-[`license.pm`](http://schwinge.homeip.net/~thomas/tmp/license.pm)
+[`license.pm`](http://git.savannah.gnu.org/cgit/hurd/web.git/plain/.library/IkiWiki/Plugin/license.pm)
Usage instructions are found inside the two plugin files.
> and rebuilt the wiki, but the copyright/license text doesn't show up. Does these plugin work with Ikiwiki `3.20100815`?
> -- 9unmetal
+>> Solved by email long ago; the problem was that the user had not put them
+>> into the *add_plugins* set in the wiki's `ikiwiki.setup`. --[[tschwinge]]
+
[[!template id=gitbranch branch=smcv/contrib/defcopyright author="[[tschwinge]]"]]
> For `./gitremotes` convenience (taking the Linus approach to backups :-) )
field_allow_config => 1,
Allow the $config hash to be queried like any other field; the
-keys of the config hash are the field names.
+keys of the config hash are the field names with a prefix of "CONFIG-".
**field_register**
tagging system.
The way this works is that a given field-name will be associated with a given
-page, and the values of that field will be linked to sub-pages of that page.
+page, and the values of that field will be linked to sub-pages of that page,
+the same way that the \[[!tag ]] directive does.
+
+This also provides a field with the suffix of `-tagpage` which gives
+the name of the page to which that field-value is linked.
For example:
will link to "/books/genres/SF", with a link-type of "bookgenre".
+If one was using a template, then the following template:
+
+ Genre: <TMPL_VAR BOOKGENRE>
+ GenrePage: <TMPL_VAR BOOKGENRE-TAGPAGE>
+ GenreLink: \[[<TMPL_VAR BOOKGENRE-TAGPAGE>]]
+
+would give:
+
+ Genre: SF
+ GenrePage: /books/genres/SF
+ GenreLink: <a href="/books/genres/SF/">SF</a>
+
## PageSpec
The `field` plugin provides a few PageSpec functions to match values
* destfield_item
* **destfield_item(*name* *glob*)**
* as for "field_item" but matches against the destination page.
+* field_null
+ * **field_null(*name*)**
+ * matches if the field is null, that is, if there is no value for that field, or the value is empty.
* field_tagged
* **field_tagged(*name* *glob*)**
* like `tagged`, but this uses the tag-bases and link-types defined in the `field_tags` configuration option.
sort="field(bar)" will sort by the value og the "bar" field.
+Additionally, the "field_natural" SortSpec function will use the
+Sort::Naturally module to do its comparison (though it will fail if that
+module is not installed).
+
## FUNCTIONS
### field_register
### field_get_value($field, $page)
- my @values = field_get_value($field, $page);
-
my $value = field_get_value($field, $page);
-Returns the values of the field for that page, or undef if none is found.
-Note that it will return an array of values if you ask for an array,
-and a scalar value if you ask for a scalar.
+ my $value = field_get_value($field, $page, foo=>'bar');
+
+Returns the value of the field for that page, or undef if none is found.
+It is also possible to override the value returned by passing in
+a value of your own.
## DOWNLOAD
This does not use directive markup, in order to make it easier to
use the markup inside other directives. There are four forms:
-* {{$*fieldname*}}
+* \{{$*fieldname*}}
This queries the value of *fieldname* for the source page.
<h1>My Long and Complicated Title With Potential For Spelling Mistakes</h1>
-* {{$*pagename*#*fieldname*}}
+* \{{$*pagename*#*fieldname*}}
This queries the value of *fieldname* for the page *pagename*.
On PageBar:
- For more info, see \[[{{$PageFoo#title}}|PageFoo]].
+ For more info, see \[[\{{$PageFoo#title}}|PageFoo]].
When PageBar is displayed:
<p>For more info, see <a href="PageFoo">I Am Page Foo</a>.</p>
-* {{+$*fieldname*+}}
+* \{{+$*fieldname*+}}
This queries the value of *fieldname* for the destination page; that is,
the value when this page is included inside another page.
<h1>I Am Page B</h1>
<p>Stuff about A.</p>
-* {{+$*pagename*#*fieldname*+}}
+* \{{+$*pagename*#*fieldname*+}}
This queries the value of *fieldname* for the page *pagename*; the
- only difference between this and {{$*pagename*#*fieldname*}} is
+ only difference between this and \{{$*pagename*#*fieldname*}} is
that the full name of *pagename* is calculated relative to the
destination page rather than the source page.
I can't really think of a reason why this should be needed, but
this format has been added for completeness.
+### Escaping
+
+Getfield markup can be escaped by putting a backwards slash `\`
+in front of the markup.
+If that is done, then the markup is displayed as-is.
+
### No Value Found
If no value is found for the given field, then the field name is returned.
+++ /dev/null
-[[!template id=plugin name=headinganchors author="[[PaulWise]]"]]
-
-This is a simple plugin to add ids (which will serve as [[anchor]]s) to all headings, based on their text. It
-works as a postprocessing filter, allowing it to work on mdwn, wiki, html,
-rst and any other format that produces html. The code is available here:
-
- #!/usr/bin/perl
- # quick HTML heading id adder by Paul Wise
- package IkiWiki::Plugin::headinganchors;
-
- use warnings;
- use strict;
- use IkiWiki 2.00;
-
- sub import {
- hook(type => "sanitize", id => "headinganchors", call => \&headinganchors);
- }
-
- sub text_to_anchor {
- my $str = shift;
- $str =~ s/^\s+//;
- $str =~ s/\s+$//;
- $str = lc($str);
- $str =~ s/[&\?"\'\.,\(\)!]//mig;
- $str =~ s/[^a-z]/_/mig;
- return $str;
- }
-
- sub headinganchors (@) {
- my %params=@_;
- my $content=$params{content};
- $content=~s{<h([0-9])>([^>]*)</h([0-9])>}{'<h'.$1.' id="'.text_to_anchor($2).'">'.$2.'</h'.$3.'>'}gie;
- return $content;
- }
-
- 1
[mdocml](http://mdocml.bsd.lv/) for the conversion, and postprocesses
xrefs into hyperlinks.
-Sample output: <http://wiki.netbsd.org/users/schmonz/tunefs.8/>
+Possible enhancements:
+
+* configurable path and args to `mandoc` (and it could be `groff`)
+* configurable location for rendered manpages (such as subdirs per section)
--- /dev/null
+[[!template id=plugin name=mscgen author="[[users/Terry_Golubiewski]]"]]
+[[!tag type/widget]]
+
+## NAME
+
+IkiWiki::Plugin::mscgen - embed message sequence chart
+
+## SYNOPSIS
+
+In the ikiwiki setup file, enable this plugin by adding it to the list of active plugins.
+
+ add_plugins:
+ - mscgen
+
+## DESCRIPTION
+
+This plugin provides the msc [[ikiwiki/directive]].
+This directive allows embedding [mscgen](http://www.mcternan.me.uk/mscgen/)
+message sequence chart graphs in an ikiwiki page.
+
+Here's an example that shows how an mscgen message sequence chart is embedded into an ikiwiki page.
+
+ \[[!msc src="""
+ arcgradient = 8;
+
+ a [label="Client"],b [label="Server"];
+
+ a=>b [label="data1"];
+ a-xb [label="data2"];
+ a=>b [label="data3"];
+ a<=b [label="ack1, nack2"];
+ a=>b [label="data2", arcskip="1"];
+ |||;
+ a<=b [label="ack3"];
+ |||;
+ """]]
+
+Security implications: to be determined.
+
+This plugin borrows heavily from the [[graphviz|plugins/graphviz]] plugin written by [[JoshTriplett]].
+
+## PREREQUISITES
+ IkiWiki
+ mscgen
+ Digest::SHA
+
+## DOWNLOAD
+
+* browse at GitHub: <http://github.com/tjgolubi/ikiwiki.mscgen>
+* repo at git://github.com/tjgolubi/ikiwiki.mscgen.git
+
+
Tobi Oetiker 2006.12.30
If you are interested in this, drop me a line tobi at oetiker dot ch
+
+
+In the meanwhile, I ([[MartinQuinson]]) have hacked this a bit to make it fit my needs. The result is [[here|http://www.loria.fr/~quinson/Hacking/ikiwiki/]]
--- /dev/null
+[[!template id=plugin name=plusone author="[[BerndZeimetz]]"]]
+[[!toc]]
+[[!tag plugins]] [[!tag patch]] [[!tag wishlist]]
+
+## NAME
+
+IkiWiki::Plugin::plusone - Adding the +1 button to your posts
+
+## SYNOPSIS
+
+ # activate the plugin
+ add_plugins => [qw{goodstuff plusone ....}],
+
+ # set some options:
+ plusone_count => 1,
+ plusone_size => 'standard',
+ plusone_lang => 'en-US',
+
+
+## DESCRIPTION
+
+This plugin allows to add a google plusone button using the plusone directive
+ [[!plusone ]]
+where ever you want the button to show up.
+
+## plusone directive
+The plusone directive allows to override the automativally generated url by specifying the wanted url as option:
+ [[!plusone url="http://bzed.de/"]]
+
+
+## DOWNLOAD
+
+* single file: [plusone.pm](http://git.recluse.de/?p=users/bzed/ikiwiki.git;a=blob_plain;f=IkiWiki/Plugin/plusone.pm;hb=refs/heads/plusone)
+* browse repository: <http://git.recluse.de/?p=users/bzed/ikiwiki.git;a=shortlog;h=refs/heads/plusone>
+* git repo: `git://git.recluse.de/users/bzed/ikiwiki.git` or <http://git.recluse.de/repos/users/bzed/ikiwiki.git> (Use the plusone branch)
### Common values
-Values known for all pages: "page", "destpage". Also "basename" (the
-base name of the page).
+Values known for all pages:
+
+* page (the current page)
+* destpage (the destination page)
+* basename (the base name of the page)
+* recno (N if the page is the Nth page in the report)
+
+### Prev_Page And Next_Page
+
+The "prev_page" and "next_page" variables will give the value of the
+previous page in the matching pages, or the next page in the matching pages.
+This is mainly useful for a "here_only" report.
### Passed-in values
the "Mood" section of your template when it is true, which one could
use when the Mood is one of the headers.
-### Prev_ And Next_ Items
-
-Any of the above variables can be prefixed with "prev_" or "next_"
-and that will give the previous or next value of that variable; that is,
-the value from the previous or next page that this report is reporting on.
-This is mainly useful for a "here_only" report.
-
### Headers
See the section on Headers.
wiki pages in the Texinfo format (even though that is possible, of course),
but rather to ease collaboration on existing Texinfo documents.
-The plugin is available at <http://schwinge.homeip.net/~thomas/tmp/texinfo.pm>.
+The plugin is available at
+<http://git.savannah.gnu.org/cgit/hurd/web.git/plain/.library/IkiWiki/Plugin/texinfo.pm>.
It's very basic at the moment, but will be improved over time.
+It also has not really been audited for any security issues.
+
# Issues
+## How can I use verbatiminclude?
+
+I only can post a file ...
+
## N-to-M Mapping of Input and Output Files
Conventional ikiwiki [[*htmlize*ing|plugins/write#index6h3]] plugins
--- /dev/null
+[[!template id=plugin name=video author="[[Yury Chumak|sphynkx]]"]]
+
+## Video
+
+This plugin provides embedding video on wikipages. Plugin uses most simple embedding method - only with *embed* tag and without any JS-scripts.
+
+###Usage
+
+>\[\[\!video width=100 height=100 type="application/x-shockwave-flash" src="/\_jwplayer/player.swf" allowscriptaccess="always" allowfullscreen="true" autostart="false" file="path\_to\_video"\]\]
+
+All parameters are optional except *file* and will be replaced with the default settings as showed in the above example.
+
+*file* is relative path in webdir or web-address (to Youtube page).
+
+### Install
+Download and unpack [archive](http://sphynkx.org.ua/progr/videoplug/jw_videoplugin.tar.bz2) in your ikiwiki webdir.
+Or download [JW Player](http://www.longtailvideo.com/players/jw-flv-player/) and [perl module](http://sphynkx.org.ua/progr/videoplug/video.pm) separately. Make dir *\_jwplayer* and put player.swf in it. Also put *video.pm* in *Plugin* dir. In Ikiwiki configuration switch on the plugin:
+
+ add_plugins => [qw{.......... video}]
+
+### Note
+
+[Htmlscrubber](http://ikiwiki.info/plugins/htmlscrubber/) may block *embed* tag.
+
+If embed tag present but video not playing - check mode of unpacked *player.swf*.
--- /dev/null
+I'm sure this is useful to its author in his situation, but I have to point
+out that ikiwiki supports the html5 `<video>` tag, and so this is not
+necessary to support any reasonably modern browser. --[[Joey]]
--- /dev/null
+[[!template id=plugin name=headinganchors author="[[PaulWise]]"]]
+[[!tag type/html]]
+
+This is a simple plugin to add ids (which will serve as [[anchor]]s) to all
+headings (h1, h2, etc), based on their text. It works as a postprocessing
+filter, allowing it to work on mdwn, wiki, html, rst and any other format that
+produces html.
It excludes all html tags and attributes except for those that are
whitelisted using the same lists as used by Mark Pilgrim's Universal Feed
-Parser, documented at <http://feedparser.org/docs/html-sanitization.html>.
+Parser, documented at
+<http://web.archive.org/web/20110726052341/http://feedparser.org/docs/html-sanitization.html>.
Notably it strips `style` and `link` tags, and the `style` attribute.
All attributes that can be used to specify an url are checked to make sure
The `htmlscrubber_skip` configuration setting can be used to skip scrubbing
of some pages. Set it to a [[ikiwiki/PageSpec]], such as
-"posts/* and !comment(*) and !*/Discussion", and pages matching that can have
+`posts/* and !comment(*) and !*/Discussion`, and pages matching that can have
all the evil CSS, JavsScript, and unsafe html elements you like. One safe
way to use this is to use [[lockedit]] to lock those pages, so only admins
can edit them.
## options
These options do not normally need to be set, but can be useful in
-certian setups.
+certain setups.
* `openid_realm` can be used to control the scope of the openid request.
It defaults to the `cgiurl` (or `openid_cgiurl` if set); only allowing
The `ISTRANSLATION` and `ISTRANSLATABLE` variables can be used to
display things only on translatable or translation pages.
+The `LANG_CODE` and `LANG_NAME` variables can respectively be used to
+display the current page's language code and pretty name.
+
### Display page's versions in other languages
The `OTHERLANGUAGES` loop provides ways to display other languages'
--- /dev/null
+couldn't the diff be displayed as a popup? right now it's too bad because the diff is actually in the page, generated and downloaded, but the user can't see it. I have tried to address the issue by adding stuff to the change.tmpl template, but I may be missing something - and it doesn't quite look right:
+
+ --- /usr/share/ikiwiki/templates/change.tmpl 2011-09-05 15:14:19.000000000 -0400
+ +++ templates/change.tmpl 2011-10-11 13:04:37.704346964 -0400
+ @@ -39,6 +39,7 @@
+ </TMPL_LOOP>
+ </div>
+ <TMPL_IF DIFF>
+ +<a href="#" onClick="document.getElementByClass('diff').style = 'block'">[[show diff|wikiicons/diff.png]]</a>
+ <div class="diff">
+ <pre>
+ <TMPL_VAR DIFF>
+
+There are a few things wrong with this:
+
+ 1. I don't like the hardcoded javascript in there, we should use [[plugins/toggle]] or something, but i am not sure how to make the this plugin depend on toggle, or if it is desirable.
+ 2. it doesn't work at all: first it doesn't actually "toggle" and second the javascript somehow gets filtered out of the resulting HTML so we don't even see it
+ 3. if the diffurl parameter is set in the template, we'd actually see two sets of glasses, which is silly. i tried moving the diff button upwards into the PAGES loop, but there the diffurls are file-specific, which also seem quite silly
+
+I am looking for guidance on how to improve and fix this now. --[[anarcat]] 2011-10-11
or DSV ([delimiter-separated values](http://en.wikipedia.org/wiki/Delimiter-separated_values)) format.
It needs the perl module [[!cpan Text::CSV]] for the CSV data.
+
+Note that you can also build tables in [[ikiwiki/Markdown]] pages
+without using this plugin, by enabling the `multimarkdown` option
+and installing the [[!cpan Text::MultiMarkdown]] Perl module or simply by using the `<table>` HTML tag.
as wiki pages.
Unlike other [[type/format]] plugins, no formatting of markup in
-txt files is done; the file contents is displayed to the user as-is,
-with html markup characters such as ">" escaped.
+txt files is done; the file contents is displayed to the user as
+pre-formatted text, with html markup characters such as ">" escaped.
The only exceptions are that [[WikiLinks|ikiwiki/WikiLink]] and
[[directives|ikiwiki/directive]] are still expanded by
[[mdwn]]. This plugin makes WMD be used for editing pages in the wiki.
To use the plugin, you will need to install WMD. Download the [WMD
-source](http://wmd-editor.com/downloads/wmd-1.0.1.zip). In that zip file
+source](http://ftp.netbsd.org/pub/NetBSD/packages/distfiles/wmd-1.0.1.zip). In that zip file
you'll find a few example html files, a readme and `wmd` directory. Create
a 'wmd' subdirectory in the ikiwiki `underlaydir` directory (ie `sudo mkdir
/usr/share/ikiwiki/wmd`). Move the `wmd` directory into the directory you
--- /dev/null
+I've tried to retrieve the wmd-editor source tarball lately, but the site seems offline.
+
+From what I've read on the Internet, wmd-editor is not (yet?) free software by itself, and its author has gone MIA.
+But it looks like somebody recently took the step to rewrite a wmd-clone under a saner license, see [[pagedown|http://code.google.com/p/pagedown/source/browse/]].
+
+Given all the above, what about upgrading this plugin to use pagedown instead of wmd? It seem a clear win to me...
+
+> AFAICS, pagedown is a modified version of WMD. Let's
+> look at its license file: --[[Joey]]
+
+<pre>
+A javascript port of Markdown, as used on Stack Overflow
+and the rest of Stack Exchange network.
+
+Largely based on showdown.js by John Fraser (Attacklab).
+
+Original Markdown Copyright (c) 2004-2005 John Gruber
+ <http://daringfireball.net/projects/markdown/>
+
+
+Original Showdown code copyright (c) 2007 John Fraser
+
+Modifications and bugfixes (c) 2009 Dana Robinson
+Modifications and bugfixes (c) 2009-2011 Stack Exchange Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a
+copy [...]
+</pre>
+
+> Ok, so it says it's based on showdown. John Fraser wrote showdown and also
+> WMD, which IIRC was built on top of showdown. (Showdown converts the
+> markdown to html, and WMD adds the editor UI.)
+>
+> I can nowhere find a actual statement of the copyright of showdown or
+> WMD. <http://code.google.com/p/wmd/> has a "MIT License" notice on it,
+> but this is clearly just the license chosen when signing up at google
+> code for the repo that would be used for a rewrite of the code, and the only thing
+> said about the previous 1.0 release of WMD is "use it freely", which is not
+> specific enough to be a grant of license, and is moreover not a free
+> software license, as it does not cover distribution or modification.
+>
+> Which was all covered in the thread here,
+> when StackOverflow decided to start working on pagedown.
+> <http://blog.stackoverflow.com/2008/12/reverse-engineering-the-wmd-editor/>
+> This thread does not give any indication that they ever managed to get
+> a license grant for WMD/showdown. It frankly, does not inspire confidence
+> that the people working on this care about the license.
+>
+> It would probably be pretty easy to adapt the ikiwiki wmd plugin
+> to use pagedown. But without a clear and credible license, why?
+>
+> (Note that I have a wmd-new branch in my ikiwiki git repo that
+> uses <https://github.com/derobins/wmd>, which was an earlier
+> version of pagedown (probably, not entirely clear).)
+>
+> An alternate alternative is markitup: <http://markitup.jaysalvat.com/>
+> It has a clear history and a credible license (MIT or GPL dual license).
+> It's also easily extensible to other formats so could handle rst etc.
+> It does not, however, have a markdown to html converter -- for
+> previewing it has to talk to the server with AJAX.
+> --[[Joey]]
feature |[[git]]|[[svn]]|[[bzr]] |[[monotone]]|[[mercurial]]|[[darcs]]|[[tla]] |[[cvs]]
[[ikiwiki-makerepo]]|yes |yes |yes |yes |yes |yes |no |yes
auto.setup |yes |yes |incomplete|yes |incomplete |yes |incomplete|yes
-`rcs_commit_staged` |yes |yes |yes |yes |no |yes |no |yes
-`rcs_rename` |yes |yes |yes |yes |no |yes |no |yes
-`rcs_remove` |yes |yes |yes |yes |no |yes |no |yes
-`rcs_diff` |yes |yes |yes |yes |no |yes |yes |yes
-`rcs_getctime` |fast |slow |slow |slow |slow |slow |slow |slow
-`rcs_getmtime` |fast |slow |slow |slow |no |no |no |no
+`rcs_commit_staged` |yes |yes |yes |yes |yes |yes |no |yes
+`rcs_rename` |yes |yes |yes |yes |yes |yes |no |yes
+`rcs_remove` |yes |yes |yes |yes |yes |yes |no |yes
+`rcs_diff` |yes |yes |yes |yes |yes |yes |yes |yes
+`rcs_getctime` |fast |slow |slow |slow |fast |slow |slow |slow
+`rcs_getmtime` |fast |slow |slow |slow |fast |no |no |no
`rcs_preprevert` |yes |no |no |no |no |no |no |no
`rcs_revert` |yes |no |no |no |no |no |no |no
anonymous push |yes |no |no |no |no |no |no |no
conflict handling |yes |yes |yes |buggy |yes |yes |yes |yes
-openid username |yes |no |no |no |no |no |no |no
+openid username |yes |no |no |no |yes |yes |no |no
"""]]
Notes:
[git]: http://git.or.cz/
-Ikiwiki can run as a `post-update` hook to update a wiki whenever commits
-come in. When running as a [[cgi]] with Git, ikiwiki automatically
-commits edited pages, and uses the Git history to generate the
-[[RecentChanges]] page.
+Ikiwiki can run as a git `post-update` hook to update a wiki
+whenever commits come in. When running as a [[cgi]],
+ikiwiki automatically commits edited pages, and uses the
+git history to generate the [[RecentChanges]] page.
+
+Normally you can just follow the instructions in [[setup]] to create
+the git repositories and get started. To understand the details, read on.
## git repository setup
-The suggested setup for git is a set of repositories setup like a
-shallow, single level tree, with a bare repository (meaning that it
-does not have a working tree checked out) at the root, and various
-working clones (with working directories) as leaf nodes. The root
-(bare) repository is meant to be pushed to and pulled from the various
-working clones.
+[[!img wiki_edit_flow.svg size=490x align=right]]
+
+The suggested setup for git has a bare repository, and various
+working clones (with working directories). The bare
+repository is pushed to and pulled from the various working clones.
-One of the leaf node clone repositories is special; it has working
-directory which is used to compile the wiki, and is also used by the
+One of the clones is special; it is the srcdir
+which is used to compile the wiki, and is also used by the
[[cgi]] to commit changes made via the web interface. It is special
since the `post-update` hook for the bare root repository is used to
trigger an update of this repository, and then an ikiwiki refresh
-updates the published wiki itself.
+updates the published wiki itself.
-The other (optional) leaf node repositories are meant for you to work
+The other (optional) clones are meant for you to work
on, and commit to, changes should then be pushed to the bare root
repository.
-So, to reiterate, when using Git, you probably want to set up three
-repositories:
-
-* The root repository. This should be a bare repository (meaning that
- it does not have a working tree checked out), which the other
- repositories will push to/pull from. It is a bare repository, since
- git does not support pushing to a repository that has a working
- directory. This is called _repository_ in [[ikiwiki-makerepo]]'s
- manual page. This bare repository has a `post-update` hook
- that either is or calls ikiwiki's `git_wrapper`, which changes to the
- working directory for ikiwiki, does a `git pull`, and refreshes ikiwiki
- to regenerate the wiki with any new content. The [[setup]] page describes
- how to do this, but note, if you are importing from an existing git repository, that ikiwiki will not create the `git_wrapper` unless its path is explicitely set in your `.setup` file.
-
-* The second repository is a clone of the bare root repository, and
- has a working tree which is used as ikiwiki's srcdir for compiling
- the wiki. **Never** push to this repository. It is wise to not make
- changes or commits directly to this repository, to avoid conflicting
- with ikiwiki's own changes. When running as a [[cgi]], the changes
- are committed to this repository, and pushed to the master repository
- above. This is called _srcdir_ in [[ikiwiki-makerepo]]'s manual page.
-
-* The other (third, fourth, fifth, sixth -- however many pleases you)
- repositories are also clones of the bare root repository above --
- and these have a working directory for you to work on. Use either
- the `git` transport (if available), or `ssh`. These repositories may
- be on remote machines, your laptop, wherever you find convenient to
- hack on your wiki. You can commit local changes to the version on
- the laptop, perhaps while offline. Any new content should be pushed to the
- bare master repository when you are ready to publish it, and then
- the post-update hook of the bare repository will ensure that the
- ikiwiki's source directory is updated, and the ikiwiki refreshed
- with the new content.
-
-Using three or more of repositories isn't the most obvious set up, but
+Using three or more repositories isn't the most obvious set up, but
it works the best for typical ikiwiki use. [[ikiwiki-makerepo]] can
automate setting this up for the common case where there is no
pre-existing wiki. [[tips/Laptop_wiki_with_git]] describes a different
way to set up ikiwiki and git.
-It is **paramount** that you **never** push to the non-bare repository
-([this FAQ entry explains why](http://git.or.cz/gitwiki/GitFaq#head-b96f48bc9c925074be9f95c0fce69bcece5f6e73)).
-Instead, clone the bare repository as mentioned above, and push
-**only** to the bare repository.
-
-The ikiwiki `post-update` hook should be put in the bare repository.
-
## git repository with multiple committers
It can be tricky to get the permissions right to allow multiple people to
## Optionally using a local wiki to preview changes
-When working on the "working clones" to add content to your wiki,
+When working on your wiki,
it is common (but optional) practice to preview your changes using a
private wiki on the local host before publishing the updates by
sending it to the root repository. If you do want to setup a private
git_wrapper => "/working/dir/.git/hooks/post-commit",
Then just committing should refresh the private ikiwiki on the local
-host. Now just run `ikiwiki -setup localwiki.setup -getctime` and
-you should be good to go. (You only need the slow `-getctime` option
+host. Now just run `ikiwiki -setup localwiki.setup -gettime` and
+you should be good to go. (You only need the slow `-gettime` option
the first time you run setup.) Use standard git commands to handle
-pulling from and pushing to the server. **Note**: Currently, after
+pulling from and pushing to the server. **Note**: After
pulling changes from the bare root repository, you will need to
manually update the local wiki, with a command such as `ikiwiki
--setup localwiki.setup -refresh`. This is because git 1.5.4 doesn't
-have a hook that is run locally after pulling changes. Newer
-versions of git will have a `post-merge` hook that should work for
-this purpose.
-
-## Fix for error on git pull origin
-
-Error message when running git pull origin:
-
- You asked me to pull without telling me which branch you
- want to merge with, and 'branch.master.merge' in
- your configuration file does not tell me either. Please
- name which branch you want to merge on the command line and
- try again (e.g. 'git pull <repository> <refspec>').
- See git-pull(1) for details on the refspec.
-
- If you often merge with the same branch, you may want to
- configure the following variables in your configuration
- file:
-
- branch.master.remote = <nickname>
- branch.master.merge = <remote-ref>
- remote.<nickname>.url = <url>
- remote.<nickname>.fetch = <refspec>
-
- See git-config(1) for details.
-
-The solution is to run this command in your srcdir:
-
- git config branch.master.remote origin
+-setup localwiki.setup -refresh`. You could use git's `post-merge` hook
+to automate that command.
I have read the hints about using a local wiki to preview changes, but I haven't understood: is it assumed that I should also have a separate "srcdir" for this local preview-wiki (as it is done for the main wiki site), or I could point the local ikiwiki's "srcdir" to the working dir? Can something bad happen if I do this? I guess no, because--as I see it--the reason to have 2 repos for the main site was only enabling pushing to it, so it's a peculiarity of git, and not a requirement for a clean functioning of ikiwiki.
Ok, probably, I have answered my question myself, but I'll let this comment stay here, if someone else will be tinking about the same issue. --Ivan Z.
+
+## Fix for error on git pull origin
+
+Error message when running git pull origin:
+
+ You asked me to pull without telling me which branch you
+ want to merge with, and 'branch.master.merge' in
+ your configuration file does not tell me either. Please
+ name which branch you want to merge on the command line and
+ try again (e.g. 'git pull <repository> <refspec>').
+ See git-pull(1) for details on the refspec.
+
+ If you often merge with the same branch, you may want to
+ configure the following variables in your configuration
+ file:
+
+ branch.master.remote = <nickname>
+ branch.master.merge = <remote-ref>
+ remote.<nickname>.url = <url>
+ remote.<nickname>.fetch = <refspec>
+
+ See git-config(1) for details.
+
+The solution is to run this command in your srcdir:
+
+ git config branch.master.remote origin
--- /dev/null
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<!-- Created with Inkscape (http://www.inkscape.org/) -->
+
+<svg
+ xmlns:dc="http://purl.org/dc/elements/1.1/"
+ xmlns:cc="http://creativecommons.org/ns#"
+ xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"
+ xmlns:svg="http://www.w3.org/2000/svg"
+ xmlns="http://www.w3.org/2000/svg"
+ xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+ xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+ width="493.90625"
+ height="548.64734"
+ id="svg2"
+ version="1.1"
+ inkscape:version="0.48.1 r9760"
+ sodipodi:docname="wiki_edit_flow.svg">
+ <defs
+ id="defs4">
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow2Lend"
+ style="overflow:visible">
+ <path
+ id="path3914"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)"
+ inkscape:connector-curvature="0" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow1Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow1Lend"
+ style="overflow:visible">
+ <path
+ id="path3896"
+ d="M 0,0 5,-5 -12.5,0 5,5 0,0 z"
+ style="fill-rule:evenodd;stroke:#000000;stroke-width:1pt;marker-start:none"
+ transform="matrix(-0.8,0,0,-0.8,-10,0)"
+ inkscape:connector-curvature="0" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow1Lstart"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow1Lstart"
+ style="overflow:visible">
+ <path
+ id="path3893"
+ d="M 0,0 5,-5 -12.5,0 5,5 0,0 z"
+ style="fill-rule:evenodd;stroke:#000000;stroke-width:1pt;marker-start:none"
+ transform="matrix(0.8,0,0,0.8,10,0)"
+ inkscape:connector-curvature="0" />
+ </marker>
+ <linearGradient
+ id="linearGradient3767">
+ <stop
+ style="stop-color:#efbc00;stop-opacity:1;"
+ offset="0"
+ id="stop3769" />
+ <stop
+ id="stop3775"
+ offset="0.93150687"
+ style="stop-color:#ffcb10;stop-opacity:1;" />
+ <stop
+ style="stop-color:#ffffff;stop-opacity:1;"
+ offset="1"
+ id="stop3771" />
+ </linearGradient>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow2Lend-4"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path3914-9"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="marker5456"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path5458"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow2Lend-3"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path3914-6"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="marker5456-4"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path5458-7"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow2Lend-5"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path3914-92"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="marker5456-3"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path5458-78"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="Arrow2Lend-36"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path3914-5"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ <marker
+ inkscape:stockid="Arrow2Lend"
+ orient="auto"
+ refY="0"
+ refX="0"
+ id="marker5532"
+ style="overflow:visible">
+ <path
+ inkscape:connector-curvature="0"
+ id="path5534"
+ style="font-size:12px;fill-rule:evenodd;stroke-width:0.625;stroke-linejoin:round"
+ d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z"
+ transform="matrix(-1.1,0,0,-1.1,-1.1,0)" />
+ </marker>
+ </defs>
+ <sodipodi:namedview
+ id="base"
+ pagecolor="#ffffff"
+ bordercolor="#666666"
+ borderopacity="1.0"
+ inkscape:pageopacity="0.0"
+ inkscape:pageshadow="2"
+ inkscape:zoom="1.0885159"
+ inkscape:cx="281.26331"
+ inkscape:cy="219.65103"
+ inkscape:document-units="px"
+ inkscape:current-layer="layer1"
+ showgrid="false"
+ showguides="true"
+ inkscape:guide-bbox="true"
+ inkscape:snap-global="true"
+ inkscape:window-width="1280"
+ inkscape:window-height="995"
+ inkscape:window-x="1280"
+ inkscape:window-y="0"
+ inkscape:window-maximized="1"
+ fit-margin-top="25"
+ fit-margin-left="25"
+ fit-margin-right="25"
+ fit-margin-bottom="25">
+ <inkscape:grid
+ type="xygrid"
+ id="grid2985"
+ empspacing="5"
+ visible="true"
+ enabled="true"
+ snapvisiblegridlinesonly="true" />
+ </sodipodi:namedview>
+ <metadata
+ id="metadata7">
+ <rdf:RDF>
+ <cc:Work
+ rdf:about="">
+ <dc:format>image/svg+xml</dc:format>
+ <dc:type
+ rdf:resource="http://purl.org/dc/dcmitype/StillImage" />
+ <dc:title></dc:title>
+ </cc:Work>
+ </rdf:RDF>
+ </metadata>
+ <g
+ inkscape:label="Layer 1"
+ inkscape:groupmode="layer"
+ id="layer1"
+ transform="translate(-159.65625,-106.875)">
+ <rect
+ style="fill:none;stroke:#000000;stroke-width:0.70866144;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0"
+ id="rect3866"
+ width="220.00006"
+ height="79.999939"
+ x="184.99994"
+ y="142.36218"
+ ry="10"
+ rx="10" />
+ <path
+ style="fill:#ffcb14;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+ d="m 355,182.36218 55,0 0,-45 -25,0 -5,-5 -20,0 -5,5 z"
+ id="path2989"
+ inkscape:connector-curvature="0" />
+ <text
+ xml:space="preserve"
+ style="font-size:40px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="368.57144"
+ y="225.21931"
+ id="text2995"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan2997"
+ x="368.57144"
+ y="225.21931" /></text>
+ <path
+ style="fill:#ffcb14;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+ d="m 355,322.36218 55,0 0,-45 -25,0 -5,-5 -20,0 -5,5 z"
+ id="path2989-4"
+ inkscape:connector-curvature="0" />
+ <path
+ style="fill:#ffcb14;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+ d="m 355,457.36218 55,0 0,-45 -25,0 -5,-5 -20,0 -5,5 z"
+ id="path2989-1"
+ inkscape:connector-curvature="0" />
+ <path
+ style="fill:#ffcb14;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+ d="m 355,597.36218 55,0 0,-45 -25,0 -5,-5 -20,0 -5,5 z"
+ id="path2989-5"
+ inkscape:connector-curvature="0" />
+ <path
+ style="opacity:0.48800001;fill:#ffcb14;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+ d="m 475,597.36218 55,0 0,-45 -25,0 -5,-5 -20,0 -5,5 z"
+ id="path2989-2"
+ inkscape:connector-curvature="0" />
+ <path
+ style="opacity:0.5;fill:#ffcb14;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+ d="m 235,597.36218 55,0 0,-45 -25,0 -5,-5 -20,0 -5,5 z"
+ id="path2989-8"
+ inkscape:connector-curvature="0" />
+ <text
+ xml:space="preserve"
+ style="font-size:40px;font-style:normal;font-weight:normal;text-align:center;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:middle;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="386.06738"
+ y="626.36218"
+ id="text3868"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan3870"
+ x="386.06738"
+ y="626.36218"
+ style="font-size:20px;text-align:center;text-anchor:middle">working clones</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:18px;font-style:normal;font-weight:normal;text-align:center;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:middle;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="524.37988"
+ y="437.36218"
+ id="text3874"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan3876"
+ x="524.37988"
+ y="437.36218"
+ style="font-size:20px;text-align:center;text-anchor:middle">repository</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;text-align:center;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:middle;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="525.35156"
+ y="304.36218"
+ id="text3878"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan3880"
+ x="525.35156"
+ y="304.36218"
+ style="font-size:20px;text-align:center;text-anchor:middle">srcdir</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;text-align:center;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:middle;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="525.1543"
+ y="165.36218"
+ id="text3882"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan3884"
+ x="525.1543"
+ y="165.36218"
+ style="font-size:20px;text-align:center;text-anchor:middle">destdir</tspan></text>
+ <g
+ id="g5440"
+ transform="translate(5,25.000003)">
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3886"
+ d="m 370,512.36218 c -5,-24.99999 -5,-44.99999 0,-70"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-start:none;marker-mid:none;marker-end:url(#Arrow2Lend)" />
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3888"
+ d="m 390,442.36218 c 5,25 5,45 0,70"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-end:url(#Arrow2Lend)" />
+ </g>
+ <g
+ transform="translate(5,-110)"
+ id="g5440-4">
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3886-8"
+ d="m 370,512.36218 c -5,-24.99999 -5,-44.99999 0,-70"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-start:none;marker-mid:none;marker-end:url(#Arrow2Lend)" />
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3888-9"
+ d="m 390,442.36218 c 5,25 5,45 0,70"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-end:url(#Arrow2Lend)" />
+ </g>
+ <g
+ transform="matrix(0.71872744,0.69529193,-0.69529193,0.71872744,353.78964,-104.94206)"
+ id="g5440-47">
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3886-3"
+ d="m 370,512.36218 c -5,-24.99999 -0.0778,-66.9912 7.34379,-88.08431"
+ style="opacity:0.5;fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-start:none;marker-mid:none;marker-end:url(#Arrow2Lend)" />
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3888-6"
+ d="m 391.48399,424.51223 c 5,25 6.0155,63.74804 -1.48399,87.84995"
+ style="opacity:0.5;fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-end:url(#Arrow2Lend)" />
+ </g>
+ <g
+ transform="matrix(-0.71872744,0.69529193,0.69529193,0.71872744,421.21036,-104.94206)"
+ id="g5440-47-9"
+ style="opacity:0.5">
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3886-3-3"
+ d="m 370,512.36218 c -5,-24.99999 -0.0778,-66.9912 7.34379,-88.08431"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-start:none;marker-mid:none;marker-end:url(#Arrow2Lend)" />
+ <path
+ sodipodi:nodetypes="cc"
+ inkscape:connector-curvature="0"
+ id="path3888-6-3"
+ d="m 391.48399,424.51223 c 5,25 6.0155,63.74804 -1.48399,87.84995"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-end:url(#Arrow2Lend)" />
+ </g>
+ <path
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-end:url(#marker5532)"
+ d="m 380,262.36218 0,-60"
+ id="path5558"
+ inkscape:connector-curvature="0" />
+ <g
+ id="g5810"
+ transform="translate(0,-9)">
+ <g
+ transform="translate(-230,-4.9999974)"
+ id="g3784-7">
+ <g
+ id="g3779-37">
+ <path
+ inkscape:connector-curvature="0"
+ id="path2993-5"
+ d="m 440,177.36218 10,0 0,-10"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ <path
+ sodipodi:nodetypes="cccccc"
+ inkscape:connector-curvature="0"
+ id="path2991-3"
+ d="m 440,177.36218 0,40 35,0 0,-50 -25,0 z"
+ style="fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ <path
+ inkscape:connector-curvature="0"
+ id="path3777-8"
+ d="m 440,177.36218 10,0 0,-10"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ </g>
+ </g>
+ <g
+ transform="translate(-235,-9.9999974)"
+ id="g3784">
+ <g
+ id="g3779">
+ <path
+ inkscape:connector-curvature="0"
+ id="path2993"
+ d="m 440,177.36218 10,0 0,-10"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ <path
+ sodipodi:nodetypes="cccccc"
+ inkscape:connector-curvature="0"
+ id="path2991"
+ d="m 440,177.36218 0,40 35,0 0,-50 -25,0 z"
+ style="fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ <path
+ inkscape:connector-curvature="0"
+ id="path3777"
+ d="m 440,177.36218 10,0 0,-10"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ </g>
+ </g>
+ <text
+ sodipodi:linespacing="125%"
+ id="text5762"
+ y="176.55017"
+ x="206.62401"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ xml:space="preserve"><tspan
+ style="font-size:8px"
+ y="176.55017"
+ x="206.62401"
+ id="tspan5764"
+ sodipodi:role="line"><html></tspan></text>
+ </g>
+ <g
+ id="g5824"
+ transform="translate(0,-9)">
+ <g
+ transform="translate(-165,-9.9999974)"
+ id="g3784-0">
+ <g
+ id="g3779-3">
+ <path
+ inkscape:connector-curvature="0"
+ id="path2993-2"
+ d="m 440,177.36218 10,0 0,-10"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ <path
+ sodipodi:nodetypes="cccccc"
+ inkscape:connector-curvature="0"
+ id="path2991-8"
+ d="m 440,177.36218 0,40 35,0 0,-50 -25,0 z"
+ style="fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ <path
+ inkscape:connector-curvature="0"
+ id="path3777-7"
+ d="m 440,177.36218 10,0 0,-10"
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" />
+ </g>
+ </g>
+ <g
+ transform="matrix(0.74161576,0,0,0.74161576,75.250882,53.354937)"
+ id="g5772">
+ <path
+ sodipodi:type="star"
+ style="fill:#939393;fill-opacity:1;stroke:#939393;stroke-width:0.70866144;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0"
+ id="path5768"
+ sodipodi:sides="13"
+ sodipodi:cx="295"
+ sodipodi:cy="187.36218"
+ sodipodi:r1="10.889445"
+ sodipodi:r2="14.142136"
+ sodipodi:arg1="-2.3561945"
+ sodipodi:arg2="-2.1145335"
+ inkscape:flatsided="false"
+ inkscape:rounded="0.36"
+ inkscape:randomized="0"
+ d="m 287.3,179.66218 c 1.12496,-1.12496 -0.97775,-3.57952 0.38374,-4.40257 1.36149,-0.82305 2.55772,2.1795 4.07662,1.70619 1.5189,-0.47331 0.79773,-3.62389 2.38576,-3.71995 1.58803,-0.0961 1.25188,3.11848 2.81676,3.40526 1.56487,0.28677 2.39046,-2.83808 3.84123,-2.18514 1.45078,0.65294 -0.34074,3.34306 0.91162,4.32422 1.25235,0.98116 3.43557,-1.40209 4.41673,-0.14973 0.98116,1.25236 -1.85532,2.80178 -1.20238,4.25255 0.65294,1.45078 3.69363,0.35511 3.98041,1.91998 0.28677,1.56488 -2.94485,1.61865 -3.04091,3.20668 -0.0961,1.58803 3.10552,2.03094 2.63221,3.54984 -0.47331,1.5189 -3.35976,0.0647 -4.18281,1.42619 -0.82305,1.3615 1.80598,3.24152 0.68102,4.36648 -1.12496,1.12496 -3.00498,-1.50407 -4.36648,-0.68101 -1.36149,0.82305 0.0927,3.7095 -1.42619,4.1828 -1.5189,0.47331 -1.96181,-2.72827 -3.54984,-2.63221 -1.58803,0.0961 -1.64181,3.32768 -3.20668,3.04091 -1.56488,-0.28678 -0.4692,-3.32746 -1.91998,-3.9804 -1.45077,-0.65294 -3.00019,2.18353 -4.25255,1.20237 -1.25236,-0.98116 1.13089,-3.16437 0.14973,-4.41673 -0.98116,-1.25236 -3.67128,0.53916 -4.32422,-0.91161 -0.65294,-1.45078 2.47191,-2.27636 2.18513,-3.84124 -0.28677,-1.56488 -3.50131,-1.22873 -3.40525,-2.81676 0.096,-1.58803 3.24664,-0.86686 3.71995,-2.38576 0.47331,-1.5189 -2.52925,-2.71513 -1.70619,-4.07662 0.82305,-1.36149 3.27761,0.74122 4.40257,-0.38374 z"
+ inkscape:transform-center-x="-0.68364368"
+ inkscape:transform-center-y="0.68364368"
+ transform="translate(-2,0)" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#ffffff;fill-opacity:1;stroke:#939393;stroke-width:0.70866144;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0"
+ id="path5770"
+ sodipodi:cx="295"
+ sodipodi:cy="187.36218"
+ sodipodi:rx="5"
+ sodipodi:ry="5"
+ d="m 300,187.36218 a 5,5 0 1 1 -10,0 5,5 0 1 1 10,0 z"
+ transform="matrix(1.4,0,0,1.4,-120,-74.944873)" />
+ </g>
+ </g>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="265"
+ y="211.36218"
+ id="text5806"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan5808"
+ x="265"
+ y="211.36218"
+ style="font-size:12px">ikiwiki.cgi</tspan></text>
+ <path
+ style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;marker-end:url(#marker5532)"
+ d="m 295,217.36218 c 10,40 25,65 55,85"
+ id="path5834"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="cc" />
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;text-align:end;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:end;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="351.31982"
+ y="362.36218"
+ id="text6240"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6242"
+ x="351.31982"
+ y="362.36218"
+ style="font-size:14px;text-align:end;writing-mode:lr-tb;text-anchor:end">post-update</tspan><tspan
+ sodipodi:role="line"
+ x="351.31982"
+ y="379.86218"
+ style="font-size:14px;text-align:end;writing-mode:lr-tb;text-anchor:end"
+ id="tspan6244">hook</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="420"
+ y="362.36218"
+ id="text6246"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6248"
+ x="420"
+ y="362.36218"
+ style="font-size:14px">ikiwiki.cgi</tspan><tspan
+ sodipodi:role="line"
+ x="420"
+ y="379.86218"
+ id="tspan6250"
+ style="font-size:14px">push</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="382"
+ y="316.36218"
+ id="text6252"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6254"
+ x="382"
+ y="316.36218">.git</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="383"
+ y="592.36218"
+ id="text6252-3"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6254-1"
+ x="383"
+ y="592.36218">.git</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;opacity:0.3;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="502"
+ y="591.36218"
+ id="text6252-3-1"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6254-1-0"
+ x="502"
+ y="591.36218">.git</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;opacity:0.3;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="263"
+ y="592.36218"
+ id="text6252-3-6"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6254-1-1"
+ x="263"
+ y="592.36218">.git</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="411"
+ y="456.36218"
+ id="text6252-3-0"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6254-1-2"
+ x="411"
+ y="456.36218">.git</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;text-align:end;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:end;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="300"
+ y="262.36218"
+ id="text6372"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6374"
+ x="300"
+ y="262.36218"
+ style="font-size:14px">web-side</tspan><tspan
+ sodipodi:role="line"
+ x="300"
+ y="279.86218"
+ id="tspan6376"
+ style="font-size:14px">edit</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="410"
+ y="232.36218"
+ id="text6378"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6380"
+ x="410"
+ y="232.36218"
+ style="font-size:14px">automatic</tspan><tspan
+ sodipodi:role="line"
+ x="410"
+ y="249.86218"
+ id="tspan6382"
+ style="font-size:14px">rebuild</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="406.75635"
+ y="501.15298"
+ id="text6384"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6386"
+ x="406.75635"
+ y="501.15298"
+ style="font-size:14px">git</tspan><tspan
+ sodipodi:role="line"
+ x="406.75635"
+ y="518.65295"
+ id="tspan6388"
+ style="font-size:14px">pull</tspan></text>
+ <text
+ xml:space="preserve"
+ style="font-size:16px;font-style:normal;font-weight:normal;text-align:end;line-height:125%;letter-spacing:0px;word-spacing:0px;text-anchor:end;fill:#000000;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans"
+ x="363.62955"
+ y="504.39691"
+ id="text6390"
+ sodipodi:linespacing="125%"><tspan
+ sodipodi:role="line"
+ id="tspan6392"
+ x="363.62955"
+ y="504.39691"
+ style="font-size:14px;text-align:end;text-anchor:end">git</tspan><tspan
+ sodipodi:role="line"
+ x="363.62955"
+ y="521.89691"
+ id="tspan6394"
+ style="font-size:14px;text-align:end;text-anchor:end">push</tspan></text>
+ </g>
+</svg>
# Sandbox
+[[!pagestats pages="/tags/*"]]
+
+[[!sidebar content="dfdsfsf""
+This is my custom sidebar for this page.
+
+\[[!calendar pages="posts/*"]]
+"""]]
+
+[[!sidebar ]]
+
+## number 2
+
This is the [[SandBox]], a page anyone can edit to try out ikiwiki
(version [[!version ]]).
[[!toc levels=1 startlevel=2 ]]
+Let's try this~!
+
+w00t, how does this look on the **git** end? Well, as a commit of course.
+
Testing this sandbox thing.
## Blockquotes
* Cool !
* Indeed.
+[[new link]]
----
_italic_
+Umcacaumca
### this shows a problem with the list and the verbatim
----
+Test some tags
+[[!tag tech life linux]]
+[[!taglink tech life linux]]
+
+Toggle:
+[[!toggle id="ipsum" text="show"]]
+[[!toggleable id="ipsum" text="""
+Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do
+eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim
+ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut
+aliquip ex ea commodo consequat.
+[[!toggle id="ipsum" text="hide"]]
+"""]]
----
-This **SandBox** is also a [[blog]]!
+This **SandBox** is also a [[blog]]! xxx
[[!inline pages="sandbox/* and !*/Discussion" rootpage="sandbox" show="4" archive="yes"]]a
+[[!format verilog """
+module vc_Mux2 #( parameter W = 1 )
+(
+ input [W-1:0] in0, in1,
+ input sel,
+ output reg [W-1:0] out
+);
+
+ always @(*)
+ begin
+ case ( sel )
+ 1'd0 : out = in0;
+ 1'd1 : out = in1;
+ default : out = {W{1'bx}};
+ endcase
+ end
+
+endmodule
+"""]]
--- /dev/null
+## 룰루랄라 잘되나 테스트
+
+### 두번째
+
+#### 세번째
+
+[[link test]]
+
+ code test
+ basic
+
+----
+
+몸에 좋고 맛도 좋은 소고기
test:)
+
+echo and bounce
* [[!shortcut name=archive url="http://web.archive.org/*/%S"]]
* [[!shortcut name=gmap url="http://maps.google.com/maps?q=%s"]]
* [[!shortcut name=gmsg url="http://groups.google.com/groups?selm=%s"]]
-* [[!shortcut name=wikipedia url="https://secure.wikimedia.org/wikipedia/en/wiki/%s"]]
+* [[!shortcut name=wikipedia url="https://en.wikimedia.org/wiki/%s"]]
* [[!shortcut name=wikitravel url="https://wikitravel.org/en/%s"]]
-* [[!shortcut name=wiktionary url="https://secure.wikimedia.org/wiktionary/en/wiki/%s"]]
+* [[!shortcut name=wiktionary url="https://en.wiktionary.org/wiki/%s"]]
* [[!shortcut name=debbug url="http://bugs.debian.org/%S" desc="Debian bug #%s"]]
* [[!shortcut name=deblist url="http://lists.debian.org/debian-%s" desc="debian-%s@lists.debian.org"]]
* [[!shortcut name=debpkg url="http://packages.debian.org/%s"]]
* [[!shortcut name=debpts url="http://packages.qa.debian.org/%s"]]
* [[!shortcut name=debmsg url="http://lists.debian.org/msgid-search/%s"]]
* [[!shortcut name=debrt url="https://rt.debian.org/Ticket/Display.html?id=%s"]]
-* [[!shortcut name=debss url="http://snapshot.debian.net/package/%s"]]
- * Usage: `\[[!debss package]]`, `\[[!debss package#version]]`, or `\[[!debss package/version]]`. See http://snapshot.debian.net for details.
+* [[!shortcut name=debss url="http://snapshot.debian.org/package/%s/"]]
+ * Usage: `\[[!debss package]]` or `\[[!debss package/version]]`. See <http://snapshot.debian.org/> for details.
* [[!shortcut name=debwiki url="http://wiki.debian.org/%s"]]
* [[!shortcut name=fdobug url="https://bugs.freedesktop.org/show_bug.cgi?id=%s" desc="freedesktop.org bug #%s"]]
* [[!shortcut name=fdolist url="http://lists.freedesktop.org/mailman/listinfo/%s" desc="%s@lists.freedesktop.org"]]
* [[!shortcut name=ohloh url="http://www.ohloh.net/projects/%s"]]
* [[!shortcut name=cpanrt url="https://rt.cpan.org/Ticket/Display.html?id=%s" desc="CPAN RT#%s"]]
* [[!shortcut name=novellbug url="https://bugzilla.novell.com/show_bug.cgi?id=%s" desc="bug %s"]]
+* [[!shortcut name=ubupkg url="http://packages.ubuntu.com/%s"]]
+* [[!shortcut name=mozillazinekb url="http://kb.mozillazine.org/%s"]]
+* [[!shortcut name=freebsdwiki url="http://wiki.freebsd.org/%s"]]
+* [[!shortcut name=hackage url="http://hackage.haskell.org/package/%s"]]
To add a new shortcut, use the `shortcut`
[[ikiwiki/directive]]. In the url, "%s" is replaced with the
height: 20px;
}
.fileupload-content .ui-progressbar-value {
- background: url(images/pbar-ani.gif);
+ background: url(ikiwiki/images/pbar-ani.gif);
+}
+
+.trail {
+ display: block;
+ clear: both;
+ position: relative;
+}
+
+.trailprev {
+ display: block;
+ text-align: left;
+ position: absolute;
+ top: 0%;
+ left: 3%;
+ width: 30%;
+}
+
+.trailup {
+ display: block;
+ text-align: center;
+ margin-left: 35%;
+ margin-right: 35%;
+}
+
+.trailnext {
+ display: block;
+ text-align: right;
+ position: absolute;
+ top: 0%;
+ width: 30%;
+ right: 3%;
+}
+
+.trailsep {
+ display: none;
}
* `autotag.tmpl` - Filled in by the tag plugin to make tag pages.
* `calendarmonth.tmpl`, `calendaryear.tmpl` - Used by ikiwiki-calendar to
make calendar archive pages.
+* `trails.tmpl` - Used by the trail plugin to generate links on each page
+ that is a member of a trail.
* `editpage.tmpl`, `editconflict.tmpl`, `editcreationconflict.tmpl`,
`editfailedsave.tmpl`, `editpagegone.tmpl`, `pocreatepage.tmpl`,
`editcomment.tmpl` `commentmoderation.tmpl`, `renamesummary.tmpl`,
<li>[[TipJar]]</li>
</ul>
<a href="http://flattr.com/thing/39811/ikiwiki">
-<img src="http://api.flattr.com/button/button-compact-static-100x17.png"
+<img src="http://api.flattr.com/button/flattr-badge-large.png"
alt="Flattr this" title="Flattr this" /></a>
</div>
...
</html>
-This script has not been extensively tested.
\ No newline at end of file
+This script has not been extensively tested.
+
+---
+
+A version that handles anchors:
+
+
+ function fixLinks() {
+ var scheme = location.protocol;
+ if (scheme != "file:") return;
+ var links = document.getElementsByTagName("a");
+ for (var i = links.length; --i >= 0; ) {
+ var link = links[i];
+ var href = link.href;
+ var anchor = "";
+ var anchorIndex = href.indexOf("#");
+ if (anchorIndex != -1) {
+ anchor = href.substring(anchorIndex);
+ href = href.substring(0, anchorIndex);
+ };
+ var hlen = href.length;
+ if (hlen > 0 && link.protocol==scheme && href.charAt(hlen-1) == "/")
+ links[i].href = href + "index.html" + anchor;
+ }
+ }
--- /dev/null
+To accomplish this on a blog setup, I ran:
+
+ mkdir ${SRCDIR}/templates
+ cp /usr/share/ikiwiki/templates/calendar* ${SRCDIR}/templates/
+ sed -i 's/^\(\[\[!calendar\)/\1 week_start_day="1"/' ${SRCDIR}/templates/calendar* ${SRCDIR}/sidebar.mdwn
+
+where `${SRCDIR}` was the source directory for the blog. This overrides the standard templates with ones that have the `week_start_day="1"` option added. If the upstream templates change, one has to manually update the locally overriding ones.
+
+I personally managed to forget about having to change also the initially auto-generated `sidebar.mdwn` page, which led to some brain activity for me.
+++ /dev/null
-If you want do a bunch of manual labor, this is good, but most people probably want to get ikiwiki via a package system. My Mac laptop's ikiwiki is installed from pkgsrc. --[[schmonz]]
+[[!toc]]
+
+# MacPorts
+
+The easiest way of installing ikiwiki on Mac OS X [Snow] Leopard and Tiger is via MacPorts: <http://www.macports.org/>
+
+This project ports Open Source software into Mac Os X platform.
+It's very easy to intall ikiwiki via MacPorts:
+
+1.- Donwnload and install MacPorts port manager from: <http://www.macports.org/install.php> .
+ Port manager installs via Mac Os X installer. Prerequisite: XCode.
+ Se above URL for details
+
+2.- Run
+
+ $ sudo port install ikiwiki
+
+This installs ikiwiki and all of its dependencies
+
+enjoy
+
+Enrique Castilla
+
+-----
+
+# pkgsrc
+
+The other easiest way of installing ikiwiki on Mac OS X is via
+[pkgsrc](http://www.pkgsrc.org/).
+
+7. Bootstrap pkgsrc
+7. Run `cd .../pkgsrc/www/ikiwiki && make install clean`
+
+-----
+
+# Manual install
+
These are some notes on installing ikiwiki on Mac OS X Snow Leopard. I have a three year old machine with a lot of stuff on it so it took quite a while, YMMV.
The best part of installing ikiwiki was learning how to use git. I never used source control before but its pretty slick.
I did a "find / -name "omega" -print" and found the omega program in "/usr/local/lib/xapian-omega/bin/omega".
Then I went into the 2wiki.setup file and replaced the bad path, updated and badda-boom badda-bing.
-
-
-
--- /dev/null
+It appears that this is no longer necessary with git_wrapper_background_command.
the ikiwiki web interface, rather than only with direct commit
access. --[[JoshTriplett]]
+Chrome and chromium have [Edit with
+Emacs](https://chrome.google.com/webstore/detail/ljobjlafonikaiipfkggjbhkghgicgoh)
+for those who use Emacs -- Rémi Vanicat
+
For Firefox or Iceweasel users, the vimperator extension is also a good
idea. You can press Ctrl-I in the insert mode of vimperator and switch to
an external editor, e.g. Vim. --[[WeakishJiang]]
1. First, make sure you have the [[!cpan YAML]] perl module installed.
(Run: `apt-get install libyaml-perl`)
-2. Run: `ikiwiki -setup my.setup -dumpsetup my.setup --set setuptype=Yaml`
+2. Run: `ikiwiki --setup my.setup --dumpsetup my.setup --set setuptype=Yaml`
The format of the YAML setup file should be fairly self-explanatory.
--- /dev/null
+When I added or edited a page, no commit message was written out (Mercurial backend, though I guess it shouldn't matter). This was done for e.g. the `rename` plugin. I made a naive but seemingly working change to `editpage.pm` to add a message.
+
+I modeled the message on `rename.pm`, which used a lowercase initial letter and imperative form of the verb. This is not the case for e.g. the `comment` plugin, which says "Added a comment: ", so I guess there is no strict rule on style in this case.
+
+Diff follows. --[[Daniel Andersson]]
+
+> This is somewhat intentional. It's pretty usual for changes to be made
+> to a wiki without bothering to say what changed; the change speaks for
+> itself and it would just be clutter to mention what file was changed,
+> since any reasonable interface will show the filename, or a link,
+> or some summary of what files were affected when showing a change.
+
+>> I use the Mercurial backend, and Mercurial doesn't allow empty commit messages, so if there were no message, it would default to "no message given" (hardcoded in `mercurial.pm`), which is also clutter, and non-descriptive at that. But I'm on board with your reasoning. It's a matter of taste (and somewhat backend), I guess. I might continue to locally use this patch (with the caveat below fixed when commit message is given), but I won't push for it to be included upstream. --[[Daniel Andersson]]
+
+>>> Hmm.. It would be possible to make the mercurial backend
+>>> include the filename (or just "added" or "edited") in the commit
+>>> message. It might take some work, especially to handle
+>>> `rcs_commit_staged`, since it would probably need to cache
+>>> what files have been staged for commit. --[[Joey]]
+
+> Also your patch stomps over any commit message that the user *does*
+> provide, so certianly cannot be applied as-is. --[[Joey]]
+
+>> Yes, "naive" was the word :-) . --[[Daniel Andersson]]
+
+[[!tag patch]]
+
+---
+
+ diff -r ee177ca9bf36 Plugin/editpage.pm
+ --- a/Plugin/editpage.pm Fri Jul 15 17:58:04 2011 +0200
+ +++ b/Plugin/editpage.pm Sat Jul 16 03:01:13 2011 +0200
+ @@ -405,6 +405,10 @@
+ if ($config{rcs}) {
+ if (! $exists) {
+ rcs_add($file);
+ + $message = "add $file";
+ + }
+ + else {
+ + $message = "edit $file";
+ }
+
+ # Prevent deadlock with post-commit hook by
--- /dev/null
+As [[Add instructive commit messages for add _47_ edit pages]], but for `remove.pm`.
+
+I use a `join()` since it at least looks like the plugin is able to remove several pages at once (`foreach` looping over file parameters), thus holding multiple entries in `@pages`. I haven't seen this happen, though.
+
+> I feel that anything that shows a change should show what files were
+> changed (at least as an easily accessible option), so mentioning
+> filenames in commits is almost always clutter.
+>
+> It could be argued that there should be no message at all here, unless
+> the user provides one (which they currently cannot), as is done when
+> adding files. But the entire removal of a page from a wiki is a fairly
+> unusual circumstance that is probably best highlighted as such in
+> recentchanges. --[[Joey]]
+
+Diff follows. --[[Daniel Andersson]]
+
+[[!tag patch]]
+
+---
+
+ diff -r 4f2ad3a5377e Plugin/remove.pm
+ --- a/Plugin/remove.pm Fri Jul 15 17:39:04 2011 +0200
+ +++ b/Plugin/remove.pm Sat Jul 16 03:20:35 2011 +0200
+ @@ -228,7 +228,7 @@
+ IkiWiki::rcs_remove($file);
+ }
+ IkiWiki::rcs_commit_staged(
+ - message => gettext("removed"),
+ + message => sprintf(gettext("remove %s"), join(', ', @files)),
+ session => $session,
+ );
+ IkiWiki::enable_commit_hook();
--- /dev/null
+Using the Mercurial backend, the lack of `rcs_commit_staged` is noticed
+frequently. I couldn't find any tries to update `mercurial.pm`, so not
+letting lack of Mercurial AND Perl knowledge bring me down, I copy-pasted
+from `git.pm` to mimic its behaviour from a Mercurial perspective. I hope
+it can be a foundation for development by those more proficient in
+ikiwiki's inner workings. I have doubts that I personally will be able to
+revise it more, based on my Perl skills.
+
+I've tested it briefly. `ikiwiki-calendar` and posting of comments now
+works with automatic commits, i.e. the `rcs_commit_staged` function works
+in those cases. Under my current setup, I don't know where else to expect
+it to work. I would be flabberghasted if there wasn't any problems with it,
+though.
+
+> Absolutely, the [[/rcs]] chart shows mercurial is lagging behind
+> nearly everything.
+>
+> I don't think this stuff is hard, or unlikely to work, familiarity with
+> the rcs's particular details is the main thing. --[[Joey]]
+
+Diff follows, for anyone to annotate. First code version is also available at [my hg-repo](http://510x.se/hg/program/ikiwiki/file/e741fcfd800f/Plugin/mercurial.pm). Latest version should be [here](http://46.239.104.5:81/hg/program/ikiwiki/file/tip/Plugin/mercurial.pm) ([raw format](http://46.239.104.5:81/hg/program/ikiwiki/raw-file/tip/Plugin/mercurial.pm)). I'll notify on this page with "*Done*" remarks when I've actually commited changes to my local repository. I don't know if I should replace the code and the comments below when I've changed something. I'll probably do this when the code feels more mature. --[[Daniel Andersson]]
+
+> I've looked over the current version and it looks ok to me. --[[Joey]]
+
+>> I changed the by `mercurial.pm` recorded commit messages and the `rcs_recentchanges` logic to include more information, to emulate the `git.pm` behaviour regarding name presentation on RecentChanges. I don't have anything more to add at the moment, so if the code passes review, I'm done, and I tag this page as "patch". [Final patch version as per this page at my hg repo](http://510x.se/hg/program/ikiwiki/file/bc0e2f838fe3/Plugin/mercurial.pm) ([raw format](http://46.239.104.5:81/hg/program/ikiwiki/raw-file/bc0e2f838fe3/Plugin/mercurial.pm)). I keep the below conversation for reference, but it's mostly outdated. --[[Daniel Andersson]]
+
+[[merged|done]] --[[Joey]]
+
+[[!tag patch]]
+
+***
+
+ diff -r 20c61288d7bd Plugin/mercurial.pm
+ --- a/Plugin/mercurial.pm Fri Jul 15 02:55:12 2011 +0200
+ +++ b/Plugin/mercurial.pm Fri Jul 15 03:29:10 2011 +0200
+ @@ -7,6 +7,8 @@
+ use Encode;
+ use open qw{:utf8 :std};
+
+ +my $hg_dir=undef;
+ +
+ sub import {
+ hook(type => "checkconfig", id => "mercurial", call => \&checkconfig);
+ hook(type => "getsetup", id => "mercurial", call => \&getsetup);
+
+A corresponding variable is declared for git. It is unused as of yet for
+Mercurial, but when more advanced merge features become available for
+`mercurial.pm`, I think it will come into play.
+
+> Maybe.. I'd rather avoid unused cruft though. --[[Joey]]
+
+>> OK, will be removed. *Done* --[[Daniel Andersson]]
+
+ @@ -69,6 +71,62 @@
+ },
+ }
+
+ +sub safe_hg (&@) {
+ + # Start a child process safely without resorting to /bin/sh.
+ + # Returns command output (in list content) or success state
+ + # (in scalar context), or runs the specified data handler.
+ +
+ + my ($error_handler, $data_handler, @cmdline) = @_;
+ +
+ + my $pid = open my $OUT, "-|";
+ +
+ + error("Cannot fork: $!") if !defined $pid;
+ +
+ + if (!$pid) {
+ + # In child.
+ + # hg commands want to be in wc.
+ + if (! defined $hg_dir) {
+ + chdir $config{srcdir}
+ + or error("cannot chdir to $config{srcdir}: $!");
+ + }
+ + else {
+ + chdir $hg_dir
+ + or error("cannot chdir to $hg_dir: $!");
+ + }
+
+> How can this possibly work, since `$hg_dir` is not set? The code
+> that is being replaced seems to use `-R` to make hg use the right
+> directory. If it worked for you without specifying the directory,
+> it's quite likely this is the place the patch fails in some
+> unusual circumstance.. but I think it could easily use `-R` here.
+
+>> It works since `if (! defined $hg_dir)` always hits, and `chdir $config{srcdir}` is well defined. The whole logic is just used in `git.pm` for merge functionality that is not present in `mercurial.pm`, so by the cruft argument above, this should be replaced with just chdir `$config{srcdir}` (which is equivalent to `hg -R` or `hg --cwd` from what I know). Will be removed. *Done* --[[Daniel Andersson]]
+
+ + exec @cmdline or error("Cannot exec '@cmdline': $!");
+ + }
+ + # In parent.
+ +
+ + # hg output is probably utf-8 encoded, but may contain
+ + # other encodings or invalidly encoded stuff. So do not rely
+ + # on the normal utf-8 IO layer, decode it by hand.
+ + binmode($OUT);
+
+> Is this actually true for hg?
+
+>> I don't know. ["hg stores everything internally as UTF-8, except for pathnames"](https://jira.atlassian.com/browse/FE-3198), but output is dependent on the system's locale. The environment variable `HGENCODING=utf-8` can be set to ensure that Mercurial's own output is always UTF-8, but when viewing a diff containing non-UTF-8 changes, the affected lines are nevertheless output in their original encoding. I personally think that this is the correct way to output it, though, unless there is a possibility that someone is running ikiwiki wih a non-UTF-8 locale.
+
+>>> *Done*. I removed the `encode_utf8()` part and instead set `HGENCODING=utf-8` where the external `hg` command was called. It seems to have taken care of "all" character encoding issues (but it is an almost infinite error pool to draw from, so some problem might pop up). --[[Daniel Andersson]]
+
+ + my @lines;
+ + while (<$OUT>) {
+ + $_=decode_utf8($_, 0);
+ +
+ + chomp;
+ +
+ + if (! defined $data_handler) {
+ + push @lines, $_;
+ + }
+ + else {
+ + last unless $data_handler->($_);
+ + }
+ + }
+ +
+ + close $OUT;
+ +
+ + $error_handler->("'@cmdline' failed: $!") if $? && $error_handler;
+ +
+ + return wantarray ? @lines : ($? == 0);
+ +}
+ +# Convenient wrappers.
+ +sub run_or_die ($@) { safe_hg(\&error, undef, @_) }
+ +sub run_or_cry ($@) { safe_hg(sub { warn @_ }, undef, @_) }
+ +sub run_or_non ($@) { safe_hg(undef, undef, @_) }
+ +
+ sub mercurial_log ($) {
+ my $out = shift;
+ my @infos;
+ @@ -116,10 +174,7 @@
+ }
+
+ sub rcs_update () {
+ - my @cmdline = ("hg", "-q", "-R", "$config{srcdir}", "update");
+ - if (system(@cmdline) != 0) {
+ - warn "'@cmdline' failed: $!";
+ - }
+ + run_or_cry('hg', '-q', 'update');
+ }
+
+ sub rcs_prepedit ($) {
+
+With the `run_or_{die,cry,non}()` functions defined as in `git.pm`, some old Mercurial functions can be rewritten more compactly.
+
+ @@ -129,6 +184,14 @@
+ sub rcs_commit (@) {
+ my %params=@_;
+
+ + return rcs_commit_helper(@_);
+ +}
+ +
+ +sub rcs_commit_helper (@) {
+ + my %params=@_;
+ +
+ + my %env=%ENV;
+
+> This `%env` stash is unused; `%ENV` is never modified.
+
+>> Yes, the code is missing setting the username at all. The local `hgrc` file is always used. I'll add setting of `$ENV{HGUSER}`. *Done* --[[Daniel Andersson]]
+
+ +
+ my $user="Anonymous";
+ if (defined $params{session}) {
+ if (defined $params{session}->param("name")) {
+
+Here comes the `rcs_commit{,_staged}` part. It is modeled on a `rcs_commit_helper` function, as in `git.pm`.
+
+Some old `mercurial.pm` logic concerning commiter name is kept instead of transplanting the more elaborate logic from `git.pm`. Maybe it is better to "steal" that as well.
+
+> Exactly how to encode the nickname from openid in the commit metadata,
+> and get it back out in `rcs_recentchanges`, would probably vary from git.
+
+>> Yes, right now the long and ugly OpenID strings, e.g. `https://www.google.com/accounts/o8/id?id=AItOawmUIes3yDLfQME0uvZvJKDN0NsdKPx_PTw`, gets recorded as author and are shown as `id [www.google.com/accounts/o8]` in RecentChanges. I see that here on `ikiwiki.info`, my commits, identified by OpenID, are shown as authored by simply `Daniel`. I'll look into it. --[[Daniel Andersson]]
+
+>>> I adapted some logic from `git.pm`. `hg` only has a single commiter name field, whereas `git` has both `GIT_AUTHOR_NAME` and `GIT_AUTHOR_EMAIL`. The behaviour can be emulated by encoding nick and commit medium into commiter name as "`https://www.google.com/accounts/o8/id?id=AItOawmUIes3yDLfQME0uvZvJKDN0NsdKPx_PTw <Daniel@web>`" and parsing this out as necessary when `rcs_recentchanges` is called. *Done* --[[Daniel Andersson]]
+
+ @@ -143,43 +206,45 @@
+ $params{message} = "no message given";
+ }
+
+ - my @cmdline = ("hg", "-q", "-R", $config{srcdir}, "commit",
+ - "-m", IkiWiki::possibly_foolish_untaint($params{message}),
+ - "-u", IkiWiki::possibly_foolish_untaint($user));
+ - if (system(@cmdline) != 0) {
+ - warn "'@cmdline' failed: $!";
+ + $params{message} = IkiWiki::possibly_foolish_untaint($params{message});
+ +
+ + my @opts;
+ +
+ + if (exists $params{file}) {
+ + push @opts, '--', $params{file};
+ }
+ -
+ + # hg commit returns non-zero if nothing really changed.
+ + # So we should ignore its exit status (hence run_or_non).
+ + run_or_non('hg', 'commit', '-m', $params{message}, '-q', @opts);
+ +
+ + %ENV=%env;
+ return undef; # success
+ }
+
+ sub rcs_commit_staged (@) {
+ # Commits all staged changes. Changes can be staged using rcs_add,
+ # rcs_remove, and rcs_rename.
+ - my %params=@_;
+ -
+ - error("rcs_commit_staged not implemented for mercurial"); # TODO
+ + return rcs_commit_helper(@_);
+ }
+
+ sub rcs_add ($) {
+ my ($file) = @_;
+
+ - my @cmdline = ("hg", "-q", "-R", "$config{srcdir}", "add", "$config{srcdir}/$file");
+ - if (system(@cmdline) != 0) {
+ - warn "'@cmdline' failed: $!";
+ - }
+ + run_or_cry('hg', 'add', $file);
+ }
+
+ sub rcs_remove ($) {
+ + # Remove file from archive.
+ +
+ my ($file) = @_;
+
+ - error("rcs_remove not implemented for mercurial"); # TODO
+ + run_or_cry('hg', 'remove', '-f', $file);
+ }
+
+ sub rcs_rename ($$) {
+ my ($src, $dest) = @_;
+
+ - error("rcs_rename not implemented for mercurial"); # TODO
+ + run_or_cry('hg', 'rename', '-f', $src, $dest);
+ }
+
+ sub rcs_recentchanges ($) {
+
+> Remainder seems ok to me. Should probably test that the remove plugin
+> works, since this implements `rcs_remove` too and you didn't mention
+> any tests that would run that code path. --[[Joey]]
+
+>> I tested `rename`. It fails if the page title includes e.g. åäö. Trying to rename a page from "title without special chars" to "title with åäö" renders in `/var/log/apache2/error.log`:
+
+ [Fri Jul 15 14:58:17 2011] [error] [client 46.239.104.5] transaction abort!, referer: http://46.239.104.5:81/blog/ikiwiki.cgi
+ [Fri Jul 15 14:58:17 2011] [error] [client 46.239.104.5] rollback completed, referer: http://46.239.104.5:81/blog/ikiwiki.cgi
+ [Fri Jul 15 14:58:17 2011] [error] [client 46.239.104.5] abort: decoding near 'itle_with_\xc3\xa5\xc3\xa4\xc3\xb6.mdw': 'ascii' codec can't decode byte 0xc3 in position 66: ordinal not in range(128)!, referer: http://46.239.104.5:81/blog/ikiwiki.cgi
+ [Fri Jul 15 14:58:17 2011] [error] [client 46.239.104.5] 'hg commit -m rename posts/title_without_special_chars.mdwn to posts/title_with_\xc3\xa5\xc3\xa4\xc3\xb6.mdwn -q' failed: at /usr/share/perl5/IkiWiki/Plugin/mercurial.pm line 123., referer: http://46.239.104.5:81/blog/ikiwiki.cgi
+
+>>> I added setting the environment variable `HGENCODING=utf-8` in `rcs_commit_helper`, which took care of these problems. *Done* --[[Daniel Andersson]]
+
+>> When this has happened, directly following by `rename` and `remove` doesn't work as it should, since the file is not commited. `hg remove -f` doesn't physically remove files that aren't tracked (no `hg` command does). Perhaps a regular `unlink $file` should be called to not clutter the source dir if `hg remove` failed because the file wasn't tracked. --[[Daniel Andersson]]
+
+>> I've also noted that when a post is added or removed, the commit message lacks the page title. It contains the title when the page is renamed though, so it should be an easy fix. I'll look into it. --[[Daniel Andersson]]
+
+>>> This is to do with `{rename,remove,editchanges}.pm`. The last two simply don't give a message to `rcs_commit_staged`. Separate issue. --[[Daniel Andersson]]
--- /dev/null
+Attempt to fix a `TODO` in `Automator.pm` in combination with the Mercurial backend.
+
+1. To define hooks, Mercurial uses paths given in the config file `.hg/hgrc`. To enable Mercurial to call `ikiwiki-wrapper` automatically after blog/wiki setup, ikiwiki thus needs to create `hgrc`.
+2. To reflect changes in `$config{srcdir}` and/or `$config{mercurial_wrapper}`, relevant lines in `hgrc` need to be updated on wrapper creation.
+
+ikiwiki can keep track of lines in `hgrc` for which it is responsible by adding a `.ikiwiki` suffix to its hooks. This is correct and recommended markup, Mercurial-wise.
+
+Two ways follow below. I prefer the long one. --[[Daniel Andersson]]
+
+> I comment myself: this can probably be solved without adding ad-hoc hooks and stuff (maybe not as "correct" as changing the config file only directly after wrappers have been generated, but good enough). I have a large rewrite of `mercurial.pm` ready, currently under local testing before I upload it for comments, trying to make it equal in function to `git.pm`. Comments below are of course welcome, but I will look into other ways of solving it later. Maybe `rcs_checkconfig` or `rcs_genwrapper` should host the `hgrc`-changing code. --[[Daniel Andersson]]
+
+>> Having a hook that runs after a wrapper is generated may well be a good
+>> thing anyway. In ikiwiki-hosting, there are some genwrapper hooks
+>> that don't add any code to the wrapper, but are there only to run at,
+>> essentially, that time.
+>>
+>> With that said, here it seems like unnecessary complexity.
+>> Why is `mercurial_wrapper` configurable at all? Why not just always
+>> write it to a specific place relative to the srcdir, and always make
+>> the hgrc look there?
+>>
+>> (Other rcs plugins have good reasons to make their wrappers
+>> configurable, because one might want the wrapper to run as a git
+>> post-update or post-commit hook.) --[[Joey]]
+
+Compact way (addresses only point 1)
+------------------------------------
+[This patch at pastebin](http://pastebin.com/by9f4dwX) ([raw version](http://pastebin.com/raw.php?i=by9f4dwX)).
+
+Set default `ikiwiki-wrapper` path.
+
+ diff -r 8faf136ca94f Setup/Automator.pm
+ --- a/Setup/Automator.pm Tue Jul 19 21:04:13 2011 +0200
+ +++ b/Setup/Automator.pm Wed Jul 20 15:33:21 2011 +0200
+ @@ -75,8 +75,7 @@
+ print STDERR "warning: do not know how to set up the bzr_wrapper hook!\n";
+ }
+ elsif ($config{rcs} eq 'mercurial') {
+ - # TODO
+ - print STDERR "warning: do not know how to set up the mercurial_wrapper hook!\n";
+ + $config{mercurial_wrapper}=$config{srcdir}."/.hg/ikiwiki-wrapper";
+ }
+ elsif ($config{rcs} eq 'tla') {
+ # TODO
+
+Create `$config{srcdir}/.hg/hgrc` with hook info during auto-installation script. Use relative paths to not require manual `hgrc` intervention if `$config{srcdir}` is changed. If `$config{mercurial_wrapper}` is changed, manual edit of `hgrc` is needed to catch the new wrapper path.
+
+(Is there a security risk with relative paths?)
+
+> The code seems to assume that hg will be run from within the srcdir,
+> specifically the top of the srcdir. If it's run from somewhere else,
+> even a subdirectory, this will fail to find the wrapper, or could
+> run some other program. Unless mercurial always interprets these paths
+> as relative to the top of the repository? --[[Joey]]
+
+ @@ -187,6 +186,22 @@
+ die "ikiwiki --wrappers --setup $config{dumpsetup} failed";
+ }
+
+ + # Setup initial config file for Mercurial to hook up the wrapper.
+ + if ($config{rcs} eq 'mercurial' && exists $config{mercurial_wrapper}
+ + && length $config{mercurial_wrapper}) {
+ + # Use a relative path to avoid having to manually change the
+ + # autogenerated hgrc if the user changes $config{srcdir}.
+ + use File::Spec;
+ + my $mercurial_wrapper_relpath=File::Spec->abs2rel($config{mercurial_wrapper}, $config{srcdir});
+ + open (HGRC, '>', $config{srcdir}.'/.hg/hgrc');
+ + print HGRC <<EOF;
+ +[hooks]
+ +post-commit.ikiwiki = $mercurial_wrapper_relpath
+ +incoming.ikiwiki = $mercurial_wrapper_relpath
+ +EOF
+ + close (HGRC);
+ + }
+ +
+ # Add it to the wikilist.
+ mkpath("$ENV{HOME}/.ikiwiki");
+ open (WIKILIST, ">>$ENV{HOME}/.ikiwiki/wikilist") || die "$ENV{HOME}/.ikiwiki/wikilist: $!";
+
+
+Less compact but more robust way (addresses point 1 and 2)
+----------------------------------------------------------
+[This complete patch at pastebin](http://pastebin.com/AcDHjbK6) ([raw version](http://pastebin.com/raw.php?i=AcDHjbK6)).
+
+This way leaks onto additional files and adds general functionality that may or may not be wanted. The main part of the extra code is contained within `mercurial.pm`, though.
+
+Set default `ikiwiki-wrapper` path.
+
+ diff -r b08179653c00 IkiWiki/Setup/Automator.pm
+ --- a/IkiWiki/Setup/Automator.pm Wed Jul 20 16:56:09 2011 +0200
+ +++ b/IkiWiki/Setup/Automator.pm Wed Jul 20 19:28:21 2011 +0200
+ @@ -75,8 +75,7 @@
+ print STDERR "warning: do not know how to set up the bzr_wrapper hook!\n";
+ }
+ elsif ($config{rcs} eq 'mercurial') {
+ - # TODO
+ - print STDERR "warning: do not know how to set up the mercurial_wrapper hook!\n";
+ + $config{mercurial_wrapper}=$config{srcdir}."/.hg/ikiwiki-wrapper";
+ }
+ elsif ($config{rcs} eq 'tla') {
+ # TODO
+
+Create `$config{srcdir}/.hg/hgrc` during auto-installation with hook info.
+
+ @@ -182,6 +181,19 @@
+ }
+ }
+
+ + # Setup initial config file for Mercurial to hook up the wrapper. The
+ + # path to the wrapper will be automatically added when it is generated.
+ + if ($config{rcs} eq 'mercurial' && exists $config{mercurial_wrapper}
+ + && length $config{mercurial_wrapper}) {
+ + open (HGRC, '>', $config{srcdir}.'/.hg/hgrc');
+ + print HGRC <<EOF;
+ +[hooks]
+ +post-commit.ikiwiki =
+ +incoming.ikiwiki =
+ +EOF
+ + close (HGRC);
+ + }
+ +
+ # Add wrappers, make live.
+ if (system("ikiwiki", "--wrappers", "--setup", $config{dumpsetup}) != 0) {
+ die "ikiwiki --wrappers --setup $config{dumpsetup} failed";
+
+`hgrc` is setup initially. Below follows code to keep `hgrc` updated.
+
+Add backend specific function `rcs_wrapper_postcall()` for later call in `Wrappers.pm`.
+
+ diff -r b08179653c00 IkiWiki/Plugin/mercurial.pm
+ --- a/IkiWiki/Plugin/mercurial.pm Wed Jul 20 16:56:09 2011 +0200
+ +++ b/IkiWiki/Plugin/mercurial.pm Wed Jul 20 19:28:21 2011 +0200
+ @@ -21,6 +21,7 @@
+ hook(type => "rcs", id => "rcs_diff", call => \&rcs_diff);
+ hook(type => "rcs", id => "rcs_getctime", call => \&rcs_getctime);
+ hook(type => "rcs", id => "rcs_getmtime", call => \&rcs_getmtime);
+ + hook(type => "rcs", id => "rcs_wrapper_postcall", call => \&rcs_wrapper_postcall);
+ }
+
+ sub checkconfig () {
+
+Pass variable to `gen_wrapper()` to decide if `rcs_wrapper_postcall()` should run. Default is `1` to update `hgrc`, since it is done non-intrusive (won't create `hgrc` if it doesn't exist, won't overwrite anything unless it is set by ikiwiki itself).
+
+ @@ -28,6 +29,7 @@
+ push @{$config{wrappers}}, {
+ wrapper => $config{mercurial_wrapper},
+ wrappermode => (defined $config{mercurial_wrappermode} ? $config{mercurial_wrappermode} : "06755"),
+ + wrapper_postcall => (defined $config{mercurial_wrapper_hgrc_update} ? $config{mercurial_wrapper_hgrc_update} : "1"),
+ };
+ }
+ }
+
+Include default configuration value and comment.
+
+ @@ -53,6 +55,13 @@
+ safe => 0,
+ rebuild => 0,
+ },
+ + mercurial_wrapper_hgrc_update => {
+ + type => "string",
+ + example => "1",
+ + description => "updates existing hgrc to reflect path changes for mercurial_wrapper",
+ + safe => 0,
+ + rebuild => 0,
+ + },
+ historyurl => {
+ type => "string",
+ example => "http://example.com:8000/log/tip/\[[file]]",
+
+`hgrc` should be updated to point to the new wrapper path. The regexp transforms lines as e.g.
+
+ post-commit.ikiwiki = /home/daniel/blog/.hg/ikiwiki-wrapper-oldpath
+ incoming.ikiwiki = /home/daniel/blog/.hg/ikiwiki-wrapper-oldpath
+
+to
+
+ post-commit.ikiwiki = $config{mercurial_wrapper}
+ incoming.ikiwiki = $config{mercurial_wrapper}
+
+with absolute paths.
+
+ @@ -402,4 +411,23 @@
+ return findtimes($file, 0);
+ }
+
+ +sub rcs_wrapper_postcall($) {
+ + # Update hgrc if it exists. Change post-commit/incoming hooks with the
+ + # .ikiwiki suffix to point to the wrapper path given in the setup file.
+ + # Work with a tempfile to not delete hgrc if the loop is interrupted
+ + # midway.
+ + my $hgrc=$config{srcdir}.'/.hg/hgrc';
+ + my $backup_suffix='.ikiwiki.bak';
+ + if (-e $hgrc) {
+ + use File::Spec;
+ + my $mercurial_wrapper_abspath=File::Spec->rel2abs($config{mercurial_wrapper}, $config{srcdir});
+ + local ($^I, @ARGV)=($backup_suffix, $hgrc);
+ + while (<>) {
+ + s/^(post-commit|incoming)(\.ikiwiki[ \t]*=[ \t]*).*$/$1$2$mercurial_wrapper_abspath/;
+ + print;
+ + }
+ + unlink($hgrc.$backup_suffix);
+ + }
+ +}
+ +
+ 1
+
+`rcs_wrapper_postcall` is made available.
+
+ diff -r b08179653c00 IkiWiki.pm
+ --- a/IkiWiki.pm Wed Jul 20 16:56:09 2011 +0200
+ +++ b/IkiWiki.pm Wed Jul 20 19:28:21 2011 +0200
+ @@ -2059,6 +2059,10 @@
+ $hooks{rcs}{rcs_getmtime}{call}->(@_);
+ }
+
+ +sub rcs_wrapper_postcall (@) {
+ + $hooks{rcs}{rcs_wrapper_postcall}{call}->(@_);
+ +}
+ +
+ sub rcs_receive () {
+ $hooks{rcs}{rcs_receive}{call}->();
+ }
+
+
+`rcs_wrapper_postcall` is called if $config{wrapper_postcall} is true, which it should only be for Mercurial at the moment.
+
+ diff -r b08179653c00 IkiWiki/Wrapper.pm
+ --- a/IkiWiki/Wrapper.pm Wed Jul 20 16:56:09 2011 +0200
+ +++ b/IkiWiki/Wrapper.pm Wed Jul 20 19:28:21 2011 +0200
+ @@ -238,6 +238,10 @@
+ }
+ #translators: The parameter is a filename.
+ debug(sprintf(gettext("successfully generated %s"), $wrapper));
+ +
+ + if (defined $config{wrapper_postcall} && $config{wrapper_postcall} ) {
+ + IkiWiki::rcs_wrapper_postcall();
+ + }
+ }
+
+ 1
--- /dev/null
+I think that the auto-generated setup files generated by /etc/ikiwiki/*.setup should be created in the new YAML format.
+
+> Ah, I missed that. [[done]] --[[Joey]]
--[[JoshTriplett]]
+> There is such a plugin at [[plugins/contrib/bibtex|plugins/contrib/bibtex]]. --[[MatthiasIhrke]]
+
I work on a plugin to htmlize '.bib' files.
-A sample result is shown on my webpage : <http://alexandre.dupas.free.fr/code/pub/>.
+A sample result is shown on my webpage : <http://www.adupas.org/research/publications/>.
It features the htmlization of the bibtex with 4 types of entry supported (InProceedings, Article, MastersThesis and PhdThesis). I will add the book entry support soon. It creates for each '.bib' file an html version, and for each entry a specific page with abstract as well as an individual bib file. It lack some features like the possibility to have a pdf or ps version of the article attached.
Is it possible to create several wiki page from only one source file?
-The source of this plugin could be found on this page : <http://alexandre.dupas.free.fr/code/ikiwiki/> .
+The source of this plugin could be found on this page : <http://www.adupas.org/software/ikiwiki/> .
Feel free to propose any modifications to enhance this plugin.
--- /dev/null
+I submitted some changes that added 5 "Yes"es and 2 "Fast"s to Mercurial at [[/rcs]], but some functionality is still missing as compared to e.g. `git.pm`, with which it should be able to be equivalent.
+
+To do this, a more basic rewrite would simplify things. I inline the complete file below with comments. I don't expect anyone to take the time to read it all at once, but I'd be glad if those interested in the Mercurial backend could do some beta testing.
+
+* [This specific revision at my hg repo](http://46.239.104.5:81/hg/program/ikiwiki/file/4994ba5e36fa/Plugin/mercurial.pm) ([raw version](http://46.239.104.5:81/hg/program/ikiwiki/raw-file/4994ba5e36fa/Plugin/mercurial.pm)).
+
+* [My default branch](http://510x.se/hg/program/ikiwiki/file/default/Plugin/mercurial.pm) (where updates will be made, will mention here if anything happens) ([raw version](http://510x.se/hg/program/ikiwiki/raw-file/default/Plugin/mercurial.pm)).
+
+(I've stripped the `hgrc`-generation from the linked versions, so it should work to just drop them on top of the old `mercurial.pm`).
+
+I break out my comments from the code to make them more readable. I comment all the changes as compared to current upstream. --[[Daniel Andersson]]
+
+> So, sorry it took me so long (summer vacation), but I've finally
+> gotten around to looking at this. Based mostly just on the comments,
+> it does not seem mergeable as-is, yet. Red flags for me include:
+>
+> * This is a big rewrite, and the main idea seems to be to copy git.pm
+> and hack on it until it works, which I think is unlikely to be ideal
+> as git and mercurial are not really similar at the level used here.
+> * There have been no changes in your hg repo to the code since you
+> originally committed it. Either it's perfect, or it's not been tested..
+> * `hg_local_dirstate_shelve` writes to a temp file in the srcdir,
+> which is hardly clean or ideal.
+> * Relies on mercurial bookmarks extension that seems to need to be
+> turned on (how?)
+> * There are some places where code was taken from git.pm and the
+> comment asks if it even makes sense for mercurial, which obviously
+> would need to be cleaned up.
+> * The `rcs_receive` support especially is very ambitious to try to add to
+> the mercurial code. Does mercurial support anonymous pushes at all? How
+> would ikiwiki be run to handle such a push? How would it tell
+> mercurial not to accept a push if it made prohibited changes?
+>
+> I'm glad we already got so many standalone improvements into
+> mercurial.pm. That's a better approach than rewriting the world, unless
+> the world is badly broken.
+>
+> --[[Joey]]
+
+---
+
+ #!/usr/bin/perl
+ package IkiWiki::Plugin::mercurial;
+
+ use warnings;
+ use strict;
+ use IkiWiki;
+ use Encode;
+ use open qw{:utf8 :std};
+
+
+Pattern to validate hg sha1 sums. hg usually truncates the hash to 12
+characters and prepends a local revision number for output, but internally
+it keeps a 40 character hash. Will use the long version in this code.
+
+ my $sha1_pattern = qr/[0-9a-fA-F]{40}/;
+
+Message to skip in recent changes
+
+ my $dummy_commit_msg = 'dummy commit';
+
+*TODO:* `$hg_dir` not really implemented yet, until a srcdir/repository distinction is
+made as for e.g. Git. Used in `rcs_receive`, and for attachments in `hg_parse_changes`. See comments in those places, though.
+
+ my $hg_dir=undef;
+
+ sub import {
+ hook(type => "checkconfig", id => "mercurial", call => \&checkconfig);
+ hook(type => "getsetup", id => "mercurial", call => \&getsetup);
+ hook(type => "rcs", id => "rcs_update", call => \&rcs_update);
+ hook(type => "rcs", id => "rcs_prepedit", call => \&rcs_prepedit);
+ hook(type => "rcs", id => "rcs_commit", call => \&rcs_commit);
+ hook(type => "rcs", id => "rcs_commit_staged", call => \&rcs_commit_staged);
+ hook(type => "rcs", id => "rcs_add", call => \&rcs_add);
+ hook(type => "rcs", id => "rcs_remove", call => \&rcs_remove);
+ hook(type => "rcs", id => "rcs_rename", call => \&rcs_rename);
+ hook(type => "rcs", id => "rcs_recentchanges", call => \&rcs_recentchanges);
+ hook(type => "rcs", id => "rcs_diff", call => \&rcs_diff);
+ hook(type => "rcs", id => "rcs_getctime", call => \&rcs_getctime);
+ hook(type => "rcs", id => "rcs_getmtime", call => \&rcs_getmtime);
+ hook(type => "rcs", id => "rcs_preprevert", call => \&rcs_preprevert);
+ hook(type => "rcs", id => "rcs_revert", call => \&rcs_revert);
+
+This last hook is "unsanctioned" from [[Auto-setup and maintain Mercurial wrapper hooks]]. Will try to solve its function
+another way later.
+
+ hook(type => "rcs", id => "rcs_wrapper_postcall", call => \&rcs_wrapper_postcall);
+ }
+
+ sub checkconfig () {
+ if (exists $config{mercurial_wrapper} && length $config{mercurial_wrapper}) {
+ push @{$config{wrappers}}, {
+ wrapper => $config{mercurial_wrapper},
+ wrappermode => (defined $config{mercurial_wrappermode} ? $config{mercurial_wrappermode} : "06755"),
+
+Next line part of [[Auto-setup and maintain Mercurial wrapper hooks]].
+
+ wrapper_postcall => (defined $config{mercurial_wrapper_hgrc_update} ? $config{mercurial_wrapper_hgrc_update} : "1"),
+ };
+ }
+ }
+
+ sub getsetup () {
+ return
+ plugin => {
+ safe => 0, # rcs plugin
+ rebuild => undef,
+ section => "rcs",
+ },
+ mercurial_wrapper => {
+ type => "string",
+ #example => # FIXME add example
+ description => "mercurial post-commit hook to generate",
+ safe => 0, # file
+ rebuild => 0,
+ },
+ mercurial_wrappermode => {
+ type => "string",
+ example => '06755',
+ description => "mode for mercurial_wrapper (can safely be made suid)",
+ safe => 0,
+ rebuild => 0,
+ },
+ mercurial_wrapper_hgrc_update => {
+ type => "string",
+ example => "1",
+ description => "updates existing hgrc to reflect path changes for mercurial_wrapper",
+ safe => 0,
+ rebuild => 0,
+ },
+ historyurl => {
+ type => "string",
+ example => "http://example.com:8000/log/tip/\[[file]]",
+ description => "url to hg serve'd repository, to show file history (\[[file]] substituted)",
+ safe => 1,
+ rebuild => 1,
+ },
+ diffurl => {
+ type => "string",
+ example => "http://localhost:8000/?fd=\[[r2]];file=\[[file]]",
+ description => "url to hg serve'd repository, to show diff (\[[file]] and \[[r2]] substituted)",
+ safe => 1,
+ rebuild => 1,
+ },
+ }
+
+ sub safe_hg (&@) {
+ # Start a child process safely without resorting to /bin/sh.
+ # Returns command output (in list content) or success state
+ # (in scalar context), or runs the specified data handler.
+
+ my ($error_handler, $data_handler, @cmdline) = @_;
+
+ my $pid = open my $OUT, "-|";
+
+ error("Cannot fork: $!") if !defined $pid;
+
+ if (!$pid) {
+ # In child.
+ # hg commands want to be in wc.
+
+This `$hg_dir` logic means nothing and could be stripped until srcdir/repdir distinction is made (it's stripped in upstream `mercurial.pm` right now).
+
+ if (! defined $hg_dir) {
+ chdir $config{srcdir}
+ or error("cannot chdir to $config{srcdir}: $!");
+ }
+ else {
+ chdir $hg_dir or error("cannot chdir to $hg_dir: $!");
+ }
+
+ exec @cmdline or error("Cannot exec '@cmdline': $!");
+ }
+ # In parent.
+
+ my @lines;
+ while (<$OUT>) {
+ chomp;
+
+ if (! defined $data_handler) {
+ push @lines, $_;
+ }
+ else {
+ last unless $data_handler->($_);
+ }
+ }
+
+ close $OUT;
+
+ $error_handler->("'@cmdline' failed: $!") if $? && $error_handler;
+
+ return wantarray ? @lines : ($? == 0);
+ }
+ # Convenient wrappers.
+ sub run_or_die ($@) { safe_hg(\&error, undef, @_) }
+ sub run_or_cry ($@) { safe_hg(sub { warn @_ }, undef, @_) }
+ sub run_or_non ($@) { safe_hg(undef, undef, @_) }
+
+
+To handle uncommited local changes ("ULC"s for short), I use logic similar to the (non-standard) "shelve" extension to Mercurial. By taking a diff before resetting to last commit, making changes and then applying diff again, one can do things Mercurial otherwise refuses, which is necessary later.
+
+This function creates this diff.
+
+ sub hg_local_dirstate_shelve ($) {
+ # Creates a diff snapshot of uncommited changes existing the srcdir.
+ # Takes a string (preferably revision) as input to create a unique and
+ # identifiable diff name.
+ my $tempdiffname = "diff_".shift;
+ my $tempdiffpath;
+ if (my @tempdiff = run_or_die('hg', 'diff', '-g')) {
+ $"="\n";
+ writefile($tempdiffname, $config{srcdir},
+ "@tempdiff");
+ $"=" ";
+ $tempdiffpath = $config{srcdir}.'/'.$tempdiffname;
+ }
+ return $tempdiffpath;
+ }
+
+This function restores the diff.
+
+ sub hg_local_dirstate_unshelve ($) {
+ # Applies diff snapshot to revert back to initial dir state. If diff
+ # revert succeeds, the diff is removed. Otherwise it stays to not
+ # eradicate the local changes if they were important. This clutters the
+ # directory though. Better ways to handle this are welcome. A true way
+ # around this dance is to have a separate repository for local changes
+ # and push ready commits to the srcdir instead.
+ if (my $tempdiffpath = shift) {
+ if (run_or_cry('hg', 'import', '--no-commit', $tempdiffpath)) {
+ unlink($tempdiffpath);
+ return undef;
+ }
+ }
+ }
+
+This makes online diffing possible. A similar approach as in `git.pm`, which is [discussed to some length in a comment there](http://source.ikiwiki.branchable.com/?p=source.git;a=blob;f=IkiWiki/Plugin/git.pm;h=cf7fbe9b7c43ee53180612d0411e6202074fb9e0;hb=refs/heads/master#l211), is taken.
+
+ sub merge_past ($$$) {
+ my ($sha1, $file, $message) = @_;
+
+ # Undo stack for cleanup in case of an error
+ my @undo;
+ # File content with conflict markers
+ my $conflict;
+ my $tempdiffpath;
+
+ eval {
+ # Hide local changes from Mercurial by renaming the modified
+ # file. Relative paths must be converted to absolute for
+ # renaming.
+ my ($target, $hidden) = (
+ "$config{srcdir}/${file}",
+ "$config{srcdir}/${file}.${sha1}"
+ );
+ rename($target, $hidden)
+ or error("rename '$target' to '$hidden' failed: $!");
+ # Ensure to restore the renamed file on error.
+ push @undo, sub {
+ return if ! -e "$hidden"; # already renamed
+ rename($hidden, $target)
+ or warn "rename '$hidden' to '$target' failed: $!";
+ };
+
+
+Take a snapshot of srcdir to be able to restore uncommited local changes ("ULCs") afterwards.
+
+* This must happen _after_ the merging commit in Mercurial, there is no way around it. By design hg refuses to commit merges if there are other changes to tracked content present, no matter how much you beg.
+
+* ULCs to the file being edited are special: they can't be diffed here since `editpage.pm` already has overwritten the file. When the web edit session started though, the ULC version (not the commited
+version) was read into the form, so in a way, the web user _has already merged_ with the ULC. It is not saved in commit history, but that is the exact consequence of "uncommited" changes. If an ULC is done between the time the web edit started and was submitted, then it is lost, though. All in all, one shouldn't be editing the srcdir directly when web edits of the same file are allowed. Clone the repo and push changes instead.
+
+Much of these issues disappear, I believe, if one works with a master repo which only is pushed to.
+
+ my $tempdiffpath = hg_local_dirstate_shelve($sha1);
+
+ # Ensure uniqueness of bookmarks.
+ my $bookmark_upstream_head = "current_head_$sha1";
+ my $bookmark_edit_base = "edit_base_$sha1";
+
+ # Git and Mercurial differ in the branch concept. Mercurial's
+ # "bookmarks" are closer in function in this regard.
+
+Bookmarks aren't standard until Mercurial 1.8 ([2011--02--10](http://selenic.com/hg/rev/d4ab9486e514)), but they've been bundled with Mercurial since ~2008, so they can be enabled by writing a `hgrc`, which is also being worked on.
+
+ # Create a bookmark at current tip.
+ push @undo, sub { run_or_cry('hg', 'bookmark', '--delete',
+ $bookmark_upstream_head) };
+ run_or_die('hg', 'bookmark', $bookmark_upstream_head);
+
+ # Create a bookmark at the revision from which the edit was
+ # started and switch to it, discarding changes (they are stored
+ # in $tempdiff and the hidden file at the moment).
+ push @undo, sub { run_or_cry('hg', 'bookmark', '--delete',
+ $bookmark_edit_base) };
+ run_or_die('hg', 'bookmark', '-r', $sha1, $bookmark_edit_base);
+ run_or_die('hg', 'update', ,'-C', $bookmark_edit_base);
+
+ # Reveal the modified file.
+ rename($hidden, $target)
+ or error("rename '$hidden' to '$target' failed: $!");
+
+ # Commit at the bookmarked revision, creating a new head.
+ run_or_cry('hg', 'commit', '-m', $message);
+
+ # Attempt to merge the newly created head with upstream head.
+ # '--tool internal:merge' to avoid spawning a GUI merger.
+
+(*Semi-TODO:* How do you make this command quiet? On failed merge, it
+always writes to STDERR and clutters the web server log.)
+
+ if (!run_or_non('hg', 'merge', '--tool', 'internal:merge',
+ $bookmark_upstream_head)) {
+ # ..., otherwise return file with conflict markers.
+ $conflict = readfile($target);
+
+ # The hardcore reset approach. Keep your hands inside
+ # the cart.
+ run_or_die('hg', 'rollback');
+ run_or_die('hg', 'update', '-C',
+ $bookmark_upstream_head);
+ if ($tempdiffpath) {
+ hg_local_dirstate_unshelve($tempdiffpath);
+ }
+
+Other approaches tried here:
+
+1. Clean up merge attempt,
+
+ run_or_die('hg', 'update', '-C', $bookmark_upstream_head);
+
+2. Redo "merge", using only upstream head versions,
+
+ run_or_die('hg', 'merge', '--tool', 'internal:local', $bookmark_edit_base);
+
+3. dummy commit to close head.
+
+ run_or_non('hg', 'commit', '-m', $message);
+
+This creates a cluttered and erroneous history. We
+tell Mercurial to merge, even though we in practice
+discard. This creates problems when trying to revert
+changes.
+
+Other attempt:
+
+1. Discard merge attempt and switch to temp head,
+
+ run_or_die('hg', 'update', '-C', $bookmark_edit_base);
+
+2. close the temp head (why do they call the command that in practice closes heads "--close-branch"?),
+
+ run_or_non('hg', 'commit', '--close-branch', '-m', $message);
+
+3. restore working directory to pre-fiddling status.
+
+ run_or_die('hg', 'update', $bookmark_upstream_head);
+
+...but this requires the same amount of forks as the
+above method, and confuses other parts of ikiwiki
+since the upstream head is now the third newest
+revision. Maybe that particular problem is solvable
+by setting a global default bookmark that follows the
+main tip. It will leave clutter in the revision
+history, though. Two extra commits that in practice
+don't hold relevant information will be recorded for
+each failed merge attempt.
+
+To only create one extra commit, one could imagine
+adding `--close-branch` to the commit that initially
+created the new head (since there is no problem
+merging with closed heads), but it's not possible to
+close and create a head at the same time, apparently.
+
+ }
+ };
+ my $failure = $@;
+
+ # Process undo stack (in reverse order). By policy, cleanup actions
+ # should normally print a warning on failure.
+ while (my $handle = pop @undo) {
+ $handle->();
+ }
+
+ error("Mercurial merge failed!\n$failure\n") if $failure;
+
+ return ($conflict, $tempdiffpath);
+ }
+
+ sub hg_commit_info ($;$;$) {
+ # Return an array of commit info hashes of num commits starting from
+ # the given sha1sum.
+ #
+This could be optimized by using a lookup cache similar to
+`findtimes()`. By adding `KeyAttr => ['node']` to `XMLin()` options, one
+could use the revision ID as key and do a single massive history
+lookup and later just check if the given revision already exists as a
+key. Right now I'm at the "don't optimize it yet" stage, though.
+
+This uses Mercurial's built-in `--style xml` and parses it with `XML::Simple`. Mercurial's log output is otherwise somewhat cumbersome to get good stuff out of, so this XML solution is quite good, I think. It adds module dependency, but XML::Simple seems fairly standard (but what do I know, I've used 1 Perl installation in my life).
+
+ use XML::Simple;
+ use Date::Parse;
+
+ my ($sha1, $num, $file) = @_;
+
+ my @opts;
+ if (defined $sha1) {
+ if ($sha1 =~ m/^($sha1_pattern)$/) {
+ push @opts, ('-r'. $1.':0');
+ }
+ elsif ($sha1 =~ m/^($sha1_pattern):($sha1_pattern)$/) {
+ push @opts, ('-r', $1.':'.$2);
+ }
+ }
+ push @opts, ('--limit', $num) if defined $num;
+ push @opts, ('--', $file) if defined $file;
+
+ my %env=%ENV;
+ $ENV{HGENCODING} = 'utf-8';
+ my @xml = run_or_cry('hg', 'log', '-v', '--style', 'xml', @opts);
+ %ENV=%env;
+
+ # hg returns empty string if file is not in repository.
+ return undef if !@xml;
+
+Some places it is clear that I'm coding ad-hoc Perl. I don't know if this is a reasonably efficient way to give input to `XMLin`, but it works.
+
+ # Want to preserve linebreaks in multiline comments.
+ $"="\n";
+ my $xmllog = XMLin("@xml",
+ ForceArray => ['logentry', 'parent', 'copy', 'path']);
+ $"=" ";
+
+ my @c_infos;
+ foreach my $rev (@{$xmllog->{logentry}}) {
+ my %c_info;
+ # In Mercurial, "rev" is technically the strictly local
+ # revision number. What ikiwiki wants is what is called
+ # "node": a globally defined SHA1 checksum.
+ $c_info{rev} = $rev->{node};
+ foreach my $parent (@{$rev->{parent}}) {
+ push @{$c_info{parents}}, {rev => $parent->{node}};
+ }
+ $c_info{user} = $rev->{author}{content};
+ # Mercurial itself parses out and stores an email address if
+ # present in author name. If not, hg sets email to author name.
+ if ( $rev->{author}{content} ne $rev->{author}{email} &&
+ $rev->{author}{email} =~ m/^([^\@]+)\@(.*)$/ ) {
+ if ($2 eq "web") {
+ $c_info{nickname} = $1;
+ $c_info{web_commit} = "1";
+ }
+ }
+ # Mercurial gives date in ISO 8601, well handled by str2time().
+ $c_info{when} = str2time($rev->{date});
+ # Mercurial doesn't allow empty commit messages, so there
+ # should always be a single defined message.
+ $c_info{message} = $rev->{msg}{content};
+ # Inside "paths" sits a single array "path" that contains
+ # multiple paths. Crystal clear :-)
+ foreach my $path (@{$rev->{paths}{path}}) {
+ push @{$c_info{files}}, {
+ # Mercurial doesn't track file permissions as
+ # Git do, so that's missing here.
+ 'file' => $path->{content},
+ 'status' => $path->{action},
+ };
+ }
+ # There also exists an XML branch "copies"->"copy", containing
+ # source and dest of files that have been copied with "hg cp".
+ # The copy action is also registered in "paths" as a removal of
+ # source and addition of dest, so it's not needed here.
+ push @c_infos, {%c_info};
+ use Data::Dumper;
+ }
+
+ return wantarray ? @c_infos : $c_infos[0];
+ }
+
+ sub hg_sha1 (;$) {
+ # Return head sha1sum (of given file).
+ my $file = shift || q{--};
+
+ # Non-existing file doesn't give error, just empty string.
+ my $f_info = hg_commit_info(undef, 1, $file);
+ my $sha1;
+ if ($f_info->{rev}) {
+ ($sha1) = $f_info->{rev} =~ m/($sha1_pattern)/;
+ }
+ else {
+ debug("Empty sha1sum for '$file'.");
+ }
+ return defined $sha1 ? $sha1 : q{};
+ }
+
+ sub rcs_update () {
+ run_or_cry('hg', '-q', 'update');
+ }
+
+ sub rcs_prepedit ($) {
+ # Return the commit sha1sum of the file when editing begins.
+ # This will be later used in rcs_commit if a merge is required.
+ my ($file) = @_;
+
+ return hg_sha1($file);
+ }
+
+ sub rcs_commit (@) {
+ # Try to commit the page; returns undef on _success_ and
+ # a version of the page with the rcs's conflict markers on
+ # failure.
+ my %params=@_;
+
+ # Check to see if the page has been changed by someone else since
+ # rcs_prepedit was called.
+ my $cur = hg_sha1($params{file});
+ my ($prev) = $params{token} =~ /^($sha1_pattern)$/; # untaint
+
+ if (defined $cur && defined $prev && $cur ne $prev) {
+
+If there was a conflict, the file with conflict markers is returned. Else, the path to the tempdiff, which is to be run to restore previous local state after `rcs_commit_staged`, is returned.
+
+ my ($conflict, $tempdiffpath) =
+ merge_past($prev, $params{file}, $dummy_commit_msg);
+ return defined $conflict
+ ? $conflict
+ : rcs_commit_helper(
+ @_,
+ merge => 1,
+ tempdiffpath => $tempdiffpath);
+ }
+
+ return rcs_commit_helper(@_);
+ }
+
+ sub rcs_commit_helper (@) {
+ my %params=@_;
+
+ my %env=%ENV;
+ $ENV{HGENCODING} = 'utf-8';
+
+ my $user="Anonymous";
+ my $nickname;
+ if (defined $params{session}) {
+ if (defined $params{session}->param("name")) {
+ $user = $params{session}->param("name");
+ }
+ elsif (defined $params{session}->remote_addr()) {
+ $user = $params{session}->remote_addr();
+ }
+
+ if (defined $params{session}->param("nickname")) {
+ $nickname=encode_utf8($params{session}->param("nickname"));
+ $nickname=~s/\s+/_/g;
+ $nickname=~s/[^-_0-9[:alnum:]]+//g;
+ }
+ $ENV{HGUSER} = encode_utf8($user . ' <' . $nickname . '@web>');
+ }
+
+ if (! length $params{message}) {
+ $params{message} = "no message given";
+ }
+
+ $params{message} = IkiWiki::possibly_foolish_untaint($params{message});
+
+ my @opts;
+
+Mercurial rejects file arguments when performing a merging commit. It
+only does "all or nothing" commits by design when merging, so given file arguments must be discarded. It should not pose a problem.
+
+ if (exists $params{file} && ! defined $params{merge}) {
+ push @opts, '--', $params{file};
+ }
+
+ # hg commit returns non-zero if nothing really changed.
+ # So we should ignore its exit status (hence run_or_non).
+ run_or_non('hg', 'commit', '-m', $params{message}, '-q', @opts);
+
+If there were uncommited local changes in srcdir before a merge was done, they are restored here.
+
+ if (defined $params{tempdiffpath}) {
+ hg_local_dirstate_unshelve($params{tempdiffpath});
+ }
+
+ %ENV=%env;
+ return undef; # success
+ }
+
+ sub rcs_commit_staged (@) {
+ # Commits all staged changes. Changes can be staged using rcs_add,
+ # rcs_remove, and rcs_rename.
+ return rcs_commit_helper(@_);
+ }
+
+ sub rcs_add ($) {
+ my ($file) = @_;
+
+ run_or_cry('hg', 'add', $file);
+ }
+
+ sub rcs_remove ($) {
+ # Remove file from archive.
+ my ($file) = @_;
+
+ run_or_cry('hg', 'remove', '-f', $file);
+ }
+
+ sub rcs_rename ($$) {
+ my ($src, $dest) = @_;
+
+ run_or_cry('hg', 'rename', '-f', $src, $dest);
+ }
+
+ sub rcs_recentchanges ($) {
+ my ($num) = @_;
+
+ my @c_infos;
+
+ foreach my $c_info (hg_commit_info(undef, $num, undef)) {
+ my @pagenames;
+ for my $page (@{$c_info->{files}}) {
+ my $diffurl=defined $config{diffurl} ?
+ $config{diffurl} : '';
+ # These substitutions enable defining keywords \[[file]]
+ # and \[[r2]] (backward compatibility) in the setup file
+ # that will be exchanged with filename and revision
+ # respectively.
+ $diffurl =~ s/\[\[file\]\]/$page->{file}/go;
+ $diffurl =~ s/\[\[r2\]\]/$c_info->{rev}/go;
+ push @pagenames, {
+ # pagename() strips suffixes and returns the
+ # path to the file as it is to be represented
+ # in the build dir.
+ page => pagename($page->{file}),
+ diffurl => $diffurl,
+ };
+ }
+
+ # It is expected of ikiwiki to get each comment line as a
+ # separate entry.
+ my @messagelines;
+ open my $message, '<', \$c_info->{message};
+ while (<$message>) { push @messagelines, { line => $_ } };
+
+ push @c_infos, {
+ rev => $c_info->{rev},
+ user => $c_info->{user},
+ nickname => defined $c_info->{nickname} ?
+ $c_info->{nickname} : $c_info->{user},
+ committype => $c_info->{web_commit} ? "web" : "hg",
+ when => $c_info->{when},
+ message => [@messagelines],
+ pages => [@pagenames],
+ } if @pagenames;
+ }
+
+ return @c_infos;
+ }
+
+ sub rcs_diff ($;$) {
+ my $rev=shift;
+ my $maxlines=shift;
+ my @lines;
+ my $addlines=sub {
+ my $line=shift;
+ return if defined $maxlines && @lines == $maxlines;
+ push @lines, $line."\n"
+ if (@lines || $line=~/^diff --git/);
+ return 1;
+ };
+ safe_hg(undef, $addlines, "hg", "diff", "-c", $rev, "-g");
+ if (wantarray) {
+ return @lines;
+ }
+ else {
+ return join("", @lines);
+ }
+ }
+
+ {
+ my %time_cache;
+
+This is an upstream change I did a week ago or so. Perhaps it can be merged in some clever way with the updated `hg_commit_info` to make one shared lookup cache. Don't know how much would be gained.
+
+ sub findtimes ($$) {
+ my $file=shift;
+ my $id=shift; # 0 = mtime ; 1 = ctime
+
+ if (! keys %time_cache) {
+ my $date;
+
+ # It doesn't seem possible to specify the format wanted for the
+ # changelog (same format as is generated in git.pm:findtimes(),
+ # though the date differs slightly) without using a style
+ # _file_. There is a "hg log" switch "--template" to directly
+ # control simple output formatting, but in this case, the
+ # {file} directive must be redefined, which can only be done
+ # with "--style".
+ #
+ # If {file} is not redefined, all files are output on a single
+ # line separated with a space. It is not possible to conclude
+ # if the space is part of a filename or just a separator, and
+ # thus impossible to use in this case.
+ #
+ # Some output filters are available in hg, but they are not fit
+ # for this cause (and would slow down the process
+ # unnecessarily).
+
+ eval q{use File::Temp};
+ error $@ if $@;
+ my ($tmpl_fh, $tmpl_filename) = File::Temp::tempfile(UNLINK => 1);
+
+ print $tmpl_fh 'changeset = "{date}\\n{files}\\n"' . "\n";
+ print $tmpl_fh 'file = "{file}\\n"' . "\n";
+
+ foreach my $line (run_or_die('hg', 'log', '--style', $tmpl_filename)) {
+ # {date} gives output on the form
+ # 1310694511.0-7200
+ # where the first number is UTC Unix timestamp with one
+ # decimal (decimal always 0, at least on my system)
+ # followed by local timezone offset from UTC in
+ # seconds.
+ if (! defined $date && $line =~ /^\d+\.\d[+-]\d*$/) {
+ $line =~ s/^(\d+).*/$1/;
+ $date=$line;
+ }
+ elsif (! length $line) {
+ $date=undef;
+ }
+ else {
+ my $f=$line;
+
+ if (! $time_cache{$f}) {
+ $time_cache{$f}[0]=$date; # mtime
+ }
+ $time_cache{$f}[1]=$date; # ctime
+ }
+ }
+ }
+
+ return exists $time_cache{$file} ? $time_cache{$file}[$id] : 0;
+ }
+
+ }
+
+ sub rcs_getctime ($) {
+ my $file = shift;
+
+ return findtimes($file, 1);
+ }
+
+ sub rcs_getmtime ($) {
+ my $file = shift;
+
+ return findtimes($file, 0);
+ }
+
+The comment just below the function declaration below is taken from `git.pm`. Is it true? Should ikiwiki support sharing its repo with other things? Mercurial-wise that sounds like a world of pain.
+
+> Yes, ikiwiki supports this for git and svn. It's useful when you want
+> a doc/ directory with the wiki for a project. I don't know why
+> it wouldn't be a useful thing to do with mercurial, but it's not
+> required. --[[Joey]]
+
+ {
+ my $ret;
+ sub hg_find_root {
+ # The wiki may not be the only thing in the git repo.
+ # Determine if it is in a subdirectory by examining the srcdir,
+ # and its parents, looking for the .git directory.
+
+ return @$ret if defined $ret;
+
+ my $subdir="";
+ my $dir=$config{srcdir};
+ while (! -d "$dir/.hg") {
+ $subdir=IkiWiki::basename($dir)."/".$subdir;
+ $dir=IkiWiki::dirname($dir);
+ if (! length $dir) {
+ error("cannot determine root of hg repo");
+ }
+ }
+
+ $ret=[$subdir, $dir];
+ return @$ret;
+ }
+
+ }
+
+ sub hg_parse_changes (@) {
+ # Only takes a single info hash as argument in rcs_preprevert, but
+ # should be able to take several in rcs_receive.
+ my @c_infos_raw = shift;
+
+ my ($subdir, $rootdir) = hg_find_root();
+ my @c_infos_ret;
+
+ foreach my $c_info_raw (@c_infos_raw) {
+ foreach my $path (@{$c_info_raw->{files}}) {
+ my ($file, $action, $temppath);
+
+ $file=$path->{file};
+
+ # check that all changed files are in the subdir
+ if (length $subdir && ! ($file =~ s/^$subdir//)) {
+ error sprintf(gettext("you are not allowed to change %s"), $file);
+ }
+
+ if ($path->{status} eq "M") { $action="change" }
+ elsif ($path->{status} eq "A") { $action="add" }
+ elsif ($path->{status} eq "R") { $action="remove" }
+ else { error "unknown status ".$path->{status} }
+
+I haven't tested the attachment code below. Is it run when there is an non-trusted file upload?
+
+> It's run when an anonymous git push is done. I don't know if there would
+> be any equivilant with mercurial; if not, it does not makes sense
+> to implement this at all (this function is only used by `rcs_receive`). --[[Joey]]
+
+ # extract attachment to temp file
+ if (($action eq 'add' || $action eq 'change') &&
+ ! pagetype($file)) {
+
+ eval q{use File::Temp};
+ die $@ if $@;
+
+ my $fh;
+ ($fh, $temppath)=File::Temp::tempfile(undef, UNLINK => 1);
+ my $cmd = "cd $hg_dir && ".
+ "hg diff -g -c $c_info_raw->{rev} > '$temppath'";
+ if (system($cmd) != 0) {
+ error("failed writing temp file '$temppath'.");
+ }
+ }
+
+ push @c_infos_ret, {
+ file => $file,
+ action => $action,
+ path => $temppath,
+ };
+ }
+ }
+
+ return @c_infos_ret;
+ }
+
+*TODO:* I don't know what's happening here. I've changed the code to adhere to this file's variables and functions, but it refers to a srcdir _and_ a default repo, which currently isn't available in the Mercurial setup.
+
+`rcs_receive` is optional and only runs when running a pre-receive hook. Where `$_` comes from and its format are mysteries to me.
+
+Also, a comment in `git.pm` mentions that we don't want to chdir to a subdir "and only see changes in it" - but this isn't true for either Git or Mercurial to my knowledge. It only seems to happen in `git.pm` since the `git log` command in `git_commit_info` ends with "`-- .`" - if it didn't do that, one wouldn't have to chdir for this reason, I believe.
+
+In this case we need to stay in default repo instead of srcdir though, so `hg_dir="."` _is_ needed, but not for the abovementioned reason :-) (maybe there's more to it, though).
+
+> Implementing some sort of anonymous push handling for mercurial is not something
+> you can funble your way through like this, if it can be done at all.
+>
+> Hint: `$_` is being populated by the specific format git sends to a
+> specific hook script.
+> --[[Joey]]
+
+ sub rcs_receive () {
+ my @c_infos_ret;
+ while (<>) {
+ chomp;
+ my ($oldrev, $newrev, $refname) = split(' ', $_, 3);
+
+ # only allow changes to hg_default_branch
+
+*TODO:* What happens here? Some Git voodoo. _If_ `$_` has the exact same format for Mercurial, then the below should work just as well here, I think.
+
+ if ($refname !~ m|^refs/heads/$config{hg_default_branch}$|) {
+ error sprintf(gettext("you are not allowed to change %s"), $refname);
+ }
+
+Comment from `git.pm`:
+
+ # Avoid chdir when running git here, because the changes are in
+ # the default git repo, not the srcdir repo. (Also, if a subdir
+ # is involved, we don't want to chdir to it and only see
+ # changes in it.) The pre-receive hook already puts us in the
+ # right place.
+ $hg_dir=".";
+ push @c_infos_ret,
+ hg_parse_changes(hg_commit_info($newrev.":".$oldrev,
+ undef, undef));
+ $hg_dir=undef;
+ }
+
+ return @c_infos_ret;
+ }
+
+ sub rcs_preprevert ($) {
+ my $rev=shift;
+ my ($sha1) = $rev =~ /^($sha1_pattern)$/; # untaint
+
+The below 4 lines of code are from `git.pm`, but I can't see what they actually do there. Neither Git nor Mercurial only lists changes in working directory when given a command - they always traverse to repository root by themselves. I keep it here for comments, in case I'm missing something.
+
+*UPDATE:* See earlier note about `git log` ending in "`-- .`".
+
+ ## Examine changes from root of git repo, not from any subdir,
+ ## in order to see all changes.
+ #my ($subdir, $rootdir) = git_find_root();
+ #$git_dir=$rootdir;
+
+ my $c_info=hg_commit_info($sha1, 1, undef) or error "unknown commit";
+
+ # hg revert will fail on merge commits. Add a nice message.
+ if (exists $c_info->{parents} && $c_info->{parents} > 1) {
+ error gettext("you are not allowed to revert a merge");
+ }
+
+ my @c_info_ret=hg_parse_changes($c_info);
+
+ ### Probably not needed, if earlier comment is correct.
+ #$hg_dir=undef;
+ return @c_info_ret;
+ }
+
+ sub rcs_revert ($) {
+ # Try to revert the given rev; returns undef on _success_.
+ my $rev = shift;
+ my ($sha1) = $rev =~ /^($sha1_pattern)$/; # untaint
+
+ # Save uncommited local changes to diff file. Attempt to restore later.
+ my $tempdiffpath = hg_local_dirstate_shelve($sha1);
+
+ # Clean dir to latest commit.
+ run_or_die('hg', 'update', '-C');
+
+Some voodoo is needed here. `hg backout --tool internal:local -r $sha1` is *almost* good, but if the reversion is done to the directly previous revision, hg automatically commits, which is bad in this case. Instead I generate a reverse diff and pipe it to `import --no-commit`.
+
+ if (run_or_non("hg diff -c $sha1 --reverse | hg import --no-commit -")) {
+ if ($tempdiffpath) { hg_local_dirstate_unshelve($tempdiffpath) }
+ return undef;
+ }
+ else {
+ if ($tempdiffpath) { hg_local_dirstate_unshelve($tempdiffpath) }
+ return sprintf(gettext("Failed to revert commit %s"), $sha1);
+ }
+ }
+
+Below follows code regarding [[Auto-setup and maintain Mercurial wrapper hooks]]. Will try to solve it in another place later, but the code in itself is working.
+
+Should perhaps add initiation of the bookmark extension here, to support older Mercurial versions.
+
+ sub rcs_wrapper_postcall($) {
+ # Update hgrc if it exists. Change post-commit/incoming hooks with the
+ # .ikiwiki suffix to point to the wrapper path given in the setup file.
+ # Work with a tempfile to not delete hgrc if the loop is interrupted
+ # midway.
+ # I believe there is a better way to solve this than creating new hooks
+ # and callbacks. Will await discussion on ikiwiki.info.
+ my $hgrc=$config{srcdir}.'/.hg/hgrc';
+ my $backup_suffix='.ikiwiki.bak';
+ if (-e $hgrc) {
+ use File::Spec;
+ my $mercurial_wrapper_abspath=File::Spec->rel2abs($config{mercurial_wrapper}, $config{srcdir});
+ local ($^I, @ARGV)=($backup_suffix, $hgrc);
+ while (<>) {
+ s/^(post-commit|incoming)(\.ikiwiki[ \t]*=[ \t]*).*$/$1$2$mercurial_wrapper_abspath/;
+ print;
+ }
+ unlink($hgrc.$backup_suffix);
+ }
+ }
+
+ 1
--- /dev/null
+I've observed people just seem to get into a dead end whilst reading my ikiwiki instances.
+
+They don't want to back out of post to an index. They want an easy button to click next or previous post, like what you find on Wordpress sites.
+
+<http://codex.wordpress.org/Next_and_Previous_Links>
+
+Thank you
+
+> This is a perfect use for [[todo/wikitrails]], of which my
+> [[plugins/contrib/trail]] plugin is an implementation. Code review on that
+> plugin would be welcome; it might even get merged one day.
+>
+> Unfortunately, IkiWiki blogs use a [[ikiwiki/PageSpec]] to define the set of
+> "posts" in the blog (through which the next/prev trail should range), and
+> the current implementation of [[plugins/contrib/trail]] in terms of typed
+> links would have a circular dependency if used with a PageSpec: typed links
+> have to be added before PageSpecs are evaluated, because "A links to B" is
+> something that can be in a PageSpec; but if you want to add typed links
+> ("A is part of trail B" in this case) based on a PageSpec, then the PageSpec
+> must be evaluated before the typed links can be added. Chicken/egg.
+>
+> One solution would be to make the trail plugin use its own data
+> structure, like [[plugins/contrib/album]] used to do, instead of typed
+> links: at scan time, the trail plugin would just record what the PageSpec
+> was, and delay actually *evaluating* the PageSpec until the beginning
+> of the `render` stage (after all pages have been scanned). This
+> reduces the generic usefulness of typed links, though - in particular
+> you can no longer use "is part of trail A" in a PageSpec. --[[smcv]]
+
+>>> Indeed, I know the problem; I ran into the same kind of thing with my [[plugins/contrib/report]] plugin and its `trail` concept.
+>>> I simply had to declare that one couldn't use "trail" and "maketrail" options within the same report. That way, "maketrail" will add links in the "scan" pass, and "trail" will test for links in the "build" pass. That usually works. --[[KathrynAndersen]]
+
+>> Do you have an example? --[[hendry]]
>>> --[[Joey]]
>>>> This is exactly what I was looking for and it took me a while to find it. I very much support the idea to provide this as a regular plugin, be it merged with pagetemplate or stand-alone. Thank you for your work and code! --BenTo
+
+>>>> Any update on this. This could be very helpful as I plan to run a section of a wiki with a different language (and language settings like RTL-ed CSS). --Nezmer
+
+>>>>> I've implemented this functionality as part of `pagetemplate` as on my "pagetemplate" branch of ikiwiki at https://github.com/rubykat/ikiwiki/tree/pagetemplate - do you want to pull this, Joey?
+>>>>> It isn't implemented quite the same way as Will did; I have the template name first and the pagespec last, but it does the same thing.
+>>>>> --[[KathrynAndersen]]
--- /dev/null
+[[!tag wishlist]]
+Information about Multimarkdown 3.X can be found at <http://fletcherpenney.net/multimarkdown/>.
+Apparently this will run faster because it's not a Perl script.
+The markdown plug-in only uses the perl script for multi-markdown.
+I see that I could just replace /usr/bin/markdown with a renamed multimarkdown,
+but I'd rather not change the system file or uninstall the perl modules.
+Perhaps a custom Plugin/mdwn.pm or a clever way to set $markdown_sub would suffice,
+but I don't know perl. If I wanted to replace Plugin/mdwn.pm with something simple
+that didn't bother to check for Text::*Markdown, calling /home/me/bin/mymdwn instead,
+what would that look like?
--[[JasonBlevins]], March 22, 2008 10:35 EDT
+----
+
+I've written a plugin to implement access keys, configured using a wiki page similar to [[shortcuts]]. It works for links and most form submit buttons.
+
+As I am new to ikiwiki plugin writing, feedback is greatly appreciated.
+
+[[!toggle id="accesskeys" text="Toggle: accesskeys.pm"]]
+
+[[!toggleable id="accesskeys" text="""
+
+ #!/usr/bin/perl
+
+ package IkiWiki::Plugin::accesskeys;
+
+ use warnings;
+ use strict;
+ use IkiWiki 3.00;
+ use CGI::FormBuilder;
+
+ =head1 NAME
+
+ accesskeys.pm - IkiWiki module to implement access keys (keyboard shortcuts)
+
+ =head1 VERSION
+
+ v.5.0 - initial version
+
+ =head1 DESCRIPTION
+
+ Access keys are defined on a page called B<accesskeys>, using the C<accesskey> directive.
+ Example:
+
+ [[!accesskey command="Save Page" key="s"]]
+
+ B<command> may contain only alphanumeric characters (and spaces), and must be a complete
+ match to the target link or submit button's display name.
+
+ B<key> may only be a single alphanumeric character.
+
+ The access key is applied to the first matching link on a page (including header), or the
+ first matching submit button in the @buttons array.
+
+ The wiki must be completely rebuilt every time the B<accesskeys> page changes.
+
+ =head2 Sample accesskeys page
+
+ [[!if test="enabled(accesskeys)"
+ then="This wiki has accesskeys **enabled**."
+ else="This wiki has accesskeys **disabled**."]]
+
+ This page controls what access keys the wiki uses.
+
+ * [[!accesskey command="Save Page" key="s"]]
+ * [[!accesskey command="Cancel" key="c"]]
+ * [[!accesskey command="Preview" key="v"]]
+ * [[!accesskey command="Edit" key="e"]]
+ * [[!accesskey command="RecentChanges" key="c"]]
+ * [[!accesskey command="Preferences" key="p"]]
+ * [[!accesskey command="Discussion" key="d"]]
+
+ =head1 IMPLEMENTATION
+
+ This plugin uses the following flow:
+
+ =over 1
+
+ =item 1. Override default CGI::FormBuilder::submit function
+
+ FormBuilder does not support any arbitrary modification of it's submit buttons, so
+ in order to add the necessary attributes you have to intercept the internal function
+ call which generates the formatted html for the submit buttons. Not pretty, but it
+ works.
+
+ =item 2. Get list of keys
+
+ During the B<checkconfig> stage the B<accesskeys> source file is read (default
+ F<accesskeys.mdwn>) to generate a list of defined keys.
+
+ =item 3. Insert keys (links)
+
+ Keys are inserted into links during the format stage. All defined commands are checked
+ against the page's links and if there is a match the key is inserted. Only the first
+ match for each command is processed.
+
+ =item 4. Insert keys (FormBuilder buttons)
+
+ FormBuilder pages are intercepted during formatting. Keys are inserted as above.
+
+ =back
+
+ =head1 TODO
+
+ =over 1
+
+ =item * non-existant page links ex: ?Discussion
+
+ =item * Support non-submit array buttons (like those added after the main group for attachments)
+
+ =item * Support form fields (search box)
+
+ =back
+
+ =cut
+
+ #=head1 HISTORY
+
+ =head1 AUTHOR
+
+ Written by Damian Small.
+
+ =cut
+
+ my %accesskeys = ();
+
+ # Initialize original function pointer to FormBuilder::submit
+ my $original_submit_function = \&{'CGI::FormBuilder::submit'};
+ # Override default submit function in FormBuilder
+ {
+ no strict 'refs';
+ no warnings;
+ *{'CGI::FormBuilder::submit'} = \&submit_override;
+ }
+
+ sub submit_override {
+ # Call the original function, and get the results
+ my $contents = $original_submit_function->(@_);
+
+ # Hack the results to add accesskeys
+ foreach my $buttonName (keys %accesskeys) {
+ $contents =~ s/(<input id="_submit[^>]+ value="$buttonName")( \/>)/$1 title="$buttonName [$accesskeys{$buttonName}]" accesskey="$accesskeys{$buttonName}"$2/;
+ }
+
+ return $contents;
+ }
+
+ sub import {
+ hook(type => "getsetup", id => "accesskeys", call => \&getsetup);
+ hook(type => "checkconfig", id => "accesskeys", call => \&checkconfig);
+ hook(type => "preprocess", id => "accesskey", call => \&preprocess_accesskey);
+ hook(type => "format", id => "accesskeys", call => \&format);
+ }
+
+ sub getsetup () {
+ return
+ plugin => {
+ safe => 1,
+ rebuild => 1,
+ section => "widget",
+ },
+ }
+
+ sub checkconfig () {
+ if (defined $config{srcdir} && length $config{srcdir}) {
+ # Preprocess the accesskeys page to get all the access keys
+ # defined before other pages are rendered.
+ my $srcfile=srcfile("accesskeys.".$config{default_pageext}, 1);
+ if (! defined $srcfile) {
+ $srcfile=srcfile("accesskeys.mdwn", 1);
+ }
+ if (! defined $srcfile) {
+ print STDERR sprintf(gettext("accesskeys plugin will not work without %s"),
+ "accesskeys.".$config{default_pageext})."\n";
+ }
+ else {
+ IkiWiki::preprocess("accesskeys", "accesskeys", readfile($srcfile));
+ }
+ }
+ }
+
+ sub preprocess_accesskey (@) {
+ my %params=@_;
+
+ if (! defined $params{command} || ! defined $params{key}) {
+ error gettext("missing command or key parameter");
+ }
+
+ # check the key
+ if ($params{key} !~ /^[a-zA-Z0-9]$/) {
+ error gettext("key parameter is not a single character");
+ }
+ # check the command
+ if ($params{command} !~ /^[a-zA-Z0-9 _]+$/) {
+ error gettext("command parameter is not an alphanumeric string");
+ }
+ # Add the access key:
+ $accesskeys{$params{command}} = $params{key};
+
+ return sprintf(gettext("[%s] is the access key for command '<i>%s</i>'"), $params{key}, $params{command});
+ }
+
+ sub format (@) {
+ my %params = @_;
+ my $contents = $params{content};
+
+ # If the accesskey page changes, all pages will need to be updated
+ #debug("Adding dependency: for " . $params{page} . " to AccessKeys");
+ add_depends($params{page}, "AccessKeys");
+
+ # insert access keys
+ foreach my $command (keys %accesskeys) {
+ $contents =~ s/(<a href=[^>]+)(>$command<\/a>)/$1 accesskey="$accesskeys{$command}"$2/;
+ }
+ # may need special handling for non-existant discussion links (and possibly other similar cases?)
+ #$contents =~ s/(<a href=[^>]+)(>\?<\/a>Discussion)/$1 accesskey="d"$2/;
+
+ return $contents;
+ }
+
+ 1
+
+
+[[!toggle id="accesskeys" text="hide accesskeys.pm"]]
+"""]]
+
+--[[DamianSmall]]
+
[[!tag wishlist]]
>>> I'm not necessarily saying that's a good idea. Indeed, my memory
>>> concerns below invalidate this idea pretty well. --[[Joey]]
- diff --git a/IkiWiki/Plugin/meta.pm b/IkiWiki/Plugin/meta.pm
- index 6fe9cda..2f8c098 100644
- --- a/IkiWiki/Plugin/meta.pm
- +++ b/IkiWiki/Plugin/meta.pm
- @@ -13,6 +13,8 @@ sub import {
- hook(type => "needsbuild", id => "meta", call => \&needsbuild);
- hook(type => "preprocess", id => "meta", call => \&preprocess, scan => 1);
- hook(type => "pagetemplate", id => "meta", call => \&pagetemplate);
- + hook(type => "scan", id => "meta", call => \&scan)
- + if $config{"meta_defaults"};
- }
-
- sub getsetup () {
- @@ -305,6 +307,15 @@ sub match {
- }
- }
-
- +sub scan() {
- + my %params = @_;
- + my $page = $params{page};
- + foreach my $default (@{$config{"meta_defaults"}}) {
- + preprocess(%$default, page => $page,
- + destpage => $page, preview => 0);
- + }
- +}
- +
- package IkiWiki::PageSpec;
-
- sub match_title ($$;@) {
- diff --git a/IkiWiki/Setup.pm b/IkiWiki/Setup.pm
- index 8a25ecc..e4d50c9 100644
- --- a/IkiWiki/Setup.pm
- +++ b/IkiWiki/Setup.pm
- @@ -51,7 +51,13 @@ sub merge ($) {
- $config{$c}=$setup{$c};
- }
- else {
- - $config{$c}=[map { IkiWiki::possibly_foolish_untaint($_) } @{$setup{$c}}]
- + $config{$c}=[map {
- + if(ref $_ eq 'HASH') {
- + $_
- + } else {
- + IkiWiki::possibly_foolish_untaint($_)
- + }
- + } @{$setup{$c}}];
- }
- }
- elsif (ref $setup{$c} eq 'HASH') {
- diff --git a/doc/ikiwiki/directive/meta.mdwn b/doc/ikiwiki/directive/meta.mdwn
- index 000f461..8d34ee4 100644
- --- a/doc/ikiwiki/directive/meta.mdwn
- +++ b/doc/ikiwiki/directive/meta.mdwn
- @@ -12,6 +12,16 @@ also specifies some additional sub-parameters.
- The field values are treated as HTML entity-escaped text, so you can include
- a quote in the text by writing `"` and so on.
-
- +You can also define site-wide defaults for meta values by including them
- +in your setup file. The key used is `meta_defaults` and the value is a list
- +of hashes, one per meta directive. e.g.:
- +
- + meta_defaults = [
- + { copyright => "Copyright 2007 by Joey Hess" },
- + { license => "GPL v2+" },
- + { link => "somepage", rel => "site entrypoint", },
- + ],
- +
- Supported fields:
-
- * title
+ <snip old patch>
-- [[Jon]]
>>
>>> I generally agree with this. It is *possible* that meta would have a new
>>> field added, that takes parameters and make sense to use globally.
+>>> (Indeed, this later happened to some extent with the sortas parameters
+>>> being added to some metas.)
>>> --[[Joey]]
>>
>> Due to this, and the added complexity of the second patch (having to adjust
>>
>> Is this merge-worthy?
- diff --git a/IkiWiki/Plugin/meta.pm b/IkiWiki/Plugin/meta.pm
- index b229592..3132257 100644
- --- a/IkiWiki/Plugin/meta.pm
- +++ b/IkiWiki/Plugin/meta.pm
- @@ -13,6 +13,7 @@ sub import {
- hook(type => "needsbuild", id => "meta", call => \&needsbuild);
- hook(type => "preprocess", id => "meta", call => \&preprocess, scan => 1);
- hook(type => "pagetemplate", id => "meta", call => \&pagetemplate);
- + hook(type => "scan", id => "meta", call => \&scan);
- }
-
- sub getsetup () {
- @@ -302,6 +303,15 @@ sub match {
- }
- }
-
- +sub scan() {
- + my %params = @_;
- + my $page = $params{page};
- + foreach my $type (map { s/^meta_//; $_ } grep /^meta_/, keys %config) {
- + $pagestate{$page}{meta}{$type} = $config{"meta_$type"}
- + unless defined $pagestate{$page}{meta}{$type};
- + }
- +}
- +
- package IkiWiki::PageSpec;
-
- sub match_title ($$;@) {
- diff --git a/doc/ikiwiki/directive/meta.mdwn b/doc/ikiwiki/directive/meta.mdwn
- index 000f461..200c4b2 100644
- --- a/doc/ikiwiki/directive/meta.mdwn
- +++ b/doc/ikiwiki/directive/meta.mdwn
- @@ -12,6 +12,12 @@ also specifies some additional sub-parameters.
- The field values are treated as HTML entity-escaped text, so you can include
- a quote in the text by writing `"` and so on.
-
- +You can also define site-wide defaults for meta values by including them
- +in your setup file, e.g.
- +
- + meta_copyright => "Copyright 2007 by Joey Hess",
- + meta_license => "GPL v2+",
- +
- Supported fields:
-
- * title
+ <snip old patch>
-- [[Jon]]
>>> metadata of the given type is present. --[[Joey]]
>>>>
>>>> that should be easy enough to do. I will work on a patch. -- [[Jon]]
+>>>>> Hi — I've written a new patch which I hope addresses the concerns raised
+>>>>> with the previous ones. The new approach is to hard-code in `scan()`
+>>>>> which of the meta types are supported in the setup file. If one is
+>>>>> defined, then `scan()` calls `preprocess()`, as [[smcv]] suggested,
+>>>>> rather than stuffing redundant data into ikiwiki's data structures.
+>>>>>
+>>>>> Two types supported in the setup file have optional arguments: `author`
+>>>>> and `title`. These are supported by having special-cased setup keys
+>>>>> `meta_author_sortas` and `meta_title_sortas`. Future expansion of the
+>>>>> number of supported types, or addition of arguments to existing ones,
+>>>>> can similarly be special-cased.
+>>>>>
+>>>>> The setup data structure is no longer complicated with an
+>>>>> array-of-hashes, which means this is suitable for exposing via websetup.
+>>>>> `getsetup()` has been adjusted accordingly.
+>>>>>
+>>>>> The patch can be found at the git branch described above.
+>>>>> — [[Jon]]
+
+>>>>>> I wish I could take pity on you and just merge this, but
+>>>>>> AFAICS it still suffers from the memory bloat described above.
+>>>>>> Specifically, when `scan` calls `preprocess`, it
+>>>>>> stores the metadata in `%pagestate` etc. --[[Joey]]
+
+>>>>>>> No pity required — but whoops, yes, that was a bit of a mistake
+>>>>>>> ☺ I guess I'll have to split the current `preprocess` in half.
+>>>>>>> — [[Jon]]
-----
-I'm using a [plugin](http://metameso.org/~joe/math/tex.pm) created by [Josef Urban](http://www.cs.ru.nl/~urban) that gets LaTeX into ikiwiki by using [LaTeXML](http://dlmf.nist.gov/LaTeXML). This could well be "the right way" to go (long term) but the plugin still does not render math expressions right, because ikiwiki is filtering out requisite header information. Examples (I recommend you use Firefox to view these!) are available [here](http://metameso.org/aa/math/) and [here](http://metameso.org/aa/simple/). Compare that last example to the [file generated by LaTeXML](http://metameso.org/~joe/math/math.xml). I posted the sources [here](http://metameso.org/aa/sources/) for easy perusal. How to get ikiwiki to use the original DOCTYPE and html fields? I could use some help getting this polished off. --[[jcorneli]]
+I'm using a [plugin](http://metameso.org/~joe/math/tex.pm) created by [Josef Urban](http://www.cs.ru.nl/~urban) that gets LaTeX into ikiwiki by using [LaTeXML](http://dlmf.nist.gov/LaTeXML). This could well be "the right way" to go (long term) but the plugin still does not render math expressions right, because ikiwiki is filtering out requisite header information. Examples (I recommend you use Firefox to view these!) are available [here](http://li101-104.members.linode.com/aa/math/) and [here](http://li101-104.members.linode.com/aa/simple/). Compare that last example to the [file generated by LaTeXML directly](http://metameso.org/~joe/math/math.xml). I posted the sources [here](http://metameso.org/aa/sources/) for easy perusal. How to get ikiwiki to use the original DOCTYPE and html fields? I could use some help getting this polished off. --[[jcorneli]]
> update: it seems important to force the browser to think of the content as xml, e.g. [http://metameso.org/~joe/math/example.xml](http://metameso.org/~joe/math/example.xml) has the same source code as [http://metameso.org/~joe/math/example.html](http://metameso.org/~joe/math/example.html) and the former shows math working, but the latter doesn't. --[[jcorneli]]
+>> Looking at the source code, it seems Ikiwiki is doing more than filtering header information - it is filtering out all HTML formatting around MathML constituent objects. In the first example, we see that formatting for tables and such is preserved. --[[jcorneli]]
+
[[!tag soc]]
[[!tag wishlist]]
--- /dev/null
+[[!tag wishlist]]
+
+[My ikiwiki instance](http://www.ipol.im/) is quite heavy. 674M of data in the source repo, 1.1G in its .git folder.
+Lots of \[[!img ]] (~2200), lots of \[[!teximg ]] (~2700). A complete rebuild takes 10 minutes.
+
+We could use a big machine, with plenty of CPUs. Could some multi-threading support be added to ikiwiki, by forking out all the external heavy plugins (imagemagick, tex, ...) and/or by processing pages in parallel?
+
+Disclaimer: I know nothing of the Perl approach to parallel processing.
--- /dev/null
+I don't find org.pm in git branch. The steps are:
+
+1. git clone git://github.com/wking/ikiwiki.git
+2. cd ikiwiki
+3. find . | grep org.pm
+
+I've taken the name from <http://www.golden-gryphon.com/software/misc/org.pm.html>
--- /dev/null
+[[!template id=gitbranch branch=git://github.com/yds/ikiwiki.git/pagedown/ author="[[yds]]"]]
+
+Here's a [PageDown](http://Code.Google.com/p/pagedown/wiki/PageDown) plugin I put together based on the [WMD](http://WMD-Editor.com/) plugin source. In `editpage.tmpl` I moved `<TMPL_VAR WMD_PREVIEW>` to the top of the template. Makes it look like the edit `textarea` pops up below the content when hitting the edit link. Should work the same with the WMD plugin as well.
+
+I also wrote a couple of `makefile`s to make fetching and installing the sources for the `pagedown` and `wmd` `underlaydir`s simpler. And updated `doc/plugins/wmd.mdwn` to reflect these changes.
+[[!template id=gitbranch branch=jon/pagespec_alias author="[[Jon]]"]]
[[!tag patch wishlist]]I quite often find myself repeating a boiler-plate
[[ikiwiki/pagespec]] chunk, e.g.
I wrote the following plugin to achieve this:
- commit f3a9dd113338fe5d2b717de1dc69679ff74e2f8d
- Author: Jon Dowland <jmtd@debian.org>
- Date: Tue May 3 17:40:16 2011 +0100
-
- new plugin: alias.pm - pagespec aliases
-
- diff --git a/IkiWiki/Plugin/alias.pm b/IkiWiki/Plugin/alias.pm
- new file mode 100644
- index 0000000..b8d4574
- --- /dev/null
- +++ b/IkiWiki/Plugin/alias.pm
- @@ -0,0 +1,47 @@
- +package IkiWiki::Plugin::alias;
- +
- +use warnings;
- +use strict;
- +use IkiWiki '3.00';
- +
- +sub import {
- + hook(type => "getsetup", id=> "alias", call => \&getsetup);
- + hook(type => "checkconfig", id=> "alias", call => \&checkconfig);
- +}
- +
- +sub getsetup () {
- + return
- + plugin => {
- + description => "allows the definition of pagespec aliases",
- + safe => 1,
- + rebuild => 1,
- + section => "misc",
- + },
- + pagespec_aliases => {
- + type => "string",
- + example => {"image" => "*jpg or *jpeg or *png or *gif or *ico" },
- + description => "a set of mappings from alias name to pagespec",
- + safe => 1,
- + rebuild => 0,
- + },
- +}
- +
- +sub checkconfig () {
- + no strict 'refs';
- + no warnings 'redefine';
- +
- + if ($config{pagespec_aliases}) {
- + foreach my $key (keys %{$config{pagespec_aliases}}) {
- + my $value = ${$config{pagespec_aliases}}{$key};
- + # XXX: validate key?
- + my $subname = "IkiWiki::PageSpec::match_$key";
- + *{ $subname } = sub {
- + my $path = shift;
- + return IkiWiki::pagespec_match($path, $value);
- + }
- + }
- + }
- +}
- +
- +1;
+ <snip old patch; see git branch outlined above>
I need to reflect on this a bit more before I send a pull request. In
particular I imagine the strict/warnings stuff will make you puke. Also, I'm
> I think it would make sense to have "pagespec" in the name somehow.
-> > Good idea, how about `pagespecalias`? — [[Jon]]
+>> Good idea, how about `pagespecalias`? — [[Jon]]
->
> No, the strict/warnings does not make me puke. Have you read my perl
> code? :-P
>
>> Useful indeed! --[[Joey]]
+
+>>> I've tweaked my patch in light of your above feedback: The plugin has been
+>>> renamed, and I now validate keys. I've also added documentation and tests
+>>> to the branch. I haven't read rubykat's code properly yet, and don't have
+>>> access at the time of writing (I'm on a beach in Greece ☺), but I expect it
+>>> would be possible to extend what I've got here to support defining the
+>>> aliases in a PageSpec, once the dependency stuff has been reasoned out
+>>> properly.
+>>>
+>>> I'd like to solve the issue of this not being web-configurable by
+>>> implementing support for more nested datatypes in [[plugins/websetup]]. —
+>>> [[Jon]]
+
+>>>> Well, it's a difficult problem. websetup builds a form using
+>>>> CGI::FormBuilder, which makes it easy to build the simple UI we have
+>>>> now, but sorta precludes anything more complicated. And anything with
+>>>> a nested datatype probably needs a customized UI for users to be able
+>>>> to deal with it. I don't think websetupability need be a deal-breaker
+>>>> for this patch. I personally like special pages like Kathryn is doing
+>>>> more than complex setup files. --[[Joey]]
+
---------------------------
Based on the above, I have written an experimental plugin called "subset".
>>> As for the name "subset"... well, it's even less like an alias now, and "alias" is already a reserved name. What other names would you suggest?
>>>--[[KathrynAndersen]]
+
+>>>> Regarding my comments: I wasn't clear what you are/were intending to
+>>>> achieve with your modifications. I've aimed for a self-contained plugin
+>>>> which could be merged with ikiwiki proper. I think I initially took your
+>>>> developments as being an evolution of that with the same goal, which is
+>>>> why I commented on the (change of) name. However, I guess your work is
+>>>> more of a fork than a continuation, in which case you can call it
+>>>> whatever you like ☺ I like some of the enhancements you've made, but
+>>>> having the aliases/subsets/"things" work in any pagespec (inside map, or
+>>>> inline) is a deal-breaker for me. — [[Jon]]
+
+>>>>> I'm a bit confused by your statement "having the aliases/subsets/"things" work in any pagespec (inside map, or inline) is a deal-breaker for me".
+>>>>> Do you mean that you want them to work in any pagespec, or that you *don't* want them to work in any pagespec? -- [[KathrynAndersen]]
+
--- /dev/null
+Some time ago there was a [[question|http://ikiwiki.info/forum/how_to_get_nice_pdf_from_ikiwiki_pages__63__/?updated#comment-05381634f89629ad26298a1af4b1d5f9]] in the forum how to get a nice pdf output from an ikiwiki page. However there were no answers. So I put it on the todo list, because I think this would be a nice feature.
+
+Note that for example dokuwiki has a [[nice plugin|http://danjer.doudouke.org/tech/dokutexit]] which converts the wiki page to latex and then to pdf and you can customize the latex-preamble.
+
+> I've actually written one, it's just not publicly released. You can check it out from the "experimental" branch of my <a href="https://github.com/rubykat/ikiplugins">ikiplugins githup repo</a>. It's called "html2pdf" and it depends on the static version of <a href="http://code.google.com/p/wkhtmltopdf/">wkhtmltopdf</a> rather than requiring a whole LaTeX setup. It's only been used on Ubuntu, so I can't say what problems there might be on other setups, but it works for me. It's not properly documented; I'd appreciate some help with that.
+> -- [[KathrynAndersen]]
--- /dev/null
+My po branch adds two new template variables: `lang_code` and
+`lang_name`, that respectively display the current page's language
+codename and pretty name. Please review and pull. --[[intrigeri]]
+
+> [[done]] --[[Joey]]
+
+[[patch]]
--- /dev/null
+(**Note:** this patch is built on top of [[Attempt to extend Mercurial backend support]] and [[rcs__95__get__123__c__44__m__125__time_implementation_for_Mercurial_backend__44___based_on_Git_backend]]. The former is needed for the `safe_hg()` definition. The latter only shows up in the very last line matching of this patch.)
+
+CC of `rcs_diff` implementation in `git.pm` with few changes. Mercurial provides the `hg diff -g` switch, which outputs the diff in Git-format, making the implementation easy. I think it's a good idea to base `mercurial.pm` as much as possible om `git.pm` to simplify and be able to benefit from the maintenance of `git.pm`, which probably is more used.
+
+[Patch at my hg repo](http://510x.se/hg/program/ikiwiki/diff/cc73d670bf99/Plugin/mercurial.pm) ([raw format](http://510x.se/hg/program/ikiwiki/raw-file/cc73d670bf99/Plugin/mercurial.pm)).
+
+--[[Daniel Andersson]]
+
+> Guess that makes sense, [[done]] --[[Joey]]
+
+---
+
+ diff -r 1b6c46b62a28 -r cc73d670bf99 Plugin/mercurial.pm
+ --- a/Plugin/mercurial.pm Tue Jul 19 13:35:17 2011 +0200
+ +++ b/Plugin/mercurial.pm Tue Jul 19 13:35:37 2011 +0200
+ @@ -307,7 +307,23 @@
+ }
+
+ sub rcs_diff ($;$) {
+ - # TODO
+ + my $rev=shift;
+ + my $maxlines=shift;
+ + my @lines;
+ + my $addlines=sub {
+ + my $line=shift;
+ + return if defined $maxlines && @lines == $maxlines;
+ + push @lines, $line."\n"
+ + if (@lines || $line=~/^diff --git/);
+ + return 1;
+ + };
+ + safe_hg(undef, $addlines, "hg", "diff", "-c", $rev, "-g");
+ + if (wantarray) {
+ + return @lines;
+ + }
+ + else {
+ + return join("", @lines);
+ + }
+ }
+
+ {
--- /dev/null
+(**Note:** this patch is built on top of the patch discussed at [[Attempt to extend Mercurial backend support]]. The `run_or_die()` function declared therein is needed for this patch to run.)
+
+Patch to change the Mercurial entries for `rcs_getctime` and `rcs_getmtime` from "slow"/"no" to "fast"/"fast" in [[/rcs]].
+
+The patch is mostly a slightly modified cc of the code in `git.pm`. The exception is that a Mercurial style file is needed to get a reasonable output from `hg log`. To make the file self-contained in its current state, this was solved with a generated temp file, but that section could and should be replaced with just setting `$tmpl_filename` to a path to a static file `map-cmdline.ikiwiki-log` (to conform with Mercurial's naming of its default styles) in the Ikiwiki distribution, with contents
+
+ changeset = "{date}\n{files}\n"
+ file = "{file}\n"
+
+which is based on an [example](http://hgbook.red-bean.com/read/customizing-the-output-of-mercurial.html#id417978) in [Mercurial: The Definitive Guide](http://hgbook.red-bean.com/) (and otherwise fascinatingly undocumented). A style *file* is required for this kind of formatting. There is a switch `hg log --template` to directly control simple output formatting, but in this case, the `{file}` directive must be redefined, which can only be done with `hg log --style`.
+
+If `{file}` is not redefined, all filenames are output on a single line separated with a space. It is not possible to conclude if the space is part of a filename or just a separator, and thus impossible to use in this case. Some output filters are available in hg, but they are not fit for this cause (and would slow down the process unnecessarily).
+
+In the patch listing below, I've marked the parts of the patch that should be removed when the tempfile replacement is done with **Marker# start** and **Marker# end**.
+
+[Patch at pastebin](http://pastebin.com/QBE4UH6n).
+
+[Patch at pastebin with tempfile code replaced by a path to a static file (change path accordingly)](http://pastebin.com/dmSCRkUK).
+
+[My `mercurial.pm` in raw format after this and beforementioned patches (tempfile code present)](http://510x.se/hg/program/ikiwiki/raw-file/1b6c46b62a28/Plugin/mercurial.pm).
+
+--[[Daniel Andersson]]
+
+> I have applied this, but I left the temp file in.
+> The overhead seems small since it will only be run once per ikiwiki run,
+> and only when `ikiwiki --gettime` is run, or the first time
+> ikiwiki runs. Thanks for this! [[done]] --[[Joey]]
+
+---
+
+ diff -r 78a217fb13f3 -r 1b6c46b62a28 Plugin/mercurial.pm
+ --- a/Plugin/mercurial.pm Sat Jul 16 03:19:25 2011 +0200
+ +++ b/Plugin/mercurial.pm Tue Jul 19 13:35:17 2011 +0200
+ @@ -310,28 +310,91 @@
+ # TODO
+ }
+
+ -sub rcs_getctime ($) {
+ - my ($file) = @_;
+ +{
+ +my %time_cache;
+
+ - my @cmdline = ("hg", "-R", $config{srcdir}, "log", "-v",
+ - "--style", "default", "$config{srcdir}/$file");
+ - open (my $out, "-|", @cmdline);
+ +sub findtimes ($$) {
+ + my $file=shift;
+ + my $id=shift; # 0 = mtime ; 1 = ctime
+
+ - my @log = (mercurial_log($out));
+ + if (! keys %time_cache) {
+ + my $date;
+
+ - if (@log < 1) {
+ - return 0;
+
+**Marker1 start**
+
+ + # The tempfile logic should be replaced with a file included
+ + # with ikiwiki containing
+ + # --
+ + # changeset = "{date}\n{files}\n"
+ + # file = "{file}\n"
+ + # --
+ + # to avoid creating a file with static contents every time this
+ + # function is called. The path to this file should replace
+ + # $tmpl_filename in run_or_die() below.
+ + #
+
+**Marker1 end**
+
+ + # It doesn't seem possible to specify the format wanted for the
+ + # changelog (same format as is generated in git.pm:findtimes(),
+ + # though the date differs slightly) without using a style
+ + # _file_. There is a "hg log" switch "--template" to directly
+ + # control simple output formatting, but in this case, the
+ + # {file} directive must be redefined, which can only be done
+ + # with "--style".
+ + #
+ + # If {file} is not redefined, all files are output on a single
+ + # line separated with a space. It is not possible to conclude
+ + # if the space is part of a filename or just a separator, and
+ + # thus impossible to use in this case.
+ + #
+ + # Some output filters are available in hg, but they are not fit
+ + # for this cause (and would slow down the process
+ + # unnecessarily).
+ +
+
+**Marker2 start**
+
+ + use File::Temp qw(tempfile);
+ + my ($tmpl_fh, $tmpl_filename) = tempfile(UNLINK => 1);
+ +
+ + print $tmpl_fh 'changeset = "{date}\\n{files}\\n"' . "\n";
+ + print $tmpl_fh 'file = "{file}\\n"' . "\n";
+ +
+
+**Marker2 end**
+
+ + foreach my $line (run_or_die('hg', 'log', '--style',
+ + $tmpl_filename)) {
+ + # {date} gives output on the form
+ + # 1310694511.0-7200
+ + # where the first number is UTC Unix timestamp with one
+ + # decimal (decimal always 0, at least on my system)
+ + # followed by local timezone offset from UTC in
+ + # seconds.
+ + if (! defined $date && $line =~ /^\d+\.\d[+-]\d*$/) {
+ + $line =~ s/^(\d+).*/$1/;
+ + $date=$line;
+ + }
+ + elsif (! length $line) {
+ + $date=undef;
+ + }
+ + else {
+ + my $f=$line;
+ +
+ + if (! $time_cache{$f}) {
+ + $time_cache{$f}[0]=$date; # mtime
+ + }
+ + $time_cache{$f}[1]=$date; # ctime
+ + }
+ + }
+
+**Marker3 start**
+
+ + close ($tmpl_fh);
+
+**Marker3 end**
+
+ }
+
+ - eval q{use Date::Parse};
+ - error($@) if $@;
+ -
+ - my $ctime = str2time($log[$#log]->{"date"});
+ - return $ctime;
+ + return exists $time_cache{$file} ? $time_cache{$file}[$id] : 0;
+ +}
+ +
+ +}
+ +
+ +sub rcs_getctime ($) {
+ + my $file = shift;
+ +
+ + return findtimes($file, 1);
+ }
+
+ sub rcs_getmtime ($) {
+ - error "rcs_getmtime is not implemented for mercurial\n"; # TODO
+ + my $file = shift;
+ +
+ + return findtimes($file, 0);
+ }
+
+ 1
HTML::Template's HTML-like markup prevents me from editing templates in KompoZer or other WYSIWYG HTML editors. The editor tries to render the template markup rather than display it verbatim, and large parts of the template become invisible. A markup syntax that doesn't confuse editors (such as Template::Toolkit's "[% FOO %]") may promote template customization. The ability to replace the template engine would be within the spirit of ikiwiki's extensibility. --Rocco
+> HTML::Template allows the use of `<!-- TMPL_SOMETHING ... -->`
+> instead of `<TMPL_SOMETHING ...>`, see
+> <http://search.cpan.org/~samtregar/HTML-Template-2.6/Template.pm#NOTES>
+> for details. I used this PERL regexp to convert my own templates:
+>
+> s{<\s*(/?TMPL_[A-Z]+)((\s+\w+(=(['"]?)\w+\5)?)+)?\s*/?>}{<!-- $1$2 -->}gi;
+>
+> (Quoting it properly to use from the shell command-line is
+> nightmarish, write a script with it.)
+> --[[RiccardoMurri]]
I agree that being able to replace the template toolkit would be a great piece of modularity, and one I would use. If I could use the slot-based filling and the conditional logic from Template::Toolkit, we could build much more flexible inline and archivepage templates that would look different depending on where in the wiki we use them. Some of this can currently be accomplished with separate templates for each use case and a manual call to the right template in the !inline directive, but this is limited, cumbersome, and makes it difficult to reuse bits of formatting by trapping all of that information in multiple template files. -Ian
>> A modular template system in ikiwiki is unlikely, as template objects
>> are part of the API, notably the `pagetemplate` hook. Unless the other
>> system has a compatible template object. --[[Joey]]
+
+>>> I hacked an adapter that exposes the HTML::Template API but uses
+>>> Template::Toolkit for the template rendering. Very rough, but it
+>>> works: my Wikis compile mostly ok. The code includes a `.tmpl`
+>>> converter script. Get it from: <http://github.com/riccardomurri/ikiwiki>
+>>> --[[RiccardoMurri]]
+
+---
+
+>>> I found this thing yesterday:
+>>>
+>>> http://search.cpan.org/~rhandom/Template-Alloy-1.016/lib/Template/Alloy.pod
+>>> I think (hope) this can solve all the problems related to this feature request.
+>>>
+>>> From the url above:
+>>> "With Template::Alloy you can use your favorite template interface and syntax
+>>> and get features from each of the other major template systems."
+>>> --[[Cstamas]]
--- /dev/null
+This plugin provides the `last_comment` [[ikiwiki/pagespec/sorting]] order which uses the modification time of their last comment to sort pages. It also updates the mtime of the page to this value.
+
+For example, it could be useful to make active threads of discussion appear on top of the list of threads in a forum.
+
+You'll find it in this repository, in the 'sortbylastcomment' branch:
+
+<https://un.poivron.org/~sajolida/ikiwiki.git/>
+
+[[!tag wishlist patch]]
+
+> Reviewed, tested: looks good to me. We need it for the [Tails forum](https://tails.boum.org/forum/). --[[intrigeri]]
--- /dev/null
+It would be nice for some plugins to use hashes as setup data structures
+(which ones? pagespec aliases for one. Any others?), but these cannot
+currently be adequately described in `getsetup()`, nor represented in
+`websetup()`. It would be nice to extend ikiwiki to support this.
+
+I've had an initial go at how to represent this in a nice way within a HTML
+page. An initial mock up is available at
+<https://github.com/jmtd/ikiwiki/blob/websetup_hashes/hash.html>. The
+approach taken is to use a javascript hash/dictionary as the canonical copy of
+the data; to express that in the form elements, and to capture all relevant
+events to update the main data structure (and the HTML representations
+thereof).
+
+I imagine packing the js structure into a form element which is posted, and
+ignoring the other form element data.
+
+This would mean mandating javascript support for editing such hashes.
+
+— [[Jon]]
+
+> I really don't like mandating javascript for anything in ikiwiki.
+>
+> Ikiwiki's websetup is built using CGI::FormBuilder, which makes it easy
+> to create forms for simple stuff, but does not allow custom UI for
+> complex stuff. This does not seem compatable with that, unless your
+> idea is to have a separate form for these more complex things. --[[Joey]]
--- /dev/null
+Would be nice if the recentchangesdiff plugin could optionally provide wdiffs, or highlight the changes on each line. When people edit a wiki via the web interface, they often put each paragraph on a single line, like this one, and if someone later edits the paragraph, the diff only shows the whole line changed, making it difficult to figure out what the actual change is. --liw
and refresh site.
Peter Gammie has done an initial implementation of the above.
-[[!template id=gitbranch branch=peteg/revert author="[[peteg]]"]]
+[[!template id=gitbranch branch=peteg/revert author="[[users/peteg]]"]]
->> It is on a separate branch now. --[[peteg]]
+>> It is on a separate branch now. --[[users/peteg]]
> Review: --[[Joey]]
>
> The revert commit will not currently say what web user did the revert.
> This could be fixed by doing a --no-commit revert first and then using
> rcs_commit_staged.
->> Fixed, I think. --[[peteg]]
+>> Fixed, I think. --[[users/peteg]]
>
> So I see one thing I completly forgot about is `check_canedit`. Avoiding users
> using reverting to make changes they would normally not be allowed to do is
> structure that `rcs_recieve` does. This could be done by using `git revert
> --no-commit`, and then examining the changes, and then `git reset` to drop
> them.
->> We can use the existing `git_commit_info` with the patch ID - no need to touch the working directory. -- [[peteg]]
+>> We can use the existing `git_commit_info` with the patch ID - no need to touch the working directory. -- [[users/peteg]]
>
> Then the code that is currently in IkiWiki/Receive.pm, that calls
> `check_canedit` and `check_canremove` to test the change, can be
> straightforwardly refactored out, and used for checking reverts too.
->> Wow, that was easy. :-) -- [[peteg]]
+>> Wow, that was easy. :-) -- [[users/peteg]]
>
> (The data from `rcs_preprevert` could also be used for a confirmation
> prompt -- it doesn't currently include enough info for diffs, but at
>>> I agree, but have not figured out a way to make a hook work yet.
>>> --[[Joey]]
>>
->> Please look it over and tell me what else needs fixing... -- [[peteg]]
+>> Please look it over and tell me what else needs fixing... -- [[users/peteg]]
>>> I have made my own revert branch and put a few^Wseveral fixes in there.
>>> All merged to master now! --[[Joey]]
+[[!toc]]
+
# A few questions about translating PO file
I have a few questions about translating PO file:
> appropriate. ikiwiki should display translated messages when building the
> wiki (with -v).
-2. I'll send you my translation when I finish it, of course. But what about
+2. I'll send you my translation when I finish it, of course. But about
updating my PO file? Should I send it to you for every ikiwiki issue?
Maybe you should give write access to ikiwiki repository for translators
of PO files?
> and I've turned that on, and added a few. --[[Joey]]
>> Thank you very much! It also will be a big help for me. --[[Paweł|ptecza]]
+
+# Why .po files? Designing an alternative, more user-friendly
+
+I think this plugin is very powerful, and very useful, especially for frontend or vanity sites. However, for live and dynamic sites, edited through the web interface (ie. a wiki!!), the .po file format is very limiting and counter-intuitive for newbies. I know I can fire up emacs and get a nice interface to translate it, but it's not really what I am looking for. .po formats aim to completely translate certain data, while I would expect a wiki to be a bit more lax.
+
+Basically, the problem is that the current plugin assumes the user is familiar with .po files and has a master language, two assumptions that I think are invalid in a lot of cases, especially in "bilingual" or multilingual countries.
+
+One of the canonical examples of functional translation tracking in a wiki is the LizzyWiki, a screencast of which can be seen here: <https://www.youtube.com/watch?v=42kHzyVKsZw> Some of those ideas were implemented in wikis like [[TikiWiki|http://tiki.org/i18n]]
+
+I believe that there are some parts the po plugin that could be reused for such a flexible translation system, in which all languages could be in any format. But basically to implement such a system, those things would be required:
+
+ 1. mapping between pages - this is accomplished by the current po plugin
+ 2. allow the user to flip between pages (other languages links...) - in the current po plugin
+ 3. create a translation based on another page - this is in the current po plugin, but the resulting page is a .po, it should be a regular wiki page
+ 4. track required translations - this is done by gettext in the current po plugin, so this would need to be redone if we change the format
+
+Step 4 is obviously the hard part - tracking changes between pages would involve extra metadata (maybe in the .ikiwiki directory?) to mark which commits have been translated. The metadata is not so much an issue as the user interface problems.
+
+So say when a user edits page foo.fr.mdwn that is a translation from page foo.en.mdwn, how does he/she tell that the translation is finished or not? The web UI could show the changes that have been done in foo.en.mdwn that need to be translated, and when the user saves the page, he/she is asked to confirm if the page is now completely translated.
+
+Through git only, this would seem to be harder. Maybe if the two translations are committed together they can be assumed to be completely translated, for one. Then maybe there is a way commits could be amended so that they are link - maybe some tree merging magic here? My git internals are a bit far to elaborate on that, and anyways i feel that ikiwiki aims to be RCS agnostic so relying to much on those internals doesn't sound like a good idea.
+
+Obviously, this is a lot more work, diverging in a different direction than the current po-based approach, but it seems to me this is a much more natural system for users.
+
+Also, the thing with the above is that if functionalities 1 and 2 (mapping and page flipping) is stripped out of the po plugin and made reusable, functionalities 3 and 4 can be made optional and a wiki is still translatable, giving the user the responsability of tracking the translations...
+
+So basically, what I think should happen is to have ikiwiki be able to use the .po plugin without .po files - just allow for pages to be linked together. Detect foo.fr.mdwn when parsing foo.mdwn and create links to it would already be a huge start... -- [[anarcat]]
--- /dev/null
+New Ikiwiki user.
--- /dev/null
+Heard about ikiwiki through Planet Debian and Joey Hess. Started playing with it, and make attempts to report bugs and maybe even fix them, though my Perl experience is equal to zero.
+
+At the moment I'm fiddling with ikiwiki at <http://510x.se/notes>.
--- /dev/null
+Just started learning Ikiwiki...
+
+I have been using [MediaWiki](http://www.mediawiki.org/wiki/MediaWiki) for a long time, now I would like to switch to [Ikiwiki](http://ikiwiki.info/) because of:
+
++ git backend
++ MarkDown syntax
+
+I have browsed <http://www.wikimatrix.org/compare/ikiwiki+MediaWiki>, but I am still not sure about which useful features (if any) I would miss from MediaWiki...
+
+So the best way is actually trying it, isn't it?
+
+I would also try integrating Ikiwiki with [Infinote](http://infinote.org/) (or perhaps [jinfinote](http://www.jinfinote.com/)), in order to allow concurrent editing of pages.
+
+-- [Gianpaolo Macario](http://gmacario.altervista.org/)
--- /dev/null
+*Love* ikiwiki!
+
+## Done here: ##
+* [[plugins/contrib/bibtex]]-plugin
--- /dev/null
+Terry Golubiewski likes to program in C++ and manages software projects.
+Terry is just starting to use ikiwiki.
--- /dev/null
+See <https://wiki.koumbit.net/TheAnarcat>
## Wikis
-Currently, I run a couple of Ikiwiki instances. Namely:
+Currently, I run a few Ikiwiki instances. Namely:
* <http://lhc.am-1.org/lhc/>
— to hold random stuff written by me, my colleagues,
University) program I've recently participated in as
an instructor.
+* <http://nets.asu591.ru/networks-2011/>
+ — for bits & pieces related to the course on computer
+ networks I've read in 2011.
+
## Preferences
I prefer to use [Lynx][] along with [Emacs][] (via
mode: markdown
coding: utf-8
fill-column: 64
- ispell-dictionary: "american"
+ ispell-local-dictionary: "american"
End:
--- /dev/null
+[My infopage](http://sphynkx.org.ua)
--- /dev/null
+[yds.CoolRat.org](http://yds.CoolRat.org)
my %users;
sub processuser {
my $user=shift;
- next if $user=~/^-/ || $users{$user};
+ return if $user=~/^-/ || $users{$user};
$users{$user}=1;
my $ret=system("su", $user, "-s", "/bin/sh", "-c", "--", "$0 --nonglobal @ARGV");
if ($ret != 0) {
$seen=1;
push @lines, $_;
}
+ else {
+ $changed=1;
+ }
}
else {
push @lines, $_;
$config{srcdir}="" if ! defined $config{srcdir};
$config{destdir}="" if ! defined $config{destdir};
$config{syslog}=1 if $config{setupsyslog};
+ checkconfig();
require IkiWiki::Setup;
IkiWiki::Setup::dump($config{dumpsetup});
}
Name: ikiwiki
-Version: 3.20110608
+Version: 3.20111106
Release: 1%{?dist}
Summary: A wiki compiler
__copyright__ = 'Copyright © ' + __author__
__licence__ = 'BSD-2-clause'
-from docutils.core import publish_parts;
from proxy import IkiWikiProcedureProxy
+publish_parts = None
+
def rst2html(proxy, *args):
+ # delayed import so docutils is only needed if you *use* rst -
+ # http://bugs.debian.org/637604
+ global publish_parts
+ if publish_parts is None:
+ try:
+ from docutils.core import publish_parts
+ except ImportError, e:
+ proxy.error('cannot import docutils.core: %s: %s' %
+ (e.__class__.__name__, e))
+ raise
+
kwargs = _to_dict(args)
parts = publish_parts(kwargs["content"],
writer_name="html",
msgstr ""
"Project-Id-Version: ikiwiki-bg\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2007-01-12 01:19+0200\n"
"Last-Translator: Damyan Ivanov <dam@modsodtsys.com>\n"
"Language-Team: Bulgarian <dict@fsa-bg.org>\n"
msgid "You are banned."
msgstr "Достъпът ви е забранен."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Грешка"
msgid "expiring %s"
msgstr "премахване на „%s”"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "проверка на източника „%s”"
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "не е намерен източник на адрес „%s”"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
#, fuzzy
msgid "feed not found"
msgstr "шаблонът „%s” не е намерен"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "данните от източника предизвикаха грешка в модула XML::Feed!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "създаване на нова страницa „%s”"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "грешка при обработване на шаблона"
msgid "Failed to delete file from S3: "
msgstr "грешка при запис на файла „%s”: %s"
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:344
+msgid "this attachment is not yet saved"
+msgstr ""
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Няма „счупени” връзки!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "създаване на %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, fuzzy, perl-format
msgid "commenting on %s"
msgstr "създаване на %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "създаване на %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "промяна на %s"
msgstr ""
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
msgid "Failed to revert commit %s"
msgstr "крешка при компилиране на файла %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, fuzzy, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "При използване на приеставката „search” е необходимо е да се укаже %s"
msgid "htmltidy failed to parse this html"
msgstr "няма разпознати усмивки; изключване на приставката „smiley”"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
#, fuzzy
msgid "Image::Magick is not installed"
msgstr "не е инсталиран polygen"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, fuzzy, perl-format
msgid "failed to read %s: %s"
msgstr "грешка при запис на файла „%s”: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, fuzzy, perl-format
msgid "failed to resize: %s"
msgstr "грешка при запис на файла „%s”: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, fuzzy, perl-format
msgid "failed to determine size of image %s"
msgstr "грешка при запис на файла „%s”: %s"
msgid "failed to process template %s"
msgstr "грешка при обработване на шаблона"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "модулът „RPC::XML::Client” не е намерен; източникът не е проверен"
msgid "more"
msgstr ""
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "крешка при компилиране на файла %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr ""
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
#, fuzzy
msgid "LWP not found, not pinging"
msgstr "модулът „RPC::XML::Client” не е намерен; източникът не е проверен"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, fuzzy, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "крешка при компилиране на файла %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, fuzzy, perl-format
msgid "failed to update %s"
msgstr "крешка при компилиране на файла %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, fuzzy, perl-format
msgid "failed to copy the POT file to %s"
msgstr "крешка при компилиране на файла %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, fuzzy, perl-format
msgid "failed to translate %s"
msgstr "грешка при запис на файла „%s”: %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, fuzzy, perl-format
msgid "failed to write %s"
msgstr "грешка при запис на файла „%s”: %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
#, fuzzy
msgid "failed to translate"
msgstr "приставката „linkmap”: грешка при изпълнение на „dot”"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, fuzzy, perl-format
msgid "update for rename of %s to %s"
msgstr "обновяване на страниците от уики „%s”: %s от потребител „%s”"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr "премахване на старата страница „%s”"
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "login"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "премахване на старата страница „%s”"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, fuzzy, perl-format
msgid "building %s, which links to %s"
msgstr "обновяване на страницата „%s”, съдържаща препратки към „%s”"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, fuzzy, perl-format
msgid "removing %s, no longer built by %s"
msgstr "премахване на „%s” понеже не се генерира от „%s”"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, fuzzy, perl-format
msgid "building %s, which depends on %s"
msgstr "обновяване на страницата „%s”, зависеща от „%s”"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, fuzzy, perl-format
msgid "building %s, to update its backlinks"
msgstr "обновяване на „%s” и осъвременяване на обратните връзки"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, fuzzy, perl-format
msgid "building %s"
msgstr "промяна на %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, fuzzy, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: неуспех при обновяване на страницата „%s”"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, fuzzy, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "открита е циклична завидимост при %s на „%s” на дълбочина %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, fuzzy, perl-format
msgid "bad file name %s"
msgstr "пропускане на невалидното име на файл „%s”"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "шаблонът „%s” не е намерен"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "непознат вид сортиране „%s”"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "непознат вид сортиране „%s”"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, fuzzy, perl-format
msgid "cannot match pages: %s"
msgstr "грешка при четене на „%s”: %s"
msgstr ""
"Project-Id-Version: ikiwiki\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2009-09-11 20:23+0200\n"
"Last-Translator: Miroslav Kure <kurem@debian.cz>\n"
"Language-Team: Czech <debian-l10n-czech@lists.debian.org>\n"
msgid "You are banned."
msgstr "Jste vyhoštěni."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Chyba"
msgid "expiring %s"
msgstr "expiruji %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "poslední kontrola %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "kontroluji kanál %s ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "nemohu najít kanál na %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "kanál nebyl nalezen"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(neplatné UTF-8 bylo z kanálu odstraněno)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(entity byly v kanálu zakódovány)"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "kanál shodil XML::Feed!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "vytvářím novou stránku %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "nepodařilo se zpracovat:"
msgid "Failed to delete file from S3: "
msgstr "Nelze smazat soubor z S3:"
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr "stránka nazvaná %s již existuje"
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr "zakázáno proměnnou allowed_attachments"
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr "chybné jméno souboru s přílohou"
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr "příloha nahrána"
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "%s není ani příloha, ani stránka."
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Žádné porušené odkazy!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "komentář k %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
#, fuzzy
msgid "moderation"
msgstr "Schvalování komentářů"
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr "nepodporovaný formát stránky %s"
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr "komentář musí mít obsah"
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr "Anonym"
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
#, fuzzy
msgid "Comment Moderation"
msgstr "Schvalování komentářů"
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr "chybný název stránky"
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr "komentář k %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr "stránka „%s“ neexistuje, takže nemůžete komentovat"
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr "komentáře na stránce „%s“ jsou uzamčeny"
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr "komentář uložen pro schválení"
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr "Váš komentář bude zobrazen po schválení moderátorem"
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr "Přidán komentář"
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr "Přidán komentář: %s"
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr "nejste přihlášeni jako správce"
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr "Schvalování komentářů"
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr "schvalování komentářů"
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, fuzzy, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
#, fuzzy
msgid "Comment"
msgstr "Komentáře"
msgid "%s is not an editable page"
msgstr "%s není editovatelná stránka"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "vytvářím %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "upravuji %s"
msgstr "%s není ani příloha, ani stránka."
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr "nejste oprávněni měnit %s"
msgid "Failed to revert commit %s"
msgstr "nelze zkompilovat %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "%s musíte zadat při každém použití modulu %s"
msgid "htmltidy failed to parse this html"
msgstr "htmltidy se nepodařilo zpracovat toto html"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr "Image::Magick není nainstalován"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "nelze číst %s: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr "chybné rozměry „%s“ (formát má být ŠxV)"
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "nelze změnit velikost: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr "nelze určit velikost obrázku %s"
msgid "failed to process template %s"
msgstr "nepodařilo se zpracovat:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client nebyl nalezen, nepinkám"
msgid "more"
msgstr "více"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "nelze zkompilovat %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr "Ignoruji direktivu ping pro wiki %s (toto je wiki %s)"
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr "LWP nebyl nalezen, nepinkám"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr "varování: rozpoznána stará verze po4a, doporučen přechod na 0.35."
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr "%s není platným kódem jazyka"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
"%s není platnou hodnotou parametru po_link_to, používám po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
"po_link_to=negotiated vyžaduje zapnuté usedirs, používám po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr "aktualizovány PO soubory"
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
"Nemohu odstranit překlad. Nicméně pokud bude odstraněna hlavní stránka, "
"budou odstraněny také její překlady."
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
"Nemohu přejmenovat překlad. Nicméně pokud bude přejmenována hlavní stránka, "
"budou přejmenovány také její překlady."
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr "POT soubor (%s) neexistuje"
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "nepodařilo se zkopírovat PO soubor na %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, perl-format
msgid "failed to update %s"
msgstr "nepodařilo se aktualizovat %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr "nepodařilo se zkopírovat POT soubor na %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr "N/A"
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, perl-format
msgid "failed to translate %s"
msgstr "nepodařilo se přeložit %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr "odstraněny zastaralé PO soubory"
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, perl-format
msgid "failed to write %s"
msgstr "nepodařilo se zapsat %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
msgid "failed to translate"
msgstr "překlad se nezdařil"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
"neplatná gettext data, pro pokračování v úpravách se vraťte na předchozí "
"stránku"
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr "%s není souborem"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr "potvrďte odstranění %s"
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr "Vyberte prosím přílohy, které se mají odstranit."
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr "odstraněno"
msgid "Also rename SubPages and attachments"
msgstr "Také přejmenovat podstránky a přílohy"
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr "Najednou lze přejmenovat pouze jednu přílohu."
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr "Vyberte přílohu, kterou chcete přejmenovat."
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr "přejmenování %s na %s"
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr "aktualizace pro přejmenování %s na %s"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, fuzzy, perl-format
msgid "need Digest::SHA to index %s"
msgstr "pro indexování %s je potřeba Digest::SHA1"
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr "hledání"
msgid "removing transient version of %s"
msgstr "potvrďte odstranění %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "Přihlášení"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, fuzzy, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr "povolit %s?"
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr "konfigurační soubor této wiki je neznámý"
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr "hlavní"
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr "Níže uvedené změny v konfiguraci se projeví až po znovusestavení wiki."
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
"Aby se níže uvedené změny v konfiguraci zcela projevily, budete možná muset "
"znovusestavit wiki."
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "odstraňuji starou stránku %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr "sestavuji %s, která odkazuje na %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr "odstraňuji %s, již není sestavována pomocí %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr "sestavuji %s, která závisí na %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr "sestavuji %s, aby se aktualizovaly zpětné odkazy"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr "sestavuji %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: nelze sestavit %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr "nepodařilo se nahrát externí modul vyžadovaný modulem %s: %s"
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "Byla rozpoznána smyčka na %s v hloubce %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr "chybné jméno souboru %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "šablona %s nebyla nalezena"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr "ano"
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "neznámý typ řazení %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "neznámý typ řazení %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr "nelze vybrat stránky: %s"
msgstr ""
"Project-Id-Version: ikiwiki 3.20110430\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2011-05-05 13:30+0200\n"
"Last-Translator: Jonas Smedegaard <dr@jones.dk>\n"
"Language-Team: None\n"
msgid "You are banned."
msgstr "Du er banlyst."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Fejl"
msgid "expiring %s"
msgstr "udløber %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "senest undersøgt %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "undersøger fødning %s ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "kunne ikke finde fødning ved %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "fødning ikke fundet"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(defekt UTF-8 fjernet fra fødning)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(fødningselementer omgået (escaped))"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "fødning fik XML::Feed til at bryde sammen!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "opretter ny side %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
msgid "failed to process template:"
msgstr "behandling af skabelon mislykkedes:"
msgid "Failed to delete file from S3: "
msgstr "Sletning af fil fra S3 mislykkedes: "
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr "der er allerede en side ved navn %s"
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr "forhindret af allowed_attachments"
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr "dårligt vedhæftningsfilnavn"
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr "vedhæftningsoplægning"
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "%s er en vedhæftning, ikke en side."
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Ingen henvisninger der ikker fungerer!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, perl-format
msgid "this comment needs %s"
msgstr "denne kommentar kræver %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr "moderering"
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr "Ikke-understøttet sideformat %s"
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr "kommentar skal have indhold"
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr "Anonym"
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr "Kommentarmoderering"
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr "dårligt sidenavn"
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr "kommenterer på %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr "siden '%s' eksisterer ikke, så du kan ikke kommentere"
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr "kommentarer på side '%s' er lukket"
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr "kommentar gemt for moderering"
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr "Din kommentar vil blive tilføjet efter moderatorgenemsyn"
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr "Tilføjede en kommentar"
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr "Tilføjede en kommentar: %s"
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr "du er ikke logget på som en administrator"
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr "Kommentarmoderering"
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr "kommentarkoderering"
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr "Kommentér"
msgid "%s is not an editable page"
msgstr "%s er ikke en redigérbar side"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "opretter %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "redigerer %s"
msgstr "%s er en vedhæftning, ikke en side."
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr "Du har ikke lov til at ændre %s"
msgid "Failed to revert commit %s"
msgstr "tilbageføring af indlæg %s mislykkedes"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Skal angive %s når udvidelsen %s bruges"
msgid "htmltidy failed to parse this html"
msgstr "htmltidy kunne ikke afkode dette html"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr "Image::Magick ikke installeret"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "læsning af %s mislykkedes: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr "forkert størrelsesformat \"%s\" (burde være WxH)"
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "Ændring af størrelse mislykkedes: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr "Vurdering af billedstørrelse mislykkedes: %s"
msgid "failed to process template %s"
msgstr "behandling af skabelon %s mislykkedes"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client ikke fundet, pinger ikke"
msgid "more"
msgstr "mere"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, perl-format
msgid "failed to load openid module: "
msgstr "indlæsning af openid-modul mislykkedes: "
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr "ignorerer ping-direktiv for wiki %s (denne wiki er %s)"
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr "LWP ikke fundet, pinger ikke"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr "advarsel: Gammel po4a detekteret. Anbefaler opgradering til 0.35."
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr "%s er ikke en gyldig sprogkode"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
"%s er ikke en gyldig værdi for po_link_to, falder tilbage til "
"po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
"po_link_to=negotiated kræver at usedirs er aktiveret, falder tilbage til "
"po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr "opdaterer PO-filer"
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
"Kan ikke fjerne en oversættelse. Fjern i stedet hovedsiden, så fjernes dens "
"oversættelser også."
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
"Kan ikke omdøbe en oversættelse. Omdøb i stedet hovedsiden, så omdøbes dens "
"oversættelser også."
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr "POT-filen %s eksisterer ikke"
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "kopiering af underlags-PO-fil til %s mislykkedes"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, perl-format
msgid "failed to update %s"
msgstr "opdatering af %s mislykkedes"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr "kopiering af POT-filen til %s mislykkedes"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr "N/A"
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, perl-format
msgid "failed to translate %s"
msgstr "oversættelse af %s mislykkedes"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr "forældede PO filer fjernet"
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, perl-format
msgid "failed to write %s"
msgstr "skrivning af %s mislykkedes"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
msgid "failed to translate"
msgstr "oversættelse mislykkedes"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
"forkert gettext-data, gå tilbage til forrige side og fortsæt redigering"
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr "%s har forkert syntaks: skal bruge CODE|NAME"
msgid "%s is not a file"
msgstr "%s er ikke en fil"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr "bekræft at %s bliver fjernet"
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr "Vælg vedhæftning der skal slettes."
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr "fjernet"
msgid "Also rename SubPages and attachments"
msgstr "Omdøb også UnderSider og vedhæftninger"
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr "Kun en vedhæftning kan blive omdøbt ad gangen."
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr "Vælg vedhæftningen som skal omdøbes."
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr "omdøb %s til %s"
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr "opdatering til omdøbning af %s til %s"
msgid "rsync_command exited %d"
msgstr "rsync_command sluttede (exit code) %d"
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr "behøver Digest::SHA til indeks %s"
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr "søg"
msgid "removing transient version of %s"
msgstr "fjerner kortvarig udgave af %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "Pålogning"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr "aktivér %s?"
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr "opsætningsfilen for denne wiki er ukendt"
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr "primær"
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
"Opsætningsændringerne vist nedenfor kræver wiki-genopbygning for at træde i "
"kraft."
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
"For at opsætningsændringerne vist nedenfor træder fuldt ud i kraft, skal du "
"muligvis genopbygge wikien."
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr "Fejl: %s returnerede ikke-nul (%s). Dropper opsætningsændringer."
msgid "removing obsolete %s"
msgstr "fjerner forældet %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr "danner %s, som henviser til %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr "fjerner %s, ikke længere dannet af %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr "danner %s, som afhænger af %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr "danner %s, for at opdatere dens krydshenvisninger (backlinks)"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr "danner %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: kan ikke danne %s"
msgstr ""
"indlæsning af ekstern udvidelse krævet af udvidelsen %s mislykkedes: %s"
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "forudberegningssløkke fundet på %s ved dybde %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr "dårligt filnavn %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "skabelon %s ikke fundet"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr "ja"
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, perl-format
msgid "invalid sort type %s"
msgstr "forkert sorteringstype %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "ukendt sorteringsform %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr "kan ikke få sider til at passe sammen: %s"
msgstr ""
"Project-Id-Version: ikiwiki 3.14159\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2010-03-14 16:09+0530\n"
"Last-Translator: Sebastian Kuhnert <mail@sebastian-kuhnert.de>\n"
"Language-Team: German <debian-l10n-german@lists.debian.org>\n"
msgid "You are banned."
msgstr "Sie sind ausgeschlossen worden."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Fehler"
msgid "expiring %s"
msgstr "%s läuft aus"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "zuletzt geprüft %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "überprüfe Vorlage (feed) %s ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "konnte Vorlage (feed) unter %s nicht finden"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "Vorlage (feed) nicht gefunden"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(ungültiges UTF-8 wurde aus der Vorlage (feed) entfernt)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(Einträge in der Vorlage (feed) wurden maskiert)"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "Vorlage (feed) führte zum Absturz von XML::Feed!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "erstelle neue Seite %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "Fehler beim Ablauf:"
msgid "Failed to delete file from S3: "
msgstr "Konnte die Datei nicht in S3 löschen: "
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr "eine Seite mit dem Namen %s existiert bereits"
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr "durch allowed_attachements verboten"
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr "fehlerhafter Dateiname für Anhang"
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr "Anhang hochladen"
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "Seite %s ist ein Anhang und keine Seite."
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Es gibt keine ungültigen Verweise!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "kommentiere %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
#, fuzzy
msgid "moderation"
msgstr "Kommentar-Moderation"
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr "nicht unterstütztes Seitenformat %s"
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr "ein Kommentar sollte Inhalt haben"
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr "Anonym"
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
#, fuzzy
msgid "Comment Moderation"
msgstr "Kommentar-Moderation"
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr "fehlerhafter Seitenname"
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr "kommentiere %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
"Seite %s existiert nicht, Sie können sie deshalb auch nicht kommentieren"
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr "Kommentare zur Seite %s sind gesperrt"
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr "Der Kommentar wurde zur Moderation gespeichert"
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr "Ihr Kommentar wird nach Moderation verschickt"
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr "Kommentar hinzugefügt"
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr "Kommentar hinzugefügt: %s"
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr "Sie sind nicht als Administrator angemeldet"
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr "Kommentar-Moderation"
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr "Kommentar-Moderation"
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr "Kommentieren"
msgid "%s is not an editable page"
msgstr "Seite %s kann nicht bearbeitet werden"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "erstelle %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "bearbeite %s"
msgstr "Seite %s ist ein Anhang und keine Seite."
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr "Sie dürfen %s nicht verändern"
msgid "Failed to revert commit %s"
msgstr "erzeugen von %s fehlgeschlagen"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "%s muss angegeben werden, wenn die %s Erweiterung verwandt wird"
msgid "htmltidy failed to parse this html"
msgstr "htmltidy konnte dieses HTML nicht auswerten"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr "Image::Magick ist nicht installiert"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "Lesen von %s fehlgeschlagen: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr "falsches Format in \"%s\" für size (sollte BxH sein)"
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "Größenänderung fehlgeschlagen: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr "Größe des Bildes %s konnte nicht festgestellt werden."
msgid "failed to process template %s"
msgstr "Fehler beim Ablauf:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client nicht gefunden, führe Ping nicht aus"
msgid "more"
msgstr "mehr"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "erzeugen von %s fehlgeschlagen"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr "Ignoriere die ping Anweisung für das Wiki %s (dieses Wiki ist %s)"
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr "LWP nicht gefunden, führe Ping nicht aus"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr "Warnung: Altes po4a erkannt! Empfehle Aktualisierung auf 0.35"
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr "%s ist keine gültige Sprachkodierung"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
"%s ist kein gültiger Wert für po_link_to, greife zurück auf "
"po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
"po_link_to=negotiated benötigt usedirs eingeschaltet, greife zurück auf "
"po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr "PO-Dateien aktualisiert"
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
"Übersetzung kann nicht entfernt werden. Wenn die Master Seite entfernt wird, "
"werden auch ihre Übersetzungen entfernt."
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
"Eine Übersetzung kann nicht umbenannt werden. Wenn die Master Seite "
"unbenannt wird, werden auch ihre Übersetzungen unbenannt."
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr "POT-Datei (%s) existiert nicht"
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "konnte die PO-Datei nicht aus dem Underlay nach %s kopieren"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, perl-format
msgid "failed to update %s"
msgstr "aktualisieren von %s fehlgeschlagen"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr "kopieren der POT-Datei nach %s fehlgeschlagen"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr "N/A"
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, perl-format
msgid "failed to translate %s"
msgstr "übersetzen von %s fehlgeschlagen"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr "überflüssige PO-Dateien wurden entfernt"
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, perl-format
msgid "failed to write %s"
msgstr "schreiben von %s fehlgeschlagen"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
msgid "failed to translate"
msgstr "übersetzen fehlgeschlagen"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
"ungültige gettext Datei, gehe zurück zur vorherigen Seite um weiter zu "
"arbeiten"
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr "%s ist keine Datei"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr "bestätigen Sie die Entfernung von %s"
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr "Bitte wählen Sie die zu entfernenden Anhänge aus."
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr "entfernt"
msgid "Also rename SubPages and attachments"
msgstr "Auch Unterseiten (SubPages) und Anhänge umbenennen"
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr "Es kann immer nur ein Anhang gleichzeitig umbenannt werden."
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr "Bitte wählen Sie den Anhang aus, der umbenannt werden soll."
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr "benenne %s in %s um"
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr "aktualisiert zum Umbenennen von %s nach %s"
msgid "rsync_command exited %d"
msgstr "rsync_command gibt Fehler %d zurück"
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, fuzzy, perl-format
msgid "need Digest::SHA to index %s"
msgstr "benötige Digest::SHA1 um einen Index von %s zu erstellen"
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr "suchen"
msgid "removing transient version of %s"
msgstr "bestätigen Sie die Entfernung von %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "Anmelden"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr "%s aktivieren?"
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr "Die Einrichtungsdatei für dieses Wiki ist unbekannt"
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr "Hauptseite"
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
"Die unten aufgeführten Konfigurationsänderungen erfordern ein Neubau des "
"Wikis, um wirksam zu werden."
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
"Damit die unten aufgeführten Konfigurationsänderungen insgesamt wirksam "
"werden, kann es notwendig sein, das Wikis neu zu bauen."
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "entferne alte Seite %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr "erzeuge %s, die auf %s verweist"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr "entferne %s, wird nicht länger von %s erzeugt"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr "erzeuge %s, die von %s abhängt"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr "erzeuge %s, um dessen Rückverweise zu aktualisieren"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr "erzeuge %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: kann %s nicht erzeugen"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr "Laden der für %s benötigten externen Erweiterung fehlgeschlagen: %s"
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "Präprozessorschleife auf %s in Tiefe %i erkannt"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr "fehlerhafter Dateiname %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "Vorlage %s nicht gefunden"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr "ja"
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "Unbekannter Sortierungstyp %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "Unbekannter Sortierungstyp %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr "Kann die Seiten nicht zuordnen: %s"
msgstr ""
"Project-Id-Version: es\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2009-06-14 12:32+0200\n"
"Last-Translator: Victor Moral <victor@taquiones.net>\n"
"Language-Team: <en@li.org>\n"
msgid "You are banned."
msgstr "Ha sido expulsado."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Error"
msgid "expiring %s"
msgstr "%s caducada"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "última comprobación el %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "comprobando fuente de datos %s ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "no puedo encontrar la fuente de datos en %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "fuente de datos no encontrada"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(una secuencia UTF-8 inválida ha sido eliminada de la fuente de datos)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(los caracteres especiales de la fuente de datos están exceptuados)"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "¡ la fuente de datos ha provocado un error fatal en XML::Feed !"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "creando nueva página %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "se ha producido un error fatal mientras procesaba la plantilla:"
msgid "Failed to delete file from S3: "
msgstr "No puedo borrar archivo en S3: "
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr "ya existe una página de nombre %s"
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr "prohibido por la claúsula allowed_attachments"
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr "nombre de archivo adjunto erróneo"
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr "enviado el adjunto"
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "la página %s no es modificable"
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "¡ No hay enlaces rotos !"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "creando comentarios en la página %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
#, fuzzy
msgid "moderation"
msgstr "Aprobación de comentarios"
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr "formato de página %s no soportado"
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr "Un comentario debe tener algún contenido"
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr "Anónimo"
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
#, fuzzy
msgid "Comment Moderation"
msgstr "Aprobación de comentarios"
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr "nombre de página erróneo"
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr "creando comentarios en la página %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr "la página '%s' no existe, así que no se puede comentar sobre ella"
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr "los comentarios para la página '%s' están cerrados"
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr "comentario guardado a la espera de aprobación"
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr "Su comentario será publicado después de que el moderador lo revise"
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr "Añadir un comentario"
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr "Comentario añadido: %s"
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr "No está registrado como un administrador"
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr "Aprobación de comentarios"
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr "aprobación de comentarios"
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, fuzzy, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
#, fuzzy
msgid "Comment"
msgstr "Comentarios"
msgid "%s is not an editable page"
msgstr "la página %s no es modificable"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "creando página %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "modificando página %s"
msgstr "la página %s no es modificable"
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr "No puede cambiar %s"
msgid "Failed to revert commit %s"
msgstr "ha fallado la compilación del programa %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, fuzzy, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Es obligatorio indicar %s cuando se utiliza el complemento de búsqueda"
msgid "htmltidy failed to parse this html"
msgstr "Algunos emoticonos tienen errores"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr "El complemento Image::Magick no ha sido instalado"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "no puedo leer de %s: %s "
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "dimensionamiento fallido: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr "no he podido determinar el tamaño de la imagen %s"
msgid "failed to process template %s"
msgstr "se ha producido un error fatal mientras procesaba la plantilla:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "No he encontrado el componente RPC::XML::Client, no envío señal alguna"
msgid "more"
msgstr "ver más"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "ha fallado la compilación del programa %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr "Ignorando directiva 'ping' para el wiki %s (este wiki es %s)"
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr "No he encontrado el componente LWP, no envío señal alguna"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, fuzzy, perl-format
msgid "%s is not a valid language code"
msgstr "%s no es un archivo"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, fuzzy, perl-format
msgid "POT file (%s) does not exist"
msgstr "No existe la página %s."
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, fuzzy, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "ha fallado la compilación del programa %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, fuzzy, perl-format
msgid "failed to update %s"
msgstr "ha fallado la compilación del programa %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, fuzzy, perl-format
msgid "failed to copy the POT file to %s"
msgstr "ha fallado la compilación del programa %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, fuzzy, perl-format
msgid "failed to translate %s"
msgstr "dimensionamiento fallido: %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, fuzzy, perl-format
msgid "failed to write %s"
msgstr "dimensionamiento fallido: %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
#, fuzzy
msgid "failed to translate"
msgstr "no he podido ejecutar el programa dot"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr "%s no es un archivo"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr "confirme el borrado de %s"
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr "Por favor seleccione los adjuntos que serán borrados."
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr "borrado"
msgid "Also rename SubPages and attachments"
msgstr "También cambia de nombre las subpáginas y los adjuntos"
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr "Únicamente un adjunto puede ser renombrado a la vez."
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr "Por favor, seleccione el adjunto al que cambiar el nombre."
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr "%s cambia de nombre a %s"
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr "actualizado el cambio de nombre de %s a %s"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, fuzzy, perl-format
msgid "need Digest::SHA to index %s"
msgstr "se necesita la instalación de Digest::SHA1 para indexar %s"
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr "buscar"
msgid "removing transient version of %s"
msgstr "confirme el borrado de %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "Identificación"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, fuzzy, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr "¿ activar %s ?"
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr "El archivo de configuración para este wiki es desconocido"
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr "principal"
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
"Los cambios en la configuración que se muestran más abajo precisan una "
"reconstrucción del wiki para tener efecto."
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
"Para que los cambios en la configuración mostrados más abajo tengan efecto, "
"es posible que necesite reconstruir el wiki."
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "eliminando la antigua página %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, fuzzy, perl-format
msgid "building %s, which links to %s"
msgstr "convirtiendo la página %s, la cual referencia a %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, fuzzy, perl-format
msgid "removing %s, no longer built by %s"
msgstr "eliminando la página %s puesto que ya no se deriva de %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, fuzzy, perl-format
msgid "building %s, which depends on %s"
msgstr "convirtiendo la página %s, la cual depende de %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, fuzzy, perl-format
msgid "building %s, to update its backlinks"
msgstr ""
"convirtiendo la página %s para actualizar la lista de páginas que hacen "
"referencia a ella."
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, fuzzy, perl-format
msgid "building %s"
msgstr "Informaremos a %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, fuzzy, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: no puedo convertir la página %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr "no he podido cargar el complemento externo %s necesario para %s"
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr ""
"se ha detectado en la página %s un bucle de preprocesado en la iteración "
"número %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr "el nombre de archivo %s es erróneo"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "no he encontrado la plantilla %s"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr "si"
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "no conozco este tipo de ordenación %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "no conozco este tipo de ordenación %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr "no encuentro páginas coincidentes: %s"
msgstr ""
"Project-Id-Version: ikiwiki 3.141\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2010-10-03 10:42+0200\n"
"Last-Translator: Philippe Batailler <philippe.batailler@free.fr>\n"
"Language-Team: French <debian-l10n-french@lists.debian.org>\n"
msgid "You are banned."
msgstr "Vous avez été banni."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Erreur"
msgid "expiring %s"
msgstr "Fin de validité de %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "dernière vérification : %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "Vérification du flux %s..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "Impossible de trouver de flux à %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "Flux introuvable "
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(chaîne UTF-8 non valable supprimée du flux)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(échappement des entités de flux)"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "Plantage du flux XML::Feed !"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "Création de la nouvelle page %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
msgid "failed to process template:"
msgstr "Échec du traitementdu modèle :"
msgid "Failed to delete file from S3: "
msgstr "Échec lors de la suppression du fichier sur S3 : "
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr "Il existe déjà une page nommée %s"
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr "Action interdite par allowed_attachments"
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr "Nom de la pièce jointe incorrect"
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr "Envoi de la pièce jointe"
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "%s est une pièce jointe, pas une page."
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Aucun lien cassé !"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, perl-format
msgid "this comment needs %s"
msgstr "Ce commentaire demande %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr "Modération"
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr "Format de page non reconnu %s"
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr "Un commentaire doit avoir un contenu."
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr "Anonyme"
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr "Modération du commentaire"
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr "Nom de page incorrect"
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr "Faire un commentaire sur %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr "La page '%s' n'existe pas, commentaire impossible."
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr "Le commentaire pour la page '%s' est terminé."
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr "Le commentaire a été enregistré, en attente de « modération »"
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr "Votre commentaire sera publié après vérification par le modérateur"
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr "Commentaire ajouté"
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr "Commentaire ajouté : %s"
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr "Vous n'êtes pas authentifié comme administrateur"
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr "Modération du commentaire"
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr "modération du commentaire"
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr "poster un commentaire"
msgid "%s is not an editable page"
msgstr "%s n'est pas une page éditable"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "Création de %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "Édition de %s"
msgstr "%s est une pièce jointe, pas une page."
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr "Vous n'êtes pas autorisé à modifier %s"
msgid "Failed to revert commit %s"
msgstr "Échec de la compilation de %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Vous devez indiquer %s lors de l'utilisation du greffon %s."
msgid "htmltidy failed to parse this html"
msgstr "htmltidy n'a pas pu analyser cette page html"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr "Image::Magick n'est pas installé"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "Échec de la lecture de %s : %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr "Format de la taille incorrect \"%s\", (devrait être LxH)"
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "Échec du redimensionnement : %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr "Échec de la détermination de la taille de l'image : %s"
msgid "failed to process template %s"
msgstr "Échec du traitementdu modèle :"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client introuvable, pas de réponse au ping"
msgid "more"
msgstr "lire la suite"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, perl-format
msgid "failed to load openid module: "
msgstr "Impossible de charger le module openid"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr "Les instructions du wiki %s sont ignorées (ce wiki est %s)"
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr "LWP est introuvable. Pas de réponse au ping"
"Note : ancienne version de po4a détectée. Il est recommandé d'installer la "
"version 0.35."
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr "%s n'est pas un code de langue valable"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
"%s n'est pas une valeur correcte pour po_link_to, retour à la valeur par "
"défaut."
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
"po_link_to=negotiated nécessite que usedirs soit activé, retour à "
"po_link_to=default."
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr "Fichiers PO mis à jour."
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
"Impossible de supprimer cette traduction. Si la page maître est supprimée, "
"alors ses traductions seront supprimées."
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
"Impossible de renommer cette traduction. Si la page maître est renommée, "
"alors ses traductions pourront être renommées."
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr "Le fichier POT %s n'existe pas."
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "Impossible de copier le fichier PO underlay dans %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, perl-format
msgid "failed to update %s"
msgstr "Impossible de mettre à jour %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr "Impossible de copier le fichier POT dans %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr "N/A"
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, perl-format
msgid "failed to translate %s"
msgstr "Impossible de traduire %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr "Fichiers PO obsolètes supprimés."
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, perl-format
msgid "failed to write %s"
msgstr "Impossible de modifier %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
msgid "failed to translate"
msgstr "Impossible de traduire"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
"Données gettext incorrectes, retour à la page précédente pour la poursuite "
"des modifications."
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr "La syntaxe de %s n'est pas correcte : il faut utiliser CODE|NOM"
msgid "%s is not a file"
msgstr "%s n'est pas un fichier"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr "Suppression de %s confirmée"
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr "Veuillez choisir la pièce jointe à supprimer"
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr "supprimé"
msgid "Also rename SubPages and attachments"
msgstr "« SubPages » et attachements renommés."
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr "Modification de pièce jointe : une seule à la fois"
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr "Veuillez sélectionner la pièce jointe à renommer"
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr "Renomme %s en %s"
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr "mise à jour, suite au changement de %s en %s"
msgid "rsync_command exited %d"
msgstr "la commande rsync s'est terminée avec le code : %d"
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr "Digest::SHA1 est nécessaire pour indexer %s"
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr "recherche"
msgid "removing transient version of %s"
msgstr "Suppression de %s confirmée"
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "S’identifier"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr "activer %s ?"
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr "Le fichier de configuration de ce wiki n'est pas connu"
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr "Partie principale"
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
"Les changements de configuration ci-dessous nécessitent une recompilation du "
"wiki pour prendre effet"
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
"Pour que les changements de configuration ci-dessous prennent effet vous "
"devez recompiler le wiki"
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr "Erreur : %s s'est terminé anormalement (%s). Modifications ignorées."
msgid "removing obsolete %s"
msgstr "Suppression de %s obsolète"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr "Reconstruction de %s, qui est lié à %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr "Suppression de %s, qui n'est plus rendu par %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr "Reconstruction de %s, qui dépend de %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr "Reconstruction de %s, afin de mettre à jour ses rétroliens"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr "construction de %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki : impossible de reconstruire %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr "Impossible de charger le greffon externe nécessaire au greffon %s : %s"
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "Une boucle de prétraitement a été détectée sur %s à hauteur de %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr "Nom de fichier incorrect %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "Modèle de page %s introuvable"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr "oui"
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, perl-format
msgid "invalid sort type %s"
msgstr "Type de tri %s inconnu"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "Type de tri %s inconnu"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr "Impossible de trouver les pages : %s"
msgstr ""
"Project-Id-Version: ikiwiki-gu\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2007-01-11 16:05+0530\n"
"Last-Translator: Kartik Mistry <kartik.mistry@gmail.com>\n"
"Language-Team: Gujarati <team@utkarsh.org>\n"
msgid "You are banned."
msgstr "તમારા પર પ્રતિબંધ છે."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "ક્ષતિ"
msgid "expiring %s"
msgstr "જુનું કરે છે %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "ફીડ %s ચકાસે છે ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "%s પર ફીડ મળી શક્યું નહી"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "ફીડ મળ્યું નહી"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, fuzzy, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "ફીડમાંથી અયોગ્ય રીતે UTF-8 નીકાળેલ છે"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "ફીડ ભાંગી ગયું XML::Feed!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "નવું પાનું %s બનાવે છે"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "ક્રિયા કરવામાં નિષ્ફળ:"
msgid "Failed to delete file from S3: "
msgstr "માપ બદલવામાં નિષ્ફળ: %s"
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "%s એ સુધારી શકાય તેવું પાનું નથી"
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "અહીં કોઇ તૂટેલ કડી નથી!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "%s બનાવે છે"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, fuzzy, perl-format
msgid "commenting on %s"
msgstr "%s બનાવે છે"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr "%s એ સુધારી શકાય તેવું પાનું નથી"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "%s બનાવે છે"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "%s સુધારે છે"
msgstr "%s એ સુધારી શકાય તેવું પાનું નથી"
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
msgid "Failed to revert commit %s"
msgstr "%s કમ્પાઇલ કરવામાં નિષ્ફળ"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, fuzzy, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "જ્યારે શોધ પ્લગઇન ઉપયોગ કરતા હોવ ત્યારે %s સ્પષ્ટ કરવું જ પડશે"
msgid "htmltidy failed to parse this html"
msgstr "કોઇપણ સ્માઇલીઓ ઉકેલવામાં નિષ્ફળ"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
#, fuzzy
msgid "Image::Magick is not installed"
msgstr "પોલિગોન સ્થાપિત નથી"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "%s વાંચવામાં નિષ્ફળ: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "માપ બદલવામાં નિષ્ફળ: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, fuzzy, perl-format
msgid "failed to determine size of image %s"
msgstr "માપ બદલવામાં નિષ્ફળ: %s"
msgid "failed to process template %s"
msgstr "ક્રિયા કરવામાં નિષ્ફળ:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client મળ્યું નહી, પિંગ કરવામાં આવતું નથી"
msgid "more"
msgstr "વધુ"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "%s કમ્પાઇલ કરવામાં નિષ્ફળ"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr ""
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
#, fuzzy
msgid "LWP not found, not pinging"
msgstr "RPC::XML::Client મળ્યું નહી, પિંગ કરવામાં આવતું નથી"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, fuzzy, perl-format
msgid "%s is not a valid language code"
msgstr "%s એ સુધારી શકાય તેવું પાનું નથી"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, fuzzy, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "%s કમ્પાઇલ કરવામાં નિષ્ફળ"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, fuzzy, perl-format
msgid "failed to update %s"
msgstr "%s કમ્પાઇલ કરવામાં નિષ્ફળ"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, fuzzy, perl-format
msgid "failed to copy the POT file to %s"
msgstr "%s કમ્પાઇલ કરવામાં નિષ્ફળ"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, fuzzy, perl-format
msgid "failed to translate %s"
msgstr "માપ બદલવામાં નિષ્ફળ: %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, fuzzy, perl-format
msgid "failed to write %s"
msgstr "%s લખવામાં નિષ્ફળ: %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
#, fuzzy
msgid "failed to translate"
msgstr "ડોટ ચલાવવામાં નિષ્ફળ"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr "%s એ સુધારી શકાય તેવું પાનું નથી"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, fuzzy, perl-format
msgid "update for rename of %s to %s"
msgstr "%s નો સુધારો %s નાં %s વડે"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr "જુનાં પાનાં દૂર કરે છે %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "login"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "જુનાં પાનાં દૂર કરે છે %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, fuzzy, perl-format
msgid "building %s, which links to %s"
msgstr "રેન્ડર કરે છે %s, જે %s સાથે જોડાણ ધરાવે છે"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, fuzzy, perl-format
msgid "removing %s, no longer built by %s"
msgstr "દૂર કરે છે %s, હવે %s વડે રેન્ડર કરાતું નથી"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, fuzzy, perl-format
msgid "building %s, which depends on %s"
msgstr "રેન્ડર કરે છે %s, જે %s પર આધારિત છે"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, fuzzy, perl-format
msgid "building %s, to update its backlinks"
msgstr "રેન્ડર કરે છે %s, તેનાં પાછળનાં જોડાણો સુધારવા માટે"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, fuzzy, perl-format
msgid "building %s"
msgstr "%s સુધારે છે"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, fuzzy, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: %s રેન્ડર કરી શકાતું નથી"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, fuzzy, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "%s પર શોધાયેલ લુપ %s પર ચલાવે છે %i ઉંડાણ પર"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, fuzzy, perl-format
msgid "bad file name %s"
msgstr "ખરાબ ફાઇલ નામ છોડી દે છે %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "ટેમ્પલેટ %s મળ્યું નહી"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "અજાણ્યો ગોઠવણી પ્રકાર %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "અજાણ્યો ગોઠવણી પ્રકાર %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, fuzzy, perl-format
msgid "cannot match pages: %s"
msgstr "વાંચી શકાતી નથી %s: %s"
msgstr ""
"Project-Id-Version: PACKAGE VERSION\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-06-03 14:44-0400\n"
+"POT-Creation-Date: 2011-11-06 16:29-0400\n"
"PO-Revision-Date: YEAR-MO-DA HO:MI+ZONE\n"
"Last-Translator: FULL NAME <EMAIL@ADDRESS>\n"
"Language-Team: LANGUAGE <LL@li.org>\n"
msgid "You are banned."
msgstr ""
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1454
msgid "Error"
msgstr ""
msgid "feed crashed XML::Feed!"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:658
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:678 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
msgid "failed to process template:"
msgstr ""
msgid "deleting bucket.."
msgstr ""
-#: ../IkiWiki/Plugin/amazon_s3.pm:38 ../ikiwiki.in:226
+#: ../IkiWiki/Plugin/amazon_s3.pm:38 ../ikiwiki.in:227
msgid "done"
msgstr ""
msgid "Failed to delete file from S3: "
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:295
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:346
+msgid "this attachment is not yet saved"
+msgstr ""
+
+#: ../IkiWiki/Plugin/attachment.pm:363
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, perl-format
msgid "this comment needs %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:272
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:307
#, perl-format
msgid "creating %s"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:325 ../IkiWiki/Plugin/editpage.pm:344
+#: ../IkiWiki/Plugin/editpage.pm:355 ../IkiWiki/Plugin/editpage.pm:400
+#: ../IkiWiki/Plugin/editpage.pm:442
#, perl-format
msgid "editing %s"
msgstr ""
msgid "%s is an attachment, not a page."
msgstr ""
-#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1671
+#: ../IkiWiki/Plugin/git.pm:777 ../IkiWiki/Plugin/git.pm:840
+#: ../IkiWiki.pm:1674
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
-#: ../IkiWiki/Plugin/git.pm:798
+#: ../IkiWiki/Plugin/git.pm:799
#, perl-format
msgid "you cannot act on a file with mode %s"
msgstr ""
-#: ../IkiWiki/Plugin/git.pm:802
+#: ../IkiWiki/Plugin/git.pm:803
msgid "you are not allowed to change file modes"
msgstr ""
-#: ../IkiWiki/Plugin/git.pm:872
+#: ../IkiWiki/Plugin/git.pm:873
msgid "you are not allowed to revert a merge"
msgstr ""
-#: ../IkiWiki/Plugin/git.pm:891
+#: ../IkiWiki/Plugin/git.pm:892
#, perl-format
msgid "Failed to revert commit %s"
msgstr ""
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:41
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr ""
msgid "prog not a valid graphviz program"
msgstr ""
-#: ../IkiWiki/Plugin/highlight.pm:88
+#: ../IkiWiki/Plugin/highlight.pm:83
#, perl-format
msgid "tohighlight contains unknown file type '%s'"
msgstr ""
-#: ../IkiWiki/Plugin/highlight.pm:99
+#: ../IkiWiki/Plugin/highlight.pm:94
#, perl-format
msgid "Source code: %s"
msgstr ""
-#: ../IkiWiki/Plugin/highlight.pm:184
+#: ../IkiWiki/Plugin/highlight.pm:179
msgid ""
"warning: highlight perl module not available; falling back to pass through"
msgstr ""
msgid "htmltidy failed to parse this html"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr ""
msgid "failed to process template %s"
msgstr ""
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr ""
msgid "redir cycle is not allowed"
msgstr ""
-#: ../IkiWiki/Plugin/meta.pm:425
+#: ../IkiWiki/Plugin/meta.pm:427
msgid "sort=meta requires a parameter"
msgstr ""
msgid "more"
msgstr ""
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, perl-format
msgid "failed to load openid module: "
msgstr ""
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:461
+#: ../IkiWiki/Plugin/po.pm:468
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:484
+#: ../IkiWiki/Plugin/po.pm:491
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:504
+#: ../IkiWiki/Plugin/po.pm:511
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:950
+#: ../IkiWiki/Plugin/po.pm:957
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:964
+#: ../IkiWiki/Plugin/po.pm:971
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:973
+#: ../IkiWiki/Plugin/po.pm:980
#, perl-format
msgid "failed to update %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:979
+#: ../IkiWiki/Plugin/po.pm:986
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1015
+#: ../IkiWiki/Plugin/po.pm:1022
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1026
+#: ../IkiWiki/Plugin/po.pm:1033
#, perl-format
msgid "failed to translate %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1105
+#: ../IkiWiki/Plugin/po.pm:1112
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
-#: ../IkiWiki/Plugin/po.pm:1213
+#: ../IkiWiki/Plugin/po.pm:1169 ../IkiWiki/Plugin/po.pm:1181
+#: ../IkiWiki/Plugin/po.pm:1220
#, perl-format
msgid "failed to write %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1172
+#: ../IkiWiki/Plugin/po.pm:1179
msgid "failed to translate"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1225
+#: ../IkiWiki/Plugin/po.pm:1232
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1268
+#: ../IkiWiki/Plugin/po.pm:1275
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:149
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:186
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:230
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr ""
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:199
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:253
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr ""
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "login"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "removing obsolete %s"
msgstr ""
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr ""
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr ""
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr ""
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr ""
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr ""
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr ""
msgid "usage: --set-yaml var=value"
msgstr ""
-#: ../ikiwiki.in:215
+#: ../ikiwiki.in:216
msgid "rebuilding wiki.."
msgstr ""
-#: ../ikiwiki.in:218
+#: ../ikiwiki.in:219
msgid "refreshing wiki.."
msgstr ""
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1435
+#: ../IkiWiki.pm:1436
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr ""
-#: ../IkiWiki.pm:1627
+#: ../IkiWiki.pm:1630
#, perl-format
msgid "bad file name %s"
msgstr ""
-#: ../IkiWiki.pm:1927
+#: ../IkiWiki.pm:1930
#, perl-format
msgid "template %s not found"
msgstr ""
-#: ../IkiWiki.pm:2177
+#: ../IkiWiki.pm:2180
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2254
+#: ../IkiWiki.pm:2257
#, perl-format
msgid "invalid sort type %s"
msgstr ""
-#: ../IkiWiki.pm:2275
+#: ../IkiWiki.pm:2278
#, perl-format
msgid "unknown sort type %s"
msgstr ""
-#: ../IkiWiki.pm:2411
+#: ../IkiWiki.pm:2414
#, perl-format
msgid "cannot match pages: %s"
msgstr ""
msgstr ""
"Project-Id-Version: Ikiwiki\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2009-08-16 11:01+0100\n"
"Last-Translator: Luca Bruno <lucab@debian.org>\n"
"Language-Team: Italian TP <tp@lists.linux.it>\n"
msgid "You are banned."
msgstr "Avete ricevuto un ban."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Errore"
msgid "expiring %s"
msgstr "in scadenza %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "ultimo controllo %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "controllo notiziario %s..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "impossibile trovare il notiziario %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "notiziario non trovato"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(codifica UTF-8 non valida eliminata dal notiziario)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(entità del notiziario espanse con escape)"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "il notiziario ha fatto andare in crash XML::Feed."
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "creazione nuova pagina %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "errore nell'elaborazione:"
msgid "Failed to delete file from S3: "
msgstr "Impossibile eliminare il file dal S3: "
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr "esiste già una pagina chiamata %s"
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr "non permesso da allowed_attachments"
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr "nome file dell'allegato non valido"
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr "carica allegato"
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "%s è un allegato, non una pagina."
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Non ci sono collegamenti rotti."
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "commento su %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
#, fuzzy
msgid "moderation"
msgstr "Moderazione commenti"
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr "formato pagina %s non supportato"
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr "i commenti devono avere un contenuto"
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr "Anonimo"
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
#, fuzzy
msgid "Comment Moderation"
msgstr "Moderazione commenti"
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr "nome pagina non valido"
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr "commento su %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr "la pagina «%s» non esiste, impossibile commentarla"
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr "i commenti per la pagina «%s» sono chiusi"
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr "commento trattenuto per moderazione"
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr "Il commento sarà pubblicato dopo la verifica del moderatore"
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr "Aggiunto commento"
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr "Aggiunto commento: %s"
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr "non siete autenticati come amministratore"
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr "Moderazione commenti"
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr "moderazione commento"
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, fuzzy, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
#, fuzzy
msgid "Comment"
msgstr "Commenti"
msgid "%s is not an editable page"
msgstr "%s non è una pagina modificabile"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "creazione %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "modifica %s"
msgstr "%s è un allegato, non una pagina."
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr "non è permesso modificare %s"
msgid "Failed to revert commit %s"
msgstr "errore nel compilare %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Occorre specificare %s quando si usa il plugin %s"
msgid "htmltidy failed to parse this html"
msgstr "impossibile interpretare gli smile"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr "Image::Magick non è installato"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr "impossibile leggere %s: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr "Formato dimensione «%s» non valido (dovrebbe essere LxA)"
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr "impossibile ridimensionare: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr "impossibile determinare la dimensione dell'immagine %s"
msgid "failed to process template %s"
msgstr "errore nell'elaborazione:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client non trovato, impossibile inviare ping"
msgid "more"
msgstr "altro"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "errore nel compilare %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr "Ignorata la richiesta di ping per il wiki %s (questo wiki è %s)"
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr "LWP non trovato, ping non inviato"
"attenzione: è presente un vecchio po4a. Si raccomanda di aggiornare almeno "
"alla versione 0.35."
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr "%s non è una codifica di lingua valida"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
"%s non è un valore per po_link_to valido, verrà utilizzato po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
"po_link_to=negotiated richiede che venga abilitato usedirs, verrà utilizzato "
"po_link_to=default"
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr "file PO aggiornati"
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
"Impossibile eliminare una traduzione. Tuttavia, se la pagina principale è "
"stata eliminata anche le traduzioni lo saranno."
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
"Impossibile rinominare una traduzione. Tuttavia, se la pagina principale è "
"stata rinominata anche le traduzioni lo saranno."
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr "Il file POT (%s) non esiste"
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "impossibile copiare il file PO di underlay in %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, perl-format
msgid "failed to update %s"
msgstr "impossibile aggiornare %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr "impossibile copiare il file POT in %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr "N/D"
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, perl-format
msgid "failed to translate %s"
msgstr "impossibile tradurre %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr "file PO obsoleti rimossi"
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, perl-format
msgid "failed to write %s"
msgstr "impossibile scrivere %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
msgid "failed to translate"
msgstr "impossibile tradurre"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
"dati gettext non validi, tornare alle pagina precedente per continuare le "
"modifiche"
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr "%s non è un file"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr "conferma rimozione di %s"
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr "Selezionare l'allegato da rimuovere."
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr "rimosso"
msgid "Also rename SubPages and attachments"
msgstr "Rinomina anche SottoPagine e allegati"
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr "Si può rinominare un solo allegato alla volta."
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr "Selezionare l'allegato da rinominare."
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr "rinomina %s in %s"
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr "aggiornamento per rinomina di %s in %s"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, fuzzy, perl-format
msgid "need Digest::SHA to index %s"
msgstr "è necessario Digest::SHA1 per l'indice di %s"
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr "cerca"
msgid "removing transient version of %s"
msgstr "conferma rimozione di %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "Entra"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, fuzzy, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr "abilitare %s?"
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr "il file di setup di questo wiki non è noto"
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr "principale"
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
"Le sottostanti modifiche alla configurazione richiedono la ricompilazione "
"del wiki."
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
"Affinché le sottostanti modifiche alla configurazione abbiano effetto, "
"occorre ricostruire il wiki."
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr "Errore: %s è terminato con errore (%s). Modifiche al setup scartate."
msgid "removing obsolete %s"
msgstr "rimozione della vecchia pagina %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr "compilazione di %s, che è collegato a %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr "rimozione di %s, non più richiesto da %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr "compilazione di %s, che dipende da %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr "compilazione di %s, per aggiornare i collegamenti ai precedenti"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr "compilazione di %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: impossibile compilare %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr "impossibile caricare il plugin esterno per il plugin %s: %s"
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "ciclo del preprocessore individuato su %s alla profondità %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr "nome file %s scorretto"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "modello %s non trovato"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr "sì"
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "ordinamento %s sconosciuto"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "ordinamento %s sconosciuto"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr "impossibile trovare pagine corrispondenti: %s"
msgstr ""
"Project-Id-Version: ikiwiki 1.51\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2007-04-27 22:05+0200\n"
"Last-Translator: Pawel Tecza <ptecza@net.icm.edu.pl>\n"
"Language-Team: Debian L10n Polish <debian-l10n-polish@lists.debian.org>\n"
msgid "You are banned."
msgstr "Twój dostęp został zabroniony przez administratora."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Błąd"
msgid "expiring %s"
msgstr "wygasający wpis %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "sprawdzanie kanału RSS %s..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "nie znaleziono kanału RSS pod adresem %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
#, fuzzy
msgid "feed not found"
msgstr "nieznaleziony kanał RSS"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, fuzzy, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "Nieprawidłowe kodowanie UTF-8 usunięte z kanału RSS"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "awaria kanału RSS w module XML::Feed!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "tworzenie nowej strony %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "awaria w trakcie przetwarzania:"
msgid "Failed to delete file from S3: "
msgstr "awaria w trakcie zmiany rozmiaru: %s"
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:344
+#, fuzzy
+msgid "this attachment is not yet saved"
+msgstr "Strona %s nie może być edytowana"
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Wszystkie odnośniki są aktualne!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "tworzenie %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, fuzzy, perl-format
msgid "commenting on %s"
msgstr "tworzenie %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr "Strona %s nie może być edytowana"
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "tworzenie %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "edycja %s"
msgstr "Strona %s nie może być edytowana"
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
msgid "Failed to revert commit %s"
msgstr "awaria w trakcie kompilowania %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, fuzzy, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Wtyczka do wyszukiwarka wymaga podania %s"
msgid "htmltidy failed to parse this html"
msgstr "awaria w trakcie przetwarzania emitoikonki"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
#, fuzzy
msgid "Image::Magick is not installed"
msgstr "wtyczka polygen nie jest zainstalowana"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, fuzzy, perl-format
msgid "failed to read %s: %s"
msgstr "awaria w trakcie odczytu %s: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, fuzzy, perl-format
msgid "failed to resize: %s"
msgstr "awaria w trakcie zmiany rozmiaru: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, fuzzy, perl-format
msgid "failed to determine size of image %s"
msgstr "awaria w trakcie zmiany rozmiaru: %s"
msgid "failed to process template %s"
msgstr "awaria w trakcie przetwarzania:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "Nieznaleziony moduł RPC::XML::Client, brak możliwości pingowania"
msgid "more"
msgstr "więcej"
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "awaria w trakcie kompilowania %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr ""
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
#, fuzzy
msgid "LWP not found, not pinging"
msgstr "Nieznaleziony moduł RPC::XML::Client, brak możliwości pingowania"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, fuzzy, perl-format
msgid "%s is not a valid language code"
msgstr "Strona %s nie może być edytowana"
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, fuzzy, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "awaria w trakcie kompilowania %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, fuzzy, perl-format
msgid "failed to update %s"
msgstr "awaria w trakcie kompilowania %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, fuzzy, perl-format
msgid "failed to copy the POT file to %s"
msgstr "awaria w trakcie kompilowania %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, fuzzy, perl-format
msgid "failed to translate %s"
msgstr "awaria w trakcie zmiany rozmiaru: %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, fuzzy, perl-format
msgid "failed to write %s"
msgstr "awaria w trakcie zapisu %s: %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
#, fuzzy
msgid "failed to translate"
msgstr "awaria w trakcie uruchamiania dot"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr "Strona %s nie może być edytowana"
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, fuzzy, perl-format
msgid "update for rename of %s to %s"
msgstr "aktualizacja stron wiki %s: %s przez użytkownika %s"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr "usuwanie starej strony %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "login"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "usuwanie starej strony %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, fuzzy, perl-format
msgid "building %s, which links to %s"
msgstr "renderowanie %s z odnośnikiem do %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, fuzzy, perl-format
msgid "removing %s, no longer built by %s"
msgstr "usuwanie %s nie tworzonego już przez %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, fuzzy, perl-format
msgid "building %s, which depends on %s"
msgstr "renderowanie %s zależącego od %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, fuzzy, perl-format
msgid "building %s, to update its backlinks"
msgstr "renderowanie %s w celu aktualizacji powrotnych odnośników"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, fuzzy, perl-format
msgid "building %s"
msgstr "edycja %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, fuzzy, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: awaria w trakcie tworzenia %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, fuzzy, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "polecenie preprocesora %s wykryte w %s na głębokości %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, fuzzy, perl-format
msgid "bad file name %s"
msgstr "pomijanie nieprawidłowej nazwy pliku %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "nieznaleziony szablon %s"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "nieznany sposób sortowania %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "nieznany sposób sortowania %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, fuzzy, perl-format
msgid "cannot match pages: %s"
msgstr "awaria w trakcie odczytu %s: %s"
msgstr ""
"Project-Id-Version: ikiwiki\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2007-01-10 23:47+0100\n"
"Last-Translator: Daniel Nylander <po@danielnylander.se>\n"
"Language-Team: Swedish <tp-sv@listor.tp-sv.se>\n"
msgid "You are banned."
msgstr "Du är bannlyst."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Fel"
msgid "expiring %s"
msgstr "låter %s gå ut"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "kontrollerar kanalen %s ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "kunde inte hitta kanalen på %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
#, fuzzy
msgid "feed not found"
msgstr "mallen %s hittades inte"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "kanalen kraschade XML::Feed!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "skapar nya sidan %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "misslyckades med att behandla mall:"
msgid "Failed to delete file from S3: "
msgstr "misslyckades med att skriva %s: %s"
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:344
+msgid "this attachment is not yet saved"
+msgstr ""
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Det finns inga trasiga länkar!"
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "skapar %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, fuzzy, perl-format
msgid "commenting on %s"
msgstr "skapar %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "skapar %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "redigerar %s"
msgstr ""
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
msgid "Failed to revert commit %s"
msgstr "misslyckades med att kompilera %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, fuzzy, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Måste ange %s när sökinsticket används"
msgid "htmltidy failed to parse this html"
msgstr "misslyckades med att tolka smilisar, inaktiverar instick"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
#, fuzzy
msgid "Image::Magick is not installed"
msgstr "polygen inte installerad"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, fuzzy, perl-format
msgid "failed to read %s: %s"
msgstr "misslyckades med att skriva %s: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, fuzzy, perl-format
msgid "failed to resize: %s"
msgstr "misslyckades med att skriva %s: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, fuzzy, perl-format
msgid "failed to determine size of image %s"
msgstr "misslyckades med att skriva %s: %s"
msgid "failed to process template %s"
msgstr "misslyckades med att behandla mall:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "RPC::XML::Client hittades inte, pingar inte"
msgid "more"
msgstr ""
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "misslyckades med att kompilera %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr ""
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
#, fuzzy
msgid "LWP not found, not pinging"
msgstr "RPC::XML::Client hittades inte, pingar inte"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, fuzzy, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "misslyckades med att kompilera %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, fuzzy, perl-format
msgid "failed to update %s"
msgstr "misslyckades med att kompilera %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, fuzzy, perl-format
msgid "failed to copy the POT file to %s"
msgstr "misslyckades med att kompilera %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, fuzzy, perl-format
msgid "failed to translate %s"
msgstr "misslyckades med att skriva %s: %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, fuzzy, perl-format
msgid "failed to write %s"
msgstr "misslyckades med att skriva %s: %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
#, fuzzy
msgid "failed to translate"
msgstr "linkmap misslyckades att köra dot"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, fuzzy, perl-format
msgid "update for rename of %s to %s"
msgstr "uppdatering av %s, %s av %s"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr "tar bort gammal sida %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "login"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "tar bort gammal sida %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, fuzzy, perl-format
msgid "building %s, which links to %s"
msgstr "ritar upp %s, vilken länkar till %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, fuzzy, perl-format
msgid "removing %s, no longer built by %s"
msgstr "tar bort %s, som inte längre ritas upp av %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, fuzzy, perl-format
msgid "building %s, which depends on %s"
msgstr "ritar upp %s, vilken är beroende av %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, fuzzy, perl-format
msgid "building %s, to update its backlinks"
msgstr "ritar upp %s, för att uppdatera dess bakåtlänkar"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, fuzzy, perl-format
msgid "building %s"
msgstr "redigerar %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, fuzzy, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: kan inte rita upp %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, fuzzy, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "%s förbehandlingsslinga detekterades på %s, djup %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, fuzzy, perl-format
msgid "bad file name %s"
msgstr "hoppar över felaktigt filnamn %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "mallen %s hittades inte"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "okänd sorteringstyp %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "okänd sorteringstyp %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, fuzzy, perl-format
msgid "cannot match pages: %s"
msgstr "kan inte läsa %s: %s"
msgstr ""
"Project-Id-Version: ikiwiki 3.20091031\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2009-11-08 03:04+0200\n"
"Last-Translator: Recai Oktaş <roktas@debian.org>\n"
"Language-Team: Turkish <debian-l10n-turkish@lists.debian.org>\n"
msgid "You are banned."
msgstr ""
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Hata"
msgid "expiring %s"
msgstr "%s için zaman aşımı"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr "son güncelleme: %s"
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "%s özet akışı denetleniyor ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "%s özet akışı bulunamadı"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
msgid "feed not found"
msgstr "özet akışı bulunamadı"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr "(geçersiz UTF-8 dizgisi özet akışından çıkarıldı)"
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr "(özet akışı girdileri işlendi)"
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "özet akışı XML::Feed'in çakılmasına yol açtı!"
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "%s için yeni sayfa oluşturuluyor"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
msgid "failed to process template:"
msgstr ""
msgid "Failed to delete file from S3: "
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:344
+msgid "this attachment is not yet saved"
+msgstr ""
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, perl-format
msgid "this comment needs %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, perl-format
msgid "commenting on %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr ""
msgstr ""
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
msgid "Failed to revert commit %s"
msgstr ""
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr ""
msgid "htmltidy failed to parse this html"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
msgid "Image::Magick is not installed"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, perl-format
msgid "failed to read %s: %s"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, perl-format
msgid "failed to resize: %s"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, perl-format
msgid "failed to determine size of image %s"
msgstr ""
msgid "failed to process template %s"
msgstr ""
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr ""
msgid "more"
msgstr ""
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, perl-format
msgid "failed to load openid module: "
msgstr ""
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr ""
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
msgid "LWP not found, not pinging"
msgstr ""
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, perl-format
msgid "failed to update %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, perl-format
msgid "failed to copy the POT file to %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, perl-format
msgid "failed to translate %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, perl-format
msgid "failed to write %s"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
msgid "failed to translate"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, perl-format
msgid "update for rename of %s to %s"
msgstr ""
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr ""
+#: ../IkiWiki/Plugin/userlist.pm:59
+#, fuzzy
+msgid "login"
+msgstr "Giriş"
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr ""
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, perl-format
msgid "building %s, which links to %s"
msgstr ""
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, perl-format
msgid "removing %s, no longer built by %s"
msgstr ""
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, perl-format
msgid "building %s, which depends on %s"
msgstr ""
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, perl-format
msgid "building %s, to update its backlinks"
msgstr ""
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, perl-format
msgid "building %s"
msgstr ""
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, perl-format
msgid "ikiwiki: cannot build %s"
msgstr ""
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr ""
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, perl-format
msgid "bad file name %s"
msgstr ""
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr ""
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, perl-format
msgid "invalid sort type %s"
msgstr ""
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr ""
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, perl-format
msgid "cannot match pages: %s"
msgstr ""
"wiki/%s\"]]"
msgstr ""
"[[!shortcut name=wiktionary url=\"https://secure.wikimedia.org/wiktionary/en/"
+"wiki/%s\"]]"
#. type: Bullet: '* '
msgid ""
msgstr ""
"Project-Id-Version: ikiwiki\n"
"Report-Msgid-Bugs-To: \n"
-"POT-Creation-Date: 2011-04-30 17:20-0400\n"
+"POT-Creation-Date: 2011-07-11 18:36-0400\n"
"PO-Revision-Date: 2007-01-13 15:31+1030\n"
"Last-Translator: Clytie Siddall <clytie@riverland.net.au>\n"
"Language-Team: Vietnamese <vi-VN@googlegroups.com>\n"
msgid "You are banned."
msgstr "Bạn bị cấm ra."
-#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1443
+#: ../IkiWiki/CGI.pm:464 ../IkiWiki/CGI.pm:465 ../IkiWiki.pm:1453
msgid "Error"
msgstr "Lỗi"
msgid "expiring %s"
msgstr "đang mãn hạn %s"
-#: ../IkiWiki/Plugin/aggregate.pm:509
+#: ../IkiWiki/Plugin/aggregate.pm:510
#, perl-format
msgid "last checked %s"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:513
+#: ../IkiWiki/Plugin/aggregate.pm:514
#, perl-format
msgid "checking feed %s ..."
msgstr "đang kiểm tra nguồn tin %s ..."
-#: ../IkiWiki/Plugin/aggregate.pm:518
+#: ../IkiWiki/Plugin/aggregate.pm:519
#, perl-format
msgid "could not find feed at %s"
msgstr "không tìm thấy nguồn tin ở %s"
-#: ../IkiWiki/Plugin/aggregate.pm:541
+#: ../IkiWiki/Plugin/aggregate.pm:542
#, fuzzy
msgid "feed not found"
msgstr "không tìm thấy mẫu %s"
-#: ../IkiWiki/Plugin/aggregate.pm:552
+#: ../IkiWiki/Plugin/aggregate.pm:553
#, perl-format
msgid "(invalid UTF-8 stripped from feed)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:560
+#: ../IkiWiki/Plugin/aggregate.pm:561
#, perl-format
msgid "(feed entities escaped)"
msgstr ""
-#: ../IkiWiki/Plugin/aggregate.pm:568
+#: ../IkiWiki/Plugin/aggregate.pm:569
msgid "feed crashed XML::Feed!"
msgstr "nguồn tin đã gây ra XML::Feed sụp đổ."
-#: ../IkiWiki/Plugin/aggregate.pm:657
+#: ../IkiWiki/Plugin/aggregate.pm:661
#, perl-format
msgid "creating new page %s"
msgstr "đang tạo trang mới %s"
-#: ../IkiWiki/Plugin/aggregate.pm:677 ../IkiWiki/Plugin/edittemplate.pm:135
+#: ../IkiWiki/Plugin/aggregate.pm:689 ../IkiWiki/Plugin/edittemplate.pm:135
#, fuzzy
msgid "failed to process template:"
msgstr "mẫu không xử lý được:"
msgid "Failed to delete file from S3: "
msgstr "lỗi ghi %s: %s"
-#: ../IkiWiki/Plugin/attachment.pm:50
+#: ../IkiWiki/Plugin/attachment.pm:52
#, perl-format
msgid "there is already a page named %s"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:66
+#: ../IkiWiki/Plugin/attachment.pm:68
msgid "prohibited by allowed_attachments"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:144
+#: ../IkiWiki/Plugin/attachment.pm:225
msgid "bad attachment filename"
msgstr ""
-#: ../IkiWiki/Plugin/attachment.pm:188
+#: ../IkiWiki/Plugin/attachment.pm:293
msgid "attachment upload"
msgstr ""
+#: ../IkiWiki/Plugin/attachment.pm:344
+msgid "this attachment is not yet saved"
+msgstr ""
+
+#: ../IkiWiki/Plugin/attachment.pm:361
+msgid "just uploaded"
+msgstr ""
+
#: ../IkiWiki/Plugin/autoindex.pm:43
#, fuzzy, perl-format
msgid "creating index page %s"
msgid "There are no broken links!"
msgstr "Không có liên kết bị ngắt nào."
-#: ../IkiWiki/Plugin/comments.pm:113
+#: ../IkiWiki/Plugin/comments.pm:114
#, fuzzy, perl-format
msgid "this comment needs %s"
msgstr "đang tạo %s"
-#: ../IkiWiki/Plugin/comments.pm:116
+#: ../IkiWiki/Plugin/comments.pm:117
msgid "moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:137 ../IkiWiki/Plugin/format.pm:50
+#: ../IkiWiki/Plugin/comments.pm:138 ../IkiWiki/Plugin/format.pm:50
#, perl-format
msgid "unsupported page format %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:142
+#: ../IkiWiki/Plugin/comments.pm:143
msgid "comment must have content"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:195
+#: ../IkiWiki/Plugin/comments.pm:201
msgid "Anonymous"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:257
+#: ../IkiWiki/Plugin/comments.pm:263
msgid "Comment Moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:373 ../IkiWiki/Plugin/editpage.pm:95
+#: ../IkiWiki/Plugin/comments.pm:379 ../IkiWiki/Plugin/editpage.pm:95
#: ../IkiWiki/Plugin/editpage.pm:101
msgid "bad page name"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:376
+#: ../IkiWiki/Plugin/comments.pm:382
#, fuzzy, perl-format
msgid "commenting on %s"
msgstr "đang tạo %s"
-#: ../IkiWiki/Plugin/comments.pm:393
+#: ../IkiWiki/Plugin/comments.pm:399
#, perl-format
msgid "page '%s' doesn't exist, so you can't comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:400
+#: ../IkiWiki/Plugin/comments.pm:406
#, perl-format
msgid "comments on page '%s' are closed"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:514
+#: ../IkiWiki/Plugin/comments.pm:520
msgid "comment stored for moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:516
+#: ../IkiWiki/Plugin/comments.pm:522
msgid "Your comment will be posted after moderator review"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:529
+#: ../IkiWiki/Plugin/comments.pm:535
msgid "Added a comment"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:533
+#: ../IkiWiki/Plugin/comments.pm:539
#, perl-format
msgid "Added a comment: %s"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:602 ../IkiWiki/Plugin/websetup.pm:269
+#: ../IkiWiki/Plugin/comments.pm:608 ../IkiWiki/Plugin/userlist.pm:55
+#: ../IkiWiki/Plugin/websetup.pm:272
msgid "you are not logged in as an admin"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:654
+#: ../IkiWiki/Plugin/comments.pm:660
msgid "Comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:695
+#: ../IkiWiki/Plugin/comments.pm:701
msgid "comment moderation"
msgstr ""
-#: ../IkiWiki/Plugin/comments.pm:856
+#: ../IkiWiki/Plugin/comments.pm:862
#, perl-format
msgid "%i comment"
msgid_plural "%i comments"
#. translators: Here "Comment" is a verb;
#. translators: the user clicks on it to
#. translators: post a comment.
-#: ../IkiWiki/Plugin/comments.pm:866
+#: ../IkiWiki/Plugin/comments.pm:872
msgid "Comment"
msgstr ""
msgid "%s is not an editable page"
msgstr ""
-#: ../IkiWiki/Plugin/editpage.pm:298
+#: ../IkiWiki/Plugin/editpage.pm:305
#, perl-format
msgid "creating %s"
msgstr "đang tạo %s"
-#: ../IkiWiki/Plugin/editpage.pm:316 ../IkiWiki/Plugin/editpage.pm:335
-#: ../IkiWiki/Plugin/editpage.pm:346 ../IkiWiki/Plugin/editpage.pm:391
-#: ../IkiWiki/Plugin/editpage.pm:433
+#: ../IkiWiki/Plugin/editpage.pm:323 ../IkiWiki/Plugin/editpage.pm:342
+#: ../IkiWiki/Plugin/editpage.pm:353 ../IkiWiki/Plugin/editpage.pm:398
+#: ../IkiWiki/Plugin/editpage.pm:440
#, perl-format
msgid "editing %s"
msgstr "đang sửa %s"
msgstr ""
#: ../IkiWiki/Plugin/git.pm:776 ../IkiWiki/Plugin/git.pm:839
-#: ../IkiWiki.pm:1653
+#: ../IkiWiki.pm:1671
#, perl-format
msgid "you are not allowed to change %s"
msgstr ""
msgid "Failed to revert commit %s"
msgstr "lỗi biên dịch %s"
-#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:38
+#: ../IkiWiki/Plugin/google.pm:26 ../IkiWiki/Plugin/search.pm:39
#, fuzzy, perl-format
msgid "Must specify %s when using the %s plugin"
msgstr "Cần phải xác định %s khi dùng bổ sung tìm kiếm"
msgid "htmltidy failed to parse this html"
msgstr "lỗi phân tách hình cười nào nên tắt bổ sung"
-#: ../IkiWiki/Plugin/img.pm:69
+#: ../IkiWiki/Plugin/img.pm:70
#, fuzzy
msgid "Image::Magick is not installed"
msgstr "chưa cài đặt polygen"
-#: ../IkiWiki/Plugin/img.pm:73 ../IkiWiki/Plugin/img.pm:117
+#: ../IkiWiki/Plugin/img.pm:74 ../IkiWiki/Plugin/img.pm:118
#, fuzzy, perl-format
msgid "failed to read %s: %s"
msgstr "lỗi ghi %s: %s"
-#: ../IkiWiki/Plugin/img.pm:79
+#: ../IkiWiki/Plugin/img.pm:80
#, perl-format
msgid "wrong size format \"%s\" (should be WxH)"
msgstr ""
-#: ../IkiWiki/Plugin/img.pm:122
+#: ../IkiWiki/Plugin/img.pm:123
#, fuzzy, perl-format
msgid "failed to resize: %s"
msgstr "lỗi ghi %s: %s"
-#: ../IkiWiki/Plugin/img.pm:146
+#: ../IkiWiki/Plugin/img.pm:147
#, fuzzy, perl-format
msgid "failed to determine size of image %s"
msgstr "lỗi ghi %s: %s"
msgid "failed to process template %s"
msgstr "mẫu không xử lý được:"
-#: ../IkiWiki/Plugin/inline.pm:693
+#: ../IkiWiki/Plugin/inline.pm:695
msgid "RPC::XML::Client not found, not pinging"
msgstr "Không tìm thấy RPC::XML::Client nên không gửi gói tin ping"
msgid "more"
msgstr ""
-#: ../IkiWiki/Plugin/openid.pm:70
+#: ../IkiWiki/Plugin/openid.pm:71
#, fuzzy, perl-format
msgid "failed to load openid module: "
msgstr "lỗi biên dịch %s"
msgid "Ignoring ping directive for wiki %s (this wiki is %s)"
msgstr ""
-#: ../IkiWiki/Plugin/pinger.pm:78
+#: ../IkiWiki/Plugin/pinger.pm:80
#, fuzzy
msgid "LWP not found, not pinging"
msgstr "Không tìm thấy RPC::XML::Client nên không gửi gói tin ping"
msgid "warning: Old po4a detected! Recommend upgrade to 0.35."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:179
+#: ../IkiWiki/Plugin/po.pm:180
#, perl-format
msgid "%s is not a valid language code"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:191
+#: ../IkiWiki/Plugin/po.pm:192
#, perl-format
msgid ""
"%s is not a valid value for po_link_to, falling back to po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:196
+#: ../IkiWiki/Plugin/po.pm:197
msgid ""
"po_link_to=negotiated requires usedirs to be enabled, falling back to "
"po_link_to=default"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:460
+#: ../IkiWiki/Plugin/po.pm:461
msgid "updated PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:483
+#: ../IkiWiki/Plugin/po.pm:484
msgid ""
"Can not remove a translation. If the master page is removed, however, its "
"translations will be removed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:503
+#: ../IkiWiki/Plugin/po.pm:504
msgid ""
"Can not rename a translation. If the master page is renamed, however, its "
"translations will be renamed as well."
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:949
+#: ../IkiWiki/Plugin/po.pm:950
#, perl-format
msgid "POT file (%s) does not exist"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:963
+#: ../IkiWiki/Plugin/po.pm:964
#, fuzzy, perl-format
msgid "failed to copy underlay PO file to %s"
msgstr "lỗi biên dịch %s"
-#: ../IkiWiki/Plugin/po.pm:972
+#: ../IkiWiki/Plugin/po.pm:973
#, fuzzy, perl-format
msgid "failed to update %s"
msgstr "lỗi biên dịch %s"
-#: ../IkiWiki/Plugin/po.pm:978
+#: ../IkiWiki/Plugin/po.pm:979
#, fuzzy, perl-format
msgid "failed to copy the POT file to %s"
msgstr "lỗi biên dịch %s"
-#: ../IkiWiki/Plugin/po.pm:1014
+#: ../IkiWiki/Plugin/po.pm:1015
msgid "N/A"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1025
+#: ../IkiWiki/Plugin/po.pm:1026
#, fuzzy, perl-format
msgid "failed to translate %s"
msgstr "lỗi ghi %s: %s"
-#: ../IkiWiki/Plugin/po.pm:1104
+#: ../IkiWiki/Plugin/po.pm:1105
msgid "removed obsolete PO files"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1161 ../IkiWiki/Plugin/po.pm:1173
-#: ../IkiWiki/Plugin/po.pm:1212
+#: ../IkiWiki/Plugin/po.pm:1162 ../IkiWiki/Plugin/po.pm:1174
+#: ../IkiWiki/Plugin/po.pm:1213
#, fuzzy, perl-format
msgid "failed to write %s"
msgstr "lỗi ghi %s: %s"
-#: ../IkiWiki/Plugin/po.pm:1171
+#: ../IkiWiki/Plugin/po.pm:1172
#, fuzzy
msgid "failed to translate"
msgstr "linkmap không chạy dot được"
-#: ../IkiWiki/Plugin/po.pm:1224
+#: ../IkiWiki/Plugin/po.pm:1225
msgid "invalid gettext data, go back to previous page to continue edit"
msgstr ""
-#: ../IkiWiki/Plugin/po.pm:1266
+#: ../IkiWiki/Plugin/po.pm:1268
#, perl-format
msgid "%s has invalid syntax: must use CODE|NAME"
msgstr ""
msgid "%s is not a file"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:136
+#: ../IkiWiki/Plugin/remove.pm:150
#, perl-format
msgid "confirm removal of %s"
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:173
+#: ../IkiWiki/Plugin/remove.pm:187
msgid "Please select the attachments to remove."
msgstr ""
-#: ../IkiWiki/Plugin/remove.pm:217
+#: ../IkiWiki/Plugin/remove.pm:231
msgid "removed"
msgstr ""
msgid "Also rename SubPages and attachments"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:251
+#: ../IkiWiki/Plugin/rename.pm:258
msgid "Only one attachment can be renamed at a time."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:254
+#: ../IkiWiki/Plugin/rename.pm:261
msgid "Please select the attachment to rename."
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:353
+#: ../IkiWiki/Plugin/rename.pm:371
#, perl-format
msgid "rename %s to %s"
msgstr ""
-#: ../IkiWiki/Plugin/rename.pm:579
+#: ../IkiWiki/Plugin/rename.pm:597
#, fuzzy, perl-format
msgid "update for rename of %s to %s"
msgstr "cập nhật %2$s của %1$s bởi %3$s"
msgid "rsync_command exited %d"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:195
+#: ../IkiWiki/Plugin/search.pm:196
#, perl-format
msgid "need Digest::SHA to index %s"
msgstr ""
-#: ../IkiWiki/Plugin/search.pm:233
+#: ../IkiWiki/Plugin/search.pm:250
msgid "search"
msgstr ""
msgid "removing transient version of %s"
msgstr "đang gỡ bỏ trang cũ %s"
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "login"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:59
+msgid "email"
+msgstr ""
+
+#: ../IkiWiki/Plugin/userlist.pm:73
+msgid "Users"
+msgstr ""
+
#: ../IkiWiki/Plugin/websetup.pm:105
#, perl-format
msgid "%s plugin:"
msgid "enable %s?"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:273
+#: ../IkiWiki/Plugin/websetup.pm:276
msgid "setup file for this wiki is not known"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:289
+#: ../IkiWiki/Plugin/websetup.pm:292
msgid "main"
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:433
+#: ../IkiWiki/Plugin/websetup.pm:436
msgid ""
"The configuration changes shown below require a wiki rebuild to take effect."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:437
+#: ../IkiWiki/Plugin/websetup.pm:440
msgid ""
"For the configuration changes shown below to fully take effect, you may need "
"to rebuild the wiki."
msgstr ""
-#: ../IkiWiki/Plugin/websetup.pm:474
+#: ../IkiWiki/Plugin/websetup.pm:477
#, perl-format
msgid "Error: %s exited nonzero (%s). Discarding setup changes."
msgstr ""
msgid "removing obsolete %s"
msgstr "đang gỡ bỏ trang cũ %s"
-#: ../IkiWiki/Render.pm:520
+#: ../IkiWiki/Render.pm:530
#, fuzzy, perl-format
msgid "building %s, which links to %s"
msgstr "đang vẽ %s mà liên kết tới %s"
-#: ../IkiWiki/Render.pm:529
+#: ../IkiWiki/Render.pm:539
#, fuzzy, perl-format
msgid "removing %s, no longer built by %s"
msgstr "đang gỡ bỏ %s, không còn được vẽ lại bởi %s"
-#: ../IkiWiki/Render.pm:612 ../IkiWiki/Render.pm:694
+#: ../IkiWiki/Render.pm:622 ../IkiWiki/Render.pm:704
#, fuzzy, perl-format
msgid "building %s, which depends on %s"
msgstr "đang vẽ %s mà phụ thuộc vào %s"
-#: ../IkiWiki/Render.pm:707
+#: ../IkiWiki/Render.pm:717
#, fuzzy, perl-format
msgid "building %s, to update its backlinks"
msgstr "đang vẽ %s để cập nhật các liên kết ngược của nó"
-#: ../IkiWiki/Render.pm:787
+#: ../IkiWiki/Render.pm:797
#, fuzzy, perl-format
msgid "building %s"
msgstr "đang sửa %s"
-#: ../IkiWiki/Render.pm:839
+#: ../IkiWiki/Render.pm:849
#, fuzzy, perl-format
msgid "ikiwiki: cannot build %s"
msgstr "ikiwiki: không thể vẽ %s"
msgid "failed to load external plugin needed for %s plugin: %s"
msgstr ""
-#: ../IkiWiki.pm:1425
+#: ../IkiWiki.pm:1435
#, fuzzy, perl-format
msgid "preprocessing loop detected on %s at depth %i"
msgstr "vòng lặp tiền xử lý %s được phát hiện trên %s ở độ sâu %i"
-#: ../IkiWiki.pm:1609
+#: ../IkiWiki.pm:1627
#, fuzzy, perl-format
msgid "bad file name %s"
msgstr "đang bỏ qua tên tập tin sai %s"
-#: ../IkiWiki.pm:1909
+#: ../IkiWiki.pm:1927
#, perl-format
msgid "template %s not found"
msgstr "không tìm thấy mẫu %s"
-#: ../IkiWiki.pm:2159
+#: ../IkiWiki.pm:2177
msgid "yes"
msgstr ""
-#: ../IkiWiki.pm:2236
+#: ../IkiWiki.pm:2254
#, fuzzy, perl-format
msgid "invalid sort type %s"
msgstr "kiểu sắp xếp không rõ %s"
-#: ../IkiWiki.pm:2257
+#: ../IkiWiki.pm:2275
#, perl-format
msgid "unknown sort type %s"
msgstr "kiểu sắp xếp không rõ %s"
-#: ../IkiWiki.pm:2393
+#: ../IkiWiki.pm:2411
#, fuzzy, perl-format
msgid "cannot match pages: %s"
msgstr "không thể đọc %s: %s"
--- /dev/null
+#!/usr/bin/perl
+use warnings;
+use strict;
+use Test::More 'no_plan';
+use IkiWiki;
+
+ok(! system("rm -rf t/tmp"));
+ok(mkdir "t/tmp");
+ok(! system("cp -R t/tinyblog t/tmp/in"));
+ok(mkdir "t/tmp/in/post" or -d "t/tmp/in/post");
+
+my $comment;
+
+$comment = <<EOF;
+[[!comment username="neil"
+ date="1969-07-20T20:17:40Z"
+ content="I landed"]]
+EOF
+#ok(eval { writefile("post/comment_3._comment", "t/tmp/in", $comment); 1 });
+writefile("post/comment_3._comment", "t/tmp/in", $comment);
+
+$comment = <<EOF;
+[[!comment username="christopher"
+ date="1969-02-12T07:00:00Z"
+ content="I explored"]]
+EOF
+writefile("post/comment_2._comment", "t/tmp/in", $comment);
+
+$comment = <<EOF;
+[[!comment username="william"
+ date="1969-01-14T12:00:00Z"
+ content="I conquered"]]
+EOF
+writefile("post/comment_1._comment", "t/tmp/in", $comment);
+
+# Give the files mtimes in the wrong order
+ok(utime(111111111, 111111111, "t/tmp/in/post/comment_3._comment"));
+ok(utime(222222222, 222222222, "t/tmp/in/post/comment_2._comment"));
+ok(utime(333333333, 333333333, "t/tmp/in/post/comment_1._comment"));
+
+# Build the wiki
+ok(! system("make -s ikiwiki.out"));
+ok(! system("perl -I. ./ikiwiki.out -verbose -plugin comments -url=http://example.com -cgiurl=http://example.com/ikiwiki.cgi -rss -atom -underlaydir=underlays/basewiki -set underlaydirbase=underlays -set comments_pagespec='*' -templatedir=templates t/tmp/in t/tmp/out"));
+
+# Check that the comments are in the right order
+
+sub slurp {
+ open my $fh, "<", shift or return undef;
+ local $/;
+ my $content = <$fh>;
+ close $fh or return undef;
+ return $content;
+}
+
+my $content = slurp("t/tmp/out/post/index.html");
+ok(defined $content);
+ok($content =~ m/I conquered.*I explored.*I landed/s);
--- /dev/null
+#!/usr/bin/perl
+use warnings;
+use strict;
+
+BEGIN {
+ if (system("python -c 'import docutils.core'") != 0) {
+ eval 'use Test::More skip_all => "docutils not available"';
+ }
+}
+
+use Test::More tests => 2;
+
+BEGIN { use_ok("IkiWiki"); }
+
+%config=IkiWiki::defaultconfig();
+$config{srcdir}=$config{destdir}="/dev/null";
+$config{libdir}=".";
+$config{add_plugins}=[qw(rst)];
+IkiWiki::loadplugins();
+IkiWiki::checkconfig();
+
+ok(IkiWiki::htmlize("foo", "foo", "rst", "foo\n") =~ m{\s*<p>foo</p>\s*});
--- /dev/null
+#!/usr/bin/perl
+use warnings;
+use strict;
+use Test::More 'no_plan';
+use IkiWiki;
+
+my $blob;
+
+ok(! system("rm -rf t/tmp"));
+ok(! system("mkdir t/tmp"));
+
+# Use a rather stylized template to override the default rendering, to make
+# it easy to search for the desired results
+writefile("templates/trails.tmpl", "t/tmp/in", <<EOF
+<TMPL_LOOP TRAILLOOP>
+<TMPL_IF __FIRST__><nav></TMPL_IF>
+<div>
+trail=<TMPL_VAR TRAILPAGE> n=<TMPL_VAR NEXTPAGE> p=<TMPL_VAR PREVPAGE>
+</div>
+<div>
+<TMPL_IF PREVURL>
+<a href="<TMPL_VAR PREVURL>">< <TMPL_VAR PREVTITLE></a>
+</TMPL_IF> |
+<a href="<TMPL_VAR TRAILURL>">^ <TMPL_VAR TRAILTITLE> ^</a>
+| <TMPL_IF NEXTURL>
+<a href="<TMPL_VAR NEXTURL>"><TMPL_VAR NEXTTITLE> ></a>
+</TMPL_IF>
+</div>
+<TMPL_IF __LAST__></nav></TMPL_IF>
+</TMPL_LOOP>
+EOF
+);
+writefile("badger.mdwn", "t/tmp/in", "[[!meta title=\"The Breezy Badger\"]]\ncontent of badger");
+writefile("mushroom.mdwn", "t/tmp/in", "content of mushroom");
+writefile("snake.mdwn", "t/tmp/in", "content of snake");
+writefile("ratty.mdwn", "t/tmp/in", "content of ratty");
+writefile("mr_toad.mdwn", "t/tmp/in", "content of mr toad");
+writefile("add.mdwn", "t/tmp/in", '[[!trail pagenames="add/a add/b add/c add/d add/e"]]');
+writefile("add/b.mdwn", "t/tmp/in", "b");
+writefile("add/d.mdwn", "t/tmp/in", "d");
+writefile("del.mdwn", "t/tmp/in", '[[!trail pages="del/*" sort=title]]');
+writefile("del/a.mdwn", "t/tmp/in", "a");
+writefile("del/b.mdwn", "t/tmp/in", "b");
+writefile("del/c.mdwn", "t/tmp/in", "c");
+writefile("del/d.mdwn", "t/tmp/in", "d");
+writefile("del/e.mdwn", "t/tmp/in", "e");
+writefile("self_referential.mdwn", "t/tmp/in", '[[!trail pagenames="self_referential" circular=yes]]');
+
+writefile("meme.mdwn", "t/tmp/in", <<EOF
+[[!trail]]
+* [[!traillink badger]]
+* [[!traillink badger text="This is a link to badger, with a title"]]
+* [[!traillink That_is_the_badger|badger]]
+* [[!traillink badger]]
+* [[!traillink mushroom]]
+* [[!traillink mushroom]]
+* [[!traillink snake]]
+* [[!traillink snake]]
+EOF
+);
+
+writefile("wind_in_the_willows.mdwn", "t/tmp/in", <<EOF
+[[!trail circular=yes sort=title pages="ratty or badger or mr_toad"]]
+[[!trailitem moley]]
+EOF
+);
+
+ok(! system("make -s ikiwiki.out"));
+
+my $command = "perl -I. ./ikiwiki.out -set usedirs=0 -plugin trail -plugin inline -url=http://example.com -cgiurl=http://example.com/ikiwiki.cgi -rss -atom -underlaydir=underlays/basewiki -set underlaydirbase=underlays -templatedir=templates t/tmp/in t/tmp/out -verbose";
+
+ok(! system($command));
+
+ok(! system("$command -refresh"));
+
+$blob = readfile("t/tmp/out/meme.html");
+ok($blob =~ /<a href="(\.\/)?badger.html">badger<\/a>/m);
+ok($blob =~ /<a href="(\.\/)?badger.html">This is a link to badger, with a title<\/a>/m);
+ok($blob =~ /<a href="(\.\/)?badger.html">That is the badger<\/a>/m);
+
+$blob = readfile("t/tmp/out/badger.html");
+ok($blob =~ /^trail=meme n=mushroom p=$/m);
+ok($blob =~ /^trail=wind_in_the_willows n=mr_toad p=ratty$/m);
+
+ok(! -f "t/tmp/out/moley.html");
+
+$blob = readfile("t/tmp/out/mr_toad.html");
+ok($blob !~ /^trail=meme/m);
+ok($blob =~ /^trail=wind_in_the_willows n=ratty p=badger$/m);
+# meta title is respected for pages that have one
+ok($blob =~ /">< The Breezy Badger<\/a>/m);
+# pagetitle for pages that don't
+ok($blob =~ /">ratty ><\/a>/m);
+
+$blob = readfile("t/tmp/out/ratty.html");
+ok($blob !~ /^trail=meme/m);
+ok($blob =~ /^trail=wind_in_the_willows n=badger p=mr_toad$/m);
+
+$blob = readfile("t/tmp/out/mushroom.html");
+ok($blob =~ /^trail=meme n=snake p=badger$/m);
+ok($blob !~ /^trail=wind_in_the_willows/m);
+
+$blob = readfile("t/tmp/out/snake.html");
+ok($blob =~ /^trail=meme n= p=mushroom$/m);
+ok($blob !~ /^trail=wind_in_the_willows/m);
+
+$blob = readfile("t/tmp/out/self_referential.html");
+ok($blob =~ /^trail=self_referential n= p=$/m);
+
+$blob = readfile("t/tmp/out/add/b.html");
+ok($blob =~ /^trail=add n=add\/d p=$/m);
+$blob = readfile("t/tmp/out/add/d.html");
+ok($blob =~ /^trail=add n= p=add\/b$/m);
+ok(! -f "t/tmp/out/add/a.html");
+ok(! -f "t/tmp/out/add/c.html");
+ok(! -f "t/tmp/out/add/e.html");
+
+$blob = readfile("t/tmp/out/del/a.html");
+ok($blob =~ /^trail=del n=del\/b p=$/m);
+$blob = readfile("t/tmp/out/del/b.html");
+ok($blob =~ /^trail=del n=del\/c p=del\/a$/m);
+$blob = readfile("t/tmp/out/del/c.html");
+ok($blob =~ /^trail=del n=del\/d p=del\/b$/m);
+$blob = readfile("t/tmp/out/del/d.html");
+ok($blob =~ /^trail=del n=del\/e p=del\/c$/m);
+$blob = readfile("t/tmp/out/del/e.html");
+ok($blob =~ /^trail=del n= p=del\/d$/m);
+
+# Make some changes and refresh
+
+writefile("add/a.mdwn", "t/tmp/in", "a");
+writefile("add/c.mdwn", "t/tmp/in", "c");
+writefile("add/e.mdwn", "t/tmp/in", "e");
+ok(unlink("t/tmp/in/del/a.mdwn"));
+ok(unlink("t/tmp/in/del/c.mdwn"));
+ok(unlink("t/tmp/in/del/e.mdwn"));
+
+ok(! system("$command -refresh"));
+
+$blob = readfile("t/tmp/out/add/a.html");
+ok($blob =~ /^trail=add n=add\/b p=$/m);
+$blob = readfile("t/tmp/out/add/b.html");
+ok($blob =~ /^trail=add n=add\/c p=add\/a$/m);
+$blob = readfile("t/tmp/out/add/c.html");
+ok($blob =~ /^trail=add n=add\/d p=add\/b$/m);
+$blob = readfile("t/tmp/out/add/d.html");
+ok($blob =~ /^trail=add n=add\/e p=add\/c$/m);
+$blob = readfile("t/tmp/out/add/e.html");
+ok($blob =~ /^trail=add n= p=add\/d$/m);
+
+$blob = readfile("t/tmp/out/del/b.html");
+ok($blob =~ /^trail=del n=del\/d p=$/m);
+$blob = readfile("t/tmp/out/del/d.html");
+ok($blob =~ /^trail=del n= p=del\/b$/m);
+ok(! -f "t/tmp/out/del/a.html");
+ok(! -f "t/tmp/out/del/c.html");
+ok(! -f "t/tmp/out/del/e.html");
+
+#ok(! system("rm -rf t/tmp"));
</script>
<script id="template-download" type="text/x-jquery-tmpl">
<tr class="template-download{{if error}} ui-state-error{{/if}}">
- <td><input type="checkbox" name="attachment_select" value="${name}" />${name}</td>
+ <td><input type="checkbox" checked name="attachment_select" value="${name}" />${name}</td>
<td>${humansize}</td>
{{if error}}
<td class="error" colspan="2">failed!</td>
</div>
<TMPL_VAR FIELD-ATTACHMENT>
<noscript><TMPL_VAR FIELD-UPLOAD></noscript>
-<TMPL_IF NAME="ATTACHMENT_LIST">
<TMPL_VAR FIELD-LINK><TMPL_VAR FIELD-RENAME><TMPL_VAR FIELD-REMOVE>
-</TMPL_IF>
</div>
</div>
</TMPL_IF>
<TMPL_IF FEEDLINKS><TMPL_VAR FEEDLINKS></TMPL_IF>
<TMPL_IF RELVCS><TMPL_VAR RELVCS></TMPL_IF>
<TMPL_IF META><TMPL_VAR META></TMPL_IF>
+<TMPL_LOOP TRAILLOOP>
+<TMPL_IF PREVPAGE>
+<link rel="prev" href="<TMPL_VAR PREVURL>" title="<TMPL_VAR PREVTITLE>" />
+</TMPL_IF>
+<link rel="up" href="<TMPL_VAR TRAILURL>" title="<TMPL_VAR TRAILTITLE>" />
+<TMPL_IF NEXTPAGE>
+<link rel="next" href="<TMPL_VAR NEXTURL>" title="<TMPL_VAR NEXTTITLE>" />
+</TMPL_IF>
+</TMPL_LOOP>
</head>
<body>
<title><TMPL_VAR TITLE></title>
</TMPL_IF>
<TMPL_IF GUID>
- <guid isPermaLink="no"><TMPL_VAR GUID></guid>
+ <guid isPermaLink="false"><TMPL_VAR GUID></guid>
<TMPL_ELSE>
- <guid isPermaLink="no"><TMPL_VAR URL></guid>
+ <guid isPermaLink="false"><TMPL_VAR URL></guid>
</TMPL_IF>
<link><TMPL_VAR PERMALINK></link>
<TMPL_IF CATEGORIES>
$if{$field{size},<span title="$html{$field{size}} bytes">Size: <b>$html{$filesize{$field{size}}}</b></span><br>}
</div>
</td>
-<td><B><A HREF="$field{url}">$html{$or{$field{caption},$field{title},$field{url},Untitled}}</A></B><BR>
+<td><B><A HREF="$html{$field{url}}">$html{$or{$field{caption},$field{title},$field{url},Untitled}}</A></B><BR>
<small>$highlight{$field{sample},$terms}$if{$field{sample},...}</small><br>
<small>
$percentage% relevant$. matching:
--- /dev/null
+<TMPL_LOOP TRAILLOOP>
+<TMPL_IF __FIRST__><TMPL_IF HTML5><nav class="trails"><TMPL_ELSE><div class="trails"></TMPL_IF></TMPL_IF>
+<div class="trail">
+<TMPL_IF PREVPAGE>
+<span class="trailprev">
+<span class="trailarrow">←</span>
+<a href="<TMPL_VAR PREVURL>"><TMPL_VAR PREVTITLE></a>
+<span class="trailsep">|</span>
+</span>
+</TMPL_IF>
+<span class="trailup">
+<a href="<TMPL_VAR TRAILURL>"><TMPL_VAR TRAILTITLE></a>
+</span>
+<TMPL_IF NEXTPAGE>
+<span class="trailnext">
+<span class="trailsep">|</span>
+<a href="<TMPL_VAR NEXTURL>"><TMPL_VAR NEXTTITLE></a>
+<span class="trailarrow">→</span>
+</span>
+</TMPL_IF>
+</div>
+<TMPL_IF __LAST__><TMPL_IF HTML5></nav><TMPL_ELSE></div></TMPL_IF></TMPL_IF>
+</TMPL_LOOP>
padding: 0 0 0 2ex;
border-color: #999;
}
+
+.trails {
+ /* allow space for the action tabs */
+ margin-bottom: 2em;
+}
font-weight: bold;
}
-.pageheader .header .title, .pageheader .header .parentlinks, .pageheader .actions ul li, .pageheader .header span, .pageheader #otherlanguages ul li {
+.pageheader .header .title, .pageheader .header .parentlinks, .pageheader .actions ul li, .pageheader .header span, .pageheader #otherlanguages ul li, .trailprev, .trailnext, .trailup {
padding: 0.25em 0.25em 0.25em 0.25em;
background-image: url('background_darkness.png');
background-repeat: repeat;
color: white;
}
-.pageheader .header span a, .pageheader .actions ul li a, .pageheader .header .parentlinks a, .pageheader #otherlanguages ul li a {
+.pageheader .header span a, .pageheader .actions ul li a, .pageheader .header .parentlinks a, .pageheader #otherlanguages ul li a, .pageheader a {
+ font-weight: bold;
color: white;
text-decoration: none;
}
+.trailprev, .trailnext, .trailup {
+ margin-top: 0.5em;
+}
+
.pageheader .actions {
text-align: right;
vertical-align: bottom;
--- /dev/null
+/*
+ * jQuery UI CSS Framework 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Resizable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; }
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.14
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null
+/*!
+ * jQuery UI 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function( $, undefined ) {
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+ return;
+}
+
+$.extend( $.ui, {
+ version: "1.8.14",
+
+ keyCode: {
+ ALT: 18,
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ COMMAND: 91,
+ COMMAND_LEFT: 91, // COMMAND
+ COMMAND_RIGHT: 93,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ MENU: 93, // COMMAND_RIGHT
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38,
+ WINDOWS: 91 // COMMAND
+ }
+});
+
+// plugins
+$.fn.extend({
+ _focus: $.fn.focus,
+ focus: function( delay, fn ) {
+ return typeof delay === "number" ?
+ this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $( elem ).focus();
+ if ( fn ) {
+ fn.call( elem );
+ }
+ }, delay );
+ }) :
+ this._focus.apply( this, arguments );
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function( zIndex ) {
+ if ( zIndex !== undefined ) {
+ return this.css( "zIndex", zIndex );
+ }
+
+ if ( this.length ) {
+ var elem = $( this[ 0 ] ), position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ },
+
+ disableSelection: function() {
+ return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+ ".ui-disableSelection", function( event ) {
+ event.preventDefault();
+ });
+ },
+
+ enableSelection: function() {
+ return this.unbind( ".ui-disableSelection" );
+ }
+});
+
+$.each( [ "Width", "Height" ], function( i, name ) {
+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
+
+ function reduce( elem, size, border, margin ) {
+ $.each( side, function() {
+ size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
+ if ( border ) {
+ size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
+ }
+ if ( margin ) {
+ size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
+ }
+ });
+ return size;
+ }
+
+ $.fn[ "inner" + name ] = function( size ) {
+ if ( size === undefined ) {
+ return orig[ "inner" + name ].call( this );
+ }
+
+ return this.each(function() {
+ $( this ).css( type, reduce( this, size ) + "px" );
+ });
+ };
+
+ $.fn[ "outer" + name] = function( size, margin ) {
+ if ( typeof size !== "number" ) {
+ return orig[ "outer" + name ].call( this, size );
+ }
+
+ return this.each(function() {
+ $( this).css( type, reduce( this, size, true, margin ) + "px" );
+ });
+ };
+});
+
+// selectors
+function focusable( element, isTabIndexNotNaN ) {
+ var nodeName = element.nodeName.toLowerCase();
+ if ( "area" === nodeName ) {
+ var map = element.parentNode,
+ mapName = map.name,
+ img;
+ if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+ return false;
+ }
+ img = $( "img[usemap=#" + mapName + "]" )[0];
+ return !!img && visible( img );
+ }
+ return ( /input|select|textarea|button|object/.test( nodeName )
+ ? !element.disabled
+ : "a" == nodeName
+ ? element.href || isTabIndexNotNaN
+ : isTabIndexNotNaN)
+ // the element and all of its ancestors must be visible
+ && visible( element );
+}
+
+function visible( element ) {
+ return !$( element ).parents().andSelf().filter(function() {
+ return $.curCSS( this, "visibility" ) === "hidden" ||
+ $.expr.filters.hidden( this );
+ }).length;
+}
+
+$.extend( $.expr[ ":" ], {
+ data: function( elem, i, match ) {
+ return !!$.data( elem, match[ 3 ] );
+ },
+
+ focusable: function( element ) {
+ return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
+ },
+
+ tabbable: function( element ) {
+ var tabIndex = $.attr( element, "tabindex" ),
+ isTabIndexNaN = isNaN( tabIndex );
+ return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
+ }
+});
+
+// support
+$(function() {
+ var body = document.body,
+ div = body.appendChild( div = document.createElement( "div" ) );
+
+ $.extend( div.style, {
+ minHeight: "100px",
+ height: "auto",
+ padding: 0,
+ borderWidth: 0
+ });
+
+ $.support.minHeight = div.offsetHeight === 100;
+ $.support.selectstart = "onselectstart" in div;
+
+ // set display to none to avoid a layout bug in IE
+ // http://dev.jquery.com/ticket/4014
+ body.removeChild( div ).style.display = "none";
+});
+
+
+
+
+
+// deprecated
+$.extend( $.ui, {
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function( module, option, set ) {
+ var proto = $.ui[ module ].prototype;
+ for ( var i in set ) {
+ proto.plugins[ i ] = proto.plugins[ i ] || [];
+ proto.plugins[ i ].push( [ option, set[ i ] ] );
+ }
+ },
+ call: function( instance, name, args ) {
+ var set = instance.plugins[ name ];
+ if ( !set || !instance.element[ 0 ].parentNode ) {
+ return;
+ }
+
+ for ( var i = 0; i < set.length; i++ ) {
+ if ( instance.options[ set[ i ][ 0 ] ] ) {
+ set[ i ][ 1 ].apply( instance.element, args );
+ }
+ }
+ }
+ },
+
+ // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
+ contains: function( a, b ) {
+ return document.compareDocumentPosition ?
+ a.compareDocumentPosition( b ) & 16 :
+ a !== b && a.contains( b );
+ },
+
+ // only used by resizable
+ hasScroll: function( el, a ) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ( $( el ).css( "overflow" ) === "hidden") {
+ return false;
+ }
+
+ var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+ has = false;
+
+ if ( el[ scroll ] > 0 ) {
+ return true;
+ }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[ scroll ] = 1;
+ has = ( el[ scroll ] > 0 );
+ el[ scroll ] = 0;
+ return has;
+ },
+
+ // these are odd functions, fix the API or move into individual plugins
+ isOverAxis: function( x, reference, size ) {
+ //Determines when x coordinate is over "b" element axis
+ return ( x > reference ) && ( x < ( reference + size ) );
+ },
+ isOver: function( y, x, top, left, height, width ) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+ }
+});
+
+})( jQuery );
+/*!
+ * jQuery UI Widget 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+ var _cleanData = $.cleanData;
+ $.cleanData = function( elems ) {
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ $( elem ).triggerHandler( "remove" );
+ }
+ _cleanData( elems );
+ };
+} else {
+ var _remove = $.fn.remove;
+ $.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( [ this ] ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+ };
+}
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( true, {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ // TODO: add this back in 1.9 and use $.error() (see #5972)
+// if ( !instance ) {
+// throw "cannot call methods on " + name + " prior to initialization; " +
+// "attempted to call method '" + options + "'";
+// }
+// if ( !$.isFunction( instance[options] ) ) {
+// throw "no such method '" + options + "' for " + name + " widget instance";
+// }
+// var methodValue = instance[ options ].apply( instance, args );
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ instance.option( options || {} )._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ $.data( element, this.widgetName, this );
+ this.element = $( element );
+ this.options = $.extend( true, {},
+ this.options,
+ this._getCreateOptions(),
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._trigger( "create" );
+ this._init();
+ },
+ _getCreateOptions: function() {
+ return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, this.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ this._setOptions( options );
+
+ return this;
+ },
+ _setOptions: function( options ) {
+ var self = this;
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return this;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
+
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
+/*!
+ * jQuery UI Mouse 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var mouseHandled = false;
+$(document).mousedown(function(e) {
+ mouseHandled = false;
+});
+
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, self.widgetName + '.preventClickEvent');
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ if(mouseHandled) {return};
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).closest(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // Click event may never have fired (Gecko & Opera)
+ if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, this.widgetName + '.preventClickEvent');
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ event.preventDefault();
+
+ mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+
+ if (event.target == this._mouseDownEvent.target) {
+ $.data(event.target, this.widgetName + '.preventClickEvent', true);
+ }
+
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Position 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ verticalPositions = /top|center|bottom/,
+ center = "center",
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ targetElem = target[0],
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( targetElem.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ // TODO: use $.isWindow() in 1.9
+ } else if ( targetElem.setTimeout ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( targetElem.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [center] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ center ].concat( pos ) :
+ [ center, center ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if ( options.at[0] === center ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === center ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
+ marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
+ collisionWidth = elemWidth + marginLeft +
+ ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
+ collisionHeight = elemHeight + marginTop +
+ ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+ position = $.extend( {}, basePosition ),
+ collisionPosition;
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === center ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === center ) {
+ position.top -= elemHeight / 2;
+ }
+
+ // prevent fractions (see #5280)
+ position.left = Math.round( position.left );
+ position.top = Math.round( position.top );
+
+ collisionPosition = {
+ left: position.left - marginLeft,
+ top: position.top - marginTop
+ };
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ collisionPosition: collisionPosition,
+ collisionWidth: collisionWidth,
+ collisionHeight: collisionHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === center ) {
+ return;
+ }
+ var win = $( window ),
+ over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ atOffset = data.at[ 0 ] === "left" ?
+ data.targetWidth :
+ -data.targetWidth,
+ offset = -2 * data.offset[ 0 ];
+ position.left += data.collisionPosition.left < 0 ?
+ myOffset + atOffset + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === center ) {
+ return;
+ }
+ var win = $( window ),
+ over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += data.collisionPosition.top < 0 ?
+ myOffset + atOffset + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+}( jQuery ));
+/*
+ * jQuery UI Draggable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
+ if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
+
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is removed, don't bother to continue if helper is set to "original"
+ if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
+ return false;
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ _mouseUp: function(event) {
+ if (this.options.iframeFix === true) {
+ $("div.ui-draggable-iframeFix").each(function() {
+ this.parentNode.removeChild(this);
+ }); //Remove frame helpers
+ }
+
+ //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
+ if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
+
+ return $.ui.mouse.prototype._mouseUp.call(this, event);
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0),
+ right: (parseInt(this.element.css("marginRight"),10) || 0),
+ bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+ o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+ (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var c = $(o.containment);
+ var ce = c[0]; if(!ce) return;
+ var co = c.offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+ (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+ (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+ (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
+ ];
+ this.relative_container = c;
+
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+ var containment;
+ if(this.containment) {
+ if (this.relative_container){
+ var co = this.relative_container.offset();
+ containment = [ this.containment[0] + co.left,
+ this.containment[1] + co.top,
+ this.containment[2] + co.left,
+ this.containment[3] + co.top ];
+ }
+ else {
+ containment = this.containment;
+ }
+
+ if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
+ var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
+ pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
+ pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.draggable, {
+ version: "1.8.14"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.droppable", {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+
+ if(key == 'accept') {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.8.14"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l <= x1 && x2 <= r
+ && t <= y1 && y2 <= b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = dropped || this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ dragStart: function( draggable, event ) {
+ //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
+ draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() {
+ if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+ });
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ },
+ dragStop: function( draggable, event ) {
+ draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" );
+ //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
+ if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ if (o.disabled) return;
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (o.disabled) return;
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.after(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var handle = false;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
+ }
+
+ return !this.options.disabled && handle;
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ // Put this in the mouseDrag handler since the user can start pressing shift while resizing
+ this._updateVirtualBoundaries(event.shiftKey);
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateVirtualBoundaries: function(forceAspectRatio) {
+ var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
+
+ b = {
+ minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
+ maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
+ minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
+ maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
+ };
+
+ if(this._aspectRatio || forceAspectRatio) {
+ // We want to create an enclosing box whose aspect ration is the requested one
+ // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
+ pMinWidth = b.minHeight * this.aspectRatio;
+ pMinHeight = b.minWidth / this.aspectRatio;
+ pMaxWidth = b.maxHeight * this.aspectRatio;
+ pMaxHeight = b.maxWidth / this.aspectRatio;
+
+ if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
+ if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
+ if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
+ if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
+ }
+ this._vBoundaries = b;
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (isNumber(data.height)) data.width = (data.height * this.aspectRatio);
+ else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+$.extend($.ui.resizable, {
+ version: "1.8.14"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _store = function (exp) {
+ $(exp).each(function() {
+ var el = $(this);
+ el.data("resizable-alsoresize", {
+ width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+ left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
+ position: el.css('position') // to reset Opera on stop()
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function (exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
+ css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+
+ $.each(css, function (i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ // Opera fixing relative position
+ if ($.browser.opera && /relative/.test(el.css('position'))) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _reset = function (exp) {
+ $(exp).each(function() {
+ var el = $(this);
+ // reset position for Opera - no need to verify it was changed
+ el.css({ position: el.data("resizable-alsoresize").position });
+ });
+ };
+
+ if (self._revertToRelativePosition) {
+ self._revertToRelativePosition = false;
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function (exp) { _reset(exp); });
+ }else{
+ _reset(o.alsoResize);
+ }
+ }
+
+ $(this).removeData("resizable-alsoresize");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $("<div class='ui-selectable-helper'></div>");
+ },
+
+ destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected');
+ selectee.$element
+ .removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+ .addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+ selectee.unselecting = !doSelect;
+ selectee.selecting = doSelect;
+ selectee.selected = doSelect;
+ // selectable (UN)SELECTING callback
+ if (doSelect) {
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ } else {
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+$.extend($.ui.selectable, {
+ version: "1.8.14"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are being displayed horizontally
+ this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget()
+ [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(this, arguments);
+ }
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp({ target: null });
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ if (this.placeholder) {
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ if(!str.length && o.key) {
+ str.push(o.key + '=');
+ }
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
+ continue;
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ originalPosition: self.originalPosition,
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+});
+
+$.extend($.ui.sortable, {
+ version: "1.8.14"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.accordion", {
+ options: {
+ active: 0,
+ animated: "slide",
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() === location.href.toLowerCase();
+ }
+ },
+
+ _create: function() {
+ var self = this,
+ options = self.options;
+
+ self.running = 0;
+
+ self.element
+ .addClass( "ui-accordion ui-widget ui-helper-reset" )
+ // in lack of child-selectors in CSS
+ // we need to mark top-LIs in a UL-accordion for some IE-fix
+ .children( "li" )
+ .addClass( "ui-accordion-li-fix" );
+
+ self.headers = self.element.find( options.header )
+ .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
+ .bind( "mouseenter.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ })
+ .bind( "mouseleave.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .bind( "focus.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-focus" );
+ })
+ .bind( "blur.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ self.headers.next()
+ .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
+
+ if ( options.navigation ) {
+ var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
+ if ( current.length ) {
+ var header = current.closest( ".ui-accordion-header" );
+ if ( header.length ) {
+ // anchor within header
+ self.active = header;
+ } else {
+ // anchor within content
+ self.active = current.closest( ".ui-accordion-content" ).prev();
+ }
+ }
+ }
+
+ self.active = self._findActive( self.active || options.active )
+ .addClass( "ui-state-default ui-state-active" )
+ .toggleClass( "ui-corner-all" )
+ .toggleClass( "ui-corner-top" );
+ self.active.next().addClass( "ui-accordion-content-active" );
+
+ self._createIcons();
+ self.resize();
+
+ // ARIA
+ self.element.attr( "role", "tablist" );
+
+ self.headers
+ .attr( "role", "tab" )
+ .bind( "keydown.accordion", function( event ) {
+ return self._keydown( event );
+ })
+ .next()
+ .attr( "role", "tabpanel" );
+
+ self.headers
+ .not( self.active || "" )
+ .attr({
+ "aria-expanded": "false",
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if ( !self.active.length ) {
+ self.headers.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ self.active
+ .attr({
+ "aria-expanded": "true",
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ }
+
+ // only need links in tab order for Safari
+ if ( !$.browser.safari ) {
+ self.headers.find( "a" ).attr( "tabIndex", -1 );
+ }
+
+ if ( options.event ) {
+ self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
+ self._clickHandler.call( self, event, this );
+ event.preventDefault();
+ });
+ }
+ },
+
+ _createIcons: function() {
+ var options = this.options;
+ if ( options.icons ) {
+ $( "<span></span>" )
+ .addClass( "ui-icon " + options.icons.header )
+ .prependTo( this.headers );
+ this.active.children( ".ui-icon" )
+ .toggleClass(options.icons.header)
+ .toggleClass(options.icons.headerSelected);
+ this.element.addClass( "ui-accordion-icons" );
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children( ".ui-icon" ).remove();
+ this.element.removeClass( "ui-accordion-icons" );
+ },
+
+ destroy: function() {
+ var options = this.options;
+
+ this.element
+ .removeClass( "ui-accordion ui-widget ui-helper-reset" )
+ .removeAttr( "role" );
+
+ this.headers
+ .unbind( ".accordion" )
+ .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-selected" )
+ .removeAttr( "tabIndex" );
+
+ this.headers.find( "a" ).removeAttr( "tabIndex" );
+ this._destroyIcons();
+ var contents = this.headers.next()
+ .css( "display", "" )
+ .removeAttr( "role" )
+ .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
+ if ( options.autoHeight || options.fillHeight ) {
+ contents.css( "height", "" );
+ }
+
+ return $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ if ( key == "active" ) {
+ this.activate( value );
+ }
+ if ( key == "icons" ) {
+ this._destroyIcons();
+ if ( value ) {
+ this._createIcons();
+ }
+ }
+ // #5332 - opacity doesn't cascade to positioned elements in IE
+ // so we need to add the disabled class to the headers and panels
+ if ( key == "disabled" ) {
+ this.headers.add(this.headers.next())
+ [ value ? "addClass" : "removeClass" ](
+ "ui-accordion-disabled ui-state-disabled" );
+ }
+ },
+
+ _keydown: function( event ) {
+ if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+ return;
+ }
+
+ var keyCode = $.ui.keyCode,
+ length = this.headers.length,
+ currentIndex = this.headers.index( event.target ),
+ toFocus = false;
+
+ switch ( event.keyCode ) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler( { target: event.target }, event.target );
+ event.preventDefault();
+ }
+
+ if ( toFocus ) {
+ $( event.target ).attr( "tabIndex", -1 );
+ $( toFocus ).attr( "tabIndex", 0 );
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+ },
+
+ resize: function() {
+ var options = this.options,
+ maxHeight;
+
+ if ( options.fillSpace ) {
+ if ( $.browser.msie ) {
+ var defOverflow = this.element.parent().css( "overflow" );
+ this.element.parent().css( "overflow", "hidden");
+ }
+ maxHeight = this.element.parent().height();
+ if ($.browser.msie) {
+ this.element.parent().css( "overflow", defOverflow );
+ }
+
+ this.headers.each(function() {
+ maxHeight -= $( this ).outerHeight( true );
+ });
+
+ this.headers.next()
+ .each(function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ })
+ .css( "overflow", "auto" );
+ } else if ( options.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next()
+ .each(function() {
+ maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ })
+ .height( maxHeight );
+ }
+
+ return this;
+ },
+
+ activate: function( index ) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive( index )[ 0 ];
+ this._clickHandler( { target: active }, active );
+
+ return this;
+ },
+
+ _findActive: function( selector ) {
+ return selector
+ ? typeof selector === "number"
+ ? this.headers.filter( ":eq(" + selector + ")" )
+ : this.headers.not( this.headers.not( selector ) )
+ : selector === false
+ ? $( [] )
+ : this.headers.filter( ":eq(0)" );
+ },
+
+ // TODO isn't event.target enough? why the separate target argument?
+ _clickHandler: function( event, target ) {
+ var options = this.options;
+ if ( options.disabled ) {
+ return;
+ }
+
+ // called only when using activate(false) to close all parts programmatically
+ if ( !event.target ) {
+ if ( !options.collapsible ) {
+ return;
+ }
+ this.active
+ .removeClass( "ui-state-active ui-corner-top" )
+ .addClass( "ui-state-default ui-corner-all" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.headerSelected )
+ .addClass( options.icons.header );
+ this.active.next().addClass( "ui-accordion-content-active" );
+ var toHide = this.active.next(),
+ data = {
+ options: options,
+ newHeader: $( [] ),
+ oldHeader: options.active,
+ newContent: $( [] ),
+ oldContent: toHide
+ },
+ toShow = ( this.active = $( [] ) );
+ this._toggle( toShow, toHide, data );
+ return;
+ }
+
+ // get the click target
+ var clicked = $( event.currentTarget || target ),
+ clickedIsActive = clicked[0] === this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ options.active = options.collapsible && clickedIsActive ?
+ false :
+ this.headers.index( clicked );
+
+ // if animations are still active, or the active header is the target, ignore click
+ if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+ return;
+ }
+
+ // find elements to show and hide
+ var active = this.active,
+ toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: options,
+ newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ // when the call to ._toggle() comes after the class changes
+ // it causes a very odd bug in IE 8 (see #6720)
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle( toShow, toHide, data, clickedIsActive, down );
+
+ // switch classes
+ active
+ .removeClass( "ui-state-active ui-corner-top" )
+ .addClass( "ui-state-default ui-corner-all" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.headerSelected )
+ .addClass( options.icons.header );
+ if ( !clickedIsActive ) {
+ clicked
+ .removeClass( "ui-state-default ui-corner-all" )
+ .addClass( "ui-state-active ui-corner-top" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.header )
+ .addClass( options.icons.headerSelected );
+ clicked
+ .next()
+ .addClass( "ui-accordion-content-active" );
+ }
+
+ return;
+ },
+
+ _toggle: function( toShow, toHide, data, clickedIsActive, down ) {
+ var self = this,
+ options = self.options;
+
+ self.toShow = toShow;
+ self.toHide = toHide;
+ self.data = data;
+
+ var complete = function() {
+ if ( !self ) {
+ return;
+ }
+ return self._completed.apply( self, arguments );
+ };
+
+ // trigger changestart event
+ self._trigger( "changestart", null, self.data );
+
+ // count elements to animate
+ self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if ( options.animated ) {
+ var animOptions = {};
+
+ if ( options.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $( [] ),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: options.autoHeight || options.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: options.autoHeight || options.fillSpace
+ };
+ }
+
+ if ( !options.proxied ) {
+ options.proxied = options.animated;
+ }
+
+ if ( !options.proxiedDuration ) {
+ options.proxiedDuration = options.duration;
+ }
+
+ options.animated = $.isFunction( options.proxied ) ?
+ options.proxied( animOptions ) :
+ options.proxied;
+
+ options.duration = $.isFunction( options.proxiedDuration ) ?
+ options.proxiedDuration( animOptions ) :
+ options.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = options.duration,
+ easing = options.animated;
+
+ if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
+ easing = "slide";
+ }
+ if ( !animations[ easing ] ) {
+ animations[ easing ] = function( options ) {
+ this.slide( options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[ easing ]( animOptions );
+ } else {
+ if ( options.collapsible && clickedIsActive ) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete( true );
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev()
+ .attr({
+ "aria-expanded": "false",
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .blur();
+ toShow.prev()
+ .attr({
+ "aria-expanded": "true",
+ "aria-selected": "true",
+ tabIndex: 0
+ })
+ .focus();
+ },
+
+ _completed: function( cancel ) {
+ this.running = cancel ? 0 : --this.running;
+ if ( this.running ) {
+ return;
+ }
+
+ if ( this.options.clearStyle ) {
+ this.toShow.add( this.toHide ).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass( "ui-accordion-content-active" );
+ // Work around for rendering bug in IE (#5421)
+ if ( this.toHide.length ) {
+ this.toHide.parent()[0].className = this.toHide.parent()[0].className;
+ }
+
+ this._trigger( "change", null, this.data );
+ }
+});
+
+$.extend( $.ui.accordion, {
+ version: "1.8.14",
+ animations: {
+ slide: function( options, additions ) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions );
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({
+ height: "show",
+ paddingTop: "show",
+ paddingBottom: "show"
+ }, options );
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({
+ height: "hide",
+ paddingTop: "hide",
+ paddingBottom: "hide"
+ }, options );
+ return;
+ }
+ var overflow = options.toShow.css( "overflow" ),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt( s.parent().width(), 10 )
+ - parseInt( s.css( "paddingLeft" ), 10 )
+ - parseInt( s.css( "paddingRight" ), 10 )
+ - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 )
+ - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) );
+
+ $.each( fxAttrs, function( i, prop ) {
+ hideProps[ prop ] = "hide";
+
+ var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
+ showProps[ prop ] = {
+ value: parts[ 1 ],
+ unit: parts[ 2 ] || "px"
+ };
+ });
+ options.toShow.css({ height: 0, overflow: "hidden" }).show();
+ options.toHide
+ .filter( ":hidden" )
+ .each( options.complete )
+ .end()
+ .filter( ":visible" )
+ .animate( hideProps, {
+ step: function( now, settings ) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if ( settings.prop == "height" ) {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ ( settings.now - settings.start ) / ( settings.end - settings.start );
+ }
+
+ options.toShow[ 0 ].style[ settings.prop ] =
+ ( percentDone * showProps[ settings.prop ].value )
+ + showProps[ settings.prop ].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css( "height", "" );
+ }
+ options.toShow.css({
+ width: originalWidth,
+ overflow: overflow
+ });
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function( options ) {
+ this.slide( options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+
+})( jQuery );
+/*
+ * jQuery UI Autocomplete 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+ options: {
+ appendTo: "body",
+ autoFocus: false,
+ delay: 300,
+ minLength: 1,
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ source: null
+ },
+
+ pending: 0,
+
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument,
+ suppressKeyPress;
+
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ if ( self.options.disabled || self.element.attr( "readonly" ) ) {
+ return;
+ }
+
+ suppressKeyPress = false;
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._move( "previous", event );
+ // prevent moving cursor to beginning of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.DOWN:
+ self._move( "next", event );
+ // prevent moving cursor to end of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.ENTER:
+ case keyCode.NUMPAD_ENTER:
+ // when menu is open and has focus
+ if ( self.menu.active ) {
+ // #6055 - Opera still allows the keypress to occur
+ // which causes forms to submit
+ suppressKeyPress = true;
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select( event );
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ // only search if the value has changed
+ if ( self.term != self.element.val() ) {
+ self.selectedItem = null;
+ self.search( null, event );
+ }
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "keypress.autocomplete", function( event ) {
+ if ( suppressKeyPress ) {
+ suppressKeyPress = false;
+ event.preventDefault();
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ self.selectedItem = null;
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ self.closing = setTimeout(function() {
+ self.close( event );
+ self._change( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.response = function() {
+ return self._response.apply( self, arguments );
+ };
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( $( this.options.appendTo || "body", doc )[0] )
+ // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
+ .mousedown(function( event ) {
+ // clicking on the scrollbar causes focus to shift to the body
+ // but we can't detect a mouseup or a click immediately afterward
+ // so we have to track the next mousedown and close the menu if
+ // the user clicks somewhere outside of the autocomplete
+ var menuElement = self.menu.element[ 0 ];
+ if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+ setTimeout(function() {
+ $( document ).one( 'mousedown', function( event ) {
+ if ( event.target !== self.element[ 0 ] &&
+ event.target !== menuElement &&
+ !$.ui.contains( menuElement, event.target ) ) {
+ self.close();
+ }
+ });
+ }, 1 );
+ }
+
+ // use another timeout to make sure the blur-event-handler on the input was already triggered
+ setTimeout(function() {
+ clearTimeout( self.closing );
+ }, 13);
+ })
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", event, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( /^key/.test(event.originalEvent.type) ) {
+ self.element.val( item.value );
+ }
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" ),
+ previous = self.previous;
+
+ // only trigger when focus was lost (click on menu)
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ self.previous = previous;
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ setTimeout(function() {
+ self.previous = previous;
+ self.selectedItem = item;
+ }, 1);
+ }
+
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ self.term = self.element.val();
+
+ self.close( event );
+ self.selectedItem = item;
+ },
+ blur: function( event, ui ) {
+ // don't set the value of the text field if it's already correct
+ // this prevents moving the cursor unnecessarily
+ if ( self.menu.element.is(":visible") &&
+ ( self.element.val() !== self.term ) ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ if ( key === "appendTo" ) {
+ this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+ }
+ if ( key === "disabled" && value && this.xhr ) {
+ this.xhr.abort();
+ }
+ },
+
+ _initSource: function() {
+ var self = this,
+ array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter(array, request.term) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ if ( self.xhr ) {
+ self.xhr.abort();
+ }
+ self.xhr = $.ajax({
+ url: url,
+ data: request,
+ dataType: "json",
+ autocompleteRequest: ++requestIndex,
+ success: function( data, status ) {
+ if ( this.autocompleteRequest === requestIndex ) {
+ response( data );
+ }
+ },
+ error: function() {
+ if ( this.autocompleteRequest === requestIndex ) {
+ response( [] );
+ }
+ }
+ });
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+
+ // always save the actual value, not the one passed as an argument
+ this.term = this.element.val();
+
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger( "search", event ) === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.pending++;
+ this.element.addClass( "ui-autocomplete-loading" );
+
+ this.source( { term: value }, this.response );
+ },
+
+ _response: function( content ) {
+ if ( !this.options.disabled && content && content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ this.pending--;
+ if ( !this.pending ) {
+ this.element.removeClass( "ui-autocomplete-loading" );
+ }
+ },
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this.menu.element.hide();
+ this.menu.deactivate();
+ this._trigger( "close", event );
+ }
+ },
+
+ _change: function( event ) {
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 );
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+
+ // size and position menu
+ ul.show();
+ this._resizeMenu();
+ ul.position( $.extend({
+ of: this.element
+ }, this.options.position ));
+
+ if ( this.options.autoFocus ) {
+ this.menu.next( new $.Event("mouseover") );
+ }
+ },
+
+ _resizeMenu: function() {
+ var ul = this.menu.element;
+ ul.outerWidth( Math.max(
+ ul.width( "" ).outerWidth(),
+ this.element.outerWidth()
+ ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
+ },
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( $( "<a></a>" ).text( item.label ) )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
+ }
+ this.menu[ direction ]( event );
+ },
+
+ widget: function() {
+ return this.menu.element;
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+ return;
+ }
+ // temporary
+ event.preventDefault();
+ self.select( event );
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
+
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function( event ) {
+ self.activate( event, $(this).parent() );
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
+
+ activate: function( event, item ) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.scrollTop(),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.scrollTop( scroll + offset);
+ } else if (offset >= elementHeight) {
+ this.element.scrollTop( scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", event, { item: item });
+ },
+
+ deactivate: function() {
+ if (!this.active) { return; }
+
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
+
+ next: function(event) {
+ this.move("next", ".ui-menu-item:first", event);
+ },
+
+ previous: function(event) {
+ this.move("prev", ".ui-menu-item:last", event);
+ },
+
+ first: function() {
+ return this.active && !this.active.prevAll(".ui-menu-item").length;
+ },
+
+ last: function() {
+ return this.active && !this.active.nextAll(".ui-menu-item").length;
+ },
+
+ move: function(direction, edge, event) {
+ if (!this.active) {
+ this.activate(event, this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+ if (next.length) {
+ this.activate(event, next);
+ } else {
+ this.activate(event, this.element.children(edge));
+ }
+ },
+
+ // TODO merge with previousPage
+ nextPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(event, this.element.children(".ui-menu-item:first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children(".ui-menu-item").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(".ui-menu-item:last");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(".ui-menu-item")
+ .filter(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
+
+ // TODO merge with nextPage
+ previousPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(event, this.element.children(".ui-menu-item:last"));
+ return;
+ }
+
+ var base = this.active.offset().top,
+ height = this.element.height();
+ result = this.element.children(".ui-menu-item").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(".ui-menu-item:first");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(".ui-menu-item")
+ .filter(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
+
+ hasScroll: function() {
+ return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
+ },
+
+ select: function( event ) {
+ this._trigger("selected", event, { item: this.active });
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Button 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var lastActive, startXPos, startYPos, clickDragged,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ stateClasses = "ui-state-hover ui-state-active ",
+ typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+ formResetHandler = function() {
+ var buttons = $( this ).find( ":ui-button" );
+ setTimeout(function() {
+ buttons.button( "refresh" );
+ }, 1 );
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ options: {
+ disabled: null,
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
+
+ if ( typeof this.options.disabled !== "boolean" ) {
+ this.options.disabled = this.element.attr( "disabled" );
+ }
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
+
+ if ( this.element.is( ":disabled" ) ) {
+ options.disabled = true;
+ }
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "click.button", function( event ) {
+ if ( options.disabled ) {
+ event.preventDefault();
+ event.stopImmediatePropagation();
+ }
+ });
+
+ this.element
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ self.buttonElement.addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ self.buttonElement.removeClass( focusClass );
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ if ( clickDragged ) {
+ return;
+ }
+ self.refresh();
+ });
+ // if mouse moves between mousedown and mouseup (drag) set clickDragged flag
+ // prevents issue where button state changes but checkbox/radio checked state
+ // does not in Firefox (see ticket #6970)
+ this.buttonElement
+ .bind( "mousedown.button", function( event ) {
+ if ( options.disabled ) {
+ return;
+ }
+ clickDragged = false;
+ startXPos = event.pageX;
+ startYPos = event.pageY;
+ })
+ .bind( "mouseup.button", function( event ) {
+ if ( options.disabled ) {
+ return;
+ }
+ if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
+ clickDragged = true;
+ }
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled || clickDragged ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled || clickDragged ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", true );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ this._resetButton();
+ },
+
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ var ancestor = this.element.parents().filter(":last"),
+ labelSelector = "label[for=" + this.element.attr("id") + "]";
+ this.buttonElement = ancestor.find( labelSelector );
+ if ( !this.buttonElement.length ) {
+ ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+ this.buttonElement = ancestor.filter( labelSelector );
+ if ( !this.buttonElement.length ) {
+ this.buttonElement = ancestor.find( labelSelector );
+ }
+ }
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.attr( "disabled", true );
+ } else {
+ this.element.removeAttr( "disabled" );
+ }
+ return;
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement.removeClass( typeClasses ),
+ buttonText = $( "<span></span>" )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary,
+ buttonClasses = [];
+
+ if ( icons.primary || icons.secondary ) {
+ if ( this.options.text ) {
+ buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+ }
+
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+
+ if ( !this.options.text ) {
+ buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonClasses.push( "ui-button-text-only" );
+ }
+ buttonElement.addClass( buttonClasses.join( " " ) );
+ }
+});
+
+$.widget( "ui.buttonset", {
+ options: {
+ items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+ },
+
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ var ltr = this.element.css( "direction" ) === "ltr";
+
+ this.buttons = this.element.find( this.options.items )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( ltr ? "ui-corner-left" : "ui-corner-right" )
+ .end()
+ .filter( ":last" )
+ .addClass( ltr ? "ui-corner-right" : "ui-corner-left" )
+ .end()
+ .end();
+ },
+
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" );
+
+ $.Widget.prototype.destroy.call( this );
+ }
+});
+
+}( jQuery ) );
+/*
+ * jQuery UI Dialog 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function( $, undefined ) {
+
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ',
+ sizeRelatedOptions = {
+ buttons: true,
+ height: true,
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true,
+ width: true
+ },
+ resizableRelatedOptions = {
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true
+ },
+ // support for jQuery 1.3.2 - handle common attrFn methods for dialog
+ attrFn = $.attrFn || {
+ val: true,
+ css: true,
+ html: true,
+ text: true,
+ data: true,
+ width: true,
+ height: true,
+ offset: true,
+ click: true
+ };
+
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: {
+ my: 'center',
+ at: 'center',
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
+ },
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
+ // #5742 - .attr() might return a DOMElement
+ if ( typeof this.originalTitle !== "string" ) {
+ this.originalTitle = "";
+ }
+
+ this.options.title = this.options.title || this.originalTitle;
+ var self = this,
+ options = self.options,
+
+ title = options.title || ' ',
+ titleId = $.ui.dialog.getTitleId(self.element),
+
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
+
+ self._createButtons(options.buttons);
+ self._isOpen = false;
+
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
+
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
+
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ close: function(event) {
+ var self = this,
+ maxZ, thisZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ self._isOpen = false;
+
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
+
+ $.ui.dialog.overlay.resize();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ thisZ = $(this).css('z-index');
+ if(!isNaN(thisZ)) {
+ maxZ = Math.max(maxZ, thisZ);
+ }
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ }
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
+
+ return self;
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
+
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ if (options.modal) {
+ uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode !== $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $(self.element.find(':tabbable').get().concat(
+ uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
+ uiDialog.get()))).eq(0).focus();
+
+ self._isOpen = true;
+ self._trigger('open');
+
+ return self;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ ),
+ uiButtonSet = $( "<div></div>" )
+ .addClass( "ui-dialog-buttonset" )
+ .appendTo( uiDialogButtonPane );
+
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, props) {
+ props = $.isFunction( props ) ?
+ { click: props, text: name } :
+ props;
+ var button = $('<button type="button"></button>')
+ .click(function() {
+ props.click.apply(self.element[0], arguments);
+ })
+ .appendTo(uiButtonSet);
+ // can't use .attr( props, true ) with jQuery 1.3.2.
+ $.each( props, function( key, value ) {
+ if ( key === "click" ) {
+ return;
+ }
+ if ( key in attrFn ) {
+ button[ key ]( value );
+ } else {
+ button.attr( key, value );
+ }
+ });
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
+
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
+
+ if (position) {
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+ // if (typeof position == 'string' || $.isArray(position)) {
+ // myAt = $.isArray(position) ? position : position.split(' ');
+
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+
+ position = {
+ my: myAt.join(" "),
+ at: myAt.join(" "),
+ offset: offset.join(" ")
+ };
+ }
+
+ position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+ } else {
+ position = $.ui.dialog.prototype.options.position;
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position($.extend({ of: window }, position));
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOptions: function( options ) {
+ var self = this,
+ resizableOptions = {},
+ resize = false;
+
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+
+ if ( key in sizeRelatedOptions ) {
+ resize = true;
+ }
+ if ( key in resizableRelatedOptions ) {
+ resizableOptions[ key ] = value;
+ }
+ });
+
+ if ( resize ) {
+ this._size();
+ }
+ if ( this.uiDialog.is( ":data(resizable)" ) ) {
+ this.uiDialog.resizable( "option", resizableOptions );
+ }
+ },
+
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // ensure that we always pass a string
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ var isDraggable = uiDialog.is( ":data(draggable)" );
+ if ( isDraggable && !value ) {
+ uiDialog.draggable( "destroy" );
+ }
+
+ if ( !isDraggable && value ) {
+ self._makeDraggable();
+ }
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ var isResizable = uiDialog.is( ":data(resizable)" );
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply(self, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight,
+ minContentHeight,
+ isVisible = this.uiDialog.is( ":visible" );
+
+ // reset content sizing
+ this.element.show().css({
+ width: 'auto',
+ minHeight: 0,
+ height: 0
+ });
+
+ if (options.minWidth > options.width) {
+ options.width = options.minWidth;
+ }
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+ minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+
+ if ( options.height === "auto" ) {
+ // only needed for IE6 support
+ if ( $.support.minHeight ) {
+ this.element.css({
+ minHeight: minContentHeight,
+ height: "auto"
+ });
+ } else {
+ this.uiDialog.show();
+ var autoHeight = this.element.css( "height", "auto" ).height();
+ if ( !isVisible ) {
+ this.uiDialog.hide();
+ }
+ this.element.height( Math.max( autoHeight, minContentHeight ) );
+ }
+ } else {
+ this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+ }
+
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.8.14",
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ // we cannot return true when we don't want to cancel the event (#3523)
+ if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+ return false;
+ }
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ var indexOf = $.inArray($el, this.instances);
+ if (indexOf != -1){
+ this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+ }
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE
+ if ( $.browser.msie ) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Slider 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
+
+ _create: function() {
+ var self = this,
+ o = this.options,
+ existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
+ handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
+ handleCount = ( o.values && o.values.length ) || 1,
+ handles = [];
+
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" +
+ ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
+
+ this.range = $([]);
+
+ if ( o.range ) {
+ if ( o.range === true ) {
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ }
+ if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ }
+ }
+
+ this.range = $( "<div></div>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" +
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ " ui-widget-header" +
+ ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
+ }
+
+ for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
+ handles.push( handle );
+ }
+
+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ }, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ this.handles.each(function( i ) {
+ $( this ).data( "index.ui-slider-handle", i );
+ });
+
+ this.handles
+ .keydown(function( event ) {
+ var ret = true,
+ index = $( this ).data( "index.ui-slider-handle" ),
+ allowed,
+ curVal,
+ newVal,
+ step;
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ allowed = self._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = self.options.step;
+ if ( self.options.values && self.options.values.length ) {
+ curVal = newVal = self.values( index );
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === self._valueMax() ) {
+ return;
+ }
+ newVal = self._trimAlignValue( curVal + step );
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === self._valueMin() ) {
+ return;
+ }
+ newVal = self._trimAlignValue( curVal - step );
+ break;
+ }
+
+ self._slide( event, index, newVal );
+
+ return ret;
+
+ })
+ .keyup(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" );
+
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ self._stop( event, index );
+ self._change( event, index );
+ $( this ).removeClass( "ui-state-active" );
+ }
+
+ });
+
+ this._refreshValue();
+
+ this._animateOff = false;
+ },
+
+ destroy: function() {
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-slider-disabled" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" )
+ .removeData( "slider" )
+ .unbind( ".slider" );
+
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function( event ) {
+ var o = this.options,
+ position,
+ normValue,
+ distance,
+ closestHandle,
+ self,
+ index,
+ allowed,
+ offset,
+ mouseOverHandle;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ self = this;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - self.values(i) );
+ if ( distance > thisDistance ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if( o.range === true && this.values(1) === o.min ) {
+ index += 1;
+ closestHandle = $( this.handles[index] );
+ }
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
+
+ if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+ this._slide( event, index, normValue );
+ }
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function( event ) {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
+ },
+
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+ return this._trigger( "start", event, uiHash );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
+
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
+ },
+
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "stop", event, uiHash );
+ },
+
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "change", event, uiHash );
+ }
+ },
+
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ return;
+ }
+
+ return this._value();
+ },
+
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
+
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ return;
+ }
+
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
+ } else {
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
+
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.attr( "disabled", "disabled" );
+ this.element.addClass( "ui-disabled" );
+ } else {
+ this.handles.removeAttr( "disabled" );
+ this.element.removeClass( "ui-disabled" );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
+
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
+ }
+
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val <= this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val >= this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
+ valModStep = (val - this._valueMin()) % step;
+ alignValue = val - valModStep;
+
+ if ( Math.abs(valModStep) * 2 >= step ) {
+ alignValue += ( valModStep > 0 ) ? step : ( -step );
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var oRange = this.options.range,
+ o = this.options,
+ self = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ valPercent,
+ _set = {},
+ lastValPercent,
+ value,
+ valueMin,
+ valueMax;
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i, j ) {
+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( self.options.range === true ) {
+ if ( self.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+
+});
+
+$.extend( $.ui.slider, {
+ version: "1.8.14"
+});
+
+}(jQuery));
+/*
+ * jQuery UI Tabs 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var tabId = 0,
+ listId = 0;
+
+function getNextTabId() {
+ return ++tabId;
+}
+
+function getNextListId() {
+ return ++listId;
+}
+
+$.widget( "ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: "click",
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: "ui-tabs-",
+ load: null,
+ panelTemplate: "<div></div>",
+ remove: null,
+ select: null,
+ show: null,
+ spinner: "<em>Loading…</em>",
+ tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
+ },
+
+ _create: function() {
+ this._tabify( true );
+ },
+
+ _setOption: function( key, value ) {
+ if ( key == "selected" ) {
+ if (this.options.collapsible && value == this.options.selected ) {
+ return;
+ }
+ this.select( value );
+ } else {
+ this.options[ key ] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function( a ) {
+ return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
+ this.options.idPrefix + getNextTabId();
+ },
+
+ _sanitizeSelector: function( hash ) {
+ // we need this because an id may contain a ":"
+ return hash.replace( /:/g, "\\:" );
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie ||
+ ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
+ return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
+ },
+
+ _ui: function( tab, panel ) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index( tab )
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter( ".ui-state-processing" )
+ .removeClass( "ui-state-processing" )
+ .find( "span:data(label.tabs)" )
+ .each(function() {
+ var el = $( this );
+ el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
+ });
+ },
+
+ _tabify: function( init ) {
+ var self = this,
+ o = this.options,
+ fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+
+ this.list = this.element.find( "ol,ul" ).eq( 0 );
+ this.lis = $( " > li:has(a[href])", this.list );
+ this.anchors = this.lis.map(function() {
+ return $( "a", this )[ 0 ];
+ });
+ this.panels = $( [] );
+
+ this.anchors.each(function( i, a ) {
+ var href = $( a ).attr( "href" );
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split( "#" )[ 0 ],
+ baseEl;
+ if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
+ ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if ( fragmentId.test( href ) ) {
+ self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
+ // remote tab
+ // prevent loading the page itself if href is just "#"
+ } else if ( href && href !== "#" ) {
+ // required for restore on destroy
+ $.data( a, "href.tabs", href );
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
+
+ var id = self._tabId( a );
+ a.href = "#" + id;
+ var $panel = self.element.find( "#" + id );
+ if ( !$panel.length ) {
+ $panel = $( o.panelTemplate )
+ .attr( "id", id )
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .insertAfter( self.panels[ i - 1 ] || self.list );
+ $panel.data( "destroy.tabs", true );
+ }
+ self.panels = self.panels.add( $panel );
+ // invalid tab href
+ } else {
+ o.disabled.push( i );
+ }
+ });
+
+ // initialization from scratch
+ if ( init ) {
+ // attach necessary classes for styling
+ this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
+ this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+ this.lis.addClass( "ui-state-default ui-corner-top" );
+ this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if ( o.selected === undefined ) {
+ if ( location.hash ) {
+ this.anchors.each(function( i, a ) {
+ if ( a.hash == location.hash ) {
+ o.selected = i;
+ return false;
+ }
+ });
+ }
+ if ( typeof o.selected !== "number" && o.cookie ) {
+ o.selected = parseInt( self._cookie(), 10 );
+ }
+ if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
+ o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ }
+ o.selected = o.selected || ( this.lis.length ? 0 : -1 );
+ } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
+ ? o.selected
+ : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique( o.disabled.concat(
+ $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
+ return self.lis.index( n );
+ })
+ ) ).sort();
+
+ if ( $.inArray( o.selected, o.disabled ) != -1 ) {
+ o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
+ }
+
+ // highlight selected tab
+ this.panels.addClass( "ui-tabs-hide" );
+ this.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ // check for length avoids error when initializing empty list
+ if ( o.selected >= 0 && this.anchors.length ) {
+ self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
+ this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue( "tabs", function() {
+ self._trigger( "show", null,
+ self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
+ });
+
+ this.load( o.selected );
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ // TODO: namespace this event
+ $( window ).bind( "unload", function() {
+ self.lis.add( self.anchors ).unbind( ".tabs" );
+ self.lis = self.anchors = self.panels = null;
+ });
+ // update selected after add/remove
+ } else {
+ o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ }
+
+ // update collapsible
+ // TODO: use .toggleClass()
+ this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
+
+ // set or update cookie after init and add/remove respectively
+ if ( o.cookie ) {
+ this._cookie( o.selected, o.cookie );
+ }
+
+ // disable tabs
+ for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
+ $( li )[ $.inArray( i, o.disabled ) != -1 &&
+ // TODO: use .toggleClass()
+ !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+ }
+
+ // reset cache if switching from cached to not cached
+ if ( o.cache === false ) {
+ this.anchors.removeData( "cache.tabs" );
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add( this.anchors ).unbind( ".tabs" );
+
+ if ( o.event !== "mouseover" ) {
+ var addState = function( state, el ) {
+ if ( el.is( ":not(.ui-state-disabled)" ) ) {
+ el.addClass( "ui-state-" + state );
+ }
+ };
+ var removeState = function( state, el ) {
+ el.removeClass( "ui-state-" + state );
+ };
+ this.lis.bind( "mouseover.tabs" , function() {
+ addState( "hover", $( this ) );
+ });
+ this.lis.bind( "mouseout.tabs", function() {
+ removeState( "hover", $( this ) );
+ });
+ this.anchors.bind( "focus.tabs", function() {
+ addState( "focus", $( this ).closest( "li" ) );
+ });
+ this.anchors.bind( "blur.tabs", function() {
+ removeState( "focus", $( this ).closest( "li" ) );
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if ( o.fx ) {
+ if ( $.isArray( o.fx ) ) {
+ hideFx = o.fx[ 0 ];
+ showFx = o.fx[ 1 ];
+ } else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle( $el, fx ) {
+ $el.css( "display", "" );
+ if ( !$.support.opacity && fx.opacity ) {
+ $el[ 0 ].style.removeAttribute( "filter" );
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx
+ ? function( clicked, $show ) {
+ $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+ $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
+ .animate( showFx, showFx.duration || "normal", function() {
+ resetStyle( $show, showFx );
+ self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ });
+ }
+ : function( clicked, $show ) {
+ $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+ $show.removeClass( "ui-tabs-hide" );
+ self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx
+ ? function( clicked, $hide ) {
+ $hide.animate( hideFx, hideFx.duration || "normal", function() {
+ self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ $hide.addClass( "ui-tabs-hide" );
+ resetStyle( $hide, hideFx );
+ self.element.dequeue( "tabs" );
+ });
+ }
+ : function( clicked, $hide, $show ) {
+ self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ $hide.addClass( "ui-tabs-hide" );
+ self.element.dequeue( "tabs" );
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind( o.event + ".tabs", function() {
+ var el = this,
+ $li = $(el).closest( "li" ),
+ $hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
+ $show = self.element.find( self._sanitizeSelector( el.hash ) );
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
+ $li.hasClass( "ui-state-disabled" ) ||
+ $li.hasClass( "ui-state-processing" ) ||
+ self.panels.filter( ":animated" ).length ||
+ self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index( this );
+
+ self.abort();
+
+ // if tab may be closed
+ if ( o.collapsible ) {
+ if ( $li.hasClass( "ui-tabs-selected" ) ) {
+ o.selected = -1;
+
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ self.element.queue( "tabs", function() {
+ hideTab( el, $hide );
+ }).dequeue( "tabs" );
+
+ this.blur();
+ return false;
+ } else if ( !$hide.length ) {
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ self.element.queue( "tabs", function() {
+ showTab( el, $show );
+ });
+
+ // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+ self.load( self.anchors.index( this ) );
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ // show new tab
+ if ( $show.length ) {
+ if ( $hide.length ) {
+ self.element.queue( "tabs", function() {
+ hideTab( el, $hide );
+ });
+ }
+ self.element.queue( "tabs", function() {
+ showTab( el, $show );
+ });
+
+ self.load( self.anchors.index( this ) );
+ } else {
+ throw "jQuery UI Tabs: Mismatching fragment identifier.";
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ( $.browser.msie ) {
+ this.blur();
+ }
+ });
+
+ // disable click in any case
+ this.anchors.bind( "click.tabs", function(){
+ return false;
+ });
+ },
+
+ _getIndex: function( index ) {
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ // also sanitizes numerical indexes to valid values.
+ if ( typeof index == "string" ) {
+ index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) );
+ }
+
+ return index;
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element
+ .unbind( ".tabs" )
+ .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
+ .removeData( "tabs" );
+
+ this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+
+ this.anchors.each(function() {
+ var href = $.data( this, "href.tabs" );
+ if ( href ) {
+ this.href = href;
+ }
+ var $this = $( this ).unbind( ".tabs" );
+ $.each( [ "href", "load", "cache" ], function( i, prefix ) {
+ $this.removeData( prefix + ".tabs" );
+ });
+ });
+
+ this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
+ if ( $.data( this, "destroy.tabs" ) ) {
+ $( this ).remove();
+ } else {
+ $( this ).removeClass([
+ "ui-state-default",
+ "ui-corner-top",
+ "ui-tabs-selected",
+ "ui-state-active",
+ "ui-state-hover",
+ "ui-state-focus",
+ "ui-state-disabled",
+ "ui-tabs-panel",
+ "ui-widget-content",
+ "ui-corner-bottom",
+ "ui-tabs-hide"
+ ].join( " " ) );
+ }
+ });
+
+ if ( o.cookie ) {
+ this._cookie( null, o.cookie );
+ }
+
+ return this;
+ },
+
+ add: function( url, label, index ) {
+ if ( index === undefined ) {
+ index = this.anchors.length;
+ }
+
+ var self = this,
+ o = this.options,
+ $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
+ id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
+
+ $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
+
+ // try to find an existing element before creating a new one
+ var $panel = self.element.find( "#" + id );
+ if ( !$panel.length ) {
+ $panel = $( o.panelTemplate )
+ .attr( "id", id )
+ .data( "destroy.tabs", true );
+ }
+ $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
+
+ if ( index >= this.lis.length ) {
+ $li.appendTo( this.list );
+ $panel.appendTo( this.list[ 0 ].parentNode );
+ } else {
+ $li.insertBefore( this.lis[ index ] );
+ $panel.insertBefore( this.panels[ index ] );
+ }
+
+ o.disabled = $.map( o.disabled, function( n, i ) {
+ return n >= index ? ++n : n;
+ });
+
+ this._tabify();
+
+ if ( this.anchors.length == 1 ) {
+ o.selected = 0;
+ $li.addClass( "ui-tabs-selected ui-state-active" );
+ $panel.removeClass( "ui-tabs-hide" );
+ this.element.queue( "tabs", function() {
+ self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
+ });
+
+ this.load( 0 );
+ }
+
+ this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
+
+ remove: function( index ) {
+ index = this._getIndex( index );
+ var o = this.options,
+ $li = this.lis.eq( index ).remove(),
+ $panel = this.panels.eq( index ).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
+ this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+ }
+
+ o.disabled = $.map(
+ $.grep( o.disabled, function(n, i) {
+ return n != index;
+ }),
+ function( n, i ) {
+ return n >= index ? --n : n;
+ });
+
+ this._tabify();
+
+ this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
+ return this;
+ },
+
+ enable: function( index ) {
+ index = this._getIndex( index );
+ var o = this.options;
+ if ( $.inArray( index, o.disabled ) == -1 ) {
+ return;
+ }
+
+ this.lis.eq( index ).removeClass( "ui-state-disabled" );
+ o.disabled = $.grep( o.disabled, function( n, i ) {
+ return n != index;
+ });
+
+ this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
+
+ disable: function( index ) {
+ index = this._getIndex( index );
+ var self = this, o = this.options;
+ // cannot disable already selected tab
+ if ( index != o.selected ) {
+ this.lis.eq( index ).addClass( "ui-state-disabled" );
+
+ o.disabled.push( index );
+ o.disabled.sort();
+
+ this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ }
+
+ return this;
+ },
+
+ select: function( index ) {
+ index = this._getIndex( index );
+ if ( index == -1 ) {
+ if ( this.options.collapsible && this.options.selected != -1 ) {
+ index = this.options.selected;
+ } else {
+ return this;
+ }
+ }
+ this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
+ return this;
+ },
+
+ load: function( index ) {
+ index = this._getIndex( index );
+ var self = this,
+ o = this.options,
+ a = this.anchors.eq( index )[ 0 ],
+ url = $.data( a, "load.tabs" );
+
+ this.abort();
+
+ // not remote or from cache
+ if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
+ this.element.dequeue( "tabs" );
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq( index ).addClass( "ui-state-processing" );
+
+ if ( o.spinner ) {
+ var span = $( "span", a );
+ span.data( "label.tabs", span.html() ).html( o.spinner );
+ }
+
+ this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
+ url: url,
+ success: function( r, s ) {
+ self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
+
+ // take care of tab labels
+ self._cleanup();
+
+ if ( o.cache ) {
+ $.data( a, "cache.tabs", true );
+ }
+
+ self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+ try {
+ o.ajaxOptions.success( r, s );
+ }
+ catch ( e ) {}
+ },
+ error: function( xhr, s, e ) {
+ // take care of tab labels
+ self._cleanup();
+
+ self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error( xhr, s, index, a );
+ }
+ catch ( e ) {}
+ }
+ } ) );
+
+ // last, so that load event is fired before show...
+ self.element.dequeue( "tabs" );
+
+ return this;
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue( [] );
+ this.panels.stop( false, true );
+
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
+
+ // terminate pending requests from other tabs
+ if ( this.xhr ) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
+ },
+
+ url: function( index, url ) {
+ this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
+ return this;
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+});
+
+$.extend( $.ui.tabs, {
+ version: "1.8.14"
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend( $.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function( ms, continuing ) {
+ var self = this,
+ o = this.options;
+
+ var rotate = self._rotate || ( self._rotate = function( e ) {
+ clearTimeout( self.rotation );
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms );
+
+ if ( e ) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || ( self._unrotate = !continuing
+ ? function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ }
+ : function( e ) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if ( ms ) {
+ this.element.bind( "tabsshow", rotate );
+ this.anchors.bind( o.event + ".tabs", stop );
+ rotate();
+ // stop rotation
+ } else {
+ clearTimeout( self.rotation );
+ this.element.unbind( "tabsshow", rotate );
+ this.anchors.unbind( o.event + ".tabs", stop );
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})( jQuery );
+/*
+ * jQuery UI Datepicker 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function( $, undefined ) {
+
+$.extend($.ui, { datepicker: { version: "1.8.14" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+var instActive;
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'fadeIn', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'fast', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false // True to size the input for the date format, false to leave as is
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'));
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ //Keep track of the maximum number of rows displayed (see #7043)
+ maxRows: 4,
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = 'dp' + this.uuid;
+ }
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+ }
+ inst.input.attr('size', this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ inst.dpDiv.show();
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ this.uuid += 1;
+ var id = 'dp' + this.uuid;
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ removeAttr("disabled");
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ attr("disabled", "disabled");
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ extendRemove(inst.settings, settings);
+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+ if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined)
+ inst.settings.minDate = this._formatDate(inst, minDate);
+ if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined)
+ inst.settings.maxDate = this._formatDate(inst, maxDate);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDate(inst, date);
+ this._updateAlternate(inst);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
+ $.datepicker._currentClass + ')', inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (event) {
+ $.datepicker.log(event);
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ if ( $.datepicker._datepickerShowing ) {
+ $.datepicker._triggerOnClose($.datepicker._curInst);
+ }
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ //to avoid flashes on Firefox
+ inst.dpDiv.empty();
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
+ if( !! cover.length ){
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ cover.css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ }
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ $.datepicker._datepickerShowing = true;
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ self.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ instActive = inst; // for delegate hover events
+ inst.dpDiv.empty().append(this._generateHTML(inst));
+ var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
+ if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6
+ cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ }
+ inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ // #6694 - don't focus the input if it's already focused
+ // this breaks the change event in IE
+ inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement)
+ inst.input.focus();
+ // deffered render of the years select (to avoid flashes on Firefox)
+ if( inst.yearshtml ){
+ var origyearshtml = inst.yearshtml;
+ setTimeout(function(){
+ //assure that inst.yearshtml didn't change.
+ if( origyearshtml === inst.yearshtml && inst.yearshtml ){
+ inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml);
+ }
+ origyearshtml = inst.yearshtml = null;
+ }, 0);
+ }
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Trigger custom callback of onClose. */
+ _triggerOnClose: function(inst) {
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]);
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ $.datepicker._triggerOnClose(inst);
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if ($target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker();
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear) {
+ setTimeout(function() {
+ inst.input.focus();
+ }, 0);
+ }
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ var isDoubled = lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
+ return [ [k, v] ];
+ }).sort(function (a, b) {
+ return -(a[1].length - b[1].length);
+ });
+ var index = -1;
+ $.each(names, function (i, pair) {
+ var name = pair[1];
+ if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) {
+ index = pair[0];
+ iValue += name.length;
+ return false;
+ }
+ });
+ if (index != -1)
+ return index + 1;
+ else
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (iValue < value.length){
+ throw "Extra/unparsed characters found in date: " + value.substring(iValue);
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/00
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
+ newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate);
+ if (newDate) {
+ newDate.setHours(0);
+ newDate.setMinutes(0);
+ newDate.setSeconds(0);
+ newDate.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(newDate);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !date;
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = newDate.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ this.maxRows = 4;
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
+ var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
+ this.maxRows = numRows;
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
+ inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? ' ' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
+ // year selection
+ if ( !inst.yearshtml ) {
+ inst.yearshtml = '';
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ inst.yearshtml += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ inst.yearshtml += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ inst.yearshtml += '</select>';
+
+ html += inst.yearshtml;
+ inst.yearshtml = null;
+ }
+ }
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var newDate = (minDate && date < minDate ? minDate : date);
+ newDate = (maxDate && newDate > maxDate ? maxDate : newDate);
+ return newDate;
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function bindHover(dpDiv) {
+ var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a';
+ return dpDiv.bind('mouseout', function(event) {
+ var elem = $( event.target ).closest( selector );
+ if ( !elem.length ) {
+ return;
+ }
+ elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" );
+ })
+ .bind('mouseover', function(event) {
+ var elem = $( event.target ).closest( selector );
+ if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) ||
+ !elem.length ) {
+ return;
+ }
+ elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ elem.addClass('ui-state-hover');
+ if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover');
+ if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover');
+ });
+}
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Verify an empty collection wasn't passed - Fixes #6976 */
+ if ( !this.length ) {
+ return this;
+ }
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8.14";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
+
+})(jQuery);
+/*
+ * jQuery UI Progressbar 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0,
+ max: 100
+ },
+
+ min: 0,
+
+ _create: function() {
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this.min,
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this.oldValue = this._value();
+ this._refreshValue();
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+
+ $.Widget.prototype.destroy.apply( this, arguments );
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this._value();
+ }
+
+ this._setOption( "value", newValue );
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "value" ) {
+ this.options.value = value;
+ this._refreshValue();
+ if ( this._value() === this.options.max ) {
+ this._trigger( "complete" );
+ }
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ return Math.min( this.options.max, Math.max( this.min, val ) );
+ },
+
+ _percentage: function() {
+ return 100 * this._value() / this.options.max;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ var percentage = this._percentage();
+
+ if ( this.oldValue !== value ) {
+ this.oldValue = value;
+ this._trigger( "change" );
+ }
+
+ this.valueDiv
+ .toggle( value > this.min )
+ .toggleClass( "ui-corner-right", value === this.options.max )
+ .width( percentage.toFixed(0) + "%" );
+ this.element.attr( "aria-valuenow", value );
+ }
+});
+
+$.extend( $.ui.progressbar, {
+ version: "1.8.14"
+});
+
+})( jQuery );
+/*
+ * jQuery UI Effects 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($, undefined) {
+
+$.effects = {};
+
+
+
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
+ }
+
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
+
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
+
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
+
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
+
+ return diff;
+}
+
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
+
+ return this.queue(function() {
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('class');
+
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('class', className);
+
+ that.animate(styleDifference(originalStyle, newStyle), {
+ queue: false,
+ duration: duration,
+ easing: easing,
+ complete: function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
+ }
+ if (callback) { callback.apply(this, arguments); }
+ $.dequeue( this );
+ }
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ }
+ },
+
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+$.extend($.effects, {
+ version: "1.8.14",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ });
+
+ element.wrap(wrapper);
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
+ }
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+
+ options = options || {};
+
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
+
+ callback = callback || options.complete;
+
+ return [effect, options, speed, callback];
+}
+
+function standardSpeed( speed ) {
+ // valid standard speeds
+ if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
+ return true;
+ }
+
+ // invalid strings - treat as "normal" speed
+ if ( typeof speed === "string" && !$.effects[ speed ] ) {
+ return true;
+ }
+
+ return false;
+}
+
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects take actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ mode = args2.options.mode,
+ effectMethod = $.effects[effect];
+
+ if ( $.fx.off || !effectMethod ) {
+ // delegate to the original method (e.g., .show()) if possible
+ if ( mode ) {
+ return this[ mode ]( args2.duration, args2.callback );
+ } else {
+ return this.each(function() {
+ if ( args2.callback ) {
+ args2.callback.call( this );
+ }
+ });
+ }
+ }
+
+ return effectMethod.call(this, args2);
+ },
+
+ _show: $.fn.show,
+ show: function(speed) {
+ if ( standardSpeed( speed ) ) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if ( standardSpeed( speed ) ) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // jQuery core overloads toggle and creates _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fade 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.fade = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide');
+
+ elem.animate({ opacity: mode }, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show');
+ times = ((o.options.times || 5) * 2) - 1;
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
+ }
+
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
+ }
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
+ }
+
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
+
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
+
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity'];
+ var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
-.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px)}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:after{content:".";display:block;height:0;clear:both;visibility:hidden}.ui-helper-clearfix{display:inline-block}/*\*/* html .ui-helper-clearfix{height:1%}.ui-helper-clearfix{display:block}/**/.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-widget :active{outline:0}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-off{background-position:-96px -144px}.ui-icon-radio-on{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-corner-top{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-bottom{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-corner-right{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-corner-left{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all{-moz-border-radius:4px;-webkit-border-radius:4px;border-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.30;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.30;filter:Alpha(Opacity=30);-moz-border-radius:8px;-webkit-border-radius:8px;border-radius:8px}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:.1px;z-index:99999;display:block;background-image:url(data:)}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}.ui-accordion{width:100%}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1}.ui-accordion .ui-accordion-li-fix{display:inline}.ui-accordion .ui-accordion-header-active{border-bottom:0!important}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1}.ui-accordion .ui-accordion-content-active{display:block}.ui-autocomplete{position:absolute;cursor:default}* html .ui-autocomplete{width:1px}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left}.ui-menu .ui-menu{margin-top:-3px}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:0;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:0}.ui-tabs .ui-tabs-hide{display:none!important}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{display:none;display:block;position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}.ui-progressbar{height:2em;text-align:left}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}
\ No newline at end of file
+.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px)}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:after{content:".";display:block;height:0;clear:both;visibility:hidden}.ui-helper-clearfix{display:inline-block}/*\*/* html .ui-helper-clearfix{height:1%}.ui-helper-clearfix{display:block}/**/.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-widget :active{outline:0}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-off{background-position:-96px -144px}.ui-icon-radio-on{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.30;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.30;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:.1px;z-index:99999;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}.ui-accordion{width:100%}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1}.ui-accordion .ui-accordion-li-fix{display:inline}.ui-accordion .ui-accordion-header-active{border-bottom:0!important}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1}.ui-accordion .ui-accordion-content-active{display:block}.ui-autocomplete{position:absolute;cursor:default}* html .ui-autocomplete{width:1px}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left}.ui-menu .ui-menu{margin-top:-3px}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:0;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:0}.ui-tabs .ui-tabs-hide{display:none!important}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{display:none;display:block;position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}.ui-progressbar{height:2em;text-align:left}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}
\ No newline at end of file
/*
- * jQuery UI 1.8.12
+ * jQuery UI 1.8.14
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
*
* http://docs.jquery.com/UI
*/
-(function(a,c){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.12",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({_focus:a.fn.focus,focus:function(d,e){return typeof d==="number"?this.each(function(){var f=this;setTimeout(function(){a(f).focus();if(e){e.call(f)}},d)}):this._focus.apply(this,arguments)},scrollParent:function(){var d;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){d=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{d=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!d.length?a(document):d},zIndex:function(g){if(g!==c){return this.css("zIndex",g)}if(this.length){var e=a(this[0]),d,f;while(e.length&&e[0]!==document){d=e.css("position");if(d==="absolute"||d==="relative"||d==="fixed"){f=parseInt(e.css("zIndex"),10);if(!isNaN(f)&&f!==0){return f}}e=e.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(d){d.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(f,d){var e=d==="Width"?["Left","Right"]:["Top","Bottom"],g=d.toLowerCase(),j={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function h(l,k,i,m){a.each(e,function(){k-=parseFloat(a.curCSS(l,"padding"+this,true))||0;if(i){k-=parseFloat(a.curCSS(l,"border"+this+"Width",true))||0}if(m){k-=parseFloat(a.curCSS(l,"margin"+this,true))||0}});return k}a.fn["inner"+d]=function(i){if(i===c){return j["inner"+d].call(this)}return this.each(function(){a(this).css(g,h(this,i)+"px")})};a.fn["outer"+d]=function(i,k){if(typeof i!=="number"){return j["outer"+d].call(this,i)}return this.each(function(){a(this).css(g,h(this,i,true,k)+"px")})}});function b(d){return !a(d).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(f,e,d){return !!a.data(f,d[3])},focusable:function(f){var i=f.nodeName.toLowerCase(),d=a.attr(f,"tabindex");if("area"===i){var h=f.parentNode,g=h.name,e;if(!f.href||!g||h.nodeName.toLowerCase()!=="map"){return false}e=a("img[usemap=#"+g+"]")[0];return !!e&&b(e)}return(/input|select|textarea|button|object/.test(i)?!f.disabled:"a"==i?f.href||!isNaN(d):!isNaN(d))&&b(f)},tabbable:function(e){var d=a.attr(e,"tabindex");return(isNaN(d)||d>=0)&&a(e).is(":focusable")}});a(function(){var d=document.body,e=d.appendChild(e=document.createElement("div"));a.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=e.offsetHeight===100;a.support.selectstart="onselectstart" in e;d.removeChild(e).style.display="none"});a.extend(a.ui,{plugin:{add:function(e,f,h){var g=a.ui[e].prototype;for(var d in h){g.plugins[d]=g.plugins[d]||[];g.plugins[d].push([f,h[d]])}},call:function(d,f,e){var h=d.plugins[f];if(!h||!d.element[0].parentNode){return}for(var g=0;g<h.length;g++){if(d.options[h[g][0]]){h[g][1].apply(d.element,e)}}}},contains:function(e,d){return document.compareDocumentPosition?e.compareDocumentPosition(d)&16:e!==d&&e.contains(d)},hasScroll:function(g,e){if(a(g).css("overflow")==="hidden"){return false}var d=(e&&e==="left")?"scrollLeft":"scrollTop",f=false;if(g[d]>0){return true}g[d]=1;f=(g[d]>0);g[d]=0;return f},isOverAxis:function(e,d,f){return(e>d)&&(e<(d+f))},isOver:function(i,e,h,g,d,f){return a.ui.isOverAxis(i,h,d)&&a.ui.isOverAxis(e,g,f)}})})(jQuery);
+(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.14",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);
/*
- * jQuery UI Widget 1.8.12
+ * jQuery UI Widget 1.8.14
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
*/
(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(e){for(var f=0,g;(g=e[f])!=null;f++){b(g).triggerHandler("remove")}c(e)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(f,g,h){var k=this.options[f];g=b.Event(g);g.type=(f===this.widgetEventPrefix?f:this.widgetEventPrefix+f).toLowerCase();h=h||{};if(g.originalEvent){for(var e=b.event.props.length,j;e;){j=b.event.props[--e];g[j]=g.originalEvent[j]}}this.element.trigger(g,h);return !(b.isFunction(k)&&k.call(this.element[0],g,h)===false||g.isDefaultPrevented())}}})(jQuery);
/*
- * jQuery UI Mouse 1.8.12
+ * jQuery UI Mouse 1.8.14
*
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT or GPL Version 2 licenses.
* Depends:
* jquery.ui.widget.js
*/
-(function(a,b){a.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(d){return c._mouseDown(d)}).bind("click."+this.widgetName,function(d){if(true===a.data(d.target,c.widgetName+".preventClickEvent")){a.removeData(d.target,c.widgetName+".preventClickEvent");d.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(e){e.originalEvent=e.originalEvent||{};if(e.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(e));this._mouseDownEvent=e;var d=this,f=(e.which==1),c=(typeof this.options.cancel=="string"?a(e.target).parents().add(e.target).filter(this.options.cancel).length:false);if(!f||c||!this._mouseCapture(e)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){d.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(e)&&this._mouseDelayMet(e)){this._mouseStarted=(this._mouseStart(e)!==false);if(!this._mouseStarted){e.preventDefault();return true}}if(true===a.data(e.target,this.widgetName+".preventClickEvent")){a.removeData(e.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(g){return d._mouseMove(g)};this._mouseUpDelegate=function(g){return d._mouseUp(g)};a(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);e.preventDefault();e.originalEvent.mouseHandled=true;return true},_mouseMove:function(c){if(a.browser.msie&&!(document.documentMode>=9)&&!c.button){return this._mouseUp(c)}if(this._mouseStarted){this._mouseDrag(c);return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,c)!==false);(this._mouseStarted?this._mouseDrag(c):this._mouseUp(c))}return !this._mouseStarted},_mouseUp:function(c){a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(c.target==this._mouseDownEvent.target){a.data(c.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return(Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance)},_mouseDelayMet:function(c){return this.mouseDelayMet},_mouseStart:function(c){},_mouseDrag:function(c){},_mouseStop:function(c){},_mouseCapture:function(c){return true}})})(jQuery);(function(f,g){f.ui=f.ui||{};var d=/left|center|right/,e=/top|center|bottom/,a="center",b=f.fn.position,c=f.fn.offset;f.fn.position=function(i){if(!i||!i.of){return b.apply(this,arguments)}i=f.extend({},i);var m=f(i.of),l=m[0],o=(i.collision||"flip").split(" "),n=i.offset?i.offset.split(" "):[0,0],k,h,j;if(l.nodeType===9){k=m.width();h=m.height();j={top:0,left:0}}else{if(l.setTimeout){k=m.width();h=m.height();j={top:m.scrollTop(),left:m.scrollLeft()}}else{if(l.preventDefault){i.at="left top";k=h=0;j={top:i.of.pageY,left:i.of.pageX}}else{k=m.outerWidth();h=m.outerHeight();j=m.offset()}}}f.each(["my","at"],function(){var p=(i[this]||"").split(" ");if(p.length===1){p=d.test(p[0])?p.concat([a]):e.test(p[0])?[a].concat(p):[a,a]}p[0]=d.test(p[0])?p[0]:a;p[1]=e.test(p[1])?p[1]:a;i[this]=p});if(o.length===1){o[1]=o[0]}n[0]=parseInt(n[0],10)||0;if(n.length===1){n[1]=n[0]}n[1]=parseInt(n[1],10)||0;if(i.at[0]==="right"){j.left+=k}else{if(i.at[0]===a){j.left+=k/2}}if(i.at[1]==="bottom"){j.top+=h}else{if(i.at[1]===a){j.top+=h/2}}j.left+=n[0];j.top+=n[1];return this.each(function(){var s=f(this),v=s.outerWidth(),r=s.outerHeight(),u=parseInt(f.curCSS(this,"marginLeft",true))||0,q=parseInt(f.curCSS(this,"marginTop",true))||0,x=v+u+(parseInt(f.curCSS(this,"marginRight",true))||0),y=r+q+(parseInt(f.curCSS(this,"marginBottom",true))||0),w=f.extend({},j),p;if(i.my[0]==="right"){w.left-=v}else{if(i.my[0]===a){w.left-=v/2}}if(i.my[1]==="bottom"){w.top-=r}else{if(i.my[1]===a){w.top-=r/2}}w.left=Math.round(w.left);w.top=Math.round(w.top);p={left:w.left-u,top:w.top-q};f.each(["left","top"],function(A,z){if(f.ui.position[o[A]]){f.ui.position[o[A]][z](w,{targetWidth:k,targetHeight:h,elemWidth:v,elemHeight:r,collisionPosition:p,collisionWidth:x,collisionHeight:y,offset:n,my:i.my,at:i.at})}});if(f.fn.bgiframe){s.bgiframe()}s.offset(f.extend(w,{using:i.using}))})};f.ui.position={fit:{left:function(h,i){var k=f(window),j=i.collisionPosition.left+i.collisionWidth-k.width()-k.scrollLeft();h.left=j>0?h.left-j:Math.max(h.left-i.collisionPosition.left,h.left)},top:function(h,i){var k=f(window),j=i.collisionPosition.top+i.collisionHeight-k.height()-k.scrollTop();h.top=j>0?h.top-j:Math.max(h.top-i.collisionPosition.top,h.top)}},flip:{left:function(i,k){if(k.at[0]===a){return}var m=f(window),l=k.collisionPosition.left+k.collisionWidth-m.width()-m.scrollLeft(),h=k.my[0]==="left"?-k.elemWidth:k.my[0]==="right"?k.elemWidth:0,j=k.at[0]==="left"?k.targetWidth:-k.targetWidth,n=-2*k.offset[0];i.left+=k.collisionPosition.left<0?h+j+n:l>0?h+j+n:0},top:function(i,k){if(k.at[1]===a){return}var m=f(window),l=k.collisionPosition.top+k.collisionHeight-m.height()-m.scrollTop(),h=k.my[1]==="top"?-k.elemHeight:k.my[1]==="bottom"?k.elemHeight:0,j=k.at[1]==="top"?k.targetHeight:-k.targetHeight,n=-2*k.offset[1];i.top+=k.collisionPosition.top<0?h+j+n:l>0?h+j+n:0}}};if(!f.offset.setOffset){f.offset.setOffset=function(l,i){if(/static/.test(f.curCSS(l,"position"))){l.style.position="relative"}var k=f(l),n=k.offset(),h=parseInt(f.curCSS(l,"top",true),10)||0,m=parseInt(f.curCSS(l,"left",true),10)||0,j={top:(i.top-n.top)+h,left:(i.left-n.left)+m};if("using" in i){i.using.call(l,j)}else{k.css(j)}};f.fn.offset=function(h){var i=this[0];if(!i||!i.ownerDocument){return null}if(h){return this.each(function(){f.offset.setOffset(this,h)})}return c.call(this)}}}(jQuery));(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this},_mouseCapture:function(c){var d=this.options;if(this.helper||d.disabled||a(c.target).is(".ui-resizable-handle")){return false}this.handle=this._getHandle(c);if(!this.handle){return false}return true},_mouseStart:function(c){var d=this.options;this.helper=this._createHelper(c);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;(d.cursorAt&&this._adjustOffsetFromHelper(d.cursorAt));if(d.containment){this._setContainment()}if(this._trigger("start",c)===false){this._clear();return false}this._cacheHelperProportions();if(a.ui.ddmanager&&!d.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,c)}this.helper.addClass("ui-draggable-dragging");this._mouseDrag(c,true);return true},_mouseDrag:function(c,e){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");if(!e){var d=this._uiHash();if(this._trigger("drag",c,d)===false){this._mouseUp({});return false}this.position=d.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,c)}return false},_mouseStop:function(d){var e=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){e=a.ui.ddmanager.drop(this,d)}if(this.dropped){e=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original"){return false}if((this.options.revert=="invalid"&&!e)||(this.options.revert=="valid"&&e)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,e))){var c=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){if(c._trigger("stop",d)!==false){c._clear()}})}else{if(this._trigger("stop",d)!==false){this._clear()}}return false},cancel:function(){if(this.helper.is(".ui-draggable-dragging")){this._mouseUp({})}else{this._clear()}return this},_getHandle:function(c){var d=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==c.target){d=true}});return d},_createHelper:function(d){var e=this.options;var c=a.isFunction(e.helper)?a(e.helper.apply(this.element[0],[d])):(e.helper=="clone"?this.element.clone():this.element);if(!c.parents("body").length){c.appendTo((e.appendTo=="parent"?this.element[0].parentNode:e.appendTo))}if(c[0]!=this.element[0]&&!(/(fixed|absolute)/).test(c.css("position"))){c.css("position","absolute")}return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string"){c=c.split(" ")}if(a.isArray(c)){c={left:+c[0],top:+c[1]||0}}if("left" in c){this.offset.click.left=c.left+this.margins.left}if("right" in c){this.offset.click.left=this.helperProportions.width-c.right+this.margins.left}if("top" in c){this.offset.click.top=c.top+this.margins.top}if("bottom" in c){this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){c={top:0,left:0}}return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.element.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0),right:(parseInt(this.element.css("marginRight"),10)||0),bottom:(parseInt(this.element.css("marginBottom"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var f=this.options;if(f.containment=="parent"){f.containment=this.helper[0].parentNode}if(f.containment=="document"||f.containment=="window"){this.containment=[(f.containment=="document"?0:a(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(f.containment=="document"?0:a(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(f.containment=="document"?0:a(window).scrollLeft())+a(f.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(f.containment=="document"?0:a(window).scrollTop())+(a(f.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(f.containment)&&f.containment.constructor!=Array){var d=a(f.containment)[0];if(!d){return}var e=a(f.containment).offset();var c=(a(d).css("overflow")!="hidden");this.containment=[e.left+(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0),e.top+(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0),e.left+(c?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,e.top+(c?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}else{if(f.containment.constructor==Array){this.containment=f.containment}}},_convertPositionTo:function(g,i){if(!i){i=this.position}var e=g=="absolute"?1:-1;var f=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=(/(html|body)/i).test(c[0].tagName);return{top:(i.top+this.offset.relative.top*e+this.offset.parent.top*e-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(h?0:c.scrollTop()))*e)),left:(i.left+this.offset.relative.left*e+this.offset.parent.left*e-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:c.scrollLeft())*e))}},_generatePosition:function(f){var i=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,j=(/(html|body)/i).test(c[0].tagName);var e=f.pageX;var d=f.pageY;if(this.originalPosition){if(this.containment){if(f.pageX-this.offset.click.left<this.containment[0]){e=this.containment[0]+this.offset.click.left}if(f.pageY-this.offset.click.top<this.containment[1]){d=this.containment[1]+this.offset.click.top}if(f.pageX-this.offset.click.left>this.containment[2]){e=this.containment[2]+this.offset.click.left}if(f.pageY-this.offset.click.top>this.containment[3]){d=this.containment[3]+this.offset.click.top}}if(i.grid){var h=this.originalPageY+Math.round((d-this.originalPageY)/i.grid[1])*i.grid[1];d=this.containment?(!(h-this.offset.click.top<this.containment[1]||h-this.offset.click.top>this.containment[3])?h:(!(h-this.offset.click.top<this.containment[1])?h-i.grid[1]:h+i.grid[1])):h;var g=this.originalPageX+Math.round((e-this.originalPageX)/i.grid[0])*i.grid[0];e=this.containment?(!(g-this.offset.click.left<this.containment[0]||g-this.offset.click.left>this.containment[2])?g:(!(g-this.offset.click.left<this.containment[0])?g-i.grid[0]:g+i.grid[0])):g}}return{top:(d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(j?0:c.scrollTop())))),left:(e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():j?0:c.scrollLeft())))}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval){this.helper.remove()}this.helper=null;this.cancelHelperRemoval=false},_trigger:function(c,d,e){e=e||this._uiHash();a.ui.plugin.call(this,c,[d,e]);if(c=="drag"){this.positionAbs=this._convertPositionTo("absolute")}return a.Widget.prototype._trigger.call(this,c,d,e)},plugins:{},_uiHash:function(c){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});a.extend(a.ui.draggable,{version:"1.8.12"});a.ui.plugin.add("draggable","connectToSortable",{start:function(d,f){var e=a(this).data("draggable"),g=e.options,c=a.extend({},f,{item:e.element});e.sortables=[];a(g.connectToSortable).each(function(){var h=a.data(this,"sortable");if(h&&!h.options.disabled){e.sortables.push({instance:h,shouldRevert:h.options.revert});h.refreshPositions();h._trigger("activate",d,c)}})},stop:function(d,f){var e=a(this).data("draggable"),c=a.extend({},f,{item:e.element});a.each(e.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;e.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert){this.instance.options.revert=true}this.instance._mouseStop(d);this.instance.options.helper=this.instance.options._helper;if(e.options.helper=="original"){this.instance.currentItem.css({top:"auto",left:"auto"})}}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",d,c)}})},drag:function(d,g){var f=a(this).data("draggable"),c=this;var e=function(j){var p=this.offset.click.top,n=this.offset.click.left;var h=this.positionAbs.top,l=this.positionAbs.left;var k=j.height,m=j.width;var q=j.top,i=j.left;return a.ui.isOver(h+p,l+n,q,i,k,m)};a.each(f.sortables,function(h){this.instance.positionAbs=f.positionAbs;this.instance.helperProportions=f.helperProportions;this.instance.offset.click=f.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(c).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return g.helper[0]};d.target=this.instance.currentItem[0];this.instance._mouseCapture(d,true);this.instance._mouseStart(d,true,true);this.instance.offset.click.top=f.offset.click.top;this.instance.offset.click.left=f.offset.click.left;this.instance.offset.parent.left-=f.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=f.offset.parent.top-this.instance.offset.parent.top;f._trigger("toSortable",d);f.dropped=this.instance.element;f.currentItem=f.element;this.instance.fromOutside=f}if(this.instance.currentItem){this.instance._mouseDrag(d)}}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",d,this.instance._uiHash(this.instance));this.instance._mouseStop(d,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder){this.instance.placeholder.remove()}f._trigger("fromSortable",d);f.dropped=false}}})}});a.ui.plugin.add("draggable","cursor",{start:function(d,e){var c=a("body"),f=a(this).data("draggable").options;if(c.css("cursor")){f._cursor=c.css("cursor")}c.css("cursor",f.cursor)},stop:function(c,d){var e=a(this).data("draggable").options;if(e._cursor){a("body").css("cursor",e._cursor)}}});a.ui.plugin.add("draggable","iframeFix",{start:function(c,d){var e=a(this).data("draggable").options;a(e.iframeFix===true?"iframe":e.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(c,d){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(d,e){var c=a(e.helper),f=a(this).data("draggable").options;if(c.css("opacity")){f._opacity=c.css("opacity")}c.css("opacity",f.opacity)},stop:function(c,d){var e=a(this).data("draggable").options;if(e._opacity){a(d.helper).css("opacity",e._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(d,e){var c=a(this).data("draggable");if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){c.overflowOffset=c.scrollParent.offset()}},drag:function(e,f){var d=a(this).data("draggable"),g=d.options,c=false;if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML"){if(!g.axis||g.axis!="x"){if((d.overflowOffset.top+d.scrollParent[0].offsetHeight)-e.pageY<g.scrollSensitivity){d.scrollParent[0].scrollTop=c=d.scrollParent[0].scrollTop+g.scrollSpeed}else{if(e.pageY-d.overflowOffset.top<g.scrollSensitivity){d.scrollParent[0].scrollTop=c=d.scrollParent[0].scrollTop-g.scrollSpeed}}}if(!g.axis||g.axis!="y"){if((d.overflowOffset.left+d.scrollParent[0].offsetWidth)-e.pageX<g.scrollSensitivity){d.scrollParent[0].scrollLeft=c=d.scrollParent[0].scrollLeft+g.scrollSpeed}else{if(e.pageX-d.overflowOffset.left<g.scrollSensitivity){d.scrollParent[0].scrollLeft=c=d.scrollParent[0].scrollLeft-g.scrollSpeed}}}}else{if(!g.axis||g.axis!="x"){if(e.pageY-a(document).scrollTop()<g.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()-g.scrollSpeed)}else{if(a(window).height()-(e.pageY-a(document).scrollTop())<g.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()+g.scrollSpeed)}}}if(!g.axis||g.axis!="y"){if(e.pageX-a(document).scrollLeft()<g.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()-g.scrollSpeed)}else{if(a(window).width()-(e.pageX-a(document).scrollLeft())<g.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()+g.scrollSpeed)}}}}if(c!==false&&a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(d,e)}}});a.ui.plugin.add("draggable","snap",{start:function(d,e){var c=a(this).data("draggable"),f=c.options;c.snapElements=[];a(f.snap.constructor!=String?(f.snap.items||":data(draggable)"):f.snap).each(function(){var h=a(this);var g=h.offset();if(this!=c.element[0]){c.snapElements.push({item:this,width:h.outerWidth(),height:h.outerHeight(),top:g.top,left:g.left})}})},drag:function(u,p){var g=a(this).data("draggable"),q=g.options;var y=q.snapTolerance;var x=p.offset.left,w=x+g.helperProportions.width,f=p.offset.top,e=f+g.helperProportions.height;for(var v=g.snapElements.length-1;v>=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y<x&&x<n+y&&m-y<f&&f<A+y)||(s-y<x&&x<n+y&&m-y<e&&e<A+y)||(s-y<w&&w<n+y&&m-y<f&&f<A+y)||(s-y<w&&w<n+y&&m-y<e&&e<A+y))){if(g.snapElements[v].snapping){(g.options.snap.release&&g.options.snap.release.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=false;continue}if(q.snapMode!="inner"){var c=Math.abs(m-e)<=y;var z=Math.abs(A-f)<=y;var j=Math.abs(s-w)<=y;var k=Math.abs(n-x)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s-g.helperProportions.width}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n}).left-g.margins.left}}var h=(c||z||j||k);if(q.snapMode!="outer"){var c=Math.abs(m-f)<=y;var z=Math.abs(A-e)<=y;var j=Math.abs(s-x)<=y;var k=Math.abs(n-w)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A-g.helperProportions.height,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n-g.helperProportions.width}).left-g.margins.left}}if(!g.snapElements[v].snapping&&(c||z||j||k||h)){(g.options.snap.snap&&g.options.snap.snap.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=(c||z||j||k||h)}}});a.ui.plugin.add("draggable","stack",{start:function(d,e){var g=a(this).data("draggable").options;var f=a.makeArray(a(g.stack)).sort(function(i,h){return(parseInt(a(i).css("zIndex"),10)||0)-(parseInt(a(h).css("zIndex"),10)||0)});if(!f.length){return}var c=parseInt(f[0].style.zIndex)||0;a(f).each(function(h){this.style.zIndex=c+h});this[0].style.zIndex=c+f.length}});a.ui.plugin.add("draggable","zIndex",{start:function(d,e){var c=a(e.helper),f=a(this).data("draggable").options;if(c.css("zIndex")){f._zIndex=c.css("zIndex")}c.css("zIndex",f.zIndex)},stop:function(c,d){var e=a(this).data("draggable").options;if(e._zIndex){a(d.helper).css("zIndex",e._zIndex)}}})})(jQuery);(function(a,b){a.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var d=this.options,c=d.accept;this.isover=0;this.isout=1;this.accept=a.isFunction(c)?c:function(e){return e.is(c)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};a.ui.ddmanager.droppables[d.scope]=a.ui.ddmanager.droppables[d.scope]||[];a.ui.ddmanager.droppables[d.scope].push(this);(d.addClasses&&this.element.addClass("ui-droppable"))},destroy:function(){var c=a.ui.ddmanager.droppables[this.options.scope];for(var d=0;d<c.length;d++){if(c[d]==this){c.splice(d,1)}}this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(c,d){if(c=="accept"){this.accept=a.isFunction(d)?d:function(e){return e.is(d)}}a.Widget.prototype._setOption.apply(this,arguments)},_activate:function(d){var c=a.ui.ddmanager.current;if(this.options.activeClass){this.element.addClass(this.options.activeClass)}(c&&this._trigger("activate",d,this.ui(c)))},_deactivate:function(d){var c=a.ui.ddmanager.current;if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}(c&&this._trigger("deactivate",d,this.ui(c)))},_over:function(d){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0]){return}if(this.accept.call(this.element[0],(c.currentItem||c.element))){if(this.options.hoverClass){this.element.addClass(this.options.hoverClass)}this._trigger("over",d,this.ui(c))}},_out:function(d){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0]){return}if(this.accept.call(this.element[0],(c.currentItem||c.element))){if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("out",d,this.ui(c))}},_drop:function(d,e){var c=e||a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0]){return false}var f=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=a.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],(c.currentItem||c.element))&&a.ui.intersect(c,a.extend(g,{offset:g.element.offset()}),g.options.tolerance)){f=true;return false}});if(f){return false}if(this.accept.call(this.element[0],(c.currentItem||c.element))){if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("drop",d,this.ui(c));return this.element}return false},ui:function(d){return{draggable:(d.currentItem||d.element),helper:d.helper,position:d.position,offset:d.positionAbs}}});a.extend(a.ui.droppable,{version:"1.8.12"});a.ui.intersect=function(q,j,o){if(!j.offset){return false}var e=(q.positionAbs||q.position.absolute).left,d=e+q.helperProportions.width,n=(q.positionAbs||q.position.absolute).top,m=n+q.helperProportions.height;var g=j.offset.left,c=g+j.proportions.width,p=j.offset.top,k=p+j.proportions.height;switch(o){case"fit":return(g<=e&&d<=c&&p<=n&&m<=k);break;case"intersect":return(g<e+(q.helperProportions.width/2)&&d-(q.helperProportions.width/2)<c&&p<n+(q.helperProportions.height/2)&&m-(q.helperProportions.height/2)<k);break;case"pointer":var h=((q.positionAbs||q.position.absolute).left+(q.clickOffset||q.offset.click).left),i=((q.positionAbs||q.position.absolute).top+(q.clickOffset||q.offset.click).top),f=a.ui.isOver(i,h,p,g,j.proportions.height,j.proportions.width);return f;break;case"touch":return((n>=p&&n<=k)||(m>=p&&m<=k)||(n<p&&m>k))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(e<g&&d>c));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(f,h){var c=a.ui.ddmanager.droppables[f.options.scope]||[];var g=h?h.type:null;var k=(f.currentItem||f.element).find(":data(droppable)").andSelf();droppablesLoop:for(var e=0;e<c.length;e++){if(c[e].options.disabled||(f&&!c[e].accept.call(c[e].element[0],(f.currentItem||f.element)))){continue}for(var d=0;d<k.length;d++){if(k[d]==c[e].element[0]){c[e].proportions.height=0;continue droppablesLoop}}c[e].visible=c[e].element.css("display")!="none";if(!c[e].visible){continue}if(g=="mousedown"){c[e]._activate.call(c[e],h)}c[e].offset=c[e].element.offset();c[e].proportions={width:c[e].element[0].offsetWidth,height:c[e].element[0].offsetHeight}}},drop:function(c,d){var e=false;a.each(a.ui.ddmanager.droppables[c.options.scope]||[],function(){if(!this.options){return}if(!this.options.disabled&&this.visible&&a.ui.intersect(c,this,this.options.tolerance)){e=e||this._drop.call(this,d)}if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],(c.currentItem||c.element))){this.isout=1;this.isover=0;this._deactivate.call(this,d)}});return e},drag:function(c,d){if(c.options.refreshPositions){a.ui.ddmanager.prepareOffsets(c,d)}a.each(a.ui.ddmanager.droppables[c.options.scope]||[],function(){if(this.options.disabled||this.greedyChild||!this.visible){return}var f=a.ui.intersect(c,this,this.options.tolerance);var h=!f&&this.isover==1?"isout":(f&&this.isover==0?"isover":null);if(!h){return}var g;if(this.options.greedy){var e=this.element.parents(":data(droppable):eq(0)");if(e.length){g=a.data(e[0],"droppable");g.greedyChild=(h=="isover"?1:0)}}if(g&&h=="isover"){g.isover=0;g.isout=1;g._out.call(g,d)}this[h]=1;this[h=="isout"?"isover":"isout"]=0;this[h=="isover"?"_over":"_out"].call(this,d);if(g&&h=="isout"){g.isout=0;g.isover=1;g._over.call(g,d)}})}}})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&c.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}if(c.browser.opera&&(/relative/).test(e.css("position"))){e.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(h.height){h.width=(f.height*this.aspectRatio)}else{if(h.width){h.height=(f.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this.options,r=this._aspectRatio||g.shiftKey,q=this.axis,u=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(u){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(u&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.12"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10),position:k.css("position")})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,v){var u=(r[v]||0)+(k[v]||0);if(u&&u>=0){p[v]=u||null}});if(c.browser.opera&&/relative/.test(q.css("position"))){f._revertToRelativePosition=true;q.css({position:"absolute",top:"auto",left:"auto"})}q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(g,h){var f=c(this).data("resizable"),i=f.options;var e=function(j){c(j).each(function(){var k=c(this);k.css({position:k.data("resizable-alsoresize").position})})};if(f._revertToRelativePosition){f._revertToRelativePosition=false;if(typeof(i.alsoResize)=="object"&&!i.alsoResize.nodeType){c.each(i.alsoResize,function(j){e(j)})}else{e(i.alsoResize)}}c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var u=c(this).data("resizable"),j=u.options,l=u.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}u.containerElement=c(k);if(/document/.test(g)||g==document){u.containerOffset={left:0,top:0};u.containerPosition={left:0,top:0};u.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});u.containerOffset=n.offset();u.containerPosition=n.position();u.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=u.containerOffset,e=u.containerSize.height,m=u.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);u.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var u=c(this).data("resizable"),i=u.options,f=u.containerSize,p=u.containerOffset,m=u.size,n=u.position,r=u._aspectRatio||g.shiftKey,e={top:0,left:0},h=u.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(u._helper?p.left:0)){u.size.width=u.size.width+(u._helper?(u.position.left-p.left):(u.position.left-e.left));if(r){u.size.height=u.size.width/i.aspectRatio}u.position.left=i.helper?p.left:0}if(n.top<(u._helper?p.top:0)){u.size.height=u.size.height+(u._helper?(u.position.top-p.top):u.position.top);if(r){u.size.width=u.size.height*i.aspectRatio}u.position.top=u._helper?p.top:0}u.offset.left=u.parentData.left+u.position.left;u.offset.top=u.parentData.top+u.position.top;var l=Math.abs((u._helper?u.offset.left-e.left:(u.offset.left-e.left))+u.sizeDiff.width),s=Math.abs((u._helper?u.offset.top-e.top:(u.offset.top-p.top))+u.sizeDiff.height);var k=u.containerElement.get(0)==u.element.parent().get(0),j=/relative|absolute/.test(u.containerElement.css("position"));if(k&&j){l-=u.parentData.left}if(l+u.size.width>=u.parentData.width){u.size.width=u.parentData.width-l;if(r){u.size.height=u.size.width/u.aspectRatio}}if(s+u.size.height>=u.parentData.height){u.size.height=u.parentData.height-s;if(r){u.size.width=u.size.height*u.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var d;this.refresh=function(){d=a(c.options.filter,c.element[0]);d.each(function(){var e=a(this);var f=e.offset();a.data(this,"selectable-item",{element:this,$element:e,left:f.left,top:f.top,right:f.left+e.outerWidth(),bottom:f.top+e.outerHeight(),startselected:false,selected:e.hasClass("ui-selected"),selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})};this.refresh();this.selectees=d.addClass("ui-selectee");this._mouseInit();this.helper=a("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(e){var c=this;this.opos=[e.pageX,e.pageY];if(this.options.disabled){return}var d=this.options;this.selectees=a(d.filter,this.element[0]);this._trigger("start",e);a(d.appendTo).append(this.helper);this.helper.css({left:e.clientX,top:e.clientY,width:0,height:0});if(d.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var f=a.data(this,"selectable-item");f.startselected=true;if(!e.metaKey){f.$element.removeClass("ui-selected");f.selected=false;f.$element.addClass("ui-unselecting");f.unselecting=true;c._trigger("unselecting",e,{unselecting:f.element})}});a(e.target).parents().andSelf().each(function(){var g=a.data(this,"selectable-item");if(g){var f=!e.metaKey||!g.$element.hasClass("ui-selected");g.$element.removeClass(f?"ui-unselecting":"ui-selected").addClass(f?"ui-selecting":"ui-unselecting");g.unselecting=!f;g.selecting=f;g.selected=f;if(f){c._trigger("selecting",e,{selecting:g.element})}else{c._trigger("unselecting",e,{unselecting:g.element})}return false}})},_mouseDrag:function(j){var d=this;this.dragged=true;if(this.options.disabled){return}var f=this.options;var e=this.opos[0],i=this.opos[1],c=j.pageX,h=j.pageY;if(e>c){var g=c;c=e;e=g}if(i>h){var g=h;h=i;i=g}this.helper.css({left:e,top:i,width:c-e,height:h-i});this.selectees.each(function(){var k=a.data(this,"selectable-item");if(!k||k.element==d.element[0]){return}var l=false;if(f.tolerance=="touch"){l=(!(k.left>c||k.right<e||k.top>h||k.bottom<i))}else{if(f.tolerance=="fit"){l=(k.left>e&&k.right<c&&k.top>i&&k.bottom<h)}}if(l){if(k.selected){k.$element.removeClass("ui-selected");k.selected=false}if(k.unselecting){k.$element.removeClass("ui-unselecting");k.unselecting=false}if(!k.selecting){k.$element.addClass("ui-selecting");k.selecting=true;d._trigger("selecting",j,{selecting:k.element})}}else{if(k.selecting){if(j.metaKey&&k.startselected){k.$element.removeClass("ui-selecting");k.selecting=false;k.$element.addClass("ui-selected");k.selected=true}else{k.$element.removeClass("ui-selecting");k.selecting=false;if(k.startselected){k.$element.addClass("ui-unselecting");k.unselecting=true}d._trigger("unselecting",j,{unselecting:k.element})}}if(k.selected){if(!j.metaKey&&!k.startselected){k.$element.removeClass("ui-selected");k.selected=false;k.$element.addClass("ui-unselecting");k.unselecting=true;d._trigger("unselecting",j,{unselecting:k.element})}}}});return false},_mouseStop:function(e){var c=this;this.dragged=false;var d=this.options;a(".ui-unselecting",this.element[0]).each(function(){var f=a.data(this,"selectable-item");f.$element.removeClass("ui-unselecting");f.unselecting=false;f.startselected=false;c._trigger("unselected",e,{unselected:f.element})});a(".ui-selecting",this.element[0]).each(function(){var f=a.data(this,"selectable-item");f.$element.removeClass("ui-selecting").addClass("ui-selected");f.selecting=false;f.selected=true;f.startselected=true;c._trigger("selected",e,{selected:f.element})});this._trigger("stop",e);this.helper.remove();return false}});a.extend(a.ui.selectable,{version:"1.8.12"})})(jQuery);(function(a,b){a.widget("ui.sortable",a.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000},_create:function(){var c=this.options;this.containerCache={};this.element.addClass("ui-sortable");this.refresh();this.floating=this.items.length?(/left|right/).test(this.items[0].item.css("float"))||(/inline|table-cell/).test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var c=this.items.length-1;c>=0;c--){this.items[c].item.removeData("sortable-item")}return this},_setOption:function(c,d){if(c==="disabled"){this.options[c]=d;this.widget()[d?"addClass":"removeClass"]("ui-sortable-disabled")}else{a.Widget.prototype._setOption.apply(this,arguments)}},_mouseCapture:function(f,g){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(f);var e=null,d=this,c=a(f.target).parents().each(function(){if(a.data(this,"sortable-item")==d){e=a(this);return false}});if(a.data(f.target,"sortable-item")==d){e=a(f.target)}if(!e){return false}if(this.options.handle&&!g){var h=false;a(this.options.handle,e).find("*").andSelf().each(function(){if(this==f.target){h=true}});if(!h){return false}}this.currentItem=e;this._removeCurrentsFromItems();return true},_mouseStart:function(f,g,c){var h=this.options,d=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(f);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:f.pageX-this.offset.left,top:f.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(f);this.originalPageX=f.pageX;this.originalPageY=f.pageY;(h.cursorAt&&this._adjustOffsetFromHelper(h.cursorAt));this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(h.containment){this._setContainment()}if(h.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",h.cursor)}if(h.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",h.opacity)}if(h.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",h.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",f,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!c){for(var e=this.containers.length-1;e>=0;e--){this.containers[e]._trigger("activate",f,d._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!h.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,f)}this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(f);return true},_mouseDrag:function(g){this.position=this._generatePosition(g);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var h=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-g.pageY<h.scrollSensitivity){this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+h.scrollSpeed}else{if(g.pageY-this.overflowOffset.top<h.scrollSensitivity){this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-h.scrollSpeed}}if((this.overflowOffset.left+this.scrollParent[0].offsetWidth)-g.pageX<h.scrollSensitivity){this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+h.scrollSpeed}else{if(g.pageX-this.overflowOffset.left<h.scrollSensitivity){this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-h.scrollSpeed}}}else{if(g.pageY-a(document).scrollTop()<h.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()-h.scrollSpeed)}else{if(a(window).height()-(g.pageY-a(document).scrollTop())<h.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()+h.scrollSpeed)}}if(g.pageX-a(document).scrollLeft()<h.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()-h.scrollSpeed)}else{if(a(window).width()-(g.pageX-a(document).scrollLeft())<h.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()+h.scrollSpeed)}}}if(c!==false&&a.ui.ddmanager&&!h.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,g)}}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}for(var e=this.items.length-1;e>=0;e--){var f=this.items[e],d=f.item[0],j=this._intersectsWithPointer(f);if(!j){continue}if(d!=this.currentItem[0]&&this.placeholder[j==1?"next":"prev"]()[0]!=d&&!a.ui.contains(this.placeholder[0],d)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],d):true)){this.direction=j==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f)){this._rearrange(g,f)}else{break}this._trigger("change",g,this._uiHash());break}}this._contactContainers(g);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,g)}this._trigger("sort",g,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,e){if(!d){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,d)}if(this.options.revert){var c=this;var f=c.placeholder.offset();c.reverting=true;a(this.helper).animate({left:f.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:f.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(d)})}else{this._clear(d,e)}return false},cancel:function(){var c=this;if(this.dragging){this._mouseUp({target:null});if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("deactivate",null,c._uiHash(this));if(this.containers[d].containerCache.over){this.containers[d]._trigger("out",null,c._uiHash(this));this.containers[d].containerCache.over=0}}}if(this.placeholder){if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}}return this},serialize:function(e){var c=this._getItemsAsjQuery(e&&e.connected);var d=[];e=e||{};a(c).each(function(){var f=(a(e.item||this).attr(e.attribute||"id")||"").match(e.expression||(/(.+)[-=_](.+)/));if(f){d.push((e.key||f[1]+"[]")+"="+(e.key&&e.expression?f[1]:f[2]))}});if(!d.length&&e.key){d.push(e.key+"=")}return d.join("&")},toArray:function(e){var c=this._getItemsAsjQuery(e&&e.connected);var d=[];e=e||{};c.each(function(){d.push(a(e.item||this).attr(e.attribute||"id")||"")});return d},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)<i&&(e+h)>f&&(e+h)<c;if(this.options.tolerance=="pointer"||this.options.forcePointerForContainers||(this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>m[this.floating?"width":"height"])){return g}else{return(f<e+(this.helperProportions.width/2)&&d-(this.helperProportions.width/2)<c&&n<k+(this.helperProportions.height/2)&&j-(this.helperProportions.height/2)<i)}},_intersectsWithPointer:function(e){var f=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,e.top,e.height),d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,e.left,e.width),h=f&&d,c=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();if(!h){return false}return this.floating?(((g&&g=="right")||c=="down")?2:1):(c&&(c=="down"?2:1))},_intersectsWithSides:function(f){var d=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,f.top+(f.height/2),f.height),e=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,f.left+(f.width/2),f.width),c=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();if(this.floating&&g){return((g=="right"&&e)||(g=="left"&&!e))}else{return c&&((c=="down"&&d)||(c=="up"&&!d))}},_getDragVerticalDirection:function(){var c=this.positionAbs.top-this.lastPositionAbs.top;return c!=0&&(c>0?"down":"up")},_getDragHorizontalDirection:function(){var c=this.positionAbs.left-this.lastPositionAbs.left;return c!=0&&(c>0?"right":"left")},refresh:function(c){this._refreshItems(c);this.refreshPositions();return this},_connectWith:function(){var c=this.options;return c.connectWith.constructor==String?[c.connectWith]:c.connectWith},_getItemsAsjQuery:function(c){var m=this;var h=[];var f=[];var k=this._connectWith();if(k&&c){for(var e=k.length-1;e>=0;e--){var l=a(k[e]);for(var d=l.length-1;d>=0;d--){var g=a.data(l[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element):a(g.options.items,g.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),g])}}}}f.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var e=f.length-1;e>=0;e--){f[e][0].each(function(){h.push(this)})}return a(h)},_removeCurrentsFromItems:function(){var e=this.currentItem.find(":data(sortable-item)");for(var d=0;d<this.items.length;d++){for(var c=0;c<e.length;c++){if(e[c]==this.items[d].item[0]){this.items.splice(d,1)}}}},_refreshItems:function(c){this.items=[];this.containers=[this];var k=this.items;var q=this;var g=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],c,{item:this.currentItem}):a(this.options.items,this.element),this]];var m=this._connectWith();if(m){for(var f=m.length-1;f>=0;f--){var n=a(m[f]);for(var e=n.length-1;e>=0;e--){var h=a.data(n[e],"sortable");if(h&&h!=this&&!h.options.disabled){g.push([a.isFunction(h.options.items)?h.options.items.call(h.element[0],c,{item:this.currentItem}):a(h.options.items,h.element),h]);this.containers.push(h)}}}}for(var f=g.length-1;f>=0;f--){var l=g[f][1];var d=g[f][0];for(var e=0,o=d.length;e<o;e++){var p=a(d[e]);p.data("sortable-item",l);k.push({item:p,instance:l,width:0,height:0,left:0,top:0})}}},refreshPositions:function(c){if(this.offsetParent&&this.helper){this.offset.parent=this._getParentOffset()}for(var e=this.items.length-1;e>=0;e--){var f=this.items[e];if(f.instance!=this.currentContainer&&this.currentContainer&&f.item[0]!=this.currentItem[0]){continue}var d=this.options.toleranceElement?a(this.options.toleranceElement,f.item):f.item;if(!c){f.width=d.outerWidth();f.height=d.outerHeight()}var g=d.offset();f.left=g.left;f.top=g.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var e=this.containers.length-1;e>=0;e--){var g=this.containers[e].element.offset();this.containers[e].containerCache.left=g.left;this.containers[e].containerCache.top=g.top;this.containers[e].containerCache.width=this.containers[e].element.outerWidth();this.containers[e].containerCache.height=this.containers[e].element.outerHeight()}}return this},_createPlaceholder:function(e){var c=e||this,f=c.options;if(!f.placeholder||f.placeholder.constructor==String){var d=f.placeholder;f.placeholder={element:function(){var g=a(document.createElement(c.currentItem[0].nodeName)).addClass(d||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!d){g.style.visibility="hidden"}return g},update:function(g,h){if(d&&!f.forcePlaceholderSize){return}if(!h.height()){h.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10))}if(!h.width()){h.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}}c.placeholder=a(f.placeholder.element.call(c.element,c.currentItem));c.currentItem.after(c.placeholder);f.placeholder.update(c,c.placeholder)},_contactContainers:function(c){var e=null,l=null;for(var g=this.containers.length-1;g>=0;g--){if(a.ui.contains(this.currentItem[0],this.containers[g].element[0])){continue}if(this._intersectsWith(this.containers[g].containerCache)){if(e&&a.ui.contains(this.containers[g].element[0],e.element[0])){continue}e=this.containers[g];l=g}else{if(this.containers[g].containerCache.over){this.containers[g]._trigger("out",c,this._uiHash(this));this.containers[g].containerCache.over=0}}}if(!e){return}if(this.containers.length===1){this.containers[l]._trigger("over",c,this._uiHash(this));this.containers[l].containerCache.over=1}else{if(this.currentContainer!=this.containers[l]){var k=10000;var h=null;var d=this.positionAbs[this.containers[l].floating?"left":"top"];for(var f=this.items.length-1;f>=0;f--){if(!a.ui.contains(this.containers[l].element[0],this.items[f].item[0])){continue}var m=this.items[f][this.containers[l].floating?"left":"top"];if(Math.abs(m-d)<k){k=Math.abs(m-d);h=this.items[f]}}if(!h&&!this.options.dropOnEmpty){return}this.currentContainer=this.containers[l];h?this._rearrange(c,h,null,true):this._rearrange(c,null,this.containers[l].element,true);this._trigger("change",c,this._uiHash());this.containers[l]._trigger("change",c,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[l]._trigger("over",c,this._uiHash(this));this.containers[l].containerCache.over=1}}},_createHelper:function(d){var e=this.options;var c=a.isFunction(e.helper)?a(e.helper.apply(this.element[0],[d,this.currentItem])):(e.helper=="clone"?this.currentItem.clone():this.currentItem);if(!c.parents("body").length){a(e.appendTo!="parent"?e.appendTo:this.currentItem[0].parentNode)[0].appendChild(c[0])}if(c[0]==this.currentItem[0]){this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}}if(c[0].style.width==""||e.forceHelperSize){c.width(this.currentItem.width())}if(c[0].style.height==""||e.forceHelperSize){c.height(this.currentItem.height())}return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string"){c=c.split(" ")}if(a.isArray(c)){c={left:+c[0],top:+c[1]||0}}if("left" in c){this.offset.click.left=c.left+this.margins.left}if("right" in c){this.offset.click.left=this.helperProportions.width-c.right+this.margins.left}if("top" in c){this.offset.click.top=c.top+this.margins.top}if("bottom" in c){this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){c={top:0,left:0}}return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.currentItem.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.currentItem.css("marginLeft"),10)||0),top:(parseInt(this.currentItem.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var f=this.options;if(f.containment=="parent"){f.containment=this.helper[0].parentNode}if(f.containment=="document"||f.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(f.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(f.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(f.containment)){var d=a(f.containment)[0];var e=a(f.containment).offset();var c=(a(d).css("overflow")!="hidden");this.containment=[e.left+(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0)-this.margins.left,e.top+(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0)-this.margins.top,e.left+(c?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,e.top+(c?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(g,i){if(!i){i=this.position}var e=g=="absolute"?1:-1;var f=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=(/(html|body)/i).test(c[0].tagName);return{top:(i.top+this.offset.relative.top*e+this.offset.parent.top*e-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(h?0:c.scrollTop()))*e)),left:(i.left+this.offset.relative.left*e+this.offset.parent.left*e-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:c.scrollLeft())*e))}},_generatePosition:function(f){var i=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,j=(/(html|body)/i).test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var e=f.pageX;var d=f.pageY;if(this.originalPosition){if(this.containment){if(f.pageX-this.offset.click.left<this.containment[0]){e=this.containment[0]+this.offset.click.left}if(f.pageY-this.offset.click.top<this.containment[1]){d=this.containment[1]+this.offset.click.top}if(f.pageX-this.offset.click.left>this.containment[2]){e=this.containment[2]+this.offset.click.left}if(f.pageY-this.offset.click.top>this.containment[3]){d=this.containment[3]+this.offset.click.top}}if(i.grid){var h=this.originalPageY+Math.round((d-this.originalPageY)/i.grid[1])*i.grid[1];d=this.containment?(!(h-this.offset.click.top<this.containment[1]||h-this.offset.click.top>this.containment[3])?h:(!(h-this.offset.click.top<this.containment[1])?h-i.grid[1]:h+i.grid[1])):h;var g=this.originalPageX+Math.round((e-this.originalPageX)/i.grid[0])*i.grid[0];e=this.containment?(!(g-this.offset.click.left<this.containment[0]||g-this.offset.click.left>this.containment[2])?g:(!(g-this.offset.click.left<this.containment[0])?g-i.grid[0]:g+i.grid[0])):g}}return{top:(d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(j?0:c.scrollTop())))),left:(e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():j?0:c.scrollLeft())))}},_rearrange:function(h,g,d,f){d?d[0].appendChild(this.placeholder[0]):g.item[0].parentNode.insertBefore(this.placeholder[0],(this.direction=="down"?g.item[0]:g.item[0].nextSibling));this.counter=this.counter?++this.counter:1;var e=this,c=this.counter;window.setTimeout(function(){if(c==e.counter){e.refreshPositions(!f)}},0)},_clear:function(e,f){this.reverting=false;var g=[],c=this;if(!this._noFinalSort&&this.currentItem[0].parentNode){this.placeholder.before(this.currentItem)}this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var d in this._storedCSS){if(this._storedCSS[d]=="auto"||this._storedCSS[d]=="static"){this._storedCSS[d]=""}}this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}if(this.fromOutside&&!f){g.push(function(h){this._trigger("receive",h,this._uiHash(this.fromOutside))})}if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!f){g.push(function(h){this._trigger("update",h,this._uiHash())})}if(!a.ui.contains(this.element[0],this.currentItem[0])){if(!f){g.push(function(h){this._trigger("remove",h,this._uiHash())})}for(var d=this.containers.length-1;d>=0;d--){if(a.ui.contains(this.containers[d].element[0],this.currentItem[0])&&!f){g.push((function(h){return function(i){h._trigger("receive",i,this._uiHash(this))}}).call(this,this.containers[d]));g.push((function(h){return function(i){h._trigger("update",i,this._uiHash(this))}}).call(this,this.containers[d]))}}}for(var d=this.containers.length-1;d>=0;d--){if(!f){g.push((function(h){return function(i){h._trigger("deactivate",i,this._uiHash(this))}}).call(this,this.containers[d]))}if(this.containers[d].containerCache.over){g.push((function(h){return function(i){h._trigger("out",i,this._uiHash(this))}}).call(this,this.containers[d]));this.containers[d].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedOpacity)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!f){this._trigger("beforeStop",e,this._uiHash());for(var d=0;d<g.length;d++){g[d].call(this,e)}this._trigger("stop",e,this._uiHash())}return false}if(!f){this._trigger("beforeStop",e,this._uiHash())}this.placeholder[0].parentNode.removeChild(this.placeholder[0]);if(this.helper[0]!=this.currentItem[0]){this.helper.remove()}this.helper=null;if(!f){for(var d=0;d<g.length;d++){g[d].call(this,e)}this._trigger("stop",e,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){if(a.Widget.prototype._trigger.apply(this,arguments)===false){this.cancel()}},_uiHash:function(d){var c=d||this;return{helper:c.helper,placeholder:c.placeholder||a([]),position:c.position,originalPosition:c.originalPosition,offset:c.positionAbs,item:c.currentItem,sender:d?d.element:null}}});a.extend(a.ui.sortable,{version:"1.8.12"})})(jQuery);(function(a,b){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var c=this,d=c.options;c.running=0;c.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");c.headers=c.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(d.disabled){return}a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(d.disabled){return}a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(d.disabled){return}a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(d.disabled){return}a(this).removeClass("ui-state-focus")});c.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(d.navigation){var e=c.element.find("a").filter(d.navigationFilter).eq(0);if(e.length){var f=e.closest(".ui-accordion-header");if(f.length){c.active=f}else{c.active=e.closest(".ui-accordion-content").prev()}}}c.active=c._findActive(c.active||d.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");c.active.next().addClass("ui-accordion-content-active");c._createIcons();c.resize();c.element.attr("role","tablist");c.headers.attr("role","tab").bind("keydown.accordion",function(g){return c._keydown(g)}).next().attr("role","tabpanel");c.headers.not(c.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();if(!c.active.length){c.headers.eq(0).attr("tabIndex",0)}else{c.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0})}if(!a.browser.safari){c.headers.find("a").attr("tabIndex",-1)}if(d.event){c.headers.bind(d.event.split(" ").join(".accordion ")+".accordion",function(g){c._clickHandler.call(c,g,this);g.preventDefault()})}},_createIcons:function(){var c=this.options;if(c.icons){a("<span></span>").addClass("ui-icon "+c.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(c.icons.header).toggleClass(c.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var d=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(c.autoHeight||c.fillHeight){d.css("height","")}return a.Widget.prototype.destroy.call(this)},_setOption:function(c,d){a.Widget.prototype._setOption.apply(this,arguments);if(c=="active"){this.activate(d)}if(c=="icons"){this._destroyIcons();if(d){this._createIcons()}}if(c=="disabled"){this.headers.add(this.headers.next())[d?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")}},_keydown:function(f){if(this.options.disabled||f.altKey||f.ctrlKey){return}var g=a.ui.keyCode,e=this.headers.length,c=this.headers.index(f.target),d=false;switch(f.keyCode){case g.RIGHT:case g.DOWN:d=this.headers[(c+1)%e];break;case g.LEFT:case g.UP:d=this.headers[(c-1+e)%e];break;case g.SPACE:case g.ENTER:this._clickHandler({target:f.target},f.target);f.preventDefault()}if(d){a(f.target).attr("tabIndex",-1);a(d).attr("tabIndex",0);d.focus();return false}return true},resize:function(){var c=this.options,e;if(c.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}e=this.element.parent().height();if(a.browser.msie){this.element.parent().css("overflow",d)}this.headers.each(function(){e-=a(this).outerHeight(true)});this.headers.next().each(function(){a(this).height(Math.max(0,e-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else{if(c.autoHeight){e=0;this.headers.next().each(function(){e=Math.max(e,a(this).height("").height())}).height(e)}}return this},activate:function(c){this.options.active=c;var d=this._findActive(c)[0];this._clickHandler({target:d},d);return this},_findActive:function(c){return c?typeof c==="number"?this.headers.filter(":eq("+c+")"):this.headers.not(this.headers.not(c)):c===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(c,g){var l=this.options;if(l.disabled){return}if(!c.target){if(!l.collapsible){return}this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(l.icons.headerSelected).addClass(l.icons.header);this.active.next().addClass("ui-accordion-content-active");var i=this.active.next(),f={options:l,newHeader:a([]),oldHeader:l.active,newContent:a([]),oldContent:i},d=(this.active=a([]));this._toggle(d,i,f);return}var h=a(c.currentTarget||g),j=h[0]===this.active[0];l.active=l.collapsible&&j?false:this.headers.index(h);if(this.running||(!l.collapsible&&j)){return}var e=this.active,d=h.next(),i=this.active.next(),f={options:l,newHeader:j&&l.collapsible?a([]):h,oldHeader:this.active,newContent:j&&l.collapsible?a([]):d,oldContent:i},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=j?a([]):h;this._toggle(d,i,f,j,k);e.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(l.icons.headerSelected).addClass(l.icons.header);if(!j){h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(l.icons.header).addClass(l.icons.headerSelected);h.next().addClass("ui-accordion-content-active")}return},_toggle:function(c,i,g,j,k){var m=this,n=m.options;m.toShow=c;m.toHide=i;m.data=g;var d=function(){if(!m){return}return m._completed.apply(m,arguments)};m._trigger("changestart",null,m.data);m.running=i.size()===0?c.size():i.size();if(n.animated){var f={};if(n.collapsible&&j){f={toShow:a([]),toHide:i,complete:d,down:k,autoHeight:n.autoHeight||n.fillSpace}}else{f={toShow:c,toHide:i,complete:d,down:k,autoHeight:n.autoHeight||n.fillSpace}}if(!n.proxied){n.proxied=n.animated}if(!n.proxiedDuration){n.proxiedDuration=n.duration}n.animated=a.isFunction(n.proxied)?n.proxied(f):n.proxied;n.duration=a.isFunction(n.proxiedDuration)?n.proxiedDuration(f):n.proxiedDuration;var l=a.ui.accordion.animations,e=n.duration,h=n.animated;if(h&&!l[h]&&!a.easing[h]){h="slide"}if(!l[h]){l[h]=function(o){this.slide(o,{easing:h,duration:e||700})}}l[h](f)}else{if(n.collapsible&&j){c.toggle()}else{i.hide();c.show()}d(true)}i.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur();c.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(c){this.running=c?0:--this.running;if(this.running){return}if(this.options.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""})}this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length){this.toHide.parent()[0].className=this.toHide.parent()[0].className}this._trigger("change",null,this.data)}});a.extend(a.ui.accordion,{version:"1.8.12",animations:{slide:function(k,i){k=a.extend({easing:"swing",duration:300},k,i);if(!k.toHide.size()){k.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},k);return}if(!k.toShow.size()){k.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},k);return}var d=k.toShow.css("overflow"),h=0,e={},g={},f=["height","paddingTop","paddingBottom"],c;var j=k.toShow;c=j[0].style.width;j.width(parseInt(j.parent().width(),10)-parseInt(j.css("paddingLeft"),10)-parseInt(j.css("paddingRight"),10)-(parseInt(j.css("borderLeftWidth"),10)||0)-(parseInt(j.css("borderRightWidth"),10)||0));a.each(f,function(l,n){g[n]="hide";var m=(""+a.css(k.toShow[0],n)).match(/^([\d+-.]+)(.*)$/);e[n]={value:m[1],unit:m[2]||"px"}});k.toShow.css({height:0,overflow:"hidden"}).show();k.toHide.filter(":hidden").each(k.complete).end().filter(":visible").animate(g,{step:function(l,m){if(m.prop=="height"){h=(m.end-m.start===0)?0:(m.now-m.start)/(m.end-m.start)}k.toShow[0].style[m.prop]=(h*e[m.prop].value)+e[m.prop].unit},duration:k.duration,easing:k.easing,complete:function(){if(!k.autoHeight){k.toShow.css("height","")}k.toShow.css({width:c,overflow:d});k.complete()}})},bounceslide:function(c){this.slide(c,{easing:c.down?"easeOutBounce":"swing",duration:c.down?1000:200})}}})})(jQuery);(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var d=this,f=this.element[0].ownerDocument,e;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(g){if(d.options.disabled||d.element.attr("readonly")){return}e=false;var h=a.ui.keyCode;switch(g.keyCode){case h.PAGE_UP:d._move("previousPage",g);break;case h.PAGE_DOWN:d._move("nextPage",g);break;case h.UP:d._move("previous",g);g.preventDefault();break;case h.DOWN:d._move("next",g);g.preventDefault();break;case h.ENTER:case h.NUMPAD_ENTER:if(d.menu.active){e=true;g.preventDefault()}case h.TAB:if(!d.menu.active){return}d.menu.select(g);break;case h.ESCAPE:d.element.val(d.term);d.close(g);break;default:clearTimeout(d.searching);d.searching=setTimeout(function(){if(d.term!=d.element.val()){d.selectedItem=null;d.search(null,g)}},d.options.delay);break}}).bind("keypress.autocomplete",function(g){if(e){e=false;g.preventDefault()}}).bind("focus.autocomplete",function(){if(d.options.disabled){return}d.selectedItem=null;d.previous=d.element.val()}).bind("blur.autocomplete",function(g){if(d.options.disabled){return}clearTimeout(d.searching);d.closing=setTimeout(function(){d.close(g);d._change(g)},150)});this._initSource();this.response=function(){return d._response.apply(d,arguments)};this.menu=a("<ul></ul>").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",f)[0]).mousedown(function(g){var h=d.menu.element[0];if(!a(g.target).closest(".ui-menu-item").length){setTimeout(function(){a(document).one("mousedown",function(i){if(i.target!==d.element[0]&&i.target!==h&&!a.ui.contains(h,i.target)){d.close()}})},1)}setTimeout(function(){clearTimeout(d.closing)},13)}).menu({focus:function(h,i){var g=i.item.data("item.autocomplete");if(false!==d._trigger("focus",h,{item:g})){if(/^key/.test(h.originalEvent.type)){d.element.val(g.value)}}},selected:function(i,j){var h=j.item.data("item.autocomplete"),g=d.previous;if(d.element[0]!==f.activeElement){d.element.focus();d.previous=g;setTimeout(function(){d.previous=g;d.selectedItem=h},1)}if(false!==d._trigger("select",i,{item:h})){d.element.val(h.value)}d.term=d.element.val();d.close(i);d.selectedItem=h},blur:function(g,h){if(d.menu.element.is(":visible")&&(d.element.val()!==d.term)){d.element.val(d.term)}}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");if(a.fn.bgiframe){this.menu.element.bgiframe()}},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();a.Widget.prototype.destroy.call(this)},_setOption:function(d,e){a.Widget.prototype._setOption.apply(this,arguments);if(d==="source"){this._initSource()}if(d==="appendTo"){this.menu.element.appendTo(a(e||"body",this.element[0].ownerDocument)[0])}if(d==="disabled"&&e&&this.xhr){this.xhr.abort()}},_initSource:function(){var d=this,f,e;if(a.isArray(this.options.source)){f=this.options.source;this.source=function(h,g){g(a.ui.autocomplete.filter(f,h.term))}}else{if(typeof this.options.source==="string"){e=this.options.source;this.source=function(h,g){if(d.xhr){d.xhr.abort()}d.xhr=a.ajax({url:e,data:h,dataType:"json",autocompleteRequest:++c,success:function(j,i){if(this.autocompleteRequest===c){g(j)}},error:function(){if(this.autocompleteRequest===c){g([])}}})}}else{this.source=this.options.source}}},search:function(e,d){e=e!=null?e:this.element.val();this.term=this.element.val();if(e.length<this.options.minLength){return this.close(d)}clearTimeout(this.closing);if(this._trigger("search",d)===false){return}return this._search(e)},_search:function(d){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:d},this.response)},_response:function(d){if(!this.options.disabled&&d&&d.length){d=this._normalize(d);this._suggest(d);this._trigger("open")}else{this.close()}this.pending--;if(!this.pending){this.element.removeClass("ui-autocomplete-loading")}},close:function(d){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",d)}},_change:function(d){if(this.previous!==this.element.val()){this._trigger("change",d,{item:this.selectedItem})}},_normalize:function(d){if(d.length&&d[0].label&&d[0].value){return d}return a.map(d,function(e){if(typeof e==="string"){return{label:e,value:e}}return a.extend({label:e.label||e.value,value:e.value||e.label},e)})},_suggest:function(d){var e=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(e,d);this.menu.deactivate();this.menu.refresh();e.show();this._resizeMenu();e.position(a.extend({of:this.element},this.options.position));if(this.options.autoFocus){this.menu.next(new a.Event("mouseover"))}},_resizeMenu:function(){var d=this.menu.element;d.outerWidth(Math.max(d.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(f,e){var d=this;a.each(e,function(g,h){d._renderItem(f,h)})},_renderItem:function(d,e){return a("<li></li>").data("item.autocomplete",e).append(a("<a></a>").text(e.label)).appendTo(d)},_move:function(e,d){if(!this.menu.element.is(":visible")){this.search(null,d);return}if(this.menu.first()&&/^previous/.test(e)||this.menu.last()&&/^next/.test(e)){this.element.val(this.term);this.menu.deactivate();return}this.menu[e](d)},widget:function(){return this.menu.element}});a.extend(a.ui.autocomplete,{escapeRegex:function(d){return d.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(f,d){var e=new RegExp(a.ui.autocomplete.escapeRegex(d),"i");return a.grep(f,function(g){return e.test(g.label||g.value||g)})}})}(jQuery));(function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length){return}c.preventDefault();b.select(c)});this.refresh()},refresh:function(){var c=this;var b=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");b.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(d){c.activate(d,a(this).parent())}).mouseleave(function(){c.deactivate()})},activate:function(e,d){this.deactivate();if(this.hasScroll()){var f=d.offset().top-this.element.offset().top,b=this.element.attr("scrollTop"),c=this.element.height();if(f<0){this.element.attr("scrollTop",b+f)}else{if(f>=c){this.element.attr("scrollTop",b+f-c+d.height())}}}this.active=d.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:d})},deactivate:function(){if(!this.active){return}this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null},next:function(b){this.move("next",".ui-menu-item:first",b)},previous:function(b){this.move("prev",".ui-menu-item:last",b)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,d,c){if(!this.active){this.activate(c,this.element.children(d));return}var b=this.active[e+"All"](".ui-menu-item").eq(0);if(b.length){this.activate(c,b)}else{this.activate(c,this.element.children(d))}},nextPage:function(d){if(this.hasScroll()){if(!this.active||this.last()){this.activate(d,this.element.children(".ui-menu-item:first"));return}var e=this.active.offset().top,c=this.element.height(),b=this.element.children(".ui-menu-item").filter(function(){var f=a(this).offset().top-e-c+a(this).height();return f<10&&f>-10});if(!b.length){b=this.element.children(".ui-menu-item:last")}this.activate(d,b)}else{this.activate(d,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))}},previousPage:function(c){if(this.hasScroll()){if(!this.active||this.first()){this.activate(c,this.element.children(".ui-menu-item:last"));return}var d=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var e=a(this).offset().top-d+b-a(this).height();return e<10&&e>-10});if(!result.length){result=this.element.children(".ui-menu-item:first")}this.activate(c,result)}else{this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))}},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(b){this._trigger("selected",b,{item:this.active})}})}(jQuery));(function(e,h){var c,b="ui-button ui-widget ui-state-default ui-corner-all",g="ui-state-hover ui-state-active ",f="ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",d=function(i){e(":ui-button",i.target.form).each(function(){var j=e(this).data("button");setTimeout(function(){j.refresh()},1)})},a=function(j){var i=j.name,k=j.form,l=e([]);if(i){if(k){l=e(k).find("[name='"+i+"']")}else{l=e("[name='"+i+"']",j.ownerDocument).filter(function(){return !this.form})}}return l};e.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",d);if(typeof this.options.disabled!=="boolean"){this.options.disabled=this.element.attr("disabled")}this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var i=this,k=this.options,l=this.type==="checkbox"||this.type==="radio",m="ui-state-hover"+(!l?" ui-state-active":""),j="ui-state-focus";if(k.label===null){k.label=this.buttonElement.html()}if(this.element.is(":disabled")){k.disabled=true}this.buttonElement.addClass(b).attr("role","button").bind("mouseenter.button",function(){if(k.disabled){return}e(this).addClass("ui-state-hover");if(this===c){e(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){if(k.disabled){return}e(this).removeClass(m)}).bind("focus.button",function(){e(this).addClass(j)}).bind("blur.button",function(){e(this).removeClass(j)});if(l){this.element.bind("change.button",function(){i.refresh()})}if(this.type==="checkbox"){this.buttonElement.bind("click.button",function(){if(k.disabled){return false}e(this).toggleClass("ui-state-active");i.buttonElement.attr("aria-pressed",i.element[0].checked)})}else{if(this.type==="radio"){this.buttonElement.bind("click.button",function(){if(k.disabled){return false}e(this).addClass("ui-state-active");i.buttonElement.attr("aria-pressed",true);var n=i.element[0];a(n).not(n).map(function(){return e(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)})}else{this.buttonElement.bind("mousedown.button",function(){if(k.disabled){return false}e(this).addClass("ui-state-active");c=this;e(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(k.disabled){return false}e(this).removeClass("ui-state-active")}).bind("keydown.button",function(n){if(k.disabled){return false}if(n.keyCode==e.ui.keyCode.SPACE||n.keyCode==e.ui.keyCode.ENTER){e(this).addClass("ui-state-active")}}).bind("keyup.button",function(){e(this).removeClass("ui-state-active")});if(this.buttonElement.is("a")){this.buttonElement.keyup(function(n){if(n.keyCode===e.ui.keyCode.SPACE){e(this).click()}})}}}this._setOption("disabled",k.disabled)},_determineButtonType:function(){if(this.element.is(":checkbox")){this.type="checkbox"}else{if(this.element.is(":radio")){this.type="radio"}else{if(this.element.is("input")){this.type="input"}else{this.type="button"}}}if(this.type==="checkbox"||this.type==="radio"){var i=this.element.parents().filter(":last"),k="label[for="+this.element.attr("id")+"]";this.buttonElement=i.find(k);if(!this.buttonElement.length){i=i.length?i.siblings():this.element.siblings();this.buttonElement=i.filter(k);if(!this.buttonElement.length){this.buttonElement=i.find(k)}}this.element.addClass("ui-helper-hidden-accessible");var j=this.element.is(":checked");if(j){this.buttonElement.addClass("ui-state-active")}this.buttonElement.attr("aria-pressed",j)}else{this.buttonElement=this.element}},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass(b+" "+g+" "+f).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());if(!this.hasTitle){this.buttonElement.removeAttr("title")}e.Widget.prototype.destroy.call(this)},_setOption:function(i,j){e.Widget.prototype._setOption.apply(this,arguments);if(i==="disabled"){if(j){this.element.attr("disabled",true)}else{this.element.removeAttr("disabled")}}this._resetButton()},refresh:function(){var i=this.element.is(":disabled");if(i!==this.options.disabled){this._setOption("disabled",i)}if(this.type==="radio"){a(this.element[0]).each(function(){if(e(this).is(":checked")){e(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true)}else{e(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)}})}else{if(this.type==="checkbox"){if(this.element.is(":checked")){this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true)}else{this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)}}}},_resetButton:function(){if(this.type==="input"){if(this.options.label){this.element.val(this.options.label)}return}var m=this.buttonElement.removeClass(f),k=e("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(m.empty()).text(),j=this.options.icons,i=j.primary&&j.secondary,l=[];if(j.primary||j.secondary){if(this.options.text){l.push("ui-button-text-icon"+(i?"s":(j.primary?"-primary":"-secondary")))}if(j.primary){m.prepend("<span class='ui-button-icon-primary ui-icon "+j.primary+"'></span>")}if(j.secondary){m.append("<span class='ui-button-icon-secondary ui-icon "+j.secondary+"'></span>")}if(!this.options.text){l.push(i?"ui-button-icons-only":"ui-button-icon-only");if(!this.hasTitle){m.attr("title",k)}}}else{l.push("ui-button-text-only")}m.addClass(l.join(" "))}});e.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(i,j){if(i==="disabled"){this.buttons.button("option",i,j)}e.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return e(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return e(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");e.Widget.prototype.destroy.call(this)}})}(jQuery));(function(e,f){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",b={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},d={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},a=e.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};e.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(h){var g=e(this).css(h).offset().top;if(g<0){e(this).css("top",h.top-g)}}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1000},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string"){this.originalTitle=""}this.options.title=this.options.title||this.originalTitle;var o=this,p=o.options,m=p.title||" ",h=e.ui.dialog.getTitleId(o.element),n=(o.uiDialog=e("<div></div>")).appendTo(document.body).hide().addClass(c+p.dialogClass).css({zIndex:p.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(q){if(p.closeOnEscape&&q.keyCode&&q.keyCode===e.ui.keyCode.ESCAPE){o.close(q);q.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(q){o.moveToTop(false,q)}),j=o.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(n),i=(o.uiDialogTitlebar=e("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(n),l=e('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){l.addClass("ui-state-hover")},function(){l.removeClass("ui-state-hover")}).focus(function(){l.addClass("ui-state-focus")}).blur(function(){l.removeClass("ui-state-focus")}).click(function(q){o.close(q);return false}).appendTo(i),k=(o.uiDialogTitlebarCloseText=e("<span></span>")).addClass("ui-icon ui-icon-closethick").text(p.closeText).appendTo(l),g=e("<span></span>").addClass("ui-dialog-title").attr("id",h).html(m).prependTo(i);if(e.isFunction(p.beforeclose)&&!e.isFunction(p.beforeClose)){p.beforeClose=p.beforeclose}i.find("*").add(i).disableSelection();if(p.draggable&&e.fn.draggable){o._makeDraggable()}if(p.resizable&&e.fn.resizable){o._makeResizable()}o._createButtons(p.buttons);o._isOpen=false;if(e.fn.bgiframe){n.bgiframe()}},_init:function(){if(this.options.autoOpen){this.open()}},destroy:function(){var g=this;if(g.overlay){g.overlay.destroy()}g.uiDialog.hide();g.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");g.uiDialog.remove();if(g.originalTitle){g.element.attr("title",g.originalTitle)}return g},widget:function(){return this.uiDialog},close:function(j){var g=this,i,h;if(false===g._trigger("beforeClose",j)){return}if(g.overlay){g.overlay.destroy()}g.uiDialog.unbind("keypress.ui-dialog");g._isOpen=false;if(g.options.hide){g.uiDialog.hide(g.options.hide,function(){g._trigger("close",j)})}else{g.uiDialog.hide();g._trigger("close",j)}e.ui.dialog.overlay.resize();if(g.options.modal){i=0;e(".ui-dialog").each(function(){if(this!==g.uiDialog[0]){h=e(this).css("z-index");if(!isNaN(h)){i=Math.max(i,h)}}});e.ui.dialog.maxZ=i}return g},isOpen:function(){return this._isOpen},moveToTop:function(k,j){var g=this,i=g.options,h;if((i.modal&&!k)||(!i.stack&&!i.modal)){return g._trigger("focus",j)}if(i.zIndex>e.ui.dialog.maxZ){e.ui.dialog.maxZ=i.zIndex}if(g.overlay){e.ui.dialog.maxZ+=1;g.overlay.$el.css("z-index",e.ui.dialog.overlay.maxZ=e.ui.dialog.maxZ)}h={scrollTop:g.element.attr("scrollTop"),scrollLeft:g.element.attr("scrollLeft")};e.ui.dialog.maxZ+=1;g.uiDialog.css("z-index",e.ui.dialog.maxZ);g.element.attr(h);g._trigger("focus",j);return g},open:function(){if(this._isOpen){return}var h=this,i=h.options,g=h.uiDialog;h.overlay=i.modal?new e.ui.dialog.overlay(h):null;h._size();h._position(i.position);g.show(i.show);h.moveToTop(true);if(i.modal){g.bind("keypress.ui-dialog",function(l){if(l.keyCode!==e.ui.keyCode.TAB){return}var k=e(":tabbable",this),m=k.filter(":first"),j=k.filter(":last");if(l.target===j[0]&&!l.shiftKey){m.focus(1);return false}else{if(l.target===m[0]&&l.shiftKey){j.focus(1);return false}}})}e(h.element.find(":tabbable").get().concat(g.find(".ui-dialog-buttonpane :tabbable").get().concat(g.get()))).eq(0).focus();h._isOpen=true;h._trigger("open");return h},_createButtons:function(j){var i=this,g=false,h=e("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),k=e("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);i.uiDialog.find(".ui-dialog-buttonpane").remove();if(typeof j==="object"&&j!==null){e.each(j,function(){return !(g=true)})}if(g){e.each(j,function(l,n){n=e.isFunction(n)?{click:n,text:l}:n;var m=e('<button type="button"></button>').click(function(){n.click.apply(i.element[0],arguments)}).appendTo(k);e.each(n,function(o,p){if(o==="click"){return}if(o in a){m[o](p)}else{m.attr(o,p)}});if(e.fn.button){m.button()}});h.appendTo(i.uiDialog)}},_makeDraggable:function(){var g=this,j=g.options,k=e(document),i;function h(l){return{position:l.position,offset:l.offset}}g.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(l,m){i=j.height==="auto"?"auto":e(this).height();e(this).height(e(this).height()).addClass("ui-dialog-dragging");g._trigger("dragStart",l,h(m))},drag:function(l,m){g._trigger("drag",l,h(m))},stop:function(l,m){j.position=[m.position.left-k.scrollLeft(),m.position.top-k.scrollTop()];e(this).removeClass("ui-dialog-dragging").height(i);g._trigger("dragStop",l,h(m));e.ui.dialog.overlay.resize()}})},_makeResizable:function(l){l=(l===f?this.options.resizable:l);var h=this,k=h.options,g=h.uiDialog.css("position"),j=(typeof l==="string"?l:"n,e,s,w,se,sw,ne,nw");function i(m){return{originalPosition:m.originalPosition,originalSize:m.originalSize,position:m.position,size:m.size}}h.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:h.element,maxWidth:k.maxWidth,maxHeight:k.maxHeight,minWidth:k.minWidth,minHeight:h._minHeight(),handles:j,start:function(m,n){e(this).addClass("ui-dialog-resizing");h._trigger("resizeStart",m,i(n))},resize:function(m,n){h._trigger("resize",m,i(n))},stop:function(m,n){e(this).removeClass("ui-dialog-resizing");k.height=e(this).height();k.width=e(this).width();h._trigger("resizeStop",m,i(n));e.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var g=this.options;if(g.height==="auto"){return g.minHeight}else{return Math.min(g.minHeight,g.height)}},_position:function(h){var i=[],j=[0,0],g;if(h){if(typeof h==="string"||(typeof h==="object"&&"0" in h)){i=h.split?h.split(" "):[h[0],h[1]];if(i.length===1){i[1]=i[0]}e.each(["left","top"],function(l,k){if(+i[l]===i[l]){j[l]=i[l];i[l]=k}});h={my:i.join(" "),at:i.join(" "),offset:j.join(" ")}}h=e.extend({},e.ui.dialog.prototype.options.position,h)}else{h=e.ui.dialog.prototype.options.position}g=this.uiDialog.is(":visible");if(!g){this.uiDialog.show()}this.uiDialog.css({top:0,left:0}).position(e.extend({of:window},h));if(!g){this.uiDialog.hide()}},_setOptions:function(j){var h=this,g={},i=false;e.each(j,function(k,l){h._setOption(k,l);if(k in b){i=true}if(k in d){g[k]=l}});if(i){this._size()}if(this.uiDialog.is(":data(resizable)")){this.uiDialog.resizable("option",g)}},_setOption:function(j,k){var h=this,g=h.uiDialog;switch(j){case"beforeclose":j="beforeClose";break;case"buttons":h._createButtons(k);break;case"closeText":h.uiDialogTitlebarCloseText.text(""+k);break;case"dialogClass":g.removeClass(h.options.dialogClass).addClass(c+k);break;case"disabled":if(k){g.addClass("ui-dialog-disabled")}else{g.removeClass("ui-dialog-disabled")}break;case"draggable":var i=g.is(":data(draggable)");if(i&&!k){g.draggable("destroy")}if(!i&&k){h._makeDraggable()}break;case"position":h._position(k);break;case"resizable":var l=g.is(":data(resizable)");if(l&&!k){g.resizable("destroy")}if(l&&typeof k==="string"){g.resizable("option","handles",k)}if(!l&&k!==false){h._makeResizable(k)}break;case"title":e(".ui-dialog-title",h.uiDialogTitlebar).html(""+(k||" "));break}e.Widget.prototype._setOption.apply(h,arguments)},_size:function(){var k=this.options,h,j,g=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(k.minWidth>k.width){k.width=k.minWidth}h=this.uiDialog.css({height:"auto",width:k.width}).height();j=Math.max(0,k.minHeight-h);if(k.height==="auto"){if(e.support.minHeight){this.element.css({minHeight:j,height:"auto"})}else{this.uiDialog.show();var i=this.element.css("height","auto").height();if(!g){this.uiDialog.hide()}this.element.height(Math.max(i,j))}}else{this.element.height(Math.max(k.height-h,0))}if(this.uiDialog.is(":data(resizable)")){this.uiDialog.resizable("option","minHeight",this._minHeight())}}});e.extend(e.ui.dialog,{version:"1.8.12",uuid:0,maxZ:0,getTitleId:function(g){var h=g.attr("id");if(!h){this.uuid+=1;h=this.uuid}return"ui-dialog-title-"+h},overlay:function(g){this.$el=e.ui.dialog.overlay.create(g)}});e.extend(e.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:e.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(g){return g+".dialog-overlay"}).join(" "),create:function(h){if(this.instances.length===0){setTimeout(function(){if(e.ui.dialog.overlay.instances.length){e(document).bind(e.ui.dialog.overlay.events,function(i){if(e(i.target).zIndex()<e.ui.dialog.overlay.maxZ){return false}})}},1);e(document).bind("keydown.dialog-overlay",function(i){if(h.options.closeOnEscape&&i.keyCode&&i.keyCode===e.ui.keyCode.ESCAPE){h.close(i);i.preventDefault()}});e(window).bind("resize.dialog-overlay",e.ui.dialog.overlay.resize)}var g=(this.oldInstances.pop()||e("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});if(e.fn.bgiframe){g.bgiframe()}this.instances.push(g);return g},destroy:function(g){var h=e.inArray(g,this.instances);if(h!=-1){this.oldInstances.push(this.instances.splice(h,1)[0])}if(this.instances.length===0){e([document,window]).unbind(".dialog-overlay")}g.remove();var i=0;e.each(this.instances,function(){i=Math.max(i,this.css("z-index"))});this.maxZ=i},height:function(){var h,g;if(e.browser.msie&&e.browser.version<7){h=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);g=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(h<g){return e(window).height()+"px"}else{return h+"px"}}else{return e(document).height()+"px"}},width:function(){var g,h;if(e.browser.msie&&e.browser.version<7){g=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);h=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(g<h){return e(window).width()+"px"}else{return g+"px"}}else{return e(document).width()+"px"}},resize:function(){var g=e([]);e.each(e.ui.dialog.overlay.instances,function(){g=g.add(this)});g.css({width:0,height:0}).css({width:e.ui.dialog.overlay.width(),height:e.ui.dialog.overlay.height()})}});e.extend(e.ui.dialog.overlay.prototype,{destroy:function(){e.ui.dialog.overlay.destroy(this.$el)}})}(jQuery));(function(b,c){var a=5;b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,e=this.options;this._keySliding=false;this._mouseSliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");if(e.disabled){this.element.addClass("ui-slider-disabled ui-disabled")}this.range=b([]);if(e.range){if(e.range===true){this.range=b("<div></div>");if(!e.values){e.values=[this._valueMin(),this._valueMin()]}if(e.values.length&&e.values.length!==2){e.values=[e.values[0],e.values[0]]}}else{this.range=b("<div></div>")}this.range.appendTo(this.element).addClass("ui-slider-range");if(e.range==="min"||e.range==="max"){this.range.addClass("ui-slider-range-"+e.range)}this.range.addClass("ui-widget-header")}if(b(".ui-slider-handle",this.element).length===0){b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle")}if(e.values&&e.values.length){while(b(".ui-slider-handle",this.element).length<e.values.length){b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle")}}this.handles=b(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(f){f.preventDefault()}).hover(function(){if(!e.disabled){b(this).addClass("ui-state-hover")}},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(!e.disabled){b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}else{b(this).blur()}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(f){b(this).data("index.ui-slider-handle",f)});this.handles.keydown(function(k){var h=true,g=b(this).data("index.ui-slider-handle"),l,i,f,j;if(d.options.disabled){return}switch(k.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:h=false;if(!d._keySliding){d._keySliding=true;b(this).addClass("ui-state-active");l=d._start(k,g);if(l===false){return}}break}j=d.options.step;if(d.options.values&&d.options.values.length){i=f=d.values(g)}else{i=f=d.value()}switch(k.keyCode){case b.ui.keyCode.HOME:f=d._valueMin();break;case b.ui.keyCode.END:f=d._valueMax();break;case b.ui.keyCode.PAGE_UP:f=d._trimAlignValue(i+((d._valueMax()-d._valueMin())/a));break;case b.ui.keyCode.PAGE_DOWN:f=d._trimAlignValue(i-((d._valueMax()-d._valueMin())/a));break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(i===d._valueMax()){return}f=d._trimAlignValue(i+j);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(i===d._valueMin()){return}f=d._trimAlignValue(i-j);break}d._slide(k,g,f);return h}).keyup(function(g){var f=b(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(g,f);d._change(g,f);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();return this},_mouseCapture:function(f){var g=this.options,j,l,e,h,n,k,m,i,d;if(g.disabled){return false}this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();j={x:f.pageX,y:f.pageY};l=this._normValueFromMouse(j);e=this._valueMax()-this._valueMin()+1;n=this;this.handles.each(function(o){var p=Math.abs(l-n.values(o));if(e>p){e=p;h=b(this);k=o}});if(g.range===true&&this.values(1)===g.min){k+=1;h=b(this.handles[k])}m=this._start(f,k);if(m===false){return false}this._mouseSliding=true;n._handleIndex=k;h.addClass("ui-state-active").focus();i=h.offset();d=!b(f.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=d?{left:0,top:0}:{left:f.pageX-i.left-(h.width()/2),top:f.pageY-i.top-(h.height()/2)-(parseInt(h.css("borderTopWidth"),10)||0)-(parseInt(h.css("borderBottomWidth"),10)||0)+(parseInt(h.css("marginTop"),10)||0)};if(!this.handles.hasClass("ui-state-hover")){this._slide(f,k,l)}this._animateOff=true;return true},_mouseStart:function(d){return true},_mouseDrag:function(f){var d={x:f.pageX,y:f.pageY},e=this._normValueFromMouse(d);this._slide(f,this._handleIndex,e);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._handleIndex=null;this._clickOffset=null;this._animateOff=false;return false},_detectOrientation:function(){this.orientation=(this.options.orientation==="vertical")?"vertical":"horizontal"},_normValueFromMouse:function(e){var d,h,g,f,i;if(this.orientation==="horizontal"){d=this.elementSize.width;h=e.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{d=this.elementSize.height;h=e.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}g=(h/d);if(g>1){g=1}if(g<0){g=0}if(this.orientation==="vertical"){g=1-g}f=this._valueMax()-this._valueMin();i=this._valueMin()+g*f;return this._trimAlignValue(i)},_start:function(f,e){var d={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){d.value=this.values(e);d.values=this.values()}return this._trigger("start",f,d)},_slide:function(h,g,f){var d,e,i;if(this.options.values&&this.options.values.length){d=this.values(g?0:1);if((this.options.values.length===2&&this.options.range===true)&&((g===0&&f>d)||(g===1&&f<d))){f=d}if(f!==this.values(g)){e=this.values();e[g]=f;i=this._trigger("slide",h,{handle:this.handles[g],value:f,values:e});d=this.values(g?0:1);if(i!==false){this.values(g,f,true)}}}else{if(f!==this.value()){i=this._trigger("slide",h,{handle:this.handles[g],value:f});if(i!==false){this.value(f)}}}},_stop:function(f,e){var d={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){d.value=this.values(e);d.values=this.values()}this._trigger("stop",f,d)},_change:function(f,e){if(!this._keySliding&&!this._mouseSliding){var d={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){d.value=this.values(e);d.values=this.values()}this._trigger("change",f,d)}},value:function(d){if(arguments.length){this.options.value=this._trimAlignValue(d);this._refreshValue();this._change(null,0);return}return this._value()},values:function(e,h){var g,d,f;if(arguments.length>1){this.options.values[e]=this._trimAlignValue(h);this._refreshValue();this._change(null,e);return}if(arguments.length){if(b.isArray(arguments[0])){g=this.options.values;d=arguments[0];for(f=0;f<g.length;f+=1){g[f]=this._trimAlignValue(d[f]);this._change(null,f)}this._refreshValue()}else{if(this.options.values&&this.options.values.length){return this._values(e)}else{return this.value()}}}else{return this._values()}},_setOption:function(e,f){var d,g=0;if(b.isArray(this.options.values)){g=this.options.values.length}b.Widget.prototype._setOption.apply(this,arguments);switch(e){case"disabled":if(f){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case"value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case"values":this._animateOff=true;this._refreshValue();for(d=0;d<g;d+=1){this._change(null,d)}this._animateOff=false;break}},_value:function(){var d=this.options.value;d=this._trimAlignValue(d);return d},_values:function(d){var g,f,e;if(arguments.length){g=this.options.values[d];g=this._trimAlignValue(g);return g}else{f=this.options.values.slice();for(e=0;e<f.length;e+=1){f[e]=this._trimAlignValue(f[e])}return f}},_trimAlignValue:function(f){if(f<=this._valueMin()){return this._valueMin()}if(f>=this._valueMax()){return this._valueMax()}var d=(this.options.step>0)?this.options.step:1,e=(f-this._valueMin())%d;alignValue=f-e;if(Math.abs(e)*2>=d){alignValue+=(e>0)?d:(-d)}return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var g=this.options.range,f=this.options,m=this,e=(!this._animateOff)?f.animate:false,h,d={},i,k,j,l;if(this.options.values&&this.options.values.length){this.handles.each(function(o,n){h=(m.values(o)-m._valueMin())/(m._valueMax()-m._valueMin())*100;d[m.orientation==="horizontal"?"left":"bottom"]=h+"%";b(this).stop(1,1)[e?"animate":"css"](d,f.animate);if(m.options.range===true){if(m.orientation==="horizontal"){if(o===0){m.range.stop(1,1)[e?"animate":"css"]({left:h+"%"},f.animate)}if(o===1){m.range[e?"animate":"css"]({width:(h-i)+"%"},{queue:false,duration:f.animate})}}else{if(o===0){m.range.stop(1,1)[e?"animate":"css"]({bottom:(h)+"%"},f.animate)}if(o===1){m.range[e?"animate":"css"]({height:(h-i)+"%"},{queue:false,duration:f.animate})}}}i=h})}else{k=this.value();j=this._valueMin();l=this._valueMax();h=(l!==j)?(k-j)/(l-j)*100:0;d[m.orientation==="horizontal"?"left":"bottom"]=h+"%";this.handle.stop(1,1)[e?"animate":"css"](d,f.animate);if(g==="min"&&this.orientation==="horizontal"){this.range.stop(1,1)[e?"animate":"css"]({width:h+"%"},f.animate)}if(g==="max"&&this.orientation==="horizontal"){this.range[e?"animate":"css"]({width:(100-h)+"%"},{queue:false,duration:f.animate})}if(g==="min"&&this.orientation==="vertical"){this.range.stop(1,1)[e?"animate":"css"]({height:h+"%"},f.animate)}if(g==="max"&&this.orientation==="vertical"){this.range[e?"animate":"css"]({height:(100-h)+"%"},{queue:false,duration:f.animate})}}}});b.extend(b.ui.slider,{version:"1.8.12"})}(jQuery));(function(d,f){var c=0,b=0;function e(){return ++c}function a(){return ++b}d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(g,h){if(g=="selected"){if(this.options.collapsible&&h==this.options.selected){return}this.select(h)}else{this.options[g]=h;this._tabify()}},_tabId:function(g){return g.title&&g.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(g){return g.replace(/:/g,"\\:")},_cookie:function(){var g=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+a());return d.cookie.apply(null,[g].concat(d.makeArray(arguments)))},_ui:function(h,g){return{tab:h,panel:g,index:this.anchors.index(h)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var g=d(this);g.html(g.data("label.tabs")).removeData("label.tabs")})},_tabify:function(u){var v=this,j=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(x,o){var w=d(o).attr("href");var y=w.split("#")[0],z;if(y&&(y===location.toString().split("#")[0]||(z=d("base")[0])&&y===z.href)){w=o.hash;o.href=w}if(h.test(w)){v.panels=v.panels.add(v.element.find(v._sanitizeSelector(w)))}else{if(w&&w!=="#"){d.data(o,"href.tabs",w);d.data(o,"load.tabs",w.replace(/#.*$/,""));var B=v._tabId(o);o.href="#"+B;var A=v.element.find("#"+B);if(!A.length){A=d(j.panelTemplate).attr("id",B).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(v.panels[x-1]||v.list);A.data("destroy.tabs",true)}v.panels=v.panels.add(A)}else{j.disabled.push(x)}}});if(u){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===f){if(location.hash){this.anchors.each(function(w,o){if(o.hash==location.hash){j.selected=w;return false}})}if(typeof j.selected!=="number"&&j.cookie){j.selected=parseInt(v._cookie(),10)}if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length){j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}j.selected=j.selected||(this.lis.length?0:-1)}else{if(j.selected===null){j.selected=-1}}j.selected=((j.selected>=0&&this.anchors[j.selected])||j.selected<0)?j.selected:0;j.disabled=d.unique(j.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(w,o){return v.lis.index(w)}))).sort();if(d.inArray(j.selected,j.disabled)!=-1){j.disabled.splice(d.inArray(j.selected,j.disabled),1)}this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");if(j.selected>=0&&this.anchors.length){v.element.find(v._sanitizeSelector(v.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");v.element.queue("tabs",function(){v._trigger("show",null,v._ui(v.anchors[j.selected],v.element.find(v._sanitizeSelector(v.anchors[j.selected].hash))[0]))});this.load(j.selected)}d(window).bind("unload",function(){v.lis.add(v.anchors).unbind(".tabs");v.lis=v.anchors=v.panels=null})}else{j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");if(j.cookie){this._cookie(j.selected,j.cookie)}for(var m=0,s;(s=this.lis[m]);m++){d(s)[d.inArray(m,j.disabled)!=-1&&!d(s).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(j.cache===false){this.anchors.removeData("cache.tabs")}this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.addClass("ui-state-"+o)}};var p=function(o,i){i.removeClass("ui-state-"+o)};this.lis.bind("mouseover.tabs",function(){l("hover",d(this))});this.lis.bind("mouseout.tabs",function(){p("hover",d(this))});this.anchors.bind("focus.tabs",function(){l("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){p("focus",d(this).closest("li"))})}var g,n;if(j.fx){if(d.isArray(j.fx)){g=j.fx[0];n=j.fx[1]}else{g=n=j.fx}}function k(i,o){i.css("display","");if(!d.support.opacity&&o.opacity){i[0].style.removeAttribute("filter")}}var q=n?function(i,o){d(i).closest("li").addClass("ui-tabs-selected ui-state-active");o.hide().removeClass("ui-tabs-hide").animate(n,n.duration||"normal",function(){k(o,n);v._trigger("show",null,v._ui(i,o[0]))})}:function(i,o){d(i).closest("li").addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");v._trigger("show",null,v._ui(i,o[0]))};var r=g?function(o,i){i.animate(g,g.duration||"normal",function(){v.lis.removeClass("ui-tabs-selected ui-state-active");i.addClass("ui-tabs-hide");k(i,g);v.element.dequeue("tabs")})}:function(o,i,w){v.lis.removeClass("ui-tabs-selected ui-state-active");i.addClass("ui-tabs-hide");v.element.dequeue("tabs")};this.anchors.bind(j.event+".tabs",function(){var o=this,x=d(o).closest("li"),i=v.panels.filter(":not(.ui-tabs-hide)"),w=v.element.find(v._sanitizeSelector(o.hash));if((x.hasClass("ui-tabs-selected")&&!j.collapsible)||x.hasClass("ui-state-disabled")||x.hasClass("ui-state-processing")||v.panels.filter(":animated").length||v._trigger("select",null,v._ui(this,w[0]))===false){this.blur();return false}j.selected=v.anchors.index(this);v.abort();if(j.collapsible){if(x.hasClass("ui-tabs-selected")){j.selected=-1;if(j.cookie){v._cookie(j.selected,j.cookie)}v.element.queue("tabs",function(){r(o,i)}).dequeue("tabs");this.blur();return false}else{if(!i.length){if(j.cookie){v._cookie(j.selected,j.cookie)}v.element.queue("tabs",function(){q(o,w)});v.load(v.anchors.index(this));this.blur();return false}}}if(j.cookie){v._cookie(j.selected,j.cookie)}if(w.length){if(i.length){v.element.queue("tabs",function(){r(o,i)})}v.element.queue("tabs",function(){q(o,w)});v.load(v.anchors.index(this))}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(d.browser.msie){this.blur()}});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(g){if(typeof g=="string"){g=this.anchors.index(this.anchors.filter("[href$="+g+"]"))}return g},destroy:function(){var g=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h=d.data(this,"href.tabs");if(h){this.href=h}var i=d(this).unbind(".tabs");d.each(["href","load","cache"],function(j,k){i.removeData(k+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){if(d.data(this,"destroy.tabs")){d(this).remove()}else{d(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}});if(g.cookie){this._cookie(null,g.cookie)}return this},add:function(j,i,h){if(h===f){h=this.anchors.length}var g=this,l=this.options,n=d(l.tabTemplate.replace(/#\{href\}/g,j).replace(/#\{label\}/g,i)),m=!j.indexOf("#")?j.replace("#",""):this._tabId(d("a",n)[0]);n.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var k=g.element.find("#"+m);if(!k.length){k=d(l.panelTemplate).attr("id",m).data("destroy.tabs",true)}k.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(h>=this.lis.length){n.appendTo(this.list);k.appendTo(this.list[0].parentNode)}else{n.insertBefore(this.lis[h]);k.insertBefore(this.panels[h])}l.disabled=d.map(l.disabled,function(p,o){return p>=h?++p:p});this._tabify();if(this.anchors.length==1){l.selected=0;n.addClass("ui-tabs-selected ui-state-active");k.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){g._trigger("show",null,g._ui(g.anchors[0],g.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[h],this.panels[h]));return this},remove:function(g){g=this._getIndex(g);var i=this.options,j=this.lis.eq(g).remove(),h=this.panels.eq(g).remove();if(j.hasClass("ui-tabs-selected")&&this.anchors.length>1){this.select(g+(g+1<this.anchors.length?1:-1))}i.disabled=d.map(d.grep(i.disabled,function(l,k){return l!=g}),function(l,k){return l>=g?--l:l});this._tabify();this._trigger("remove",null,this._ui(j.find("a")[0],h[0]));return this},enable:function(g){g=this._getIndex(g);var h=this.options;if(d.inArray(g,h.disabled)==-1){return}this.lis.eq(g).removeClass("ui-state-disabled");h.disabled=d.grep(h.disabled,function(k,j){return k!=g});this._trigger("enable",null,this._ui(this.anchors[g],this.panels[g]));return this},disable:function(h){h=this._getIndex(h);var g=this,i=this.options;if(h!=i.selected){this.lis.eq(h).addClass("ui-state-disabled");i.disabled.push(h);i.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[h],this.panels[h]))}return this},select:function(g){g=this._getIndex(g);if(g==-1){if(this.options.collapsible&&this.options.selected!=-1){g=this.options.selected}else{return this}}this.anchors.eq(g).trigger(this.options.event+".tabs");return this},load:function(j){j=this._getIndex(j);var h=this,l=this.options,g=this.anchors.eq(j)[0],i=d.data(g,"load.tabs");this.abort();if(!i||this.element.queue("tabs").length!==0&&d.data(g,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(j).addClass("ui-state-processing");if(l.spinner){var k=d("span",g);k.data("label.tabs",k.html()).html(l.spinner)}this.xhr=d.ajax(d.extend({},l.ajaxOptions,{url:i,success:function(n,m){h.element.find(h._sanitizeSelector(g.hash)).html(n);h._cleanup();if(l.cache){d.data(g,"cache.tabs",true)}h._trigger("load",null,h._ui(h.anchors[j],h.panels[j]));try{l.ajaxOptions.success(n,m)}catch(o){}},error:function(o,m,n){h._cleanup();h._trigger("load",null,h._ui(h.anchors[j],h.panels[j]));try{l.ajaxOptions.error(o,m,j,g)}catch(n){}}}));h.element.dequeue("tabs");return this},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},url:function(h,g){this.anchors.eq(h).removeData("cache.tabs").data("load.tabs",g);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.12"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(i,k){var g=this,l=this.options;var h=g._rotate||(g._rotate=function(m){clearTimeout(g.rotation);g.rotation=setTimeout(function(){var n=l.selected;g.select(++n<g.anchors.length?n:0)},i);if(m){m.stopPropagation()}});var j=g._unrotate||(g._unrotate=!k?function(m){if(m.clientX){g.rotate(null)}}:function(m){t=l.selected;h()});if(i){this.element.bind("tabsshow",h);this.anchors.bind(l.event+".tabs",j);h()}else{clearTimeout(g.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(l.event+".tabs",j);delete this._rotate;delete this._unrotate}return this}})})(jQuery);(function($,undefined){$.extend($.ui,{datepicker:{version:"1.8.12"}});var PROP_NAME="datepicker";var dpuuid=new Date().getTime();function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass="ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};$.extend(this._defaults,this.regional[""]);this.dpDiv=$('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){this.uuid+=1;target.id="dp"+this.uuid}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(target,inst){var input=$(target);inst.append=$([]);inst.trigger=$([]);if(input.hasClass(this.markerClassName)){return}this._attachments(input,inst);input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});this._autoSize(inst);$.data(target,PROP_NAME,inst)},_attachments:function(input,inst){var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(inst.append){inst.append.remove()}if(appendText){inst.append=$('<span class="'+this._appendClass+'">'+appendText+"</span>");input[isRTL?"before":"after"](inst.append)}input.unbind("focus",this._showDatepicker);if(inst.trigger){inst.trigger.remove()}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");inst.trigger=$(this._get(inst,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('<button type="button"></button>').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("<img/>").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](inst.trigger);inst.trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==input[0]){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(input[0])}return false})}},_autoSize:function(inst){if(this._get(inst,"autoSize")&&!inst.inline){var date=new Date(2009,12-1,20);var dateFormat=this._get(inst,"dateFormat");if(dateFormat.match(/[DM]/)){var findMax=function(names){var max=0;var maxI=0;for(var i=0;i<names.length;i++){if(names[i].length>max){max=names[i].length;maxI=i}}return maxI};date.setMonth(findMax(this._get(inst,(dateFormat.match(/MM/)?"monthNames":"monthNamesShort"))));date.setDate(findMax(this._get(inst,(dateFormat.match(/DD/)?"dayNames":"dayNamesShort")))+20-date.getDay())}inst.input.attr("size",this._formatDate(inst,date).length)}},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return}divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst),true);this._updateDatepicker(inst);this._updateAlternate(inst);inst.dpDiv.show()},_dialogDatepicker:function(input,date,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){this.uuid+=1;var id="dp"+this.uuid;this._dialogInput=$('<input type="text" id="'+id+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});date=(date&&date.constructor==Date?this._formatDate(inst,date):date);this._dialogInput.val(date);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=document.documentElement.clientWidth;var browserHeight=document.documentElement.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",(this._pos[0]+20)+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){inst.append.remove();inst.trigger.remove();$target.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;inst.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().removeClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;inst.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().addClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i<this._disabledInputs.length;i++){if(this._disabledInputs[i]==target){return true}}return false},_getInst:function(target){try{return $.data(target,PROP_NAME)}catch(err){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(target,name,value){var inst=this._getInst(target);if(arguments.length==2&&typeof name=="string"){return(name=="defaults"?$.extend({},$.datepicker._defaults):(inst?(name=="all"?$.extend({},inst.settings):this._get(inst,name)):null))}var settings=name||{};if(typeof name=="string"){settings={};settings[name]=value}if(inst){if(this._curInst==inst){this._hideDatepicker()}var date=this._getDateDatepicker(target,true);var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");extendRemove(inst.settings,settings);if(minDate!==null&&settings.dateFormat!==undefined&&settings.minDate===undefined){inst.settings.minDate=this._formatDate(inst,minDate)}if(maxDate!==null&&settings.dateFormat!==undefined&&settings.maxDate===undefined){inst.settings.maxDate=this._formatDate(inst,maxDate)}this._attachments($(target),inst);this._autoSize(inst);this._setDateDatepicker(target,date);this._updateDatepicker(inst)}},_changeDatepicker:function(target,name,value){this._optionDatepicker(target,name,value)},_refreshDatepicker:function(target){var inst=this._getInst(target);if(inst){this._updateDatepicker(inst)}},_setDateDatepicker:function(target,date){var inst=this._getInst(target);if(inst){this._setDate(inst,date);this._updateDatepicker(inst);this._updateAlternate(inst)}},_getDateDatepicker:function(target,noDefault){var inst=this._getInst(target);if(inst&&!inst.inline){this._setDateFromField(inst,noDefault)}return(inst?this._getDate(inst):null)},_doKeyDown:function(event){var inst=$.datepicker._getInst(event.target);var handled=true;var isRTL=inst.dpDiv.is(".ui-datepicker-rtl");inst._keyEvent=true;if($.datepicker._datepickerShowing){switch(event.keyCode){case 9:$.datepicker._hideDatepicker();handled=false;break;case 13:var sel=$("td."+$.datepicker._dayOverClass+":not(."+$.datepicker._currentClass+")",inst.dpDiv);if(sel[0]){$.datepicker._selectDay(event.target,inst.selectedMonth,inst.selectedYear,sel[0])}else{$.datepicker._hideDatepicker()}return false;break;case 27:$.datepicker._hideDatepicker();break;case 33:$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M");break;case 34:$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M");break;case 35:if(event.ctrlKey||event.metaKey){$.datepicker._clearDate(event.target)}handled=event.ctrlKey||event.metaKey;break;case 36:if(event.ctrlKey||event.metaKey){$.datepicker._gotoToday(event.target)}handled=event.ctrlKey||event.metaKey;break;case 37:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?+1:-1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M")}break;case 38:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,-7,"D")}handled=event.ctrlKey||event.metaKey;break;case 39:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?-1:+1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M")}break;case 40:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,+7,"D")}handled=event.ctrlKey||event.metaKey;break;default:handled=false}}else{if(event.keyCode==36&&event.ctrlKey){$.datepicker._showDatepicker(this)}else{handled=false}}if(handled){event.preventDefault();event.stopPropagation()}},_doKeyPress:function(event){var inst=$.datepicker._getInst(event.target);if($.datepicker._get(inst,"constrainInput")){var chars=$.datepicker._possibleChars($.datepicker._get(inst,"dateFormat"));var chr=String.fromCharCode(event.charCode==undefined?event.keyCode:event.charCode);return event.ctrlKey||event.metaKey||(chr<" "||!chars||chars.indexOf(chr)>-1)}},_doKeyUp:function(event){var inst=$.datepicker._getInst(event.target);if(inst.input.val()!=inst.lastVal){try{var date=$.datepicker.parseDate($.datepicker._get(inst,"dateFormat"),(inst.input?inst.input.val():null),$.datepicker._getFormatConfig(inst));if(date){$.datepicker._setDateFromField(inst);$.datepicker._updateAlternate(inst);$.datepicker._updateDatepicker(inst)}}catch(event){$.datepicker.log(event)}}return true},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);if($.datepicker._curInst&&$.datepicker._curInst!=inst){$.datepicker._curInst.dpDiv.stop(true,true)}var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));inst.lastVal=null;$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.dpDiv.empty();inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim");var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;var cover=inst.dpDiv.find("iframe.ui-datepicker-cover");if(!!cover.length){var borders=$.datepicker._getBorders(inst.dpDiv);cover.css({left:-borders[0],top:-borders[1],width:inst.dpDiv.outerWidth(),height:inst.dpDiv.outerHeight()})}};inst.dpDiv.zIndex($(input).zIndex()+1);if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim||"show"]((showAnim?duration:null),postProcess)}if(!showAnim||!duration){postProcess()}if(inst.input.is(":visible")&&!inst.input.is(":disabled")){inst.input.focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var self=this;var borders=$.datepicker._getBorders(inst.dpDiv);inst.dpDiv.empty().append(this._generateHTML(inst));var cover=inst.dpDiv.find("iframe.ui-datepicker-cover");if(!!cover.length){cover.css({left:-borders[0],top:-borders[1],width:inst.dpDiv.outerWidth(),height:inst.dpDiv.outerHeight()})}inst.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){$(this).removeClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).removeClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).removeClass("ui-datepicker-next-hover")}}).bind("mouseover",function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");$(this).addClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).addClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).addClass("ui-datepicker-next-hover")}}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}else{inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst==$.datepicker._curInst&&$.datepicker._datepickerShowing&&inst.input&&inst.input.is(":visible")&&!inst.input.is(":disabled")&&inst.input[0]!=document.activeElement){inst.input.focus()}if(inst.yearshtml){var origyearshtml=inst.yearshtml;setTimeout(function(){if(origyearshtml===inst.yearshtml){inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml)}origyearshtml=inst.yearshtml=null},0)}},_getBorders:function(elem){var convert=function(value){return{thin:1,medium:2,thick:3}[value]||value};return[parseFloat(convert(elem.css("border-left-width"))),parseFloat(convert(elem.css("border-top-width")))]},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=document.documentElement.clientWidth+$(document).scrollLeft();var viewHeight=document.documentElement.clientHeight+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=Math.min(offset.left,(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0);offset.top-=Math.min(offset.top,(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(dpHeight+inputHeight):0);return offset},_findPos:function(obj){var inst=this._getInst(obj);var isRTL=this._get(inst,"isRTL");while(obj&&(obj.type=="hidden"||obj.nodeType!=1||$.expr.filters.hidden(obj))){obj=obj[isRTL?"previousSibling":"nextSibling"]}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(this._datepickerShowing){var showAnim=this._get(inst,"showAnim");var duration=this._get(inst,"duration");var postProcess=function(){$.datepicker._tidyDialog(inst);this._curInst=null};if($.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide"))]((showAnim?duration:null),postProcess)}if(!showAnim){postProcess()}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if($target[0].id!=$.datepicker._mainDivId&&$target.parents("#"+$.datepicker._mainDivId).length==0&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker()}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear){setTimeout(function(){inst.input.focus()},0)}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{this._hideDatepicker();this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input.focus()}this._lastInput=null}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);var dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getTime());checkDate.setDate(checkDate.getDate()+4-(checkDate.getDay()||7));var time=checkDate.getTime();checkDate.setMonth(0);checkDate.setDate(1);return Math.floor(Math.round((time-checkDate)/86400000)/7)+1},parseDate:function(format,value,settings){if(format==null||value==null){throw"Invalid arguments"}value=(typeof value=="object"?value.toString():value+"");if(value==""){return null}var shortYearCutoff=(settings?settings.shortYearCutoff:null)||this._defaults.shortYearCutoff;shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var year=-1;var month=-1;var day=-1;var doy=-1;var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var getNumber=function(match){var isDoubled=lookAhead(match);var size=(match=="@"?14:(match=="!"?20:(match=="y"&&isDoubled?4:(match=="o"?3:2))));var digits=new RegExp("^\\d{1,"+size+"}");var num=value.substring(iValue).match(digits);if(!num){throw"Missing number at position "+iValue}iValue+=num[0].length;return parseInt(num[0],10)};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);for(var i=0;i<names.length;i++){if(value.substr(iValue,names[i].length).toLowerCase()==names[i].toLowerCase()){iValue+=names[i].length;return i+1}}throw"Unknown name at position "+iValue};var checkLiteral=function(){if(value.charAt(iValue)!=format.charAt(iFormat)){throw"Unexpected literal at position "+iValue}iValue++};var iValue=0;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{checkLiteral()}}else{switch(format.charAt(iFormat)){case"d":day=getNumber("d");break;case"D":getName("D",dayNamesShort,dayNames);break;case"o":doy=getNumber("o");break;case"m":month=getNumber("m");break;case"M":month=getName("M",monthNamesShort,monthNames);break;case"y":year=getNumber("y");break;case"@":var date=new Date(getNumber("@"));year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"!":var date=new Date((getNumber("!")-this._ticksTo1970)/10000);year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"'":if(lookAhead("'")){checkLiteral()}else{literal=true}break;default:checkLiteral()}}}if(year==-1){year=new Date().getFullYear()}else{if(year<100){year+=new Date().getFullYear()-new Date().getFullYear()%100+(year<=shortYearCutoff?0:-100)}}if(doy>-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(((1970-1)*365+Math.floor(1970/4)-Math.floor(1970/100)+Math.floor(1970/400))*24*60*60*10000000),formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var formatNumber=function(match,value,len){var num=""+value;if(lookAhead(match)){while(num.length<len){num="0"+num}}return num};var formatName=function(match,value,shortNames,longNames){return(lookAhead(match)?longNames[value]:shortNames[value])};var output="";var literal=false;if(date){for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{output+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":output+=formatNumber("d",date.getDate(),2);break;case"D":output+=formatName("D",date.getDay(),dayNamesShort,dayNames);break;case"o":output+=formatNumber("o",(date.getTime()-new Date(date.getFullYear(),0,0).getTime())/86400000,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"!":output+=date.getTime()*10000+this._ticksTo1970;break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{chars+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":case"m":case"y":case"@":chars+="0123456789";break;case"D":case"M":return null;case"'":if(lookAhead("'")){chars+="'"}else{literal=true}break;default:chars+=format.charAt(iFormat)}}}return chars},_get:function(inst,name){return inst.settings[name]!==undefined?inst.settings[name]:this._defaults[name]},_setDateFromField:function(inst,noDefault){if(inst.input.val()==inst.lastVal){return}var dateFormat=this._get(inst,"dateFormat");var dates=inst.lastVal=inst.input?inst.input.val():null;var date,defaultDate;date=defaultDate=this._getDefaultDate(inst);var settings=this._getFormatConfig(inst);try{date=this.parseDate(dateFormat,dates,settings)||defaultDate}catch(event){this.log(event);dates=(noDefault?"":dates)}inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();inst.currentDay=(dates?date.getDate():0);inst.currentMonth=(dates?date.getMonth():0);inst.currentYear=(dates?date.getFullYear():0);this._adjustInstDate(inst)},_getDefaultDate:function(inst){return this._restrictMinMax(inst,this._determineDate(inst,this._get(inst,"defaultDate"),new Date()))},_determineDate:function(inst,date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset){try{return $.datepicker.parseDate($.datepicker._get(inst,"dateFormat"),offset,$.datepicker._getFormatConfig(inst))}catch(e){}var date=(offset.toLowerCase().match(/^c/)?$.datepicker._getDate(inst):null)||new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,$.datepicker._getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,$.datepicker._getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};var newDate=(date==null||date===""?defaultDate:(typeof date=="string"?offsetString(date):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):new Date(date.getTime()))));newDate=(newDate&&newDate.toString()=="Invalid Date"?defaultDate:newDate);if(newDate){newDate.setHours(0);newDate.setMinutes(0);newDate.setSeconds(0);newDate.setMilliseconds(0)}return this._daylightSavingAdjust(newDate)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,noChange){var clear=!date;var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;var newDate=this._restrictMinMax(inst,this._determineDate(inst,date,new Date()));inst.selectedDay=inst.currentDay=newDate.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=newDate.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=newDate.getFullYear();if((origMonth!=inst.selectedMonth||origYear!=inst.selectedYear)&&!noChange){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-(numMonths[0]*numMonths[1])+1,maxDate.getDate()));maxDraw=(minDate&&maxDraw<minDate?minDate:maxDraw);while(this._daylightSavingAdjust(new Date(drawYear,drawMonth,1))>maxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+inst.id+"', -"+stepMonths+", 'M');\" title=\""+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>"));var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+inst.id+"', +"+stepMonths+", 'M');\" title=\""+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>"));var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls=(!inst.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+dpuuid+'.datepicker._hideDatepicker();">'+this._get(inst,"closeText")+"</button>":"");var buttonPanel=(showButtonPanel)?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._gotoToday('#"+inst.id+"');\">"+currentText+"</button>":"")+(isRTL?"":controls)+"</div>":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var showWeek=this._get(inst,"showWeek");var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var selectOtherMonths=this._get(inst,"selectOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row<numMonths[0];row++){var group="";for(var col=0;col<numMonths[1];col++){var selectedDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,inst.selectedDay));var cornerClass=" ui-corner-all";var calender="";if(isMultiMonth){calender+='<div class="ui-datepicker-group';if(numMonths[1]>1){switch(col){case 0:calender+=" ui-datepicker-group-first";cornerClass=" ui-corner-"+(isRTL?"right":"left");break;case numMonths[1]-1:calender+=" ui-datepicker-group-last";cornerClass=" ui-corner-"+(isRTL?"left":"right");break;default:calender+=" ui-datepicker-group-middle";cornerClass="";break}}calender+='">'}calender+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+cornerClass+'">'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,row>0||col>0,monthNames,monthNamesShort)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var thead=(showWeek?'<th class="ui-datepicker-week-col">'+this._get(inst,"weekHeader")+"</th>":"");for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="<th"+((dow+firstDay+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+dayNames[day]+'">'+dayNamesMin[day]+"</span></th>"}calender+=thead+"</tr></thead><tbody>";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow<numRows;dRow++){calender+="<tr>";var tbody=(!showWeek?"":'<td class="ui-datepicker-week-col">'+this._get(inst,"calculateWeek")(printDate)+"</td>");for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=(otherMonth&&!selectOtherMonths)||!daySettings[0]||(minDate&&printDate<minDate)||(maxDate&&printDate>maxDate);tbody+='<td class="'+((dow+firstDay+6)%7>=5?" ui-datepicker-week-end":"")+(otherMonth?" ui-datepicker-other-month":"")+((printDate.getTime()==selectedDate.getTime()&&drawMonth==inst.selectedMonth&&inst._keyEvent)||(defaultDate.getTime()==printDate.getTime()&&defaultDate.getTime()==selectedDate.getTime())?" "+this._dayOverClass:"")+(unselectable?" "+this._unselectableClass+" ui-state-disabled":"")+(otherMonth&&!showOtherMonths?"":" "+daySettings[1]+(printDate.getTime()==currentDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":' onclick="DP_jQuery_'+dpuuid+".datepicker._selectDay('#"+inst.id+"',"+printDate.getMonth()+","+printDate.getFullYear()+', this);return false;"')+">"+(otherMonth&&!showOtherMonths?" ":(unselectable?'<span class="ui-state-default">'+printDate.getDate()+"</span>":'<a class="ui-state-default'+(printDate.getTime()==today.getTime()?" ui-state-highlight":"")+(printDate.getTime()==currentDate.getTime()?" ui-state-active":"")+(otherMonth?" ui-priority-secondary":"")+'" href="#">'+printDate.getDate()+"</a>"))+"</td>";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+"</tr>"}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="</tbody></table>"+(isMultiMonth?"</div>"+((numMonths[0]>0&&col==numMonths[1]-1)?'<div class="ui-datepicker-row-break"></div>':""):"");group+=calender}html+=group}html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,secondary,monthNames,monthNamesShort){var changeMonth=this._get(inst,"changeMonth");var changeYear=this._get(inst,"changeYear");var showMonthAfterYear=this._get(inst,"showMonthAfterYear");var html='<div class="ui-datepicker-title">';var monthHtml="";if(secondary||!changeMonth){monthHtml+='<span class="ui-datepicker-month">'+monthNames[drawMonth]+"</span>"}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+inst.id+"', this, 'M');\" onclick=\"DP_jQuery_"+dpuuid+".datepicker._clickMonthYear('#"+inst.id+"');\">";for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth())){monthHtml+='<option value="'+month+'"'+(month==drawMonth?' selected="selected"':"")+">"+monthNamesShort[month]+"</option>"}}monthHtml+="</select>"}if(!showMonthAfterYear){html+=monthHtml+(secondary||!(changeMonth&&changeYear)?" ":"")}if(!inst.yearshtml){inst.yearshtml="";if(secondary||!changeYear){html+='<span class="ui-datepicker-year">'+drawYear+"</span>"}else{var years=this._get(inst,"yearRange").split(":");var thisYear=new Date().getFullYear();var determineYear=function(value){var year=(value.match(/c[+-].*/)?drawYear+parseInt(value.substring(1),10):(value.match(/[+-].*/)?thisYear+parseInt(value,10):parseInt(value,10)));return(isNaN(year)?thisYear:year)};var year=determineYear(years[0]);var endYear=Math.max(year,determineYear(years[1]||""));year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);inst.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+inst.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+dpuuid+".datepicker._clickMonthYear('#"+inst.id+"');\">";for(;year<=endYear;year++){inst.yearshtml+='<option value="'+year+'"'+(year==drawYear?' selected="selected"':"")+">"+year+"</option>"}inst.yearshtml+="</select>";if(!$.browser.mozilla){html+=inst.yearshtml;inst.yearshtml=null}else{html+='<select class="ui-datepicker-year"><option value="'+drawYear+'" selected="selected">'+drawYear+"</option></select>"}}}html+=this._get(inst,"yearSuffix");if(showMonthAfterYear){html+=(secondary||!(changeMonth&&changeYear)?" ":"")+monthHtml}html+="</div>";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._restrictMinMax(inst,this._daylightSavingAdjust(new Date(year,month,day)));inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_restrictMinMax:function(inst,date){var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");var newDate=(minDate&&date<minDate?minDate:date);newDate=(maxDate&&newDate>maxDate?maxDate:newDate);return newDate},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax){return this._determineDate(inst,this._get(inst,minMax+"Date"),null)},_getDaysInMonth:function(year,month){return 32-this._daylightSavingAdjust(new Date(year,month,32)).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[0]*numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");return((!minDate||date.getTime()>=minDate.getTime())&&(!maxDate||date.getTime()<=maxDate.getTime()))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!this.length){return this}if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate"||options=="widget")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}if(options=="option"&&arguments.length==2&&typeof arguments[1]=="string"){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.8.12";window["DP_jQuery_"+dpuuid]=$})(jQuery);(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===b){return this._value()}this._setOption("value",c);return this},_setOption:function(c,d){if(c==="value"){this.options.value=d;this._refreshValue();if(this._value()===this.options.max){this._trigger("complete")}}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number"){c=0}return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var d=this.value();var c=this._percentage();if(this.oldValue!==d){this.oldValue=d;this._trigger("change")}this.valueDiv.toggle(d>this.min).toggleClass("ui-corner-right",d===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",d)}});a.extend(a.ui.progressbar,{version:"1.8.12"})})(jQuery);jQuery.effects||(function(h,e){h.effects={};h.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(n,m){h.fx.step[m]=function(o){if(!o.colorInit){o.start=l(o.elem,m);o.end=j(o.end);o.colorInit=true}o.elem.style[m]="rgb("+Math.max(Math.min(parseInt((o.pos*(o.end[0]-o.start[0]))+o.start[0],10),255),0)+","+Math.max(Math.min(parseInt((o.pos*(o.end[1]-o.start[1]))+o.start[1],10),255),0)+","+Math.max(Math.min(parseInt((o.pos*(o.end[2]-o.start[2]))+o.start[2],10),255),0)+")"}});function j(n){var m;if(n&&n.constructor==Array&&n.length==3){return n}if(m=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(n)){return[parseInt(m[1],10),parseInt(m[2],10),parseInt(m[3],10)]}if(m=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(n)){return[parseFloat(m[1])*2.55,parseFloat(m[2])*2.55,parseFloat(m[3])*2.55]}if(m=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(n)){return[parseInt(m[1],16),parseInt(m[2],16),parseInt(m[3],16)]}if(m=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(n)){return[parseInt(m[1]+m[1],16),parseInt(m[2]+m[2],16),parseInt(m[3]+m[3],16)]}if(m=/rgba\(0, 0, 0, 0\)/.exec(n)){return a.transparent}return a[h.trim(n).toLowerCase()]}function l(o,m){var n;do{n=h.curCSS(o,m);if(n!=""&&n!="transparent"||h.nodeName(o,"body")){break}m="backgroundColor"}while(o=o.parentNode);return j(n)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};var f=["add","remove","toggle"],c={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};function g(){var p=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,q={},n,o;if(p&&p.length&&p[0]&&p[p[0]]){var m=p.length;while(m--){n=p[m];if(typeof p[n]=="string"){o=n.replace(/\-(\w)/g,function(r,s){return s.toUpperCase()});q[o]=p[n]}}}else{for(n in p){if(typeof p[n]==="string"){q[n]=p[n]}}}return q}function b(n){var m,o;for(m in n){o=n[m];if(o==null||h.isFunction(o)||m in c||(/scrollbar/).test(m)||(!(/color/i).test(m)&&isNaN(parseFloat(o)))){delete n[m]}}return n}function i(m,o){var p={_:0},n;for(n in o){if(m[n]!=o[n]){p[n]=o[n]}}return p}h.effects.animateClass=function(m,n,p,o){if(h.isFunction(p)){o=p;p=null}return this.queue("fx",function(){var v=h(this),r=v.attr("style")||" ",x=b(g.call(this)),u,s=v.attr("className");h.each(f,function(y,z){if(m[z]){v[z+"Class"](m[z])}});u=b(g.call(this));v.attr("className",s);v.animate(i(x,u),n,p,function(){h.each(f,function(y,z){if(m[z]){v[z+"Class"](m[z])}});if(typeof v.attr("style")=="object"){v.attr("style").cssText="";v.attr("style").cssText=r}else{v.attr("style",r)}if(o){o.apply(this,arguments)}});var q=h.queue(this),w=q.splice(q.length-1,1)[0];q.splice(1,0,w);h.dequeue(this)})};h.fn.extend({_addClass:h.fn.addClass,addClass:function(n,m,p,o){return m?h.effects.animateClass.apply(this,[{add:n},m,p,o]):this._addClass(n)},_removeClass:h.fn.removeClass,removeClass:function(n,m,p,o){return m?h.effects.animateClass.apply(this,[{remove:n},m,p,o]):this._removeClass(n)},_toggleClass:h.fn.toggleClass,toggleClass:function(o,n,m,q,p){if(typeof n=="boolean"||n===e){if(!m){return this._toggleClass(o,n)}else{return h.effects.animateClass.apply(this,[(n?{add:o}:{remove:o}),m,q,p])}}else{return h.effects.animateClass.apply(this,[{toggle:o},n,m,q])}},switchClass:function(m,o,n,q,p){return h.effects.animateClass.apply(this,[{add:o,remove:m},n,q,p])}});h.extend(h.effects,{version:"1.8.12",save:function(n,o){for(var m=0;m<o.length;m++){if(o[m]!==null){n.data("ec.storage."+o[m],n[0].style[o[m]])}}},restore:function(n,o){for(var m=0;m<o.length;m++){if(o[m]!==null){n.css(o[m],n.data("ec.storage."+o[m]))}}},setMode:function(m,n){if(n=="toggle"){n=m.is(":hidden")?"show":"hide"}return n},getBaseline:function(n,o){var p,m;switch(n[0]){case"top":p=0;break;case"middle":p=0.5;break;case"bottom":p=1;break;default:p=n[0]/o.height}switch(n[1]){case"left":m=0;break;case"center":m=0.5;break;case"right":m=1;break;default:m=n[1]/o.width}return{x:m,y:p}},createWrapper:function(m){if(m.parent().is(".ui-effects-wrapper")){return m.parent()}var n={width:m.outerWidth(true),height:m.outerHeight(true),"float":m.css("float")},o=h("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});m.wrap(o);o=m.parent();if(m.css("position")=="static"){o.css({position:"relative"});m.css({position:"relative"})}else{h.extend(n,{position:m.css("position"),zIndex:m.css("z-index")});h.each(["top","left","bottom","right"],function(p,q){n[q]=m.css(q);if(isNaN(parseInt(n[q],10))){n[q]="auto"}});m.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return o.css(n).show()},removeWrapper:function(m){if(m.parent().is(".ui-effects-wrapper")){return m.parent().replaceWith(m)}return m},setTransition:function(n,p,m,o){o=o||{};h.each(p,function(r,q){unit=n.cssUnit(q);if(unit[0]>0){o[q]=unit[0]*m+unit[1]}});return o}});function d(n,m,o,p){if(typeof n=="object"){p=m;o=null;m=n;n=m.effect}if(h.isFunction(m)){p=m;o=null;m={}}if(typeof m=="number"||h.fx.speeds[m]){p=o;o=m;m={}}if(h.isFunction(o)){p=o;o=null}m=m||{};o=o||m.duration;o=h.fx.off?0:typeof o=="number"?o:o in h.fx.speeds?h.fx.speeds[o]:h.fx.speeds._default;p=p||m.complete;return[n,m,o,p]}function k(m){if(!m||typeof m==="number"||h.fx.speeds[m]){return true}if(typeof m==="string"&&!h.effects[m]){return true}return false}h.fn.extend({effect:function(p,o,r,u){var n=d.apply(this,arguments),q={options:n[1],duration:n[2],callback:n[3]},s=q.options.mode,m=h.effects[p];if(h.fx.off||!m){if(s){return this[s](q.duration,q.callback)}else{return this.each(function(){if(q.callback){q.callback.call(this)}})}}return m.call(this,q)},_show:h.fn.show,show:function(n){if(k(n)){return this._show.apply(this,arguments)}else{var m=d.apply(this,arguments);m[1].mode="show";return this.effect.apply(this,m)}},_hide:h.fn.hide,hide:function(n){if(k(n)){return this._hide.apply(this,arguments)}else{var m=d.apply(this,arguments);m[1].mode="hide";return this.effect.apply(this,m)}},__toggle:h.fn.toggle,toggle:function(n){if(k(n)||typeof n==="boolean"||h.isFunction(n)){return this.__toggle.apply(this,arguments)}else{var m=d.apply(this,arguments);m[1].mode="toggle";return this.effect.apply(this,m)}},cssUnit:function(m){var n=this.css(m),o=[];h.each(["em","px","%","pt"],function(p,q){if(n.indexOf(q)>0){o=[parseFloat(n),q]}});return o}});h.easing.jswing=h.easing.swing;h.extend(h.easing,{def:"easeOutQuad",swing:function(n,o,m,q,p){return h.easing[h.easing.def](n,o,m,q,p)},easeInQuad:function(n,o,m,q,p){return q*(o/=p)*o+m},easeOutQuad:function(n,o,m,q,p){return -q*(o/=p)*(o-2)+m},easeInOutQuad:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o+m}return -q/2*((--o)*(o-2)-1)+m},easeInCubic:function(n,o,m,q,p){return q*(o/=p)*o*o+m},easeOutCubic:function(n,o,m,q,p){return q*((o=o/p-1)*o*o+1)+m},easeInOutCubic:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o*o+m}return q/2*((o-=2)*o*o+2)+m},easeInQuart:function(n,o,m,q,p){return q*(o/=p)*o*o*o+m},easeOutQuart:function(n,o,m,q,p){return -q*((o=o/p-1)*o*o*o-1)+m},easeInOutQuart:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o*o*o+m}return -q/2*((o-=2)*o*o*o-2)+m},easeInQuint:function(n,o,m,q,p){return q*(o/=p)*o*o*o*o+m},easeOutQuint:function(n,o,m,q,p){return q*((o=o/p-1)*o*o*o*o+1)+m},easeInOutQuint:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o*o*o*o+m}return q/2*((o-=2)*o*o*o*o+2)+m},easeInSine:function(n,o,m,q,p){return -q*Math.cos(o/p*(Math.PI/2))+q+m},easeOutSine:function(n,o,m,q,p){return q*Math.sin(o/p*(Math.PI/2))+m},easeInOutSine:function(n,o,m,q,p){return -q/2*(Math.cos(Math.PI*o/p)-1)+m},easeInExpo:function(n,o,m,q,p){return(o==0)?m:q*Math.pow(2,10*(o/p-1))+m},easeOutExpo:function(n,o,m,q,p){return(o==p)?m+q:q*(-Math.pow(2,-10*o/p)+1)+m},easeInOutExpo:function(n,o,m,q,p){if(o==0){return m}if(o==p){return m+q}if((o/=p/2)<1){return q/2*Math.pow(2,10*(o-1))+m}return q/2*(-Math.pow(2,-10*--o)+2)+m},easeInCirc:function(n,o,m,q,p){return -q*(Math.sqrt(1-(o/=p)*o)-1)+m},easeOutCirc:function(n,o,m,q,p){return q*Math.sqrt(1-(o=o/p-1)*o)+m},easeInOutCirc:function(n,o,m,q,p){if((o/=p/2)<1){return -q/2*(Math.sqrt(1-o*o)-1)+m}return q/2*(Math.sqrt(1-(o-=2)*o)+1)+m},easeInElastic:function(n,q,m,w,v){var r=1.70158;var u=0;var o=w;if(q==0){return m}if((q/=v)==1){return m+w}if(!u){u=v*0.3}if(o<Math.abs(w)){o=w;var r=u/4}else{var r=u/(2*Math.PI)*Math.asin(w/o)}return -(o*Math.pow(2,10*(q-=1))*Math.sin((q*v-r)*(2*Math.PI)/u))+m},easeOutElastic:function(n,q,m,w,v){var r=1.70158;var u=0;var o=w;if(q==0){return m}if((q/=v)==1){return m+w}if(!u){u=v*0.3}if(o<Math.abs(w)){o=w;var r=u/4}else{var r=u/(2*Math.PI)*Math.asin(w/o)}return o*Math.pow(2,-10*q)*Math.sin((q*v-r)*(2*Math.PI)/u)+w+m},easeInOutElastic:function(n,q,m,w,v){var r=1.70158;var u=0;var o=w;if(q==0){return m}if((q/=v/2)==2){return m+w}if(!u){u=v*(0.3*1.5)}if(o<Math.abs(w)){o=w;var r=u/4}else{var r=u/(2*Math.PI)*Math.asin(w/o)}if(q<1){return -0.5*(o*Math.pow(2,10*(q-=1))*Math.sin((q*v-r)*(2*Math.PI)/u))+m}return o*Math.pow(2,-10*(q-=1))*Math.sin((q*v-r)*(2*Math.PI)/u)*0.5+w+m},easeInBack:function(n,o,m,r,q,p){if(p==e){p=1.70158}return r*(o/=q)*o*((p+1)*o-p)+m},easeOutBack:function(n,o,m,r,q,p){if(p==e){p=1.70158}return r*((o=o/q-1)*o*((p+1)*o+p)+1)+m},easeInOutBack:function(n,o,m,r,q,p){if(p==e){p=1.70158}if((o/=q/2)<1){return r/2*(o*o*(((p*=(1.525))+1)*o-p))+m}return r/2*((o-=2)*o*(((p*=(1.525))+1)*o+p)+2)+m},easeInBounce:function(n,o,m,q,p){return q-h.easing.easeOutBounce(n,p-o,0,q,p)+m},easeOutBounce:function(n,o,m,q,p){if((o/=p)<(1/2.75)){return q*(7.5625*o*o)+m}else{if(o<(2/2.75)){return q*(7.5625*(o-=(1.5/2.75))*o+0.75)+m}else{if(o<(2.5/2.75)){return q*(7.5625*(o-=(2.25/2.75))*o+0.9375)+m}else{return q*(7.5625*(o-=(2.625/2.75))*o+0.984375)+m}}}},easeInOutBounce:function(n,o,m,q,p){if(o<p/2){return h.easing.easeInBounce(n,o*2,0,q,p)*0.5+m}return h.easing.easeOutBounce(n,o*2-p,0,q,p)*0.5+q*0.5+m}})})(jQuery);(function(a,b){a.effects.blind=function(c){return this.queue(function(){var e=a(this),d=["position","top","bottom","left","right"];var i=a.effects.setMode(e,c.options.mode||"hide");var h=c.options.direction||"vertical";a.effects.save(e,d);e.show();var k=a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="vertical")?"height":"width";var j=(h=="vertical")?k.height():k.width();if(i=="show"){k.css(f,0)}var g={};g[f]=i=="show"?j:0;k.animate(g,c.duration,c.options.easing,function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(c.callback){c.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);(function(a,b){a.effects.bounce=function(c){return this.queue(function(){var f=a(this),m=["position","top","bottom","left","right"];var l=a.effects.setMode(f,c.options.mode||"effect");var o=c.options.direction||"up";var d=c.options.distance||20;var e=c.options.times||5;var h=c.duration||250;if(/show|hide/.test(l)){m.push("opacity")}a.effects.save(f,m);f.show();a.effects.createWrapper(f);var g=(o=="up"||o=="down")?"top":"left";var q=(o=="up"||o=="left")?"pos":"neg";var d=c.options.distance||(g=="top"?f.outerHeight({margin:true})/3:f.outerWidth({margin:true})/3);if(l=="show"){f.css("opacity",0).css(g,q=="pos"?-d:d)}if(l=="hide"){d=d/(e*2)}if(l!="hide"){e--}if(l=="show"){var j={opacity:1};j[g]=(q=="pos"?"+=":"-=")+d;f.animate(j,h/2,c.options.easing);d=d/2;e--}for(var k=0;k<e;k++){var p={},n={};p[g]=(q=="pos"?"-=":"+=")+d;n[g]=(q=="pos"?"+=":"-=")+d;f.animate(p,h/2,c.options.easing).animate(n,h/2,c.options.easing);d=(l=="hide")?d*2:d/2}if(l=="hide"){var j={opacity:0};j[g]=(q=="pos"?"-=":"+=")+d;f.animate(j,h/2,c.options.easing,function(){f.hide();a.effects.restore(f,m);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}})}else{var p={},n={};p[g]=(q=="pos"?"-=":"+=")+d;n[g]=(q=="pos"?"+=":"-=")+d;f.animate(p,h/2,c.options.easing).animate(n,h/2,c.options.easing,function(){a.effects.restore(f,m);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}})}f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery);(function(a,b){a.effects.clip=function(c){return this.queue(function(){var g=a(this),k=["position","top","bottom","left","right","height","width"];var j=a.effects.setMode(g,c.options.mode||"hide");var l=c.options.direction||"vertical";a.effects.save(g,k);g.show();var d=a.effects.createWrapper(g).css({overflow:"hidden"});var f=g[0].tagName=="IMG"?d:g;var h={size:(l=="vertical")?"height":"width",position:(l=="vertical")?"top":"left"};var e=(l=="vertical")?f.height():f.width();if(j=="show"){f.css(h.size,0);f.css(h.position,e/2)}var i={};i[h.size]=j=="show"?e:0;i[h.position]=j=="show"?0:e/2;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(j=="hide"){g.hide()}a.effects.restore(g,k);a.effects.removeWrapper(g);if(c.callback){c.callback.apply(g[0],arguments)}g.dequeue()}})})}})(jQuery);(function(a,b){a.effects.drop=function(c){return this.queue(function(){var f=a(this),e=["position","top","bottom","left","right","opacity"];var j=a.effects.setMode(f,c.options.mode||"hide");var i=c.options.direction||"left";a.effects.save(f,e);f.show();a.effects.createWrapper(f);var g=(i=="up"||i=="down")?"top":"left";var d=(i=="up"||i=="left")?"pos":"neg";var k=c.options.distance||(g=="top"?f.outerHeight({margin:true})/2:f.outerWidth({margin:true})/2);if(j=="show"){f.css("opacity",0).css(g,d=="pos"?-k:k)}var h={opacity:j=="show"?1:0};h[g]=(j=="show"?(d=="pos"?"+=":"-="):(d=="pos"?"-=":"+="))+k;f.animate(h,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(j=="hide"){f.hide()}a.effects.restore(f,e);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}f.dequeue()}})})}})(jQuery);(function(a,b){a.effects.explode=function(c){return this.queue(function(){var l=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;var f=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;c.options.mode=c.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):c.options.mode;var k=a(this).show().css("visibility","hidden");var m=k.offset();m.top-=parseInt(k.css("marginTop"),10)||0;m.left-=parseInt(k.css("marginLeft"),10)||0;var h=k.outerWidth(true);var d=k.outerHeight(true);for(var g=0;g<l;g++){for(var e=0;e<f;e++){k.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-e*(h/f),top:-g*(d/l)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/f,height:d/l,left:m.left+e*(h/f)+(c.options.mode=="show"?(e-Math.floor(f/2))*(h/f):0),top:m.top+g*(d/l)+(c.options.mode=="show"?(g-Math.floor(l/2))*(d/l):0),opacity:c.options.mode=="show"?0:1}).animate({left:m.left+e*(h/f)+(c.options.mode=="show"?0:(e-Math.floor(f/2))*(h/f)),top:m.top+g*(d/l)+(c.options.mode=="show"?0:(g-Math.floor(l/2))*(d/l)),opacity:c.options.mode=="show"?1:0},c.duration||500)}}setTimeout(function(){c.options.mode=="show"?k.css({visibility:"visible"}):k.css({visibility:"visible"}).hide();if(c.callback){c.callback.apply(k[0])}k.dequeue();a("div.ui-effects-explode").remove()},c.duration||500)})}})(jQuery);(function(a,b){a.effects.fade=function(c){return this.queue(function(){var d=a(this),e=a.effects.setMode(d,c.options.mode||"hide");d.animate({opacity:e},{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){(c.callback&&c.callback.apply(this,arguments));d.dequeue()}})})}})(jQuery);(function(a,b){a.effects.fold=function(c){return this.queue(function(){var f=a(this),l=["position","top","bottom","left","right"];var i=a.effects.setMode(f,c.options.mode||"hide");var p=c.options.size||15;var o=!(!c.options.horizFirst);var h=c.duration?c.duration/2:a.fx.speeds._default/2;a.effects.save(f,l);f.show();var e=a.effects.createWrapper(f).css({overflow:"hidden"});var j=((i=="show")!=o);var g=j?["width","height"]:["height","width"];var d=j?[e.width(),e.height()]:[e.height(),e.width()];var k=/([0-9]+)%/.exec(p);if(k){p=parseInt(k[1],10)/100*d[i=="hide"?0:1]}if(i=="show"){e.css(o?{height:0,width:p}:{height:p,width:0})}var n={},m={};n[g[0]]=i=="show"?d[0]:p;m[g[1]]=i=="show"?d[1]:0;e.animate(n,h,c.options.easing).animate(m,h,c.options.easing,function(){if(i=="hide"){f.hide()}a.effects.restore(f,l);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(f[0],arguments)}f.dequeue()})})}})(jQuery);(function(a,b){a.effects.highlight=function(c){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"],g=a.effects.setMode(e,c.options.mode||"show"),f={backgroundColor:e.css("backgroundColor")};if(g=="hide"){f.opacity=0}a.effects.save(e,d);e.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){(g=="hide"&&e.hide());a.effects.restore(e,d);(g=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"));(c.callback&&c.callback.apply(this,arguments));e.dequeue()}})})}})(jQuery);(function(a,b){a.effects.pulsate=function(c){return this.queue(function(){var e=a(this),f=a.effects.setMode(e,c.options.mode||"show");times=((c.options.times||5)*2)-1;duration=c.duration?c.duration/2:a.fx.speeds._default/2,isVisible=e.is(":visible"),animateTo=0;if(!isVisible){e.css("opacity",0).show();animateTo=1}if((f=="hide"&&isVisible)||(f=="show"&&!isVisible)){times--}for(var d=0;d<times;d++){e.animate({opacity:animateTo},duration,c.options.easing);animateTo=(animateTo+1)%2}e.animate({opacity:animateTo},duration,c.options.easing,function(){if(animateTo==0){e.hide()}(c.callback&&c.callback.apply(this,arguments))});e.queue("fx",function(){e.dequeue()}).dequeue()})}})(jQuery);(function(a,b){a.effects.puff=function(c){return this.queue(function(){var g=a(this),h=a.effects.setMode(g,c.options.mode||"hide"),f=parseInt(c.options.percent,10)||150,e=f/100,d={height:g.height(),width:g.width()};a.extend(c.options,{fade:true,mode:h,percent:h=="hide"?f:100,from:h=="hide"?d:{height:d.height*e,width:d.width*e}});g.effect("scale",c.options,c.duration,c.callback);g.dequeue()})};a.effects.scale=function(c){return this.queue(function(){var h=a(this);var e=a.extend(true,{},c.options);var k=a.effects.setMode(h,c.options.mode||"effect");var i=parseInt(c.options.percent,10)||(parseInt(c.options.percent,10)==0?0:(k=="hide"?0:100));var j=c.options.direction||"both";var d=c.options.origin;if(k!="effect"){e.origin=d||["middle","center"];e.restore=true}var g={height:h.height(),width:h.width()};h.from=c.options.from||(k=="show"?{height:0,width:0}:g);var f={y:j!="horizontal"?(i/100):1,x:j!="vertical"?(i/100):1};h.to={height:g.height*f.y,width:g.width*f.x};if(c.options.fade){if(k=="show"){h.from.opacity=0;h.to.opacity=1}if(k=="hide"){h.from.opacity=1;h.to.opacity=0}}e.from=h.from;e.to=h.to;e.mode=k;h.effect("size",e,c.duration,c.callback);h.dequeue()})};a.effects.size=function(c){return this.queue(function(){var d=a(this),o=["position","top","bottom","left","right","width","height","overflow","opacity"];var n=["position","top","bottom","left","right","overflow","opacity"];var k=["width","height","overflow"];var q=["fontSize"];var l=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"];var g=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"];var h=a.effects.setMode(d,c.options.mode||"effect");var j=c.options.restore||false;var f=c.options.scale||"both";var p=c.options.origin;var e={height:d.height(),width:d.width()};d.from=c.options.from||e;d.to=c.options.to||e;if(p){var i=a.effects.getBaseline(p,e);d.from.top=(e.height-d.from.height)*i.y;d.from.left=(e.width-d.from.width)*i.x;d.to.top=(e.height-d.to.height)*i.y;d.to.left=(e.width-d.to.width)*i.x}var m={from:{y:d.from.height/e.height,x:d.from.width/e.width},to:{y:d.to.height/e.height,x:d.to.width/e.width}};if(f=="box"||f=="both"){if(m.from.y!=m.to.y){o=o.concat(l);d.from=a.effects.setTransition(d,l,m.from.y,d.from);d.to=a.effects.setTransition(d,l,m.to.y,d.to)}if(m.from.x!=m.to.x){o=o.concat(g);d.from=a.effects.setTransition(d,g,m.from.x,d.from);d.to=a.effects.setTransition(d,g,m.to.x,d.to)}}if(f=="content"||f=="both"){if(m.from.y!=m.to.y){o=o.concat(q);d.from=a.effects.setTransition(d,q,m.from.y,d.from);d.to=a.effects.setTransition(d,q,m.to.y,d.to)}}a.effects.save(d,j?o:n);d.show();a.effects.createWrapper(d);d.css("overflow","hidden").css(d.from);if(f=="content"||f=="both"){l=l.concat(["marginTop","marginBottom"]).concat(q);g=g.concat(["marginLeft","marginRight"]);k=o.concat(l).concat(g);d.find("*[width]").each(function(){child=a(this);if(j){a.effects.save(child,k)}var r={height:child.height(),width:child.width()};child.from={height:r.height*m.from.y,width:r.width*m.from.x};child.to={height:r.height*m.to.y,width:r.width*m.to.x};if(m.from.y!=m.to.y){child.from=a.effects.setTransition(child,l,m.from.y,child.from);child.to=a.effects.setTransition(child,l,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=a.effects.setTransition(child,g,m.from.x,child.from);child.to=a.effects.setTransition(child,g,m.to.x,child.to)}child.css(child.from);child.animate(child.to,c.duration,c.options.easing,function(){if(j){a.effects.restore(child,k)}})})}d.animate(d.to,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(d.to.opacity===0){d.css("opacity",d.from.opacity)}if(h=="hide"){d.hide()}a.effects.restore(d,j?o:n);a.effects.removeWrapper(d);if(c.callback){c.callback.apply(this,arguments)}d.dequeue()}})})}})(jQuery);(function(a,b){a.effects.shake=function(c){return this.queue(function(){var f=a(this),m=["position","top","bottom","left","right"];var l=a.effects.setMode(f,c.options.mode||"effect");var o=c.options.direction||"left";var d=c.options.distance||20;var e=c.options.times||3;var h=c.duration||c.options.duration||140;a.effects.save(f,m);f.show();a.effects.createWrapper(f);var g=(o=="up"||o=="down")?"top":"left";var q=(o=="up"||o=="left")?"pos":"neg";var j={},p={},n={};j[g]=(q=="pos"?"-=":"+=")+d;p[g]=(q=="pos"?"+=":"-=")+d*2;n[g]=(q=="pos"?"-=":"+=")+d*2;f.animate(j,h,c.options.easing);for(var k=1;k<e;k++){f.animate(p,h,c.options.easing).animate(n,h,c.options.easing)}f.animate(p,h,c.options.easing).animate(j,h/2,c.options.easing,function(){a.effects.restore(f,m);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}});f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery);(function(a,b){a.effects.slide=function(c){return this.queue(function(){var f=a(this),e=["position","top","bottom","left","right"];var j=a.effects.setMode(f,c.options.mode||"show");var i=c.options.direction||"left";a.effects.save(f,e);f.show();a.effects.createWrapper(f).css({overflow:"hidden"});var g=(i=="up"||i=="down")?"top":"left";var d=(i=="up"||i=="left")?"pos":"neg";var k=c.options.distance||(g=="top"?f.outerHeight({margin:true}):f.outerWidth({margin:true}));if(j=="show"){f.css(g,d=="pos"?(isNaN(k)?"-"+k:-k):k)}var h={};h[g]=(j=="show"?(d=="pos"?"+=":"-="):(d=="pos"?"-=":"+="))+k;f.animate(h,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(j=="hide"){f.hide()}a.effects.restore(f,e);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}f.dequeue()}})})}})(jQuery);(function(a,b){a.effects.transfer=function(c){return this.queue(function(){var g=a(this),i=a(c.options.to),f=i.offset(),h={top:f.top,left:f.left,height:i.innerHeight(),width:i.innerWidth()},e=g.offset(),d=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(c.options.className).css({top:e.top,left:e.left,height:g.innerHeight(),width:g.innerWidth(),position:"absolute"}).animate(h,c.duration,c.options.easing,function(){d.remove();(c.callback&&c.callback.apply(g[0],arguments));g.dequeue()})})}})(jQuery);
\ No newline at end of file
+(function(b,c){var a=false;b(document).mousedown(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(f,g){f.ui=f.ui||{};var d=/left|center|right/,e=/top|center|bottom/,a="center",b=f.fn.position,c=f.fn.offset;f.fn.position=function(i){if(!i||!i.of){return b.apply(this,arguments)}i=f.extend({},i);var m=f(i.of),l=m[0],o=(i.collision||"flip").split(" "),n=i.offset?i.offset.split(" "):[0,0],k,h,j;if(l.nodeType===9){k=m.width();h=m.height();j={top:0,left:0}}else{if(l.setTimeout){k=m.width();h=m.height();j={top:m.scrollTop(),left:m.scrollLeft()}}else{if(l.preventDefault){i.at="left top";k=h=0;j={top:i.of.pageY,left:i.of.pageX}}else{k=m.outerWidth();h=m.outerHeight();j=m.offset()}}}f.each(["my","at"],function(){var p=(i[this]||"").split(" ");if(p.length===1){p=d.test(p[0])?p.concat([a]):e.test(p[0])?[a].concat(p):[a,a]}p[0]=d.test(p[0])?p[0]:a;p[1]=e.test(p[1])?p[1]:a;i[this]=p});if(o.length===1){o[1]=o[0]}n[0]=parseInt(n[0],10)||0;if(n.length===1){n[1]=n[0]}n[1]=parseInt(n[1],10)||0;if(i.at[0]==="right"){j.left+=k}else{if(i.at[0]===a){j.left+=k/2}}if(i.at[1]==="bottom"){j.top+=h}else{if(i.at[1]===a){j.top+=h/2}}j.left+=n[0];j.top+=n[1];return this.each(function(){var s=f(this),v=s.outerWidth(),r=s.outerHeight(),u=parseInt(f.curCSS(this,"marginLeft",true))||0,q=parseInt(f.curCSS(this,"marginTop",true))||0,x=v+u+(parseInt(f.curCSS(this,"marginRight",true))||0),y=r+q+(parseInt(f.curCSS(this,"marginBottom",true))||0),w=f.extend({},j),p;if(i.my[0]==="right"){w.left-=v}else{if(i.my[0]===a){w.left-=v/2}}if(i.my[1]==="bottom"){w.top-=r}else{if(i.my[1]===a){w.top-=r/2}}w.left=Math.round(w.left);w.top=Math.round(w.top);p={left:w.left-u,top:w.top-q};f.each(["left","top"],function(A,z){if(f.ui.position[o[A]]){f.ui.position[o[A]][z](w,{targetWidth:k,targetHeight:h,elemWidth:v,elemHeight:r,collisionPosition:p,collisionWidth:x,collisionHeight:y,offset:n,my:i.my,at:i.at})}});if(f.fn.bgiframe){s.bgiframe()}s.offset(f.extend(w,{using:i.using}))})};f.ui.position={fit:{left:function(h,i){var k=f(window),j=i.collisionPosition.left+i.collisionWidth-k.width()-k.scrollLeft();h.left=j>0?h.left-j:Math.max(h.left-i.collisionPosition.left,h.left)},top:function(h,i){var k=f(window),j=i.collisionPosition.top+i.collisionHeight-k.height()-k.scrollTop();h.top=j>0?h.top-j:Math.max(h.top-i.collisionPosition.top,h.top)}},flip:{left:function(i,k){if(k.at[0]===a){return}var m=f(window),l=k.collisionPosition.left+k.collisionWidth-m.width()-m.scrollLeft(),h=k.my[0]==="left"?-k.elemWidth:k.my[0]==="right"?k.elemWidth:0,j=k.at[0]==="left"?k.targetWidth:-k.targetWidth,n=-2*k.offset[0];i.left+=k.collisionPosition.left<0?h+j+n:l>0?h+j+n:0},top:function(i,k){if(k.at[1]===a){return}var m=f(window),l=k.collisionPosition.top+k.collisionHeight-m.height()-m.scrollTop(),h=k.my[1]==="top"?-k.elemHeight:k.my[1]==="bottom"?k.elemHeight:0,j=k.at[1]==="top"?k.targetHeight:-k.targetHeight,n=-2*k.offset[1];i.top+=k.collisionPosition.top<0?h+j+n:l>0?h+j+n:0}}};if(!f.offset.setOffset){f.offset.setOffset=function(l,i){if(/static/.test(f.curCSS(l,"position"))){l.style.position="relative"}var k=f(l),n=k.offset(),h=parseInt(f.curCSS(l,"top",true),10)||0,m=parseInt(f.curCSS(l,"left",true),10)||0,j={top:(i.top-n.top)+h,left:(i.left-n.left)+m};if("using" in i){i.using.call(l,j)}else{k.css(j)}};f.fn.offset=function(h){var i=this[0];if(!i||!i.ownerDocument){return null}if(h){return this.each(function(){f.offset.setOffset(this,h)})}return c.call(this)}}}(jQuery));(function(a,b){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this},_mouseCapture:function(c){var d=this.options;if(this.helper||d.disabled||a(c.target).is(".ui-resizable-handle")){return false}this.handle=this._getHandle(c);if(!this.handle){return false}a(d.iframeFix===true?"iframe":d.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")});return true},_mouseStart:function(c){var d=this.options;this.helper=this._createHelper(c);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;(d.cursorAt&&this._adjustOffsetFromHelper(d.cursorAt));if(d.containment){this._setContainment()}if(this._trigger("start",c)===false){this._clear();return false}this._cacheHelperProportions();if(a.ui.ddmanager&&!d.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,c)}this.helper.addClass("ui-draggable-dragging");this._mouseDrag(c,true);if(a.ui.ddmanager){a.ui.ddmanager.dragStart(this,c)}return true},_mouseDrag:function(c,e){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");if(!e){var d=this._uiHash();if(this._trigger("drag",c,d)===false){this._mouseUp({});return false}this.position=d.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,c)}return false},_mouseStop:function(d){var e=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){e=a.ui.ddmanager.drop(this,d)}if(this.dropped){e=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original"){return false}if((this.options.revert=="invalid"&&!e)||(this.options.revert=="valid"&&e)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,e))){var c=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){if(c._trigger("stop",d)!==false){c._clear()}})}else{if(this._trigger("stop",d)!==false){this._clear()}}return false},_mouseUp:function(c){if(this.options.iframeFix===true){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}if(a.ui.ddmanager){a.ui.ddmanager.dragStop(this,c)}return a.ui.mouse.prototype._mouseUp.call(this,c)},cancel:function(){if(this.helper.is(".ui-draggable-dragging")){this._mouseUp({})}else{this._clear()}return this},_getHandle:function(c){var d=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==c.target){d=true}});return d},_createHelper:function(d){var e=this.options;var c=a.isFunction(e.helper)?a(e.helper.apply(this.element[0],[d])):(e.helper=="clone"?this.element.clone().removeAttr("id"):this.element);if(!c.parents("body").length){c.appendTo((e.appendTo=="parent"?this.element[0].parentNode:e.appendTo))}if(c[0]!=this.element[0]&&!(/(fixed|absolute)/).test(c.css("position"))){c.css("position","absolute")}return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string"){c=c.split(" ")}if(a.isArray(c)){c={left:+c[0],top:+c[1]||0}}if("left" in c){this.offset.click.left=c.left+this.margins.left}if("right" in c){this.offset.click.left=this.helperProportions.width-c.right+this.margins.left}if("top" in c){this.offset.click.top=c.top+this.margins.top}if("bottom" in c){this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){c={top:0,left:0}}return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.element.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0),right:(parseInt(this.element.css("marginRight"),10)||0),bottom:(parseInt(this.element.css("marginBottom"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var g=this.options;if(g.containment=="parent"){g.containment=this.helper[0].parentNode}if(g.containment=="document"||g.containment=="window"){this.containment=[g.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,g.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(g.containment=="document"?0:a(window).scrollLeft())+a(g.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(g.containment=="document"?0:a(window).scrollTop())+(a(g.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(g.containment)&&g.containment.constructor!=Array){var h=a(g.containment);var e=h[0];if(!e){return}var f=h.offset();var d=(a(e).css("overflow")!="hidden");this.containment=[(parseInt(a(e).css("borderLeftWidth"),10)||0)+(parseInt(a(e).css("paddingLeft"),10)||0),(parseInt(a(e).css("borderTopWidth"),10)||0)+(parseInt(a(e).css("paddingTop"),10)||0),(d?Math.max(e.scrollWidth,e.offsetWidth):e.offsetWidth)-(parseInt(a(e).css("borderLeftWidth"),10)||0)-(parseInt(a(e).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(d?Math.max(e.scrollHeight,e.offsetHeight):e.offsetHeight)-(parseInt(a(e).css("borderTopWidth"),10)||0)-(parseInt(a(e).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=h}else{if(g.containment.constructor==Array){this.containment=g.containment}}},_convertPositionTo:function(g,i){if(!i){i=this.position}var e=g=="absolute"?1:-1;var f=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=(/(html|body)/i).test(c[0].tagName);return{top:(i.top+this.offset.relative.top*e+this.offset.parent.top*e-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(h?0:c.scrollTop()))*e)),left:(i.left+this.offset.relative.left*e+this.offset.parent.left*e-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:c.scrollLeft())*e))}},_generatePosition:function(d){var e=this.options,l=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(l[0].tagName);var h=d.pageX;var g=d.pageY;if(this.originalPosition){var c;if(this.containment){if(this.relative_container){var k=this.relative_container.offset();c=[this.containment[0]+k.left,this.containment[1]+k.top,this.containment[2]+k.left,this.containment[3]+k.top]}else{c=this.containment}if(d.pageX-this.offset.click.left<c[0]){h=c[0]+this.offset.click.left}if(d.pageY-this.offset.click.top<c[1]){g=c[1]+this.offset.click.top}if(d.pageX-this.offset.click.left>c[2]){h=c[2]+this.offset.click.left}if(d.pageY-this.offset.click.top>c[3]){g=c[3]+this.offset.click.top}}if(e.grid){var j=e.grid[1]?this.originalPageY+Math.round((g-this.originalPageY)/e.grid[1])*e.grid[1]:this.originalPageY;g=c?(!(j-this.offset.click.top<c[1]||j-this.offset.click.top>c[3])?j:(!(j-this.offset.click.top<c[1])?j-e.grid[1]:j+e.grid[1])):j;var f=e.grid[0]?this.originalPageX+Math.round((h-this.originalPageX)/e.grid[0])*e.grid[0]:this.originalPageX;h=c?(!(f-this.offset.click.left<c[0]||f-this.offset.click.left>c[2])?f:(!(f-this.offset.click.left<c[0])?f-e.grid[0]:f+e.grid[0])):f}}return{top:(g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:l.scrollTop())))),left:(h-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:l.scrollLeft())))}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval){this.helper.remove()}this.helper=null;this.cancelHelperRemoval=false},_trigger:function(c,d,e){e=e||this._uiHash();a.ui.plugin.call(this,c,[d,e]);if(c=="drag"){this.positionAbs=this._convertPositionTo("absolute")}return a.Widget.prototype._trigger.call(this,c,d,e)},plugins:{},_uiHash:function(c){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});a.extend(a.ui.draggable,{version:"1.8.14"});a.ui.plugin.add("draggable","connectToSortable",{start:function(d,f){var e=a(this).data("draggable"),g=e.options,c=a.extend({},f,{item:e.element});e.sortables=[];a(g.connectToSortable).each(function(){var h=a.data(this,"sortable");if(h&&!h.options.disabled){e.sortables.push({instance:h,shouldRevert:h.options.revert});h.refreshPositions();h._trigger("activate",d,c)}})},stop:function(d,f){var e=a(this).data("draggable"),c=a.extend({},f,{item:e.element});a.each(e.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;e.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert){this.instance.options.revert=true}this.instance._mouseStop(d);this.instance.options.helper=this.instance.options._helper;if(e.options.helper=="original"){this.instance.currentItem.css({top:"auto",left:"auto"})}}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",d,c)}})},drag:function(d,g){var f=a(this).data("draggable"),c=this;var e=function(j){var p=this.offset.click.top,n=this.offset.click.left;var h=this.positionAbs.top,l=this.positionAbs.left;var k=j.height,m=j.width;var q=j.top,i=j.left;return a.ui.isOver(h+p,l+n,q,i,k,m)};a.each(f.sortables,function(h){this.instance.positionAbs=f.positionAbs;this.instance.helperProportions=f.helperProportions;this.instance.offset.click=f.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(c).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return g.helper[0]};d.target=this.instance.currentItem[0];this.instance._mouseCapture(d,true);this.instance._mouseStart(d,true,true);this.instance.offset.click.top=f.offset.click.top;this.instance.offset.click.left=f.offset.click.left;this.instance.offset.parent.left-=f.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=f.offset.parent.top-this.instance.offset.parent.top;f._trigger("toSortable",d);f.dropped=this.instance.element;f.currentItem=f.element;this.instance.fromOutside=f}if(this.instance.currentItem){this.instance._mouseDrag(d)}}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",d,this.instance._uiHash(this.instance));this.instance._mouseStop(d,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder){this.instance.placeholder.remove()}f._trigger("fromSortable",d);f.dropped=false}}})}});a.ui.plugin.add("draggable","cursor",{start:function(d,e){var c=a("body"),f=a(this).data("draggable").options;if(c.css("cursor")){f._cursor=c.css("cursor")}c.css("cursor",f.cursor)},stop:function(c,d){var e=a(this).data("draggable").options;if(e._cursor){a("body").css("cursor",e._cursor)}}});a.ui.plugin.add("draggable","opacity",{start:function(d,e){var c=a(e.helper),f=a(this).data("draggable").options;if(c.css("opacity")){f._opacity=c.css("opacity")}c.css("opacity",f.opacity)},stop:function(c,d){var e=a(this).data("draggable").options;if(e._opacity){a(d.helper).css("opacity",e._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(d,e){var c=a(this).data("draggable");if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){c.overflowOffset=c.scrollParent.offset()}},drag:function(e,f){var d=a(this).data("draggable"),g=d.options,c=false;if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML"){if(!g.axis||g.axis!="x"){if((d.overflowOffset.top+d.scrollParent[0].offsetHeight)-e.pageY<g.scrollSensitivity){d.scrollParent[0].scrollTop=c=d.scrollParent[0].scrollTop+g.scrollSpeed}else{if(e.pageY-d.overflowOffset.top<g.scrollSensitivity){d.scrollParent[0].scrollTop=c=d.scrollParent[0].scrollTop-g.scrollSpeed}}}if(!g.axis||g.axis!="y"){if((d.overflowOffset.left+d.scrollParent[0].offsetWidth)-e.pageX<g.scrollSensitivity){d.scrollParent[0].scrollLeft=c=d.scrollParent[0].scrollLeft+g.scrollSpeed}else{if(e.pageX-d.overflowOffset.left<g.scrollSensitivity){d.scrollParent[0].scrollLeft=c=d.scrollParent[0].scrollLeft-g.scrollSpeed}}}}else{if(!g.axis||g.axis!="x"){if(e.pageY-a(document).scrollTop()<g.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()-g.scrollSpeed)}else{if(a(window).height()-(e.pageY-a(document).scrollTop())<g.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()+g.scrollSpeed)}}}if(!g.axis||g.axis!="y"){if(e.pageX-a(document).scrollLeft()<g.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()-g.scrollSpeed)}else{if(a(window).width()-(e.pageX-a(document).scrollLeft())<g.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()+g.scrollSpeed)}}}}if(c!==false&&a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(d,e)}}});a.ui.plugin.add("draggable","snap",{start:function(d,e){var c=a(this).data("draggable"),f=c.options;c.snapElements=[];a(f.snap.constructor!=String?(f.snap.items||":data(draggable)"):f.snap).each(function(){var h=a(this);var g=h.offset();if(this!=c.element[0]){c.snapElements.push({item:this,width:h.outerWidth(),height:h.outerHeight(),top:g.top,left:g.left})}})},drag:function(u,p){var g=a(this).data("draggable"),q=g.options;var y=q.snapTolerance;var x=p.offset.left,w=x+g.helperProportions.width,f=p.offset.top,e=f+g.helperProportions.height;for(var v=g.snapElements.length-1;v>=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y<x&&x<n+y&&m-y<f&&f<A+y)||(s-y<x&&x<n+y&&m-y<e&&e<A+y)||(s-y<w&&w<n+y&&m-y<f&&f<A+y)||(s-y<w&&w<n+y&&m-y<e&&e<A+y))){if(g.snapElements[v].snapping){(g.options.snap.release&&g.options.snap.release.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=false;continue}if(q.snapMode!="inner"){var c=Math.abs(m-e)<=y;var z=Math.abs(A-f)<=y;var j=Math.abs(s-w)<=y;var k=Math.abs(n-x)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s-g.helperProportions.width}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n}).left-g.margins.left}}var h=(c||z||j||k);if(q.snapMode!="outer"){var c=Math.abs(m-f)<=y;var z=Math.abs(A-e)<=y;var j=Math.abs(s-x)<=y;var k=Math.abs(n-w)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A-g.helperProportions.height,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n-g.helperProportions.width}).left-g.margins.left}}if(!g.snapElements[v].snapping&&(c||z||j||k||h)){(g.options.snap.snap&&g.options.snap.snap.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=(c||z||j||k||h)}}});a.ui.plugin.add("draggable","stack",{start:function(d,e){var g=a(this).data("draggable").options;var f=a.makeArray(a(g.stack)).sort(function(i,h){return(parseInt(a(i).css("zIndex"),10)||0)-(parseInt(a(h).css("zIndex"),10)||0)});if(!f.length){return}var c=parseInt(f[0].style.zIndex)||0;a(f).each(function(h){this.style.zIndex=c+h});this[0].style.zIndex=c+f.length}});a.ui.plugin.add("draggable","zIndex",{start:function(d,e){var c=a(e.helper),f=a(this).data("draggable").options;if(c.css("zIndex")){f._zIndex=c.css("zIndex")}c.css("zIndex",f.zIndex)},stop:function(c,d){var e=a(this).data("draggable").options;if(e._zIndex){a(d.helper).css("zIndex",e._zIndex)}}})})(jQuery);(function(a,b){a.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var d=this.options,c=d.accept;this.isover=0;this.isout=1;this.accept=a.isFunction(c)?c:function(e){return e.is(c)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};a.ui.ddmanager.droppables[d.scope]=a.ui.ddmanager.droppables[d.scope]||[];a.ui.ddmanager.droppables[d.scope].push(this);(d.addClasses&&this.element.addClass("ui-droppable"))},destroy:function(){var c=a.ui.ddmanager.droppables[this.options.scope];for(var d=0;d<c.length;d++){if(c[d]==this){c.splice(d,1)}}this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(c,d){if(c=="accept"){this.accept=a.isFunction(d)?d:function(e){return e.is(d)}}a.Widget.prototype._setOption.apply(this,arguments)},_activate:function(d){var c=a.ui.ddmanager.current;if(this.options.activeClass){this.element.addClass(this.options.activeClass)}(c&&this._trigger("activate",d,this.ui(c)))},_deactivate:function(d){var c=a.ui.ddmanager.current;if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}(c&&this._trigger("deactivate",d,this.ui(c)))},_over:function(d){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0]){return}if(this.accept.call(this.element[0],(c.currentItem||c.element))){if(this.options.hoverClass){this.element.addClass(this.options.hoverClass)}this._trigger("over",d,this.ui(c))}},_out:function(d){var c=a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0]){return}if(this.accept.call(this.element[0],(c.currentItem||c.element))){if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("out",d,this.ui(c))}},_drop:function(d,e){var c=e||a.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0]){return false}var f=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=a.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],(c.currentItem||c.element))&&a.ui.intersect(c,a.extend(g,{offset:g.element.offset()}),g.options.tolerance)){f=true;return false}});if(f){return false}if(this.accept.call(this.element[0],(c.currentItem||c.element))){if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("drop",d,this.ui(c));return this.element}return false},ui:function(d){return{draggable:(d.currentItem||d.element),helper:d.helper,position:d.position,offset:d.positionAbs}}});a.extend(a.ui.droppable,{version:"1.8.14"});a.ui.intersect=function(q,j,o){if(!j.offset){return false}var e=(q.positionAbs||q.position.absolute).left,d=e+q.helperProportions.width,n=(q.positionAbs||q.position.absolute).top,m=n+q.helperProportions.height;var g=j.offset.left,c=g+j.proportions.width,p=j.offset.top,k=p+j.proportions.height;switch(o){case"fit":return(g<=e&&d<=c&&p<=n&&m<=k);break;case"intersect":return(g<e+(q.helperProportions.width/2)&&d-(q.helperProportions.width/2)<c&&p<n+(q.helperProportions.height/2)&&m-(q.helperProportions.height/2)<k);break;case"pointer":var h=((q.positionAbs||q.position.absolute).left+(q.clickOffset||q.offset.click).left),i=((q.positionAbs||q.position.absolute).top+(q.clickOffset||q.offset.click).top),f=a.ui.isOver(i,h,p,g,j.proportions.height,j.proportions.width);return f;break;case"touch":return((n>=p&&n<=k)||(m>=p&&m<=k)||(n<p&&m>k))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(e<g&&d>c));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(f,h){var c=a.ui.ddmanager.droppables[f.options.scope]||[];var g=h?h.type:null;var k=(f.currentItem||f.element).find(":data(droppable)").andSelf();droppablesLoop:for(var e=0;e<c.length;e++){if(c[e].options.disabled||(f&&!c[e].accept.call(c[e].element[0],(f.currentItem||f.element)))){continue}for(var d=0;d<k.length;d++){if(k[d]==c[e].element[0]){c[e].proportions.height=0;continue droppablesLoop}}c[e].visible=c[e].element.css("display")!="none";if(!c[e].visible){continue}if(g=="mousedown"){c[e]._activate.call(c[e],h)}c[e].offset=c[e].element.offset();c[e].proportions={width:c[e].element[0].offsetWidth,height:c[e].element[0].offsetHeight}}},drop:function(c,d){var e=false;a.each(a.ui.ddmanager.droppables[c.options.scope]||[],function(){if(!this.options){return}if(!this.options.disabled&&this.visible&&a.ui.intersect(c,this,this.options.tolerance)){e=e||this._drop.call(this,d)}if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],(c.currentItem||c.element))){this.isout=1;this.isover=0;this._deactivate.call(this,d)}});return e},dragStart:function(c,d){c.element.parentsUntil("body").bind("scroll.droppable",function(){if(!c.options.refreshPositions){a.ui.ddmanager.prepareOffsets(c,d)}})},drag:function(c,d){if(c.options.refreshPositions){a.ui.ddmanager.prepareOffsets(c,d)}a.each(a.ui.ddmanager.droppables[c.options.scope]||[],function(){if(this.options.disabled||this.greedyChild||!this.visible){return}var f=a.ui.intersect(c,this,this.options.tolerance);var h=!f&&this.isover==1?"isout":(f&&this.isover==0?"isover":null);if(!h){return}var g;if(this.options.greedy){var e=this.element.parents(":data(droppable):eq(0)");if(e.length){g=a.data(e[0],"droppable");g.greedyChild=(h=="isover"?1:0)}}if(g&&h=="isover"){g.isover=0;g.isout=1;g._out.call(g,d)}this[h]=1;this[h=="isout"?"isover":"isout"]=0;this[h=="isover"?"_over":"_out"].call(this,d);if(g&&h=="isout"){g.isout=0;g.isover=1;g._over.call(g,d)}})},dragStop:function(c,d){c.element.parentsUntil("body").unbind("scroll.droppable");if(!c.options.refreshPositions){a.ui.ddmanager.prepareOffsets(c,d)}}}})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&c.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}if(c.browser.opera&&(/relative/).test(e.css("position"))){e.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,u=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(u){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(u&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.14"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10),position:k.css("position")})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,v){var u=(r[v]||0)+(k[v]||0);if(u&&u>=0){p[v]=u||null}});if(c.browser.opera&&/relative/.test(q.css("position"))){f._revertToRelativePosition=true;q.css({position:"absolute",top:"auto",left:"auto"})}q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(g,h){var f=c(this).data("resizable"),i=f.options;var e=function(j){c(j).each(function(){var k=c(this);k.css({position:k.data("resizable-alsoresize").position})})};if(f._revertToRelativePosition){f._revertToRelativePosition=false;if(typeof(i.alsoResize)=="object"&&!i.alsoResize.nodeType){c.each(i.alsoResize,function(j){e(j)})}else{e(i.alsoResize)}}c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var u=c(this).data("resizable"),j=u.options,l=u.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}u.containerElement=c(k);if(/document/.test(g)||g==document){u.containerOffset={left:0,top:0};u.containerPosition={left:0,top:0};u.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});u.containerOffset=n.offset();u.containerPosition=n.position();u.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=u.containerOffset,e=u.containerSize.height,m=u.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);u.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var u=c(this).data("resizable"),i=u.options,f=u.containerSize,p=u.containerOffset,m=u.size,n=u.position,r=u._aspectRatio||g.shiftKey,e={top:0,left:0},h=u.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(u._helper?p.left:0)){u.size.width=u.size.width+(u._helper?(u.position.left-p.left):(u.position.left-e.left));if(r){u.size.height=u.size.width/i.aspectRatio}u.position.left=i.helper?p.left:0}if(n.top<(u._helper?p.top:0)){u.size.height=u.size.height+(u._helper?(u.position.top-p.top):u.position.top);if(r){u.size.width=u.size.height*i.aspectRatio}u.position.top=u._helper?p.top:0}u.offset.left=u.parentData.left+u.position.left;u.offset.top=u.parentData.top+u.position.top;var l=Math.abs((u._helper?u.offset.left-e.left:(u.offset.left-e.left))+u.sizeDiff.width),s=Math.abs((u._helper?u.offset.top-e.top:(u.offset.top-p.top))+u.sizeDiff.height);var k=u.containerElement.get(0)==u.element.parent().get(0),j=/relative|absolute/.test(u.containerElement.css("position"));if(k&&j){l-=u.parentData.left}if(l+u.size.width>=u.parentData.width){u.size.width=u.parentData.width-l;if(r){u.size.height=u.size.width/u.aspectRatio}}if(s+u.size.height>=u.parentData.height){u.size.height=u.parentData.height-s;if(r){u.size.width=u.size.height*u.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);(function(a,b){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var d;this.refresh=function(){d=a(c.options.filter,c.element[0]);d.each(function(){var e=a(this);var f=e.offset();a.data(this,"selectable-item",{element:this,$element:e,left:f.left,top:f.top,right:f.left+e.outerWidth(),bottom:f.top+e.outerHeight(),startselected:false,selected:e.hasClass("ui-selected"),selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})};this.refresh();this.selectees=d.addClass("ui-selectee");this._mouseInit();this.helper=a("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(e){var c=this;this.opos=[e.pageX,e.pageY];if(this.options.disabled){return}var d=this.options;this.selectees=a(d.filter,this.element[0]);this._trigger("start",e);a(d.appendTo).append(this.helper);this.helper.css({left:e.clientX,top:e.clientY,width:0,height:0});if(d.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var f=a.data(this,"selectable-item");f.startselected=true;if(!e.metaKey){f.$element.removeClass("ui-selected");f.selected=false;f.$element.addClass("ui-unselecting");f.unselecting=true;c._trigger("unselecting",e,{unselecting:f.element})}});a(e.target).parents().andSelf().each(function(){var g=a.data(this,"selectable-item");if(g){var f=!e.metaKey||!g.$element.hasClass("ui-selected");g.$element.removeClass(f?"ui-unselecting":"ui-selected").addClass(f?"ui-selecting":"ui-unselecting");g.unselecting=!f;g.selecting=f;g.selected=f;if(f){c._trigger("selecting",e,{selecting:g.element})}else{c._trigger("unselecting",e,{unselecting:g.element})}return false}})},_mouseDrag:function(j){var d=this;this.dragged=true;if(this.options.disabled){return}var f=this.options;var e=this.opos[0],i=this.opos[1],c=j.pageX,h=j.pageY;if(e>c){var g=c;c=e;e=g}if(i>h){var g=h;h=i;i=g}this.helper.css({left:e,top:i,width:c-e,height:h-i});this.selectees.each(function(){var k=a.data(this,"selectable-item");if(!k||k.element==d.element[0]){return}var l=false;if(f.tolerance=="touch"){l=(!(k.left>c||k.right<e||k.top>h||k.bottom<i))}else{if(f.tolerance=="fit"){l=(k.left>e&&k.right<c&&k.top>i&&k.bottom<h)}}if(l){if(k.selected){k.$element.removeClass("ui-selected");k.selected=false}if(k.unselecting){k.$element.removeClass("ui-unselecting");k.unselecting=false}if(!k.selecting){k.$element.addClass("ui-selecting");k.selecting=true;d._trigger("selecting",j,{selecting:k.element})}}else{if(k.selecting){if(j.metaKey&&k.startselected){k.$element.removeClass("ui-selecting");k.selecting=false;k.$element.addClass("ui-selected");k.selected=true}else{k.$element.removeClass("ui-selecting");k.selecting=false;if(k.startselected){k.$element.addClass("ui-unselecting");k.unselecting=true}d._trigger("unselecting",j,{unselecting:k.element})}}if(k.selected){if(!j.metaKey&&!k.startselected){k.$element.removeClass("ui-selected");k.selected=false;k.$element.addClass("ui-unselecting");k.unselecting=true;d._trigger("unselecting",j,{unselecting:k.element})}}}});return false},_mouseStop:function(e){var c=this;this.dragged=false;var d=this.options;a(".ui-unselecting",this.element[0]).each(function(){var f=a.data(this,"selectable-item");f.$element.removeClass("ui-unselecting");f.unselecting=false;f.startselected=false;c._trigger("unselected",e,{unselected:f.element})});a(".ui-selecting",this.element[0]).each(function(){var f=a.data(this,"selectable-item");f.$element.removeClass("ui-selecting").addClass("ui-selected");f.selecting=false;f.selected=true;f.startselected=true;c._trigger("selected",e,{selected:f.element})});this._trigger("stop",e);this.helper.remove();return false}});a.extend(a.ui.selectable,{version:"1.8.14"})})(jQuery);(function(a,b){a.widget("ui.sortable",a.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000},_create:function(){var c=this.options;this.containerCache={};this.element.addClass("ui-sortable");this.refresh();this.floating=this.items.length?c.axis==="x"||(/left|right/).test(this.items[0].item.css("float"))||(/inline|table-cell/).test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var c=this.items.length-1;c>=0;c--){this.items[c].item.removeData("sortable-item")}return this},_setOption:function(c,d){if(c==="disabled"){this.options[c]=d;this.widget()[d?"addClass":"removeClass"]("ui-sortable-disabled")}else{a.Widget.prototype._setOption.apply(this,arguments)}},_mouseCapture:function(f,g){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(f);var e=null,d=this,c=a(f.target).parents().each(function(){if(a.data(this,"sortable-item")==d){e=a(this);return false}});if(a.data(f.target,"sortable-item")==d){e=a(f.target)}if(!e){return false}if(this.options.handle&&!g){var h=false;a(this.options.handle,e).find("*").andSelf().each(function(){if(this==f.target){h=true}});if(!h){return false}}this.currentItem=e;this._removeCurrentsFromItems();return true},_mouseStart:function(f,g,c){var h=this.options,d=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(f);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:f.pageX-this.offset.left,top:f.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(f);this.originalPageX=f.pageX;this.originalPageY=f.pageY;(h.cursorAt&&this._adjustOffsetFromHelper(h.cursorAt));this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(h.containment){this._setContainment()}if(h.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",h.cursor)}if(h.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",h.opacity)}if(h.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",h.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",f,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!c){for(var e=this.containers.length-1;e>=0;e--){this.containers[e]._trigger("activate",f,d._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!h.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,f)}this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(f);return true},_mouseDrag:function(g){this.position=this._generatePosition(g);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var h=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-g.pageY<h.scrollSensitivity){this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+h.scrollSpeed}else{if(g.pageY-this.overflowOffset.top<h.scrollSensitivity){this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-h.scrollSpeed}}if((this.overflowOffset.left+this.scrollParent[0].offsetWidth)-g.pageX<h.scrollSensitivity){this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+h.scrollSpeed}else{if(g.pageX-this.overflowOffset.left<h.scrollSensitivity){this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-h.scrollSpeed}}}else{if(g.pageY-a(document).scrollTop()<h.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()-h.scrollSpeed)}else{if(a(window).height()-(g.pageY-a(document).scrollTop())<h.scrollSensitivity){c=a(document).scrollTop(a(document).scrollTop()+h.scrollSpeed)}}if(g.pageX-a(document).scrollLeft()<h.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()-h.scrollSpeed)}else{if(a(window).width()-(g.pageX-a(document).scrollLeft())<h.scrollSensitivity){c=a(document).scrollLeft(a(document).scrollLeft()+h.scrollSpeed)}}}if(c!==false&&a.ui.ddmanager&&!h.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,g)}}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}for(var e=this.items.length-1;e>=0;e--){var f=this.items[e],d=f.item[0],j=this._intersectsWithPointer(f);if(!j){continue}if(d!=this.currentItem[0]&&this.placeholder[j==1?"next":"prev"]()[0]!=d&&!a.ui.contains(this.placeholder[0],d)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],d):true)){this.direction=j==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f)){this._rearrange(g,f)}else{break}this._trigger("change",g,this._uiHash());break}}this._contactContainers(g);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,g)}this._trigger("sort",g,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,e){if(!d){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,d)}if(this.options.revert){var c=this;var f=c.placeholder.offset();c.reverting=true;a(this.helper).animate({left:f.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:f.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(d)})}else{this._clear(d,e)}return false},cancel:function(){var c=this;if(this.dragging){this._mouseUp({target:null});if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("deactivate",null,c._uiHash(this));if(this.containers[d].containerCache.over){this.containers[d]._trigger("out",null,c._uiHash(this));this.containers[d].containerCache.over=0}}}if(this.placeholder){if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}}return this},serialize:function(e){var c=this._getItemsAsjQuery(e&&e.connected);var d=[];e=e||{};a(c).each(function(){var f=(a(e.item||this).attr(e.attribute||"id")||"").match(e.expression||(/(.+)[-=_](.+)/));if(f){d.push((e.key||f[1]+"[]")+"="+(e.key&&e.expression?f[1]:f[2]))}});if(!d.length&&e.key){d.push(e.key+"=")}return d.join("&")},toArray:function(e){var c=this._getItemsAsjQuery(e&&e.connected);var d=[];e=e||{};c.each(function(){d.push(a(e.item||this).attr(e.attribute||"id")||"")});return d},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)<i&&(e+h)>f&&(e+h)<c;if(this.options.tolerance=="pointer"||this.options.forcePointerForContainers||(this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>m[this.floating?"width":"height"])){return g}else{return(f<e+(this.helperProportions.width/2)&&d-(this.helperProportions.width/2)<c&&n<k+(this.helperProportions.height/2)&&j-(this.helperProportions.height/2)<i)}},_intersectsWithPointer:function(e){var f=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,e.top,e.height),d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,e.left,e.width),h=f&&d,c=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();if(!h){return false}return this.floating?(((g&&g=="right")||c=="down")?2:1):(c&&(c=="down"?2:1))},_intersectsWithSides:function(f){var d=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,f.top+(f.height/2),f.height),e=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,f.left+(f.width/2),f.width),c=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();if(this.floating&&g){return((g=="right"&&e)||(g=="left"&&!e))}else{return c&&((c=="down"&&d)||(c=="up"&&!d))}},_getDragVerticalDirection:function(){var c=this.positionAbs.top-this.lastPositionAbs.top;return c!=0&&(c>0?"down":"up")},_getDragHorizontalDirection:function(){var c=this.positionAbs.left-this.lastPositionAbs.left;return c!=0&&(c>0?"right":"left")},refresh:function(c){this._refreshItems(c);this.refreshPositions();return this},_connectWith:function(){var c=this.options;return c.connectWith.constructor==String?[c.connectWith]:c.connectWith},_getItemsAsjQuery:function(c){var m=this;var h=[];var f=[];var k=this._connectWith();if(k&&c){for(var e=k.length-1;e>=0;e--){var l=a(k[e]);for(var d=l.length-1;d>=0;d--){var g=a.data(l[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element):a(g.options.items,g.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),g])}}}}f.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var e=f.length-1;e>=0;e--){f[e][0].each(function(){h.push(this)})}return a(h)},_removeCurrentsFromItems:function(){var e=this.currentItem.find(":data(sortable-item)");for(var d=0;d<this.items.length;d++){for(var c=0;c<e.length;c++){if(e[c]==this.items[d].item[0]){this.items.splice(d,1)}}}},_refreshItems:function(c){this.items=[];this.containers=[this];var k=this.items;var q=this;var g=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],c,{item:this.currentItem}):a(this.options.items,this.element),this]];var m=this._connectWith();if(m){for(var f=m.length-1;f>=0;f--){var n=a(m[f]);for(var e=n.length-1;e>=0;e--){var h=a.data(n[e],"sortable");if(h&&h!=this&&!h.options.disabled){g.push([a.isFunction(h.options.items)?h.options.items.call(h.element[0],c,{item:this.currentItem}):a(h.options.items,h.element),h]);this.containers.push(h)}}}}for(var f=g.length-1;f>=0;f--){var l=g[f][1];var d=g[f][0];for(var e=0,o=d.length;e<o;e++){var p=a(d[e]);p.data("sortable-item",l);k.push({item:p,instance:l,width:0,height:0,left:0,top:0})}}},refreshPositions:function(c){if(this.offsetParent&&this.helper){this.offset.parent=this._getParentOffset()}for(var e=this.items.length-1;e>=0;e--){var f=this.items[e];if(f.instance!=this.currentContainer&&this.currentContainer&&f.item[0]!=this.currentItem[0]){continue}var d=this.options.toleranceElement?a(this.options.toleranceElement,f.item):f.item;if(!c){f.width=d.outerWidth();f.height=d.outerHeight()}var g=d.offset();f.left=g.left;f.top=g.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var e=this.containers.length-1;e>=0;e--){var g=this.containers[e].element.offset();this.containers[e].containerCache.left=g.left;this.containers[e].containerCache.top=g.top;this.containers[e].containerCache.width=this.containers[e].element.outerWidth();this.containers[e].containerCache.height=this.containers[e].element.outerHeight()}}return this},_createPlaceholder:function(e){var c=e||this,f=c.options;if(!f.placeholder||f.placeholder.constructor==String){var d=f.placeholder;f.placeholder={element:function(){var g=a(document.createElement(c.currentItem[0].nodeName)).addClass(d||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!d){g.style.visibility="hidden"}return g},update:function(g,h){if(d&&!f.forcePlaceholderSize){return}if(!h.height()){h.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10))}if(!h.width()){h.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||0,10))}}}}c.placeholder=a(f.placeholder.element.call(c.element,c.currentItem));c.currentItem.after(c.placeholder);f.placeholder.update(c,c.placeholder)},_contactContainers:function(c){var e=null,l=null;for(var g=this.containers.length-1;g>=0;g--){if(a.ui.contains(this.currentItem[0],this.containers[g].element[0])){continue}if(this._intersectsWith(this.containers[g].containerCache)){if(e&&a.ui.contains(this.containers[g].element[0],e.element[0])){continue}e=this.containers[g];l=g}else{if(this.containers[g].containerCache.over){this.containers[g]._trigger("out",c,this._uiHash(this));this.containers[g].containerCache.over=0}}}if(!e){return}if(this.containers.length===1){this.containers[l]._trigger("over",c,this._uiHash(this));this.containers[l].containerCache.over=1}else{if(this.currentContainer!=this.containers[l]){var k=10000;var h=null;var d=this.positionAbs[this.containers[l].floating?"left":"top"];for(var f=this.items.length-1;f>=0;f--){if(!a.ui.contains(this.containers[l].element[0],this.items[f].item[0])){continue}var m=this.items[f][this.containers[l].floating?"left":"top"];if(Math.abs(m-d)<k){k=Math.abs(m-d);h=this.items[f]}}if(!h&&!this.options.dropOnEmpty){return}this.currentContainer=this.containers[l];h?this._rearrange(c,h,null,true):this._rearrange(c,null,this.containers[l].element,true);this._trigger("change",c,this._uiHash());this.containers[l]._trigger("change",c,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[l]._trigger("over",c,this._uiHash(this));this.containers[l].containerCache.over=1}}},_createHelper:function(d){var e=this.options;var c=a.isFunction(e.helper)?a(e.helper.apply(this.element[0],[d,this.currentItem])):(e.helper=="clone"?this.currentItem.clone():this.currentItem);if(!c.parents("body").length){a(e.appendTo!="parent"?e.appendTo:this.currentItem[0].parentNode)[0].appendChild(c[0])}if(c[0]==this.currentItem[0]){this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}}if(c[0].style.width==""||e.forceHelperSize){c.width(this.currentItem.width())}if(c[0].style.height==""||e.forceHelperSize){c.height(this.currentItem.height())}return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string"){c=c.split(" ")}if(a.isArray(c)){c={left:+c[0],top:+c[1]||0}}if("left" in c){this.offset.click.left=c.left+this.margins.left}if("right" in c){this.offset.click.left=this.helperProportions.width-c.right+this.margins.left}if("top" in c){this.offset.click.top=c.top+this.margins.top}if("bottom" in c){this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){c={top:0,left:0}}return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.currentItem.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.currentItem.css("marginLeft"),10)||0),top:(parseInt(this.currentItem.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var f=this.options;if(f.containment=="parent"){f.containment=this.helper[0].parentNode}if(f.containment=="document"||f.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(f.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(f.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(f.containment)){var d=a(f.containment)[0];var e=a(f.containment).offset();var c=(a(d).css("overflow")!="hidden");this.containment=[e.left+(parseInt(a(d).css("borderLeftWidth"),10)||0)+(parseInt(a(d).css("paddingLeft"),10)||0)-this.margins.left,e.top+(parseInt(a(d).css("borderTopWidth"),10)||0)+(parseInt(a(d).css("paddingTop"),10)||0)-this.margins.top,e.left+(c?Math.max(d.scrollWidth,d.offsetWidth):d.offsetWidth)-(parseInt(a(d).css("borderLeftWidth"),10)||0)-(parseInt(a(d).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,e.top+(c?Math.max(d.scrollHeight,d.offsetHeight):d.offsetHeight)-(parseInt(a(d).css("borderTopWidth"),10)||0)-(parseInt(a(d).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(g,i){if(!i){i=this.position}var e=g=="absolute"?1:-1;var f=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=(/(html|body)/i).test(c[0].tagName);return{top:(i.top+this.offset.relative.top*e+this.offset.parent.top*e-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(h?0:c.scrollTop()))*e)),left:(i.left+this.offset.relative.left*e+this.offset.parent.left*e-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:c.scrollLeft())*e))}},_generatePosition:function(f){var i=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,j=(/(html|body)/i).test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var e=f.pageX;var d=f.pageY;if(this.originalPosition){if(this.containment){if(f.pageX-this.offset.click.left<this.containment[0]){e=this.containment[0]+this.offset.click.left}if(f.pageY-this.offset.click.top<this.containment[1]){d=this.containment[1]+this.offset.click.top}if(f.pageX-this.offset.click.left>this.containment[2]){e=this.containment[2]+this.offset.click.left}if(f.pageY-this.offset.click.top>this.containment[3]){d=this.containment[3]+this.offset.click.top}}if(i.grid){var h=this.originalPageY+Math.round((d-this.originalPageY)/i.grid[1])*i.grid[1];d=this.containment?(!(h-this.offset.click.top<this.containment[1]||h-this.offset.click.top>this.containment[3])?h:(!(h-this.offset.click.top<this.containment[1])?h-i.grid[1]:h+i.grid[1])):h;var g=this.originalPageX+Math.round((e-this.originalPageX)/i.grid[0])*i.grid[0];e=this.containment?(!(g-this.offset.click.left<this.containment[0]||g-this.offset.click.left>this.containment[2])?g:(!(g-this.offset.click.left<this.containment[0])?g-i.grid[0]:g+i.grid[0])):g}}return{top:(d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(j?0:c.scrollTop())))),left:(e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():j?0:c.scrollLeft())))}},_rearrange:function(h,g,d,f){d?d[0].appendChild(this.placeholder[0]):g.item[0].parentNode.insertBefore(this.placeholder[0],(this.direction=="down"?g.item[0]:g.item[0].nextSibling));this.counter=this.counter?++this.counter:1;var e=this,c=this.counter;window.setTimeout(function(){if(c==e.counter){e.refreshPositions(!f)}},0)},_clear:function(e,f){this.reverting=false;var g=[],c=this;if(!this._noFinalSort&&this.currentItem.parent().length){this.placeholder.before(this.currentItem)}this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var d in this._storedCSS){if(this._storedCSS[d]=="auto"||this._storedCSS[d]=="static"){this._storedCSS[d]=""}}this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}if(this.fromOutside&&!f){g.push(function(h){this._trigger("receive",h,this._uiHash(this.fromOutside))})}if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!f){g.push(function(h){this._trigger("update",h,this._uiHash())})}if(!a.ui.contains(this.element[0],this.currentItem[0])){if(!f){g.push(function(h){this._trigger("remove",h,this._uiHash())})}for(var d=this.containers.length-1;d>=0;d--){if(a.ui.contains(this.containers[d].element[0],this.currentItem[0])&&!f){g.push((function(h){return function(i){h._trigger("receive",i,this._uiHash(this))}}).call(this,this.containers[d]));g.push((function(h){return function(i){h._trigger("update",i,this._uiHash(this))}}).call(this,this.containers[d]))}}}for(var d=this.containers.length-1;d>=0;d--){if(!f){g.push((function(h){return function(i){h._trigger("deactivate",i,this._uiHash(this))}}).call(this,this.containers[d]))}if(this.containers[d].containerCache.over){g.push((function(h){return function(i){h._trigger("out",i,this._uiHash(this))}}).call(this,this.containers[d]));this.containers[d].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedOpacity)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!f){this._trigger("beforeStop",e,this._uiHash());for(var d=0;d<g.length;d++){g[d].call(this,e)}this._trigger("stop",e,this._uiHash())}return false}if(!f){this._trigger("beforeStop",e,this._uiHash())}this.placeholder[0].parentNode.removeChild(this.placeholder[0]);if(this.helper[0]!=this.currentItem[0]){this.helper.remove()}this.helper=null;if(!f){for(var d=0;d<g.length;d++){g[d].call(this,e)}this._trigger("stop",e,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){if(a.Widget.prototype._trigger.apply(this,arguments)===false){this.cancel()}},_uiHash:function(d){var c=d||this;return{helper:c.helper,placeholder:c.placeholder||a([]),position:c.position,originalPosition:c.originalPosition,offset:c.positionAbs,item:c.currentItem,sender:d?d.element:null}}});a.extend(a.ui.sortable,{version:"1.8.14"})})(jQuery);(function(a,b){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var c=this,d=c.options;c.running=0;c.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");c.headers=c.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){if(d.disabled){return}a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){if(d.disabled){return}a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){if(d.disabled){return}a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){if(d.disabled){return}a(this).removeClass("ui-state-focus")});c.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(d.navigation){var e=c.element.find("a").filter(d.navigationFilter).eq(0);if(e.length){var f=e.closest(".ui-accordion-header");if(f.length){c.active=f}else{c.active=e.closest(".ui-accordion-content").prev()}}}c.active=c._findActive(c.active||d.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");c.active.next().addClass("ui-accordion-content-active");c._createIcons();c.resize();c.element.attr("role","tablist");c.headers.attr("role","tab").bind("keydown.accordion",function(g){return c._keydown(g)}).next().attr("role","tabpanel");c.headers.not(c.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();if(!c.active.length){c.headers.eq(0).attr("tabIndex",0)}else{c.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0})}if(!a.browser.safari){c.headers.find("a").attr("tabIndex",-1)}if(d.event){c.headers.bind(d.event.split(" ").join(".accordion ")+".accordion",function(g){c._clickHandler.call(c,g,this);g.preventDefault()})}},_createIcons:function(){var c=this.options;if(c.icons){a("<span></span>").addClass("ui-icon "+c.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(c.icons.header).toggleClass(c.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var d=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(c.autoHeight||c.fillHeight){d.css("height","")}return a.Widget.prototype.destroy.call(this)},_setOption:function(c,d){a.Widget.prototype._setOption.apply(this,arguments);if(c=="active"){this.activate(d)}if(c=="icons"){this._destroyIcons();if(d){this._createIcons()}}if(c=="disabled"){this.headers.add(this.headers.next())[d?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")}},_keydown:function(f){if(this.options.disabled||f.altKey||f.ctrlKey){return}var g=a.ui.keyCode,e=this.headers.length,c=this.headers.index(f.target),d=false;switch(f.keyCode){case g.RIGHT:case g.DOWN:d=this.headers[(c+1)%e];break;case g.LEFT:case g.UP:d=this.headers[(c-1+e)%e];break;case g.SPACE:case g.ENTER:this._clickHandler({target:f.target},f.target);f.preventDefault()}if(d){a(f.target).attr("tabIndex",-1);a(d).attr("tabIndex",0);d.focus();return false}return true},resize:function(){var c=this.options,e;if(c.fillSpace){if(a.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}e=this.element.parent().height();if(a.browser.msie){this.element.parent().css("overflow",d)}this.headers.each(function(){e-=a(this).outerHeight(true)});this.headers.next().each(function(){a(this).height(Math.max(0,e-a(this).innerHeight()+a(this).height()))}).css("overflow","auto")}else{if(c.autoHeight){e=0;this.headers.next().each(function(){e=Math.max(e,a(this).height("").height())}).height(e)}}return this},activate:function(c){this.options.active=c;var d=this._findActive(c)[0];this._clickHandler({target:d},d);return this},_findActive:function(c){return c?typeof c==="number"?this.headers.filter(":eq("+c+")"):this.headers.not(this.headers.not(c)):c===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(c,g){var l=this.options;if(l.disabled){return}if(!c.target){if(!l.collapsible){return}this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(l.icons.headerSelected).addClass(l.icons.header);this.active.next().addClass("ui-accordion-content-active");var i=this.active.next(),f={options:l,newHeader:a([]),oldHeader:l.active,newContent:a([]),oldContent:i},d=(this.active=a([]));this._toggle(d,i,f);return}var h=a(c.currentTarget||g),j=h[0]===this.active[0];l.active=l.collapsible&&j?false:this.headers.index(h);if(this.running||(!l.collapsible&&j)){return}var e=this.active,d=h.next(),i=this.active.next(),f={options:l,newHeader:j&&l.collapsible?a([]):h,oldHeader:this.active,newContent:j&&l.collapsible?a([]):d,oldContent:i},k=this.headers.index(this.active[0])>this.headers.index(h[0]);this.active=j?a([]):h;this._toggle(d,i,f,j,k);e.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(l.icons.headerSelected).addClass(l.icons.header);if(!j){h.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(l.icons.header).addClass(l.icons.headerSelected);h.next().addClass("ui-accordion-content-active")}return},_toggle:function(c,i,g,j,k){var m=this,n=m.options;m.toShow=c;m.toHide=i;m.data=g;var d=function(){if(!m){return}return m._completed.apply(m,arguments)};m._trigger("changestart",null,m.data);m.running=i.size()===0?c.size():i.size();if(n.animated){var f={};if(n.collapsible&&j){f={toShow:a([]),toHide:i,complete:d,down:k,autoHeight:n.autoHeight||n.fillSpace}}else{f={toShow:c,toHide:i,complete:d,down:k,autoHeight:n.autoHeight||n.fillSpace}}if(!n.proxied){n.proxied=n.animated}if(!n.proxiedDuration){n.proxiedDuration=n.duration}n.animated=a.isFunction(n.proxied)?n.proxied(f):n.proxied;n.duration=a.isFunction(n.proxiedDuration)?n.proxiedDuration(f):n.proxiedDuration;var l=a.ui.accordion.animations,e=n.duration,h=n.animated;if(h&&!l[h]&&!a.easing[h]){h="slide"}if(!l[h]){l[h]=function(o){this.slide(o,{easing:h,duration:e||700})}}l[h](f)}else{if(n.collapsible&&j){c.toggle()}else{i.hide();c.show()}d(true)}i.prev().attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).blur();c.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(c){this.running=c?0:--this.running;if(this.running){return}if(this.options.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""})}this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length){this.toHide.parent()[0].className=this.toHide.parent()[0].className}this._trigger("change",null,this.data)}});a.extend(a.ui.accordion,{version:"1.8.14",animations:{slide:function(k,i){k=a.extend({easing:"swing",duration:300},k,i);if(!k.toHide.size()){k.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},k);return}if(!k.toShow.size()){k.toHide.animate({height:"hide",paddingTop:"hide",paddingBottom:"hide"},k);return}var d=k.toShow.css("overflow"),h=0,e={},g={},f=["height","paddingTop","paddingBottom"],c;var j=k.toShow;c=j[0].style.width;j.width(parseInt(j.parent().width(),10)-parseInt(j.css("paddingLeft"),10)-parseInt(j.css("paddingRight"),10)-(parseInt(j.css("borderLeftWidth"),10)||0)-(parseInt(j.css("borderRightWidth"),10)||0));a.each(f,function(l,n){g[n]="hide";var m=(""+a.css(k.toShow[0],n)).match(/^([\d+-.]+)(.*)$/);e[n]={value:m[1],unit:m[2]||"px"}});k.toShow.css({height:0,overflow:"hidden"}).show();k.toHide.filter(":hidden").each(k.complete).end().filter(":visible").animate(g,{step:function(l,m){if(m.prop=="height"){h=(m.end-m.start===0)?0:(m.now-m.start)/(m.end-m.start)}k.toShow[0].style[m.prop]=(h*e[m.prop].value)+e[m.prop].unit},duration:k.duration,easing:k.easing,complete:function(){if(!k.autoHeight){k.toShow.css("height","")}k.toShow.css({width:c,overflow:d});k.complete()}})},bounceslide:function(c){this.slide(c,{easing:c.down?"easeOutBounce":"swing",duration:c.down?1000:200})}}})})(jQuery);(function(a,b){var c=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var d=this,f=this.element[0].ownerDocument,e;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(g){if(d.options.disabled||d.element.attr("readonly")){return}e=false;var h=a.ui.keyCode;switch(g.keyCode){case h.PAGE_UP:d._move("previousPage",g);break;case h.PAGE_DOWN:d._move("nextPage",g);break;case h.UP:d._move("previous",g);g.preventDefault();break;case h.DOWN:d._move("next",g);g.preventDefault();break;case h.ENTER:case h.NUMPAD_ENTER:if(d.menu.active){e=true;g.preventDefault()}case h.TAB:if(!d.menu.active){return}d.menu.select(g);break;case h.ESCAPE:d.element.val(d.term);d.close(g);break;default:clearTimeout(d.searching);d.searching=setTimeout(function(){if(d.term!=d.element.val()){d.selectedItem=null;d.search(null,g)}},d.options.delay);break}}).bind("keypress.autocomplete",function(g){if(e){e=false;g.preventDefault()}}).bind("focus.autocomplete",function(){if(d.options.disabled){return}d.selectedItem=null;d.previous=d.element.val()}).bind("blur.autocomplete",function(g){if(d.options.disabled){return}clearTimeout(d.searching);d.closing=setTimeout(function(){d.close(g);d._change(g)},150)});this._initSource();this.response=function(){return d._response.apply(d,arguments)};this.menu=a("<ul></ul>").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",f)[0]).mousedown(function(g){var h=d.menu.element[0];if(!a(g.target).closest(".ui-menu-item").length){setTimeout(function(){a(document).one("mousedown",function(i){if(i.target!==d.element[0]&&i.target!==h&&!a.ui.contains(h,i.target)){d.close()}})},1)}setTimeout(function(){clearTimeout(d.closing)},13)}).menu({focus:function(h,i){var g=i.item.data("item.autocomplete");if(false!==d._trigger("focus",h,{item:g})){if(/^key/.test(h.originalEvent.type)){d.element.val(g.value)}}},selected:function(i,j){var h=j.item.data("item.autocomplete"),g=d.previous;if(d.element[0]!==f.activeElement){d.element.focus();d.previous=g;setTimeout(function(){d.previous=g;d.selectedItem=h},1)}if(false!==d._trigger("select",i,{item:h})){d.element.val(h.value)}d.term=d.element.val();d.close(i);d.selectedItem=h},blur:function(g,h){if(d.menu.element.is(":visible")&&(d.element.val()!==d.term)){d.element.val(d.term)}}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");if(a.fn.bgiframe){this.menu.element.bgiframe()}},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();a.Widget.prototype.destroy.call(this)},_setOption:function(d,e){a.Widget.prototype._setOption.apply(this,arguments);if(d==="source"){this._initSource()}if(d==="appendTo"){this.menu.element.appendTo(a(e||"body",this.element[0].ownerDocument)[0])}if(d==="disabled"&&e&&this.xhr){this.xhr.abort()}},_initSource:function(){var d=this,f,e;if(a.isArray(this.options.source)){f=this.options.source;this.source=function(h,g){g(a.ui.autocomplete.filter(f,h.term))}}else{if(typeof this.options.source==="string"){e=this.options.source;this.source=function(h,g){if(d.xhr){d.xhr.abort()}d.xhr=a.ajax({url:e,data:h,dataType:"json",autocompleteRequest:++c,success:function(j,i){if(this.autocompleteRequest===c){g(j)}},error:function(){if(this.autocompleteRequest===c){g([])}}})}}else{this.source=this.options.source}}},search:function(e,d){e=e!=null?e:this.element.val();this.term=this.element.val();if(e.length<this.options.minLength){return this.close(d)}clearTimeout(this.closing);if(this._trigger("search",d)===false){return}return this._search(e)},_search:function(d){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:d},this.response)},_response:function(d){if(!this.options.disabled&&d&&d.length){d=this._normalize(d);this._suggest(d);this._trigger("open")}else{this.close()}this.pending--;if(!this.pending){this.element.removeClass("ui-autocomplete-loading")}},close:function(d){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",d)}},_change:function(d){if(this.previous!==this.element.val()){this._trigger("change",d,{item:this.selectedItem})}},_normalize:function(d){if(d.length&&d[0].label&&d[0].value){return d}return a.map(d,function(e){if(typeof e==="string"){return{label:e,value:e}}return a.extend({label:e.label||e.value,value:e.value||e.label},e)})},_suggest:function(d){var e=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(e,d);this.menu.deactivate();this.menu.refresh();e.show();this._resizeMenu();e.position(a.extend({of:this.element},this.options.position));if(this.options.autoFocus){this.menu.next(new a.Event("mouseover"))}},_resizeMenu:function(){var d=this.menu.element;d.outerWidth(Math.max(d.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(f,e){var d=this;a.each(e,function(g,h){d._renderItem(f,h)})},_renderItem:function(d,e){return a("<li></li>").data("item.autocomplete",e).append(a("<a></a>").text(e.label)).appendTo(d)},_move:function(e,d){if(!this.menu.element.is(":visible")){this.search(null,d);return}if(this.menu.first()&&/^previous/.test(e)||this.menu.last()&&/^next/.test(e)){this.element.val(this.term);this.menu.deactivate();return}this.menu[e](d)},widget:function(){return this.menu.element}});a.extend(a.ui.autocomplete,{escapeRegex:function(d){return d.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(f,d){var e=new RegExp(a.ui.autocomplete.escapeRegex(d),"i");return a.grep(f,function(g){return e.test(g.label||g.value||g)})}})}(jQuery));(function(a){a.widget("ui.menu",{_create:function(){var b=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(!a(c.target).closest(".ui-menu-item a").length){return}c.preventDefault();b.select(c)});this.refresh()},refresh:function(){var c=this;var b=this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem");b.children("a").addClass("ui-corner-all").attr("tabindex",-1).mouseenter(function(d){c.activate(d,a(this).parent())}).mouseleave(function(){c.deactivate()})},activate:function(e,d){this.deactivate();if(this.hasScroll()){var f=d.offset().top-this.element.offset().top,b=this.element.scrollTop(),c=this.element.height();if(f<0){this.element.scrollTop(b+f)}else{if(f>=c){this.element.scrollTop(b+f-c+d.height())}}}this.active=d.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:d})},deactivate:function(){if(!this.active){return}this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null},next:function(b){this.move("next",".ui-menu-item:first",b)},previous:function(b){this.move("prev",".ui-menu-item:last",b)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,d,c){if(!this.active){this.activate(c,this.element.children(d));return}var b=this.active[e+"All"](".ui-menu-item").eq(0);if(b.length){this.activate(c,b)}else{this.activate(c,this.element.children(d))}},nextPage:function(d){if(this.hasScroll()){if(!this.active||this.last()){this.activate(d,this.element.children(".ui-menu-item:first"));return}var e=this.active.offset().top,c=this.element.height(),b=this.element.children(".ui-menu-item").filter(function(){var f=a(this).offset().top-e-c+a(this).height();return f<10&&f>-10});if(!b.length){b=this.element.children(".ui-menu-item:last")}this.activate(d,b)}else{this.activate(d,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))}},previousPage:function(c){if(this.hasScroll()){if(!this.active||this.first()){this.activate(c,this.element.children(".ui-menu-item:last"));return}var d=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var e=a(this).offset().top-d+b-a(this).height();return e<10&&e>-10});if(!result.length){result=this.element.children(".ui-menu-item:first")}this.activate(c,result)}else{this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))}},hasScroll:function(){return this.element.height()<this.element[a.fn.prop?"prop":"attr"]("scrollHeight")},select:function(b){this._trigger("selected",b,{item:this.active})}})}(jQuery));(function(f,b){var k,e,a,h,i="ui-button ui-widget ui-state-default ui-corner-all",c="ui-state-hover ui-state-active ",g="ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",j=function(){var l=f(this).find(":ui-button");setTimeout(function(){l.button("refresh")},1)},d=function(m){var l=m.name,n=m.form,o=f([]);if(l){if(n){o=f(n).find("[name='"+l+"']")}else{o=f("[name='"+l+"']",m.ownerDocument).filter(function(){return !this.form})}}return o};f.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",j);if(typeof this.options.disabled!=="boolean"){this.options.disabled=this.element.attr("disabled")}this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var l=this,n=this.options,o=this.type==="checkbox"||this.type==="radio",p="ui-state-hover"+(!o?" ui-state-active":""),m="ui-state-focus";if(n.label===null){n.label=this.buttonElement.html()}if(this.element.is(":disabled")){n.disabled=true}this.buttonElement.addClass(i).attr("role","button").bind("mouseenter.button",function(){if(n.disabled){return}f(this).addClass("ui-state-hover");if(this===k){f(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){if(n.disabled){return}f(this).removeClass(p)}).bind("click.button",function(q){if(n.disabled){q.preventDefault();q.stopImmediatePropagation()}});this.element.bind("focus.button",function(){l.buttonElement.addClass(m)}).bind("blur.button",function(){l.buttonElement.removeClass(m)});if(o){this.element.bind("change.button",function(){if(h){return}l.refresh()});this.buttonElement.bind("mousedown.button",function(q){if(n.disabled){return}h=false;e=q.pageX;a=q.pageY}).bind("mouseup.button",function(q){if(n.disabled){return}if(e!==q.pageX||a!==q.pageY){h=true}})}if(this.type==="checkbox"){this.buttonElement.bind("click.button",function(){if(n.disabled||h){return false}f(this).toggleClass("ui-state-active");l.buttonElement.attr("aria-pressed",l.element[0].checked)})}else{if(this.type==="radio"){this.buttonElement.bind("click.button",function(){if(n.disabled||h){return false}f(this).addClass("ui-state-active");l.buttonElement.attr("aria-pressed",true);var q=l.element[0];d(q).not(q).map(function(){return f(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)})}else{this.buttonElement.bind("mousedown.button",function(){if(n.disabled){return false}f(this).addClass("ui-state-active");k=this;f(document).one("mouseup",function(){k=null})}).bind("mouseup.button",function(){if(n.disabled){return false}f(this).removeClass("ui-state-active")}).bind("keydown.button",function(q){if(n.disabled){return false}if(q.keyCode==f.ui.keyCode.SPACE||q.keyCode==f.ui.keyCode.ENTER){f(this).addClass("ui-state-active")}}).bind("keyup.button",function(){f(this).removeClass("ui-state-active")});if(this.buttonElement.is("a")){this.buttonElement.keyup(function(q){if(q.keyCode===f.ui.keyCode.SPACE){f(this).click()}})}}}this._setOption("disabled",n.disabled);this._resetButton()},_determineButtonType:function(){if(this.element.is(":checkbox")){this.type="checkbox"}else{if(this.element.is(":radio")){this.type="radio"}else{if(this.element.is("input")){this.type="input"}else{this.type="button"}}}if(this.type==="checkbox"||this.type==="radio"){var l=this.element.parents().filter(":last"),n="label[for="+this.element.attr("id")+"]";this.buttonElement=l.find(n);if(!this.buttonElement.length){l=l.length?l.siblings():this.element.siblings();this.buttonElement=l.filter(n);if(!this.buttonElement.length){this.buttonElement=l.find(n)}}this.element.addClass("ui-helper-hidden-accessible");var m=this.element.is(":checked");if(m){this.buttonElement.addClass("ui-state-active")}this.buttonElement.attr("aria-pressed",m)}else{this.buttonElement=this.element}},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass(i+" "+c+" "+g).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());if(!this.hasTitle){this.buttonElement.removeAttr("title")}f.Widget.prototype.destroy.call(this)},_setOption:function(l,m){f.Widget.prototype._setOption.apply(this,arguments);if(l==="disabled"){if(m){this.element.attr("disabled",true)}else{this.element.removeAttr("disabled")}return}this._resetButton()},refresh:function(){var l=this.element.is(":disabled");if(l!==this.options.disabled){this._setOption("disabled",l)}if(this.type==="radio"){d(this.element[0]).each(function(){if(f(this).is(":checked")){f(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true)}else{f(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)}})}else{if(this.type==="checkbox"){if(this.element.is(":checked")){this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true)}else{this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)}}}},_resetButton:function(){if(this.type==="input"){if(this.options.label){this.element.val(this.options.label)}return}var p=this.buttonElement.removeClass(g),n=f("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(p.empty()).text(),m=this.options.icons,l=m.primary&&m.secondary,o=[];if(m.primary||m.secondary){if(this.options.text){o.push("ui-button-text-icon"+(l?"s":(m.primary?"-primary":"-secondary")))}if(m.primary){p.prepend("<span class='ui-button-icon-primary ui-icon "+m.primary+"'></span>")}if(m.secondary){p.append("<span class='ui-button-icon-secondary ui-icon "+m.secondary+"'></span>")}if(!this.options.text){o.push(l?"ui-button-icons-only":"ui-button-icon-only");if(!this.hasTitle){p.attr("title",n)}}}else{o.push("ui-button-text-only")}p.addClass(o.join(" "))}});f.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(l,m){if(l==="disabled"){this.buttons.button("option",l,m)}f.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var l=this.element.css("direction")==="ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return f(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(l?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(l?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return f(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");f.Widget.prototype.destroy.call(this)}})}(jQuery));(function(e,f){var c="ui-dialog ui-widget ui-widget-content ui-corner-all ",b={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},d={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},a=e.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};e.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(h){var g=e(this).css(h).offset().top;if(g<0){e(this).css("top",h.top-g)}}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1000},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string"){this.originalTitle=""}this.options.title=this.options.title||this.originalTitle;var o=this,p=o.options,m=p.title||" ",h=e.ui.dialog.getTitleId(o.element),n=(o.uiDialog=e("<div></div>")).appendTo(document.body).hide().addClass(c+p.dialogClass).css({zIndex:p.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(q){if(p.closeOnEscape&&q.keyCode&&q.keyCode===e.ui.keyCode.ESCAPE){o.close(q);q.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(q){o.moveToTop(false,q)}),j=o.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(n),i=(o.uiDialogTitlebar=e("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(n),l=e('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){l.addClass("ui-state-hover")},function(){l.removeClass("ui-state-hover")}).focus(function(){l.addClass("ui-state-focus")}).blur(function(){l.removeClass("ui-state-focus")}).click(function(q){o.close(q);return false}).appendTo(i),k=(o.uiDialogTitlebarCloseText=e("<span></span>")).addClass("ui-icon ui-icon-closethick").text(p.closeText).appendTo(l),g=e("<span></span>").addClass("ui-dialog-title").attr("id",h).html(m).prependTo(i);if(e.isFunction(p.beforeclose)&&!e.isFunction(p.beforeClose)){p.beforeClose=p.beforeclose}i.find("*").add(i).disableSelection();if(p.draggable&&e.fn.draggable){o._makeDraggable()}if(p.resizable&&e.fn.resizable){o._makeResizable()}o._createButtons(p.buttons);o._isOpen=false;if(e.fn.bgiframe){n.bgiframe()}},_init:function(){if(this.options.autoOpen){this.open()}},destroy:function(){var g=this;if(g.overlay){g.overlay.destroy()}g.uiDialog.hide();g.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");g.uiDialog.remove();if(g.originalTitle){g.element.attr("title",g.originalTitle)}return g},widget:function(){return this.uiDialog},close:function(j){var g=this,i,h;if(false===g._trigger("beforeClose",j)){return}if(g.overlay){g.overlay.destroy()}g.uiDialog.unbind("keypress.ui-dialog");g._isOpen=false;if(g.options.hide){g.uiDialog.hide(g.options.hide,function(){g._trigger("close",j)})}else{g.uiDialog.hide();g._trigger("close",j)}e.ui.dialog.overlay.resize();if(g.options.modal){i=0;e(".ui-dialog").each(function(){if(this!==g.uiDialog[0]){h=e(this).css("z-index");if(!isNaN(h)){i=Math.max(i,h)}}});e.ui.dialog.maxZ=i}return g},isOpen:function(){return this._isOpen},moveToTop:function(k,j){var g=this,i=g.options,h;if((i.modal&&!k)||(!i.stack&&!i.modal)){return g._trigger("focus",j)}if(i.zIndex>e.ui.dialog.maxZ){e.ui.dialog.maxZ=i.zIndex}if(g.overlay){e.ui.dialog.maxZ+=1;g.overlay.$el.css("z-index",e.ui.dialog.overlay.maxZ=e.ui.dialog.maxZ)}h={scrollTop:g.element.attr("scrollTop"),scrollLeft:g.element.attr("scrollLeft")};e.ui.dialog.maxZ+=1;g.uiDialog.css("z-index",e.ui.dialog.maxZ);g.element.attr(h);g._trigger("focus",j);return g},open:function(){if(this._isOpen){return}var h=this,i=h.options,g=h.uiDialog;h.overlay=i.modal?new e.ui.dialog.overlay(h):null;h._size();h._position(i.position);g.show(i.show);h.moveToTop(true);if(i.modal){g.bind("keypress.ui-dialog",function(l){if(l.keyCode!==e.ui.keyCode.TAB){return}var k=e(":tabbable",this),m=k.filter(":first"),j=k.filter(":last");if(l.target===j[0]&&!l.shiftKey){m.focus(1);return false}else{if(l.target===m[0]&&l.shiftKey){j.focus(1);return false}}})}e(h.element.find(":tabbable").get().concat(g.find(".ui-dialog-buttonpane :tabbable").get().concat(g.get()))).eq(0).focus();h._isOpen=true;h._trigger("open");return h},_createButtons:function(j){var i=this,g=false,h=e("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),k=e("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);i.uiDialog.find(".ui-dialog-buttonpane").remove();if(typeof j==="object"&&j!==null){e.each(j,function(){return !(g=true)})}if(g){e.each(j,function(l,n){n=e.isFunction(n)?{click:n,text:l}:n;var m=e('<button type="button"></button>').click(function(){n.click.apply(i.element[0],arguments)}).appendTo(k);e.each(n,function(o,p){if(o==="click"){return}if(o in a){m[o](p)}else{m.attr(o,p)}});if(e.fn.button){m.button()}});h.appendTo(i.uiDialog)}},_makeDraggable:function(){var g=this,j=g.options,k=e(document),i;function h(l){return{position:l.position,offset:l.offset}}g.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(l,m){i=j.height==="auto"?"auto":e(this).height();e(this).height(e(this).height()).addClass("ui-dialog-dragging");g._trigger("dragStart",l,h(m))},drag:function(l,m){g._trigger("drag",l,h(m))},stop:function(l,m){j.position=[m.position.left-k.scrollLeft(),m.position.top-k.scrollTop()];e(this).removeClass("ui-dialog-dragging").height(i);g._trigger("dragStop",l,h(m));e.ui.dialog.overlay.resize()}})},_makeResizable:function(l){l=(l===f?this.options.resizable:l);var h=this,k=h.options,g=h.uiDialog.css("position"),j=(typeof l==="string"?l:"n,e,s,w,se,sw,ne,nw");function i(m){return{originalPosition:m.originalPosition,originalSize:m.originalSize,position:m.position,size:m.size}}h.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:h.element,maxWidth:k.maxWidth,maxHeight:k.maxHeight,minWidth:k.minWidth,minHeight:h._minHeight(),handles:j,start:function(m,n){e(this).addClass("ui-dialog-resizing");h._trigger("resizeStart",m,i(n))},resize:function(m,n){h._trigger("resize",m,i(n))},stop:function(m,n){e(this).removeClass("ui-dialog-resizing");k.height=e(this).height();k.width=e(this).width();h._trigger("resizeStop",m,i(n));e.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var g=this.options;if(g.height==="auto"){return g.minHeight}else{return Math.min(g.minHeight,g.height)}},_position:function(h){var i=[],j=[0,0],g;if(h){if(typeof h==="string"||(typeof h==="object"&&"0" in h)){i=h.split?h.split(" "):[h[0],h[1]];if(i.length===1){i[1]=i[0]}e.each(["left","top"],function(l,k){if(+i[l]===i[l]){j[l]=i[l];i[l]=k}});h={my:i.join(" "),at:i.join(" "),offset:j.join(" ")}}h=e.extend({},e.ui.dialog.prototype.options.position,h)}else{h=e.ui.dialog.prototype.options.position}g=this.uiDialog.is(":visible");if(!g){this.uiDialog.show()}this.uiDialog.css({top:0,left:0}).position(e.extend({of:window},h));if(!g){this.uiDialog.hide()}},_setOptions:function(j){var h=this,g={},i=false;e.each(j,function(k,l){h._setOption(k,l);if(k in b){i=true}if(k in d){g[k]=l}});if(i){this._size()}if(this.uiDialog.is(":data(resizable)")){this.uiDialog.resizable("option",g)}},_setOption:function(j,k){var h=this,g=h.uiDialog;switch(j){case"beforeclose":j="beforeClose";break;case"buttons":h._createButtons(k);break;case"closeText":h.uiDialogTitlebarCloseText.text(""+k);break;case"dialogClass":g.removeClass(h.options.dialogClass).addClass(c+k);break;case"disabled":if(k){g.addClass("ui-dialog-disabled")}else{g.removeClass("ui-dialog-disabled")}break;case"draggable":var i=g.is(":data(draggable)");if(i&&!k){g.draggable("destroy")}if(!i&&k){h._makeDraggable()}break;case"position":h._position(k);break;case"resizable":var l=g.is(":data(resizable)");if(l&&!k){g.resizable("destroy")}if(l&&typeof k==="string"){g.resizable("option","handles",k)}if(!l&&k!==false){h._makeResizable(k)}break;case"title":e(".ui-dialog-title",h.uiDialogTitlebar).html(""+(k||" "));break}e.Widget.prototype._setOption.apply(h,arguments)},_size:function(){var k=this.options,h,j,g=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(k.minWidth>k.width){k.width=k.minWidth}h=this.uiDialog.css({height:"auto",width:k.width}).height();j=Math.max(0,k.minHeight-h);if(k.height==="auto"){if(e.support.minHeight){this.element.css({minHeight:j,height:"auto"})}else{this.uiDialog.show();var i=this.element.css("height","auto").height();if(!g){this.uiDialog.hide()}this.element.height(Math.max(i,j))}}else{this.element.height(Math.max(k.height-h,0))}if(this.uiDialog.is(":data(resizable)")){this.uiDialog.resizable("option","minHeight",this._minHeight())}}});e.extend(e.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(g){var h=g.attr("id");if(!h){this.uuid+=1;h=this.uuid}return"ui-dialog-title-"+h},overlay:function(g){this.$el=e.ui.dialog.overlay.create(g)}});e.extend(e.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:e.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(g){return g+".dialog-overlay"}).join(" "),create:function(h){if(this.instances.length===0){setTimeout(function(){if(e.ui.dialog.overlay.instances.length){e(document).bind(e.ui.dialog.overlay.events,function(i){if(e(i.target).zIndex()<e.ui.dialog.overlay.maxZ){return false}})}},1);e(document).bind("keydown.dialog-overlay",function(i){if(h.options.closeOnEscape&&i.keyCode&&i.keyCode===e.ui.keyCode.ESCAPE){h.close(i);i.preventDefault()}});e(window).bind("resize.dialog-overlay",e.ui.dialog.overlay.resize)}var g=(this.oldInstances.pop()||e("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});if(e.fn.bgiframe){g.bgiframe()}this.instances.push(g);return g},destroy:function(g){var h=e.inArray(g,this.instances);if(h!=-1){this.oldInstances.push(this.instances.splice(h,1)[0])}if(this.instances.length===0){e([document,window]).unbind(".dialog-overlay")}g.remove();var i=0;e.each(this.instances,function(){i=Math.max(i,this.css("z-index"))});this.maxZ=i},height:function(){var h,g;if(e.browser.msie&&e.browser.version<7){h=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);g=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(h<g){return e(window).height()+"px"}else{return h+"px"}}else{return e(document).height()+"px"}},width:function(){var g,h;if(e.browser.msie){g=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);h=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(g<h){return e(window).width()+"px"}else{return g+"px"}}else{return e(document).width()+"px"}},resize:function(){var g=e([]);e.each(e.ui.dialog.overlay.instances,function(){g=g.add(this)});g.css({width:0,height:0}).css({width:e.ui.dialog.overlay.width(),height:e.ui.dialog.overlay.height()})}});e.extend(e.ui.dialog.overlay.prototype,{destroy:function(){e.ui.dialog.overlay.destroy(this.$el)}})}(jQuery));(function(b,c){var a=5;b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var e=this,k=this.options,j=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),h="<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",d=(k.values&&k.values.length)||1,g=[];this._keySliding=false;this._mouseSliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all"+(k.disabled?" ui-slider-disabled ui-disabled":""));this.range=b([]);if(k.range){if(k.range===true){if(!k.values){k.values=[this._valueMin(),this._valueMin()]}if(k.values.length&&k.values.length!==2){k.values=[k.values[0],k.values[0]]}}this.range=b("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+((k.range==="min"||k.range==="max")?" ui-slider-range-"+k.range:""))}for(var f=j.length;f<d;f+=1){g.push(h)}this.handles=j.add(b(g.join("")).appendTo(e.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(i){i.preventDefault()}).hover(function(){if(!k.disabled){b(this).addClass("ui-state-hover")}},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(!k.disabled){b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}else{b(this).blur()}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(l){b(this).data("index.ui-slider-handle",l)});this.handles.keydown(function(p){var m=true,l=b(this).data("index.ui-slider-handle"),q,n,i,o;if(e.options.disabled){return}switch(p.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:m=false;if(!e._keySliding){e._keySliding=true;b(this).addClass("ui-state-active");q=e._start(p,l);if(q===false){return}}break}o=e.options.step;if(e.options.values&&e.options.values.length){n=i=e.values(l)}else{n=i=e.value()}switch(p.keyCode){case b.ui.keyCode.HOME:i=e._valueMin();break;case b.ui.keyCode.END:i=e._valueMax();break;case b.ui.keyCode.PAGE_UP:i=e._trimAlignValue(n+((e._valueMax()-e._valueMin())/a));break;case b.ui.keyCode.PAGE_DOWN:i=e._trimAlignValue(n-((e._valueMax()-e._valueMin())/a));break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(n===e._valueMax()){return}i=e._trimAlignValue(n+o);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(n===e._valueMin()){return}i=e._trimAlignValue(n-o);break}e._slide(p,l,i);return m}).keyup(function(l){var i=b(this).data("index.ui-slider-handle");if(e._keySliding){e._keySliding=false;e._stop(l,i);e._change(l,i);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();return this},_mouseCapture:function(f){var g=this.options,j,l,e,h,n,k,m,i,d;if(g.disabled){return false}this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();j={x:f.pageX,y:f.pageY};l=this._normValueFromMouse(j);e=this._valueMax()-this._valueMin()+1;n=this;this.handles.each(function(o){var p=Math.abs(l-n.values(o));if(e>p){e=p;h=b(this);k=o}});if(g.range===true&&this.values(1)===g.min){k+=1;h=b(this.handles[k])}m=this._start(f,k);if(m===false){return false}this._mouseSliding=true;n._handleIndex=k;h.addClass("ui-state-active").focus();i=h.offset();d=!b(f.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=d?{left:0,top:0}:{left:f.pageX-i.left-(h.width()/2),top:f.pageY-i.top-(h.height()/2)-(parseInt(h.css("borderTopWidth"),10)||0)-(parseInt(h.css("borderBottomWidth"),10)||0)+(parseInt(h.css("marginTop"),10)||0)};if(!this.handles.hasClass("ui-state-hover")){this._slide(f,k,l)}this._animateOff=true;return true},_mouseStart:function(d){return true},_mouseDrag:function(f){var d={x:f.pageX,y:f.pageY},e=this._normValueFromMouse(d);this._slide(f,this._handleIndex,e);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._handleIndex=null;this._clickOffset=null;this._animateOff=false;return false},_detectOrientation:function(){this.orientation=(this.options.orientation==="vertical")?"vertical":"horizontal"},_normValueFromMouse:function(e){var d,h,g,f,i;if(this.orientation==="horizontal"){d=this.elementSize.width;h=e.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{d=this.elementSize.height;h=e.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}g=(h/d);if(g>1){g=1}if(g<0){g=0}if(this.orientation==="vertical"){g=1-g}f=this._valueMax()-this._valueMin();i=this._valueMin()+g*f;return this._trimAlignValue(i)},_start:function(f,e){var d={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){d.value=this.values(e);d.values=this.values()}return this._trigger("start",f,d)},_slide:function(h,g,f){var d,e,i;if(this.options.values&&this.options.values.length){d=this.values(g?0:1);if((this.options.values.length===2&&this.options.range===true)&&((g===0&&f>d)||(g===1&&f<d))){f=d}if(f!==this.values(g)){e=this.values();e[g]=f;i=this._trigger("slide",h,{handle:this.handles[g],value:f,values:e});d=this.values(g?0:1);if(i!==false){this.values(g,f,true)}}}else{if(f!==this.value()){i=this._trigger("slide",h,{handle:this.handles[g],value:f});if(i!==false){this.value(f)}}}},_stop:function(f,e){var d={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){d.value=this.values(e);d.values=this.values()}this._trigger("stop",f,d)},_change:function(f,e){if(!this._keySliding&&!this._mouseSliding){var d={handle:this.handles[e],value:this.value()};if(this.options.values&&this.options.values.length){d.value=this.values(e);d.values=this.values()}this._trigger("change",f,d)}},value:function(d){if(arguments.length){this.options.value=this._trimAlignValue(d);this._refreshValue();this._change(null,0);return}return this._value()},values:function(e,h){var g,d,f;if(arguments.length>1){this.options.values[e]=this._trimAlignValue(h);this._refreshValue();this._change(null,e);return}if(arguments.length){if(b.isArray(arguments[0])){g=this.options.values;d=arguments[0];for(f=0;f<g.length;f+=1){g[f]=this._trimAlignValue(d[f]);this._change(null,f)}this._refreshValue()}else{if(this.options.values&&this.options.values.length){return this._values(e)}else{return this.value()}}}else{return this._values()}},_setOption:function(e,f){var d,g=0;if(b.isArray(this.options.values)){g=this.options.values.length}b.Widget.prototype._setOption.apply(this,arguments);switch(e){case"disabled":if(f){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case"value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case"values":this._animateOff=true;this._refreshValue();for(d=0;d<g;d+=1){this._change(null,d)}this._animateOff=false;break}},_value:function(){var d=this.options.value;d=this._trimAlignValue(d);return d},_values:function(d){var g,f,e;if(arguments.length){g=this.options.values[d];g=this._trimAlignValue(g);return g}else{f=this.options.values.slice();for(e=0;e<f.length;e+=1){f[e]=this._trimAlignValue(f[e])}return f}},_trimAlignValue:function(f){if(f<=this._valueMin()){return this._valueMin()}if(f>=this._valueMax()){return this._valueMax()}var d=(this.options.step>0)?this.options.step:1,e=(f-this._valueMin())%d;alignValue=f-e;if(Math.abs(e)*2>=d){alignValue+=(e>0)?d:(-d)}return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var g=this.options.range,f=this.options,m=this,e=(!this._animateOff)?f.animate:false,h,d={},i,k,j,l;if(this.options.values&&this.options.values.length){this.handles.each(function(o,n){h=(m.values(o)-m._valueMin())/(m._valueMax()-m._valueMin())*100;d[m.orientation==="horizontal"?"left":"bottom"]=h+"%";b(this).stop(1,1)[e?"animate":"css"](d,f.animate);if(m.options.range===true){if(m.orientation==="horizontal"){if(o===0){m.range.stop(1,1)[e?"animate":"css"]({left:h+"%"},f.animate)}if(o===1){m.range[e?"animate":"css"]({width:(h-i)+"%"},{queue:false,duration:f.animate})}}else{if(o===0){m.range.stop(1,1)[e?"animate":"css"]({bottom:(h)+"%"},f.animate)}if(o===1){m.range[e?"animate":"css"]({height:(h-i)+"%"},{queue:false,duration:f.animate})}}}i=h})}else{k=this.value();j=this._valueMin();l=this._valueMax();h=(l!==j)?(k-j)/(l-j)*100:0;d[m.orientation==="horizontal"?"left":"bottom"]=h+"%";this.handle.stop(1,1)[e?"animate":"css"](d,f.animate);if(g==="min"&&this.orientation==="horizontal"){this.range.stop(1,1)[e?"animate":"css"]({width:h+"%"},f.animate)}if(g==="max"&&this.orientation==="horizontal"){this.range[e?"animate":"css"]({width:(100-h)+"%"},{queue:false,duration:f.animate})}if(g==="min"&&this.orientation==="vertical"){this.range.stop(1,1)[e?"animate":"css"]({height:h+"%"},f.animate)}if(g==="max"&&this.orientation==="vertical"){this.range[e?"animate":"css"]({height:(100-h)+"%"},{queue:false,duration:f.animate})}}}});b.extend(b.ui.slider,{version:"1.8.14"})}(jQuery));(function(d,f){var c=0,b=0;function e(){return ++c}function a(){return ++b}d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(g,h){if(g=="selected"){if(this.options.collapsible&&h==this.options.selected){return}this.select(h)}else{this.options[g]=h;this._tabify()}},_tabId:function(g){return g.title&&g.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+e()},_sanitizeSelector:function(g){return g.replace(/:/g,"\\:")},_cookie:function(){var g=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+a());return d.cookie.apply(null,[g].concat(d.makeArray(arguments)))},_ui:function(h,g){return{tab:h,panel:g,index:this.anchors.index(h)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var g=d(this);g.html(g.data("label.tabs")).removeData("label.tabs")})},_tabify:function(u){var v=this,j=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(x,o){var w=d(o).attr("href");var y=w.split("#")[0],z;if(y&&(y===location.toString().split("#")[0]||(z=d("base")[0])&&y===z.href)){w=o.hash;o.href=w}if(h.test(w)){v.panels=v.panels.add(v.element.find(v._sanitizeSelector(w)))}else{if(w&&w!=="#"){d.data(o,"href.tabs",w);d.data(o,"load.tabs",w.replace(/#.*$/,""));var B=v._tabId(o);o.href="#"+B;var A=v.element.find("#"+B);if(!A.length){A=d(j.panelTemplate).attr("id",B).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(v.panels[x-1]||v.list);A.data("destroy.tabs",true)}v.panels=v.panels.add(A)}else{j.disabled.push(x)}}});if(u){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===f){if(location.hash){this.anchors.each(function(w,o){if(o.hash==location.hash){j.selected=w;return false}})}if(typeof j.selected!=="number"&&j.cookie){j.selected=parseInt(v._cookie(),10)}if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length){j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}j.selected=j.selected||(this.lis.length?0:-1)}else{if(j.selected===null){j.selected=-1}}j.selected=((j.selected>=0&&this.anchors[j.selected])||j.selected<0)?j.selected:0;j.disabled=d.unique(j.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(w,o){return v.lis.index(w)}))).sort();if(d.inArray(j.selected,j.disabled)!=-1){j.disabled.splice(d.inArray(j.selected,j.disabled),1)}this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");if(j.selected>=0&&this.anchors.length){v.element.find(v._sanitizeSelector(v.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");v.element.queue("tabs",function(){v._trigger("show",null,v._ui(v.anchors[j.selected],v.element.find(v._sanitizeSelector(v.anchors[j.selected].hash))[0]))});this.load(j.selected)}d(window).bind("unload",function(){v.lis.add(v.anchors).unbind(".tabs");v.lis=v.anchors=v.panels=null})}else{j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");if(j.cookie){this._cookie(j.selected,j.cookie)}for(var m=0,s;(s=this.lis[m]);m++){d(s)[d.inArray(m,j.disabled)!=-1&&!d(s).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(j.cache===false){this.anchors.removeData("cache.tabs")}this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.addClass("ui-state-"+o)}};var p=function(o,i){i.removeClass("ui-state-"+o)};this.lis.bind("mouseover.tabs",function(){l("hover",d(this))});this.lis.bind("mouseout.tabs",function(){p("hover",d(this))});this.anchors.bind("focus.tabs",function(){l("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){p("focus",d(this).closest("li"))})}var g,n;if(j.fx){if(d.isArray(j.fx)){g=j.fx[0];n=j.fx[1]}else{g=n=j.fx}}function k(i,o){i.css("display","");if(!d.support.opacity&&o.opacity){i[0].style.removeAttribute("filter")}}var q=n?function(i,o){d(i).closest("li").addClass("ui-tabs-selected ui-state-active");o.hide().removeClass("ui-tabs-hide").animate(n,n.duration||"normal",function(){k(o,n);v._trigger("show",null,v._ui(i,o[0]))})}:function(i,o){d(i).closest("li").addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");v._trigger("show",null,v._ui(i,o[0]))};var r=g?function(o,i){i.animate(g,g.duration||"normal",function(){v.lis.removeClass("ui-tabs-selected ui-state-active");i.addClass("ui-tabs-hide");k(i,g);v.element.dequeue("tabs")})}:function(o,i,w){v.lis.removeClass("ui-tabs-selected ui-state-active");i.addClass("ui-tabs-hide");v.element.dequeue("tabs")};this.anchors.bind(j.event+".tabs",function(){var o=this,x=d(o).closest("li"),i=v.panels.filter(":not(.ui-tabs-hide)"),w=v.element.find(v._sanitizeSelector(o.hash));if((x.hasClass("ui-tabs-selected")&&!j.collapsible)||x.hasClass("ui-state-disabled")||x.hasClass("ui-state-processing")||v.panels.filter(":animated").length||v._trigger("select",null,v._ui(this,w[0]))===false){this.blur();return false}j.selected=v.anchors.index(this);v.abort();if(j.collapsible){if(x.hasClass("ui-tabs-selected")){j.selected=-1;if(j.cookie){v._cookie(j.selected,j.cookie)}v.element.queue("tabs",function(){r(o,i)}).dequeue("tabs");this.blur();return false}else{if(!i.length){if(j.cookie){v._cookie(j.selected,j.cookie)}v.element.queue("tabs",function(){q(o,w)});v.load(v.anchors.index(this));this.blur();return false}}}if(j.cookie){v._cookie(j.selected,j.cookie)}if(w.length){if(i.length){v.element.queue("tabs",function(){r(o,i)})}v.element.queue("tabs",function(){q(o,w)});v.load(v.anchors.index(this))}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(d.browser.msie){this.blur()}});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(g){if(typeof g=="string"){g=this.anchors.index(this.anchors.filter("[href$="+g+"]"))}return g},destroy:function(){var g=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h=d.data(this,"href.tabs");if(h){this.href=h}var i=d(this).unbind(".tabs");d.each(["href","load","cache"],function(j,k){i.removeData(k+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){if(d.data(this,"destroy.tabs")){d(this).remove()}else{d(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}});if(g.cookie){this._cookie(null,g.cookie)}return this},add:function(j,i,h){if(h===f){h=this.anchors.length}var g=this,l=this.options,n=d(l.tabTemplate.replace(/#\{href\}/g,j).replace(/#\{label\}/g,i)),m=!j.indexOf("#")?j.replace("#",""):this._tabId(d("a",n)[0]);n.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var k=g.element.find("#"+m);if(!k.length){k=d(l.panelTemplate).attr("id",m).data("destroy.tabs",true)}k.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(h>=this.lis.length){n.appendTo(this.list);k.appendTo(this.list[0].parentNode)}else{n.insertBefore(this.lis[h]);k.insertBefore(this.panels[h])}l.disabled=d.map(l.disabled,function(p,o){return p>=h?++p:p});this._tabify();if(this.anchors.length==1){l.selected=0;n.addClass("ui-tabs-selected ui-state-active");k.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){g._trigger("show",null,g._ui(g.anchors[0],g.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[h],this.panels[h]));return this},remove:function(g){g=this._getIndex(g);var i=this.options,j=this.lis.eq(g).remove(),h=this.panels.eq(g).remove();if(j.hasClass("ui-tabs-selected")&&this.anchors.length>1){this.select(g+(g+1<this.anchors.length?1:-1))}i.disabled=d.map(d.grep(i.disabled,function(l,k){return l!=g}),function(l,k){return l>=g?--l:l});this._tabify();this._trigger("remove",null,this._ui(j.find("a")[0],h[0]));return this},enable:function(g){g=this._getIndex(g);var h=this.options;if(d.inArray(g,h.disabled)==-1){return}this.lis.eq(g).removeClass("ui-state-disabled");h.disabled=d.grep(h.disabled,function(k,j){return k!=g});this._trigger("enable",null,this._ui(this.anchors[g],this.panels[g]));return this},disable:function(h){h=this._getIndex(h);var g=this,i=this.options;if(h!=i.selected){this.lis.eq(h).addClass("ui-state-disabled");i.disabled.push(h);i.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[h],this.panels[h]))}return this},select:function(g){g=this._getIndex(g);if(g==-1){if(this.options.collapsible&&this.options.selected!=-1){g=this.options.selected}else{return this}}this.anchors.eq(g).trigger(this.options.event+".tabs");return this},load:function(j){j=this._getIndex(j);var h=this,l=this.options,g=this.anchors.eq(j)[0],i=d.data(g,"load.tabs");this.abort();if(!i||this.element.queue("tabs").length!==0&&d.data(g,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(j).addClass("ui-state-processing");if(l.spinner){var k=d("span",g);k.data("label.tabs",k.html()).html(l.spinner)}this.xhr=d.ajax(d.extend({},l.ajaxOptions,{url:i,success:function(n,m){h.element.find(h._sanitizeSelector(g.hash)).html(n);h._cleanup();if(l.cache){d.data(g,"cache.tabs",true)}h._trigger("load",null,h._ui(h.anchors[j],h.panels[j]));try{l.ajaxOptions.success(n,m)}catch(o){}},error:function(o,m,n){h._cleanup();h._trigger("load",null,h._ui(h.anchors[j],h.panels[j]));try{l.ajaxOptions.error(o,m,j,g)}catch(n){}}}));h.element.dequeue("tabs");return this},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},url:function(h,g){this.anchors.eq(h).removeData("cache.tabs").data("load.tabs",g);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(i,k){var g=this,l=this.options;var h=g._rotate||(g._rotate=function(m){clearTimeout(g.rotation);g.rotation=setTimeout(function(){var n=l.selected;g.select(++n<g.anchors.length?n:0)},i);if(m){m.stopPropagation()}});var j=g._unrotate||(g._unrotate=!k?function(m){if(m.clientX){g.rotate(null)}}:function(m){t=l.selected;h()});if(i){this.element.bind("tabsshow",h);this.anchors.bind(l.event+".tabs",j);h()}else{clearTimeout(g.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(l.event+".tabs",j);delete this._rotate;delete this._unrotate}return this}})})(jQuery);(function($,undefined){$.extend($.ui,{datepicker:{version:"1.8.14"}});var PROP_NAME="datepicker";var dpuuid=new Date().getTime();var instActive;function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass="ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};$.extend(this._defaults,this.regional[""]);this.dpDiv=bindHover($('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){if(this.debug){console.log.apply("",arguments)}},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){this.uuid+=1;target.id="dp"+this.uuid}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:bindHover($('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}},_connectDatepicker:function(target,inst){var input=$(target);inst.append=$([]);inst.trigger=$([]);if(input.hasClass(this.markerClassName)){return}this._attachments(input,inst);input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});this._autoSize(inst);$.data(target,PROP_NAME,inst)},_attachments:function(input,inst){var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(inst.append){inst.append.remove()}if(appendText){inst.append=$('<span class="'+this._appendClass+'">'+appendText+"</span>");input[isRTL?"before":"after"](inst.append)}input.unbind("focus",this._showDatepicker);if(inst.trigger){inst.trigger.remove()}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");inst.trigger=$(this._get(inst,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('<button type="button"></button>').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("<img/>").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](inst.trigger);inst.trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==input[0]){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(input[0])}return false})}},_autoSize:function(inst){if(this._get(inst,"autoSize")&&!inst.inline){var date=new Date(2009,12-1,20);var dateFormat=this._get(inst,"dateFormat");if(dateFormat.match(/[DM]/)){var findMax=function(names){var max=0;var maxI=0;for(var i=0;i<names.length;i++){if(names[i].length>max){max=names[i].length;maxI=i}}return maxI};date.setMonth(findMax(this._get(inst,(dateFormat.match(/MM/)?"monthNames":"monthNamesShort"))));date.setDate(findMax(this._get(inst,(dateFormat.match(/DD/)?"dayNames":"dayNamesShort")))+20-date.getDay())}inst.input.attr("size",this._formatDate(inst,date).length)}},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return}divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst),true);this._updateDatepicker(inst);this._updateAlternate(inst);inst.dpDiv.show()},_dialogDatepicker:function(input,date,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){this.uuid+=1;var id="dp"+this.uuid;this._dialogInput=$('<input type="text" id="'+id+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});date=(date&&date.constructor==Date?this._formatDate(inst,date):date);this._dialogInput.val(date);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=document.documentElement.clientWidth;var browserHeight=document.documentElement.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",(this._pos[0]+20)+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){inst.append.remove();inst.trigger.remove();$target.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;inst.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().removeClass("ui-state-disabled");inline.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;inst.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().addClass("ui-state-disabled");inline.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i<this._disabledInputs.length;i++){if(this._disabledInputs[i]==target){return true}}return false},_getInst:function(target){try{return $.data(target,PROP_NAME)}catch(err){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(target,name,value){var inst=this._getInst(target);if(arguments.length==2&&typeof name=="string"){return(name=="defaults"?$.extend({},$.datepicker._defaults):(inst?(name=="all"?$.extend({},inst.settings):this._get(inst,name)):null))}var settings=name||{};if(typeof name=="string"){settings={};settings[name]=value}if(inst){if(this._curInst==inst){this._hideDatepicker()}var date=this._getDateDatepicker(target,true);var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");extendRemove(inst.settings,settings);if(minDate!==null&&settings.dateFormat!==undefined&&settings.minDate===undefined){inst.settings.minDate=this._formatDate(inst,minDate)}if(maxDate!==null&&settings.dateFormat!==undefined&&settings.maxDate===undefined){inst.settings.maxDate=this._formatDate(inst,maxDate)}this._attachments($(target),inst);this._autoSize(inst);this._setDate(inst,date);this._updateAlternate(inst);this._updateDatepicker(inst)}},_changeDatepicker:function(target,name,value){this._optionDatepicker(target,name,value)},_refreshDatepicker:function(target){var inst=this._getInst(target);if(inst){this._updateDatepicker(inst)}},_setDateDatepicker:function(target,date){var inst=this._getInst(target);if(inst){this._setDate(inst,date);this._updateDatepicker(inst);this._updateAlternate(inst)}},_getDateDatepicker:function(target,noDefault){var inst=this._getInst(target);if(inst&&!inst.inline){this._setDateFromField(inst,noDefault)}return(inst?this._getDate(inst):null)},_doKeyDown:function(event){var inst=$.datepicker._getInst(event.target);var handled=true;var isRTL=inst.dpDiv.is(".ui-datepicker-rtl");inst._keyEvent=true;if($.datepicker._datepickerShowing){switch(event.keyCode){case 9:$.datepicker._hideDatepicker();handled=false;break;case 13:var sel=$("td."+$.datepicker._dayOverClass+":not(."+$.datepicker._currentClass+")",inst.dpDiv);if(sel[0]){$.datepicker._selectDay(event.target,inst.selectedMonth,inst.selectedYear,sel[0])}else{$.datepicker._hideDatepicker()}return false;break;case 27:$.datepicker._hideDatepicker();break;case 33:$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M");break;case 34:$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M");break;case 35:if(event.ctrlKey||event.metaKey){$.datepicker._clearDate(event.target)}handled=event.ctrlKey||event.metaKey;break;case 36:if(event.ctrlKey||event.metaKey){$.datepicker._gotoToday(event.target)}handled=event.ctrlKey||event.metaKey;break;case 37:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?+1:-1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M")}break;case 38:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,-7,"D")}handled=event.ctrlKey||event.metaKey;break;case 39:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?-1:+1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M")}break;case 40:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,+7,"D")}handled=event.ctrlKey||event.metaKey;break;default:handled=false}}else{if(event.keyCode==36&&event.ctrlKey){$.datepicker._showDatepicker(this)}else{handled=false}}if(handled){event.preventDefault();event.stopPropagation()}},_doKeyPress:function(event){var inst=$.datepicker._getInst(event.target);if($.datepicker._get(inst,"constrainInput")){var chars=$.datepicker._possibleChars($.datepicker._get(inst,"dateFormat"));var chr=String.fromCharCode(event.charCode==undefined?event.keyCode:event.charCode);return event.ctrlKey||event.metaKey||(chr<" "||!chars||chars.indexOf(chr)>-1)}},_doKeyUp:function(event){var inst=$.datepicker._getInst(event.target);if(inst.input.val()!=inst.lastVal){try{var date=$.datepicker.parseDate($.datepicker._get(inst,"dateFormat"),(inst.input?inst.input.val():null),$.datepicker._getFormatConfig(inst));if(date){$.datepicker._setDateFromField(inst);$.datepicker._updateAlternate(inst);$.datepicker._updateDatepicker(inst)}}catch(event){$.datepicker.log(event)}}return true},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);if($.datepicker._curInst&&$.datepicker._curInst!=inst){if($.datepicker._datepickerShowing){$.datepicker._triggerOnClose($.datepicker._curInst)}$.datepicker._curInst.dpDiv.stop(true,true)}var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));inst.lastVal=null;$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.dpDiv.empty();inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim");var duration=$.datepicker._get(inst,"duration");var postProcess=function(){var cover=inst.dpDiv.find("iframe.ui-datepicker-cover");if(!!cover.length){var borders=$.datepicker._getBorders(inst.dpDiv);cover.css({left:-borders[0],top:-borders[1],width:inst.dpDiv.outerWidth(),height:inst.dpDiv.outerHeight()})}};inst.dpDiv.zIndex($(input).zIndex()+1);$.datepicker._datepickerShowing=true;if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim||"show"]((showAnim?duration:null),postProcess)}if(!showAnim||!duration){postProcess()}if(inst.input.is(":visible")&&!inst.input.is(":disabled")){inst.input.focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var self=this;self.maxRows=4;var borders=$.datepicker._getBorders(inst.dpDiv);instActive=inst;inst.dpDiv.empty().append(this._generateHTML(inst));var cover=inst.dpDiv.find("iframe.ui-datepicker-cover");if(!!cover.length){cover.css({left:-borders[0],top:-borders[1],width:inst.dpDiv.outerWidth(),height:inst.dpDiv.outerHeight()})}inst.dpDiv.find("."+this._dayOverClass+" a").mouseover();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst==$.datepicker._curInst&&$.datepicker._datepickerShowing&&inst.input&&inst.input.is(":visible")&&!inst.input.is(":disabled")&&inst.input[0]!=document.activeElement){inst.input.focus()}if(inst.yearshtml){var origyearshtml=inst.yearshtml;setTimeout(function(){if(origyearshtml===inst.yearshtml&&inst.yearshtml){inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml)}origyearshtml=inst.yearshtml=null},0)}},_getBorders:function(elem){var convert=function(value){return{thin:1,medium:2,thick:3}[value]||value};return[parseFloat(convert(elem.css("border-left-width"))),parseFloat(convert(elem.css("border-top-width")))]},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=document.documentElement.clientWidth+$(document).scrollLeft();var viewHeight=document.documentElement.clientHeight+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=Math.min(offset.left,(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0);offset.top-=Math.min(offset.top,(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(dpHeight+inputHeight):0);return offset},_findPos:function(obj){var inst=this._getInst(obj);var isRTL=this._get(inst,"isRTL");while(obj&&(obj.type=="hidden"||obj.nodeType!=1||$.expr.filters.hidden(obj))){obj=obj[isRTL?"previousSibling":"nextSibling"]}var position=$(obj).offset();return[position.left,position.top]},_triggerOnClose:function(inst){var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}},_hideDatepicker:function(input){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(this._datepickerShowing){var showAnim=this._get(inst,"showAnim");var duration=this._get(inst,"duration");var postProcess=function(){$.datepicker._tidyDialog(inst);this._curInst=null};if($.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide"))]((showAnim?duration:null),postProcess)}if(!showAnim){postProcess()}$.datepicker._triggerOnClose(inst);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if($target[0].id!=$.datepicker._mainDivId&&$target.parents("#"+$.datepicker._mainDivId).length==0&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker()}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear){setTimeout(function(){inst.input.focus()},0)}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{this._hideDatepicker();this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input.focus()}this._lastInput=null}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);var dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getTime());checkDate.setDate(checkDate.getDate()+4-(checkDate.getDay()||7));var time=checkDate.getTime();checkDate.setMonth(0);checkDate.setDate(1);return Math.floor(Math.round((time-checkDate)/86400000)/7)+1},parseDate:function(format,value,settings){if(format==null||value==null){throw"Invalid arguments"}value=(typeof value=="object"?value.toString():value+"");if(value==""){return null}var shortYearCutoff=(settings?settings.shortYearCutoff:null)||this._defaults.shortYearCutoff;shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var year=-1;var month=-1;var day=-1;var doy=-1;var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var getNumber=function(match){var isDoubled=lookAhead(match);var size=(match=="@"?14:(match=="!"?20:(match=="y"&&isDoubled?4:(match=="o"?3:2))));var digits=new RegExp("^\\d{1,"+size+"}");var num=value.substring(iValue).match(digits);if(!num){throw"Missing number at position "+iValue}iValue+=num[0].length;return parseInt(num[0],10)};var getName=function(match,shortNames,longNames){var names=$.map(lookAhead(match)?longNames:shortNames,function(v,k){return[[k,v]]}).sort(function(a,b){return -(a[1].length-b[1].length)});var index=-1;$.each(names,function(i,pair){var name=pair[1];if(value.substr(iValue,name.length).toLowerCase()==name.toLowerCase()){index=pair[0];iValue+=name.length;return false}});if(index!=-1){return index+1}else{throw"Unknown name at position "+iValue}};var checkLiteral=function(){if(value.charAt(iValue)!=format.charAt(iFormat)){throw"Unexpected literal at position "+iValue}iValue++};var iValue=0;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{checkLiteral()}}else{switch(format.charAt(iFormat)){case"d":day=getNumber("d");break;case"D":getName("D",dayNamesShort,dayNames);break;case"o":doy=getNumber("o");break;case"m":month=getNumber("m");break;case"M":month=getName("M",monthNamesShort,monthNames);break;case"y":year=getNumber("y");break;case"@":var date=new Date(getNumber("@"));year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"!":var date=new Date((getNumber("!")-this._ticksTo1970)/10000);year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"'":if(lookAhead("'")){checkLiteral()}else{literal=true}break;default:checkLiteral()}}}if(iValue<value.length){throw"Extra/unparsed characters found in date: "+value.substring(iValue)}if(year==-1){year=new Date().getFullYear()}else{if(year<100){year+=new Date().getFullYear()-new Date().getFullYear()%100+(year<=shortYearCutoff?0:-100)}}if(doy>-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(((1970-1)*365+Math.floor(1970/4)-Math.floor(1970/100)+Math.floor(1970/400))*24*60*60*10000000),formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var formatNumber=function(match,value,len){var num=""+value;if(lookAhead(match)){while(num.length<len){num="0"+num}}return num};var formatName=function(match,value,shortNames,longNames){return(lookAhead(match)?longNames[value]:shortNames[value])};var output="";var literal=false;if(date){for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{output+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":output+=formatNumber("d",date.getDate(),2);break;case"D":output+=formatName("D",date.getDay(),dayNamesShort,dayNames);break;case"o":output+=formatNumber("o",Math.round((new Date(date.getFullYear(),date.getMonth(),date.getDate()).getTime()-new Date(date.getFullYear(),0,0).getTime())/86400000),3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"!":output+=date.getTime()*10000+this._ticksTo1970;break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{chars+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":case"m":case"y":case"@":chars+="0123456789";break;case"D":case"M":return null;case"'":if(lookAhead("'")){chars+="'"}else{literal=true}break;default:chars+=format.charAt(iFormat)}}}return chars},_get:function(inst,name){return inst.settings[name]!==undefined?inst.settings[name]:this._defaults[name]},_setDateFromField:function(inst,noDefault){if(inst.input.val()==inst.lastVal){return}var dateFormat=this._get(inst,"dateFormat");var dates=inst.lastVal=inst.input?inst.input.val():null;var date,defaultDate;date=defaultDate=this._getDefaultDate(inst);var settings=this._getFormatConfig(inst);try{date=this.parseDate(dateFormat,dates,settings)||defaultDate}catch(event){this.log(event);dates=(noDefault?"":dates)}inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();inst.currentDay=(dates?date.getDate():0);inst.currentMonth=(dates?date.getMonth():0);inst.currentYear=(dates?date.getFullYear():0);this._adjustInstDate(inst)},_getDefaultDate:function(inst){return this._restrictMinMax(inst,this._determineDate(inst,this._get(inst,"defaultDate"),new Date()))},_determineDate:function(inst,date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset){try{return $.datepicker.parseDate($.datepicker._get(inst,"dateFormat"),offset,$.datepicker._getFormatConfig(inst))}catch(e){}var date=(offset.toLowerCase().match(/^c/)?$.datepicker._getDate(inst):null)||new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,$.datepicker._getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,$.datepicker._getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};var newDate=(date==null||date===""?defaultDate:(typeof date=="string"?offsetString(date):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):new Date(date.getTime()))));newDate=(newDate&&newDate.toString()=="Invalid Date"?defaultDate:newDate);if(newDate){newDate.setHours(0);newDate.setMinutes(0);newDate.setSeconds(0);newDate.setMilliseconds(0)}return this._daylightSavingAdjust(newDate)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,noChange){var clear=!date;var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;var newDate=this._restrictMinMax(inst,this._determineDate(inst,date,new Date()));inst.selectedDay=inst.currentDay=newDate.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=newDate.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=newDate.getFullYear();if((origMonth!=inst.selectedMonth||origYear!=inst.selectedYear)&&!noChange){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-(numMonths[0]*numMonths[1])+1,maxDate.getDate()));maxDraw=(minDate&&maxDraw<minDate?minDate:maxDraw);while(this._daylightSavingAdjust(new Date(drawYear,drawMonth,1))>maxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+inst.id+"', -"+stepMonths+", 'M');\" title=\""+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>"));var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._adjustDate('#"+inst.id+"', +"+stepMonths+", 'M');\" title=\""+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>"));var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls=(!inst.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+dpuuid+'.datepicker._hideDatepicker();">'+this._get(inst,"closeText")+"</button>":"");var buttonPanel=(showButtonPanel)?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+dpuuid+".datepicker._gotoToday('#"+inst.id+"');\">"+currentText+"</button>":"")+(isRTL?"":controls)+"</div>":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var showWeek=this._get(inst,"showWeek");var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var selectOtherMonths=this._get(inst,"selectOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row<numMonths[0];row++){var group="";this.maxRows=4;for(var col=0;col<numMonths[1];col++){var selectedDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,inst.selectedDay));var cornerClass=" ui-corner-all";var calender="";if(isMultiMonth){calender+='<div class="ui-datepicker-group';if(numMonths[1]>1){switch(col){case 0:calender+=" ui-datepicker-group-first";cornerClass=" ui-corner-"+(isRTL?"right":"left");break;case numMonths[1]-1:calender+=" ui-datepicker-group-last";cornerClass=" ui-corner-"+(isRTL?"left":"right");break;default:calender+=" ui-datepicker-group-middle";cornerClass="";break}}calender+='">'}calender+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+cornerClass+'">'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,row>0||col>0,monthNames,monthNamesShort)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var thead=(showWeek?'<th class="ui-datepicker-week-col">'+this._get(inst,"weekHeader")+"</th>":"");for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="<th"+((dow+firstDay+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+dayNames[day]+'">'+dayNamesMin[day]+"</span></th>"}calender+=thead+"</tr></thead><tbody>";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var curRows=Math.ceil((leadDays+daysInMonth)/7);var numRows=(isMultiMonth?this.maxRows>curRows?this.maxRows:curRows:curRows);this.maxRows=numRows;var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow<numRows;dRow++){calender+="<tr>";var tbody=(!showWeek?"":'<td class="ui-datepicker-week-col">'+this._get(inst,"calculateWeek")(printDate)+"</td>");for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=(otherMonth&&!selectOtherMonths)||!daySettings[0]||(minDate&&printDate<minDate)||(maxDate&&printDate>maxDate);tbody+='<td class="'+((dow+firstDay+6)%7>=5?" ui-datepicker-week-end":"")+(otherMonth?" ui-datepicker-other-month":"")+((printDate.getTime()==selectedDate.getTime()&&drawMonth==inst.selectedMonth&&inst._keyEvent)||(defaultDate.getTime()==printDate.getTime()&&defaultDate.getTime()==selectedDate.getTime())?" "+this._dayOverClass:"")+(unselectable?" "+this._unselectableClass+" ui-state-disabled":"")+(otherMonth&&!showOtherMonths?"":" "+daySettings[1]+(printDate.getTime()==currentDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":' onclick="DP_jQuery_'+dpuuid+".datepicker._selectDay('#"+inst.id+"',"+printDate.getMonth()+","+printDate.getFullYear()+', this);return false;"')+">"+(otherMonth&&!showOtherMonths?" ":(unselectable?'<span class="ui-state-default">'+printDate.getDate()+"</span>":'<a class="ui-state-default'+(printDate.getTime()==today.getTime()?" ui-state-highlight":"")+(printDate.getTime()==currentDate.getTime()?" ui-state-active":"")+(otherMonth?" ui-priority-secondary":"")+'" href="#">'+printDate.getDate()+"</a>"))+"</td>";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+"</tr>"}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="</tbody></table>"+(isMultiMonth?"</div>"+((numMonths[0]>0&&col==numMonths[1]-1)?'<div class="ui-datepicker-row-break"></div>':""):"");group+=calender}html+=group}html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,secondary,monthNames,monthNamesShort){var changeMonth=this._get(inst,"changeMonth");var changeYear=this._get(inst,"changeYear");var showMonthAfterYear=this._get(inst,"showMonthAfterYear");var html='<div class="ui-datepicker-title">';var monthHtml="";if(secondary||!changeMonth){monthHtml+='<span class="ui-datepicker-month">'+monthNames[drawMonth]+"</span>"}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+inst.id+"', this, 'M');\" onclick=\"DP_jQuery_"+dpuuid+".datepicker._clickMonthYear('#"+inst.id+"');\">";for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth())){monthHtml+='<option value="'+month+'"'+(month==drawMonth?' selected="selected"':"")+">"+monthNamesShort[month]+"</option>"}}monthHtml+="</select>"}if(!showMonthAfterYear){html+=monthHtml+(secondary||!(changeMonth&&changeYear)?" ":"")}if(!inst.yearshtml){inst.yearshtml="";if(secondary||!changeYear){html+='<span class="ui-datepicker-year">'+drawYear+"</span>"}else{var years=this._get(inst,"yearRange").split(":");var thisYear=new Date().getFullYear();var determineYear=function(value){var year=(value.match(/c[+-].*/)?drawYear+parseInt(value.substring(1),10):(value.match(/[+-].*/)?thisYear+parseInt(value,10):parseInt(value,10)));return(isNaN(year)?thisYear:year)};var year=determineYear(years[0]);var endYear=Math.max(year,determineYear(years[1]||""));year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);inst.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+dpuuid+".datepicker._selectMonthYear('#"+inst.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+dpuuid+".datepicker._clickMonthYear('#"+inst.id+"');\">";for(;year<=endYear;year++){inst.yearshtml+='<option value="'+year+'"'+(year==drawYear?' selected="selected"':"")+">"+year+"</option>"}inst.yearshtml+="</select>";html+=inst.yearshtml;inst.yearshtml=null}}html+=this._get(inst,"yearSuffix");if(showMonthAfterYear){html+=(secondary||!(changeMonth&&changeYear)?" ":"")+monthHtml}html+="</div>";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._restrictMinMax(inst,this._daylightSavingAdjust(new Date(year,month,day)));inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_restrictMinMax:function(inst,date){var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");var newDate=(minDate&&date<minDate?minDate:date);newDate=(maxDate&&newDate>maxDate?maxDate:newDate);return newDate},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax){return this._determineDate(inst,this._get(inst,minMax+"Date"),null)},_getDaysInMonth:function(year,month){return 32-this._daylightSavingAdjust(new Date(year,month,32)).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[0]*numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var minDate=this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");return((!minDate||date.getTime()>=minDate.getTime())&&(!maxDate||date.getTime()<=maxDate.getTime()))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function bindHover(dpDiv){var selector="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return dpDiv.bind("mouseout",function(event){var elem=$(event.target).closest(selector);if(!elem.length){return}elem.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(event){var elem=$(event.target).closest(selector);if($.datepicker._isDisabledDatepicker(instActive.inline?dpDiv.parent()[0]:instActive.input[0])||!elem.length){return}elem.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");elem.addClass("ui-state-hover");if(elem.hasClass("ui-datepicker-prev")){elem.addClass("ui-datepicker-prev-hover")}if(elem.hasClass("ui-datepicker-next")){elem.addClass("ui-datepicker-next-hover")}})}function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!this.length){return this}if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate"||options=="widget")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}if(options=="option"&&arguments.length==2&&typeof arguments[1]=="string"){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.8.14";window["DP_jQuery_"+dpuuid]=$})(jQuery);(function(a,b){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===b){return this._value()}this._setOption("value",c);return this},_setOption:function(c,d){if(c==="value"){this.options.value=d;this._refreshValue();if(this._value()===this.options.max){this._trigger("complete")}}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number"){c=0}return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var d=this.value();var c=this._percentage();if(this.oldValue!==d){this.oldValue=d;this._trigger("change")}this.valueDiv.toggle(d>this.min).toggleClass("ui-corner-right",d===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",d)}});a.extend(a.ui.progressbar,{version:"1.8.14"})})(jQuery);jQuery.effects||(function(h,e){h.effects={};h.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(n,m){h.fx.step[m]=function(o){if(!o.colorInit){o.start=l(o.elem,m);o.end=j(o.end);o.colorInit=true}o.elem.style[m]="rgb("+Math.max(Math.min(parseInt((o.pos*(o.end[0]-o.start[0]))+o.start[0],10),255),0)+","+Math.max(Math.min(parseInt((o.pos*(o.end[1]-o.start[1]))+o.start[1],10),255),0)+","+Math.max(Math.min(parseInt((o.pos*(o.end[2]-o.start[2]))+o.start[2],10),255),0)+")"}});function j(n){var m;if(n&&n.constructor==Array&&n.length==3){return n}if(m=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(n)){return[parseInt(m[1],10),parseInt(m[2],10),parseInt(m[3],10)]}if(m=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(n)){return[parseFloat(m[1])*2.55,parseFloat(m[2])*2.55,parseFloat(m[3])*2.55]}if(m=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(n)){return[parseInt(m[1],16),parseInt(m[2],16),parseInt(m[3],16)]}if(m=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(n)){return[parseInt(m[1]+m[1],16),parseInt(m[2]+m[2],16),parseInt(m[3]+m[3],16)]}if(m=/rgba\(0, 0, 0, 0\)/.exec(n)){return a.transparent}return a[h.trim(n).toLowerCase()]}function l(o,m){var n;do{n=h.curCSS(o,m);if(n!=""&&n!="transparent"||h.nodeName(o,"body")){break}m="backgroundColor"}while(o=o.parentNode);return j(n)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};var f=["add","remove","toggle"],c={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};function g(){var p=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,q={},n,o;if(p&&p.length&&p[0]&&p[p[0]]){var m=p.length;while(m--){n=p[m];if(typeof p[n]=="string"){o=n.replace(/\-(\w)/g,function(r,s){return s.toUpperCase()});q[o]=p[n]}}}else{for(n in p){if(typeof p[n]==="string"){q[n]=p[n]}}}return q}function b(n){var m,o;for(m in n){o=n[m];if(o==null||h.isFunction(o)||m in c||(/scrollbar/).test(m)||(!(/color/i).test(m)&&isNaN(parseFloat(o)))){delete n[m]}}return n}function i(m,o){var p={_:0},n;for(n in o){if(m[n]!=o[n]){p[n]=o[n]}}return p}h.effects.animateClass=function(m,n,p,o){if(h.isFunction(p)){o=p;p=null}return this.queue(function(){var u=h(this),q=u.attr("style")||" ",v=b(g.call(this)),s,r=u.attr("class");h.each(f,function(w,x){if(m[x]){u[x+"Class"](m[x])}});s=b(g.call(this));u.attr("class",r);u.animate(i(v,s),{queue:false,duration:n,easing:p,complete:function(){h.each(f,function(w,x){if(m[x]){u[x+"Class"](m[x])}});if(typeof u.attr("style")=="object"){u.attr("style").cssText="";u.attr("style").cssText=q}else{u.attr("style",q)}if(o){o.apply(this,arguments)}h.dequeue(this)}})})};h.fn.extend({_addClass:h.fn.addClass,addClass:function(n,m,p,o){return m?h.effects.animateClass.apply(this,[{add:n},m,p,o]):this._addClass(n)},_removeClass:h.fn.removeClass,removeClass:function(n,m,p,o){return m?h.effects.animateClass.apply(this,[{remove:n},m,p,o]):this._removeClass(n)},_toggleClass:h.fn.toggleClass,toggleClass:function(o,n,m,q,p){if(typeof n=="boolean"||n===e){if(!m){return this._toggleClass(o,n)}else{return h.effects.animateClass.apply(this,[(n?{add:o}:{remove:o}),m,q,p])}}else{return h.effects.animateClass.apply(this,[{toggle:o},n,m,q])}},switchClass:function(m,o,n,q,p){return h.effects.animateClass.apply(this,[{add:o,remove:m},n,q,p])}});h.extend(h.effects,{version:"1.8.14",save:function(n,o){for(var m=0;m<o.length;m++){if(o[m]!==null){n.data("ec.storage."+o[m],n[0].style[o[m]])}}},restore:function(n,o){for(var m=0;m<o.length;m++){if(o[m]!==null){n.css(o[m],n.data("ec.storage."+o[m]))}}},setMode:function(m,n){if(n=="toggle"){n=m.is(":hidden")?"show":"hide"}return n},getBaseline:function(n,o){var p,m;switch(n[0]){case"top":p=0;break;case"middle":p=0.5;break;case"bottom":p=1;break;default:p=n[0]/o.height}switch(n[1]){case"left":m=0;break;case"center":m=0.5;break;case"right":m=1;break;default:m=n[1]/o.width}return{x:m,y:p}},createWrapper:function(m){if(m.parent().is(".ui-effects-wrapper")){return m.parent()}var n={width:m.outerWidth(true),height:m.outerHeight(true),"float":m.css("float")},o=h("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});m.wrap(o);o=m.parent();if(m.css("position")=="static"){o.css({position:"relative"});m.css({position:"relative"})}else{h.extend(n,{position:m.css("position"),zIndex:m.css("z-index")});h.each(["top","left","bottom","right"],function(p,q){n[q]=m.css(q);if(isNaN(parseInt(n[q],10))){n[q]="auto"}});m.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return o.css(n).show()},removeWrapper:function(m){if(m.parent().is(".ui-effects-wrapper")){return m.parent().replaceWith(m)}return m},setTransition:function(n,p,m,o){o=o||{};h.each(p,function(r,q){unit=n.cssUnit(q);if(unit[0]>0){o[q]=unit[0]*m+unit[1]}});return o}});function d(n,m,o,p){if(typeof n=="object"){p=m;o=null;m=n;n=m.effect}if(h.isFunction(m)){p=m;o=null;m={}}if(typeof m=="number"||h.fx.speeds[m]){p=o;o=m;m={}}if(h.isFunction(o)){p=o;o=null}m=m||{};o=o||m.duration;o=h.fx.off?0:typeof o=="number"?o:o in h.fx.speeds?h.fx.speeds[o]:h.fx.speeds._default;p=p||m.complete;return[n,m,o,p]}function k(m){if(!m||typeof m==="number"||h.fx.speeds[m]){return true}if(typeof m==="string"&&!h.effects[m]){return true}return false}h.fn.extend({effect:function(p,o,r,u){var n=d.apply(this,arguments),q={options:n[1],duration:n[2],callback:n[3]},s=q.options.mode,m=h.effects[p];if(h.fx.off||!m){if(s){return this[s](q.duration,q.callback)}else{return this.each(function(){if(q.callback){q.callback.call(this)}})}}return m.call(this,q)},_show:h.fn.show,show:function(n){if(k(n)){return this._show.apply(this,arguments)}else{var m=d.apply(this,arguments);m[1].mode="show";return this.effect.apply(this,m)}},_hide:h.fn.hide,hide:function(n){if(k(n)){return this._hide.apply(this,arguments)}else{var m=d.apply(this,arguments);m[1].mode="hide";return this.effect.apply(this,m)}},__toggle:h.fn.toggle,toggle:function(n){if(k(n)||typeof n==="boolean"||h.isFunction(n)){return this.__toggle.apply(this,arguments)}else{var m=d.apply(this,arguments);m[1].mode="toggle";return this.effect.apply(this,m)}},cssUnit:function(m){var n=this.css(m),o=[];h.each(["em","px","%","pt"],function(p,q){if(n.indexOf(q)>0){o=[parseFloat(n),q]}});return o}});h.easing.jswing=h.easing.swing;h.extend(h.easing,{def:"easeOutQuad",swing:function(n,o,m,q,p){return h.easing[h.easing.def](n,o,m,q,p)},easeInQuad:function(n,o,m,q,p){return q*(o/=p)*o+m},easeOutQuad:function(n,o,m,q,p){return -q*(o/=p)*(o-2)+m},easeInOutQuad:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o+m}return -q/2*((--o)*(o-2)-1)+m},easeInCubic:function(n,o,m,q,p){return q*(o/=p)*o*o+m},easeOutCubic:function(n,o,m,q,p){return q*((o=o/p-1)*o*o+1)+m},easeInOutCubic:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o*o+m}return q/2*((o-=2)*o*o+2)+m},easeInQuart:function(n,o,m,q,p){return q*(o/=p)*o*o*o+m},easeOutQuart:function(n,o,m,q,p){return -q*((o=o/p-1)*o*o*o-1)+m},easeInOutQuart:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o*o*o+m}return -q/2*((o-=2)*o*o*o-2)+m},easeInQuint:function(n,o,m,q,p){return q*(o/=p)*o*o*o*o+m},easeOutQuint:function(n,o,m,q,p){return q*((o=o/p-1)*o*o*o*o+1)+m},easeInOutQuint:function(n,o,m,q,p){if((o/=p/2)<1){return q/2*o*o*o*o*o+m}return q/2*((o-=2)*o*o*o*o+2)+m},easeInSine:function(n,o,m,q,p){return -q*Math.cos(o/p*(Math.PI/2))+q+m},easeOutSine:function(n,o,m,q,p){return q*Math.sin(o/p*(Math.PI/2))+m},easeInOutSine:function(n,o,m,q,p){return -q/2*(Math.cos(Math.PI*o/p)-1)+m},easeInExpo:function(n,o,m,q,p){return(o==0)?m:q*Math.pow(2,10*(o/p-1))+m},easeOutExpo:function(n,o,m,q,p){return(o==p)?m+q:q*(-Math.pow(2,-10*o/p)+1)+m},easeInOutExpo:function(n,o,m,q,p){if(o==0){return m}if(o==p){return m+q}if((o/=p/2)<1){return q/2*Math.pow(2,10*(o-1))+m}return q/2*(-Math.pow(2,-10*--o)+2)+m},easeInCirc:function(n,o,m,q,p){return -q*(Math.sqrt(1-(o/=p)*o)-1)+m},easeOutCirc:function(n,o,m,q,p){return q*Math.sqrt(1-(o=o/p-1)*o)+m},easeInOutCirc:function(n,o,m,q,p){if((o/=p/2)<1){return -q/2*(Math.sqrt(1-o*o)-1)+m}return q/2*(Math.sqrt(1-(o-=2)*o)+1)+m},easeInElastic:function(n,q,m,w,v){var r=1.70158;var u=0;var o=w;if(q==0){return m}if((q/=v)==1){return m+w}if(!u){u=v*0.3}if(o<Math.abs(w)){o=w;var r=u/4}else{var r=u/(2*Math.PI)*Math.asin(w/o)}return -(o*Math.pow(2,10*(q-=1))*Math.sin((q*v-r)*(2*Math.PI)/u))+m},easeOutElastic:function(n,q,m,w,v){var r=1.70158;var u=0;var o=w;if(q==0){return m}if((q/=v)==1){return m+w}if(!u){u=v*0.3}if(o<Math.abs(w)){o=w;var r=u/4}else{var r=u/(2*Math.PI)*Math.asin(w/o)}return o*Math.pow(2,-10*q)*Math.sin((q*v-r)*(2*Math.PI)/u)+w+m},easeInOutElastic:function(n,q,m,w,v){var r=1.70158;var u=0;var o=w;if(q==0){return m}if((q/=v/2)==2){return m+w}if(!u){u=v*(0.3*1.5)}if(o<Math.abs(w)){o=w;var r=u/4}else{var r=u/(2*Math.PI)*Math.asin(w/o)}if(q<1){return -0.5*(o*Math.pow(2,10*(q-=1))*Math.sin((q*v-r)*(2*Math.PI)/u))+m}return o*Math.pow(2,-10*(q-=1))*Math.sin((q*v-r)*(2*Math.PI)/u)*0.5+w+m},easeInBack:function(n,o,m,r,q,p){if(p==e){p=1.70158}return r*(o/=q)*o*((p+1)*o-p)+m},easeOutBack:function(n,o,m,r,q,p){if(p==e){p=1.70158}return r*((o=o/q-1)*o*((p+1)*o+p)+1)+m},easeInOutBack:function(n,o,m,r,q,p){if(p==e){p=1.70158}if((o/=q/2)<1){return r/2*(o*o*(((p*=(1.525))+1)*o-p))+m}return r/2*((o-=2)*o*(((p*=(1.525))+1)*o+p)+2)+m},easeInBounce:function(n,o,m,q,p){return q-h.easing.easeOutBounce(n,p-o,0,q,p)+m},easeOutBounce:function(n,o,m,q,p){if((o/=p)<(1/2.75)){return q*(7.5625*o*o)+m}else{if(o<(2/2.75)){return q*(7.5625*(o-=(1.5/2.75))*o+0.75)+m}else{if(o<(2.5/2.75)){return q*(7.5625*(o-=(2.25/2.75))*o+0.9375)+m}else{return q*(7.5625*(o-=(2.625/2.75))*o+0.984375)+m}}}},easeInOutBounce:function(n,o,m,q,p){if(o<p/2){return h.easing.easeInBounce(n,o*2,0,q,p)*0.5+m}return h.easing.easeOutBounce(n,o*2-p,0,q,p)*0.5+q*0.5+m}})})(jQuery);(function(a,b){a.effects.blind=function(c){return this.queue(function(){var e=a(this),d=["position","top","bottom","left","right"];var i=a.effects.setMode(e,c.options.mode||"hide");var h=c.options.direction||"vertical";a.effects.save(e,d);e.show();var k=a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="vertical")?"height":"width";var j=(h=="vertical")?k.height():k.width();if(i=="show"){k.css(f,0)}var g={};g[f]=i=="show"?j:0;k.animate(g,c.duration,c.options.easing,function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(c.callback){c.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);(function(a,b){a.effects.bounce=function(c){return this.queue(function(){var f=a(this),m=["position","top","bottom","left","right"];var l=a.effects.setMode(f,c.options.mode||"effect");var o=c.options.direction||"up";var d=c.options.distance||20;var e=c.options.times||5;var h=c.duration||250;if(/show|hide/.test(l)){m.push("opacity")}a.effects.save(f,m);f.show();a.effects.createWrapper(f);var g=(o=="up"||o=="down")?"top":"left";var q=(o=="up"||o=="left")?"pos":"neg";var d=c.options.distance||(g=="top"?f.outerHeight({margin:true})/3:f.outerWidth({margin:true})/3);if(l=="show"){f.css("opacity",0).css(g,q=="pos"?-d:d)}if(l=="hide"){d=d/(e*2)}if(l!="hide"){e--}if(l=="show"){var j={opacity:1};j[g]=(q=="pos"?"+=":"-=")+d;f.animate(j,h/2,c.options.easing);d=d/2;e--}for(var k=0;k<e;k++){var p={},n={};p[g]=(q=="pos"?"-=":"+=")+d;n[g]=(q=="pos"?"+=":"-=")+d;f.animate(p,h/2,c.options.easing).animate(n,h/2,c.options.easing);d=(l=="hide")?d*2:d/2}if(l=="hide"){var j={opacity:0};j[g]=(q=="pos"?"-=":"+=")+d;f.animate(j,h/2,c.options.easing,function(){f.hide();a.effects.restore(f,m);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}})}else{var p={},n={};p[g]=(q=="pos"?"-=":"+=")+d;n[g]=(q=="pos"?"+=":"-=")+d;f.animate(p,h/2,c.options.easing).animate(n,h/2,c.options.easing,function(){a.effects.restore(f,m);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}})}f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery);(function(a,b){a.effects.clip=function(c){return this.queue(function(){var g=a(this),k=["position","top","bottom","left","right","height","width"];var j=a.effects.setMode(g,c.options.mode||"hide");var l=c.options.direction||"vertical";a.effects.save(g,k);g.show();var d=a.effects.createWrapper(g).css({overflow:"hidden"});var f=g[0].tagName=="IMG"?d:g;var h={size:(l=="vertical")?"height":"width",position:(l=="vertical")?"top":"left"};var e=(l=="vertical")?f.height():f.width();if(j=="show"){f.css(h.size,0);f.css(h.position,e/2)}var i={};i[h.size]=j=="show"?e:0;i[h.position]=j=="show"?0:e/2;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(j=="hide"){g.hide()}a.effects.restore(g,k);a.effects.removeWrapper(g);if(c.callback){c.callback.apply(g[0],arguments)}g.dequeue()}})})}})(jQuery);(function(a,b){a.effects.drop=function(c){return this.queue(function(){var f=a(this),e=["position","top","bottom","left","right","opacity"];var j=a.effects.setMode(f,c.options.mode||"hide");var i=c.options.direction||"left";a.effects.save(f,e);f.show();a.effects.createWrapper(f);var g=(i=="up"||i=="down")?"top":"left";var d=(i=="up"||i=="left")?"pos":"neg";var k=c.options.distance||(g=="top"?f.outerHeight({margin:true})/2:f.outerWidth({margin:true})/2);if(j=="show"){f.css("opacity",0).css(g,d=="pos"?-k:k)}var h={opacity:j=="show"?1:0};h[g]=(j=="show"?(d=="pos"?"+=":"-="):(d=="pos"?"-=":"+="))+k;f.animate(h,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(j=="hide"){f.hide()}a.effects.restore(f,e);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}f.dequeue()}})})}})(jQuery);(function(a,b){a.effects.explode=function(c){return this.queue(function(){var l=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;var f=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;c.options.mode=c.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):c.options.mode;var k=a(this).show().css("visibility","hidden");var m=k.offset();m.top-=parseInt(k.css("marginTop"),10)||0;m.left-=parseInt(k.css("marginLeft"),10)||0;var h=k.outerWidth(true);var d=k.outerHeight(true);for(var g=0;g<l;g++){for(var e=0;e<f;e++){k.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-e*(h/f),top:-g*(d/l)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/f,height:d/l,left:m.left+e*(h/f)+(c.options.mode=="show"?(e-Math.floor(f/2))*(h/f):0),top:m.top+g*(d/l)+(c.options.mode=="show"?(g-Math.floor(l/2))*(d/l):0),opacity:c.options.mode=="show"?0:1}).animate({left:m.left+e*(h/f)+(c.options.mode=="show"?0:(e-Math.floor(f/2))*(h/f)),top:m.top+g*(d/l)+(c.options.mode=="show"?0:(g-Math.floor(l/2))*(d/l)),opacity:c.options.mode=="show"?1:0},c.duration||500)}}setTimeout(function(){c.options.mode=="show"?k.css({visibility:"visible"}):k.css({visibility:"visible"}).hide();if(c.callback){c.callback.apply(k[0])}k.dequeue();a("div.ui-effects-explode").remove()},c.duration||500)})}})(jQuery);(function(a,b){a.effects.fade=function(c){return this.queue(function(){var d=a(this),e=a.effects.setMode(d,c.options.mode||"hide");d.animate({opacity:e},{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){(c.callback&&c.callback.apply(this,arguments));d.dequeue()}})})}})(jQuery);(function(a,b){a.effects.fold=function(c){return this.queue(function(){var f=a(this),l=["position","top","bottom","left","right"];var i=a.effects.setMode(f,c.options.mode||"hide");var p=c.options.size||15;var o=!(!c.options.horizFirst);var h=c.duration?c.duration/2:a.fx.speeds._default/2;a.effects.save(f,l);f.show();var e=a.effects.createWrapper(f).css({overflow:"hidden"});var j=((i=="show")!=o);var g=j?["width","height"]:["height","width"];var d=j?[e.width(),e.height()]:[e.height(),e.width()];var k=/([0-9]+)%/.exec(p);if(k){p=parseInt(k[1],10)/100*d[i=="hide"?0:1]}if(i=="show"){e.css(o?{height:0,width:p}:{height:p,width:0})}var n={},m={};n[g[0]]=i=="show"?d[0]:p;m[g[1]]=i=="show"?d[1]:0;e.animate(n,h,c.options.easing).animate(m,h,c.options.easing,function(){if(i=="hide"){f.hide()}a.effects.restore(f,l);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(f[0],arguments)}f.dequeue()})})}})(jQuery);(function(a,b){a.effects.highlight=function(c){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"],g=a.effects.setMode(e,c.options.mode||"show"),f={backgroundColor:e.css("backgroundColor")};if(g=="hide"){f.opacity=0}a.effects.save(e,d);e.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){(g=="hide"&&e.hide());a.effects.restore(e,d);(g=="show"&&!a.support.opacity&&this.style.removeAttribute("filter"));(c.callback&&c.callback.apply(this,arguments));e.dequeue()}})})}})(jQuery);(function(a,b){a.effects.pulsate=function(c){return this.queue(function(){var e=a(this),f=a.effects.setMode(e,c.options.mode||"show");times=((c.options.times||5)*2)-1;duration=c.duration?c.duration/2:a.fx.speeds._default/2,isVisible=e.is(":visible"),animateTo=0;if(!isVisible){e.css("opacity",0).show();animateTo=1}if((f=="hide"&&isVisible)||(f=="show"&&!isVisible)){times--}for(var d=0;d<times;d++){e.animate({opacity:animateTo},duration,c.options.easing);animateTo=(animateTo+1)%2}e.animate({opacity:animateTo},duration,c.options.easing,function(){if(animateTo==0){e.hide()}(c.callback&&c.callback.apply(this,arguments))});e.queue("fx",function(){e.dequeue()}).dequeue()})}})(jQuery);(function(a,b){a.effects.puff=function(c){return this.queue(function(){var g=a(this),h=a.effects.setMode(g,c.options.mode||"hide"),f=parseInt(c.options.percent,10)||150,e=f/100,d={height:g.height(),width:g.width()};a.extend(c.options,{fade:true,mode:h,percent:h=="hide"?f:100,from:h=="hide"?d:{height:d.height*e,width:d.width*e}});g.effect("scale",c.options,c.duration,c.callback);g.dequeue()})};a.effects.scale=function(c){return this.queue(function(){var h=a(this);var e=a.extend(true,{},c.options);var k=a.effects.setMode(h,c.options.mode||"effect");var i=parseInt(c.options.percent,10)||(parseInt(c.options.percent,10)==0?0:(k=="hide"?0:100));var j=c.options.direction||"both";var d=c.options.origin;if(k!="effect"){e.origin=d||["middle","center"];e.restore=true}var g={height:h.height(),width:h.width()};h.from=c.options.from||(k=="show"?{height:0,width:0}:g);var f={y:j!="horizontal"?(i/100):1,x:j!="vertical"?(i/100):1};h.to={height:g.height*f.y,width:g.width*f.x};if(c.options.fade){if(k=="show"){h.from.opacity=0;h.to.opacity=1}if(k=="hide"){h.from.opacity=1;h.to.opacity=0}}e.from=h.from;e.to=h.to;e.mode=k;h.effect("size",e,c.duration,c.callback);h.dequeue()})};a.effects.size=function(c){return this.queue(function(){var d=a(this),o=["position","top","bottom","left","right","width","height","overflow","opacity"];var n=["position","top","bottom","left","right","overflow","opacity"];var k=["width","height","overflow"];var q=["fontSize"];var l=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"];var g=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"];var h=a.effects.setMode(d,c.options.mode||"effect");var j=c.options.restore||false;var f=c.options.scale||"both";var p=c.options.origin;var e={height:d.height(),width:d.width()};d.from=c.options.from||e;d.to=c.options.to||e;if(p){var i=a.effects.getBaseline(p,e);d.from.top=(e.height-d.from.height)*i.y;d.from.left=(e.width-d.from.width)*i.x;d.to.top=(e.height-d.to.height)*i.y;d.to.left=(e.width-d.to.width)*i.x}var m={from:{y:d.from.height/e.height,x:d.from.width/e.width},to:{y:d.to.height/e.height,x:d.to.width/e.width}};if(f=="box"||f=="both"){if(m.from.y!=m.to.y){o=o.concat(l);d.from=a.effects.setTransition(d,l,m.from.y,d.from);d.to=a.effects.setTransition(d,l,m.to.y,d.to)}if(m.from.x!=m.to.x){o=o.concat(g);d.from=a.effects.setTransition(d,g,m.from.x,d.from);d.to=a.effects.setTransition(d,g,m.to.x,d.to)}}if(f=="content"||f=="both"){if(m.from.y!=m.to.y){o=o.concat(q);d.from=a.effects.setTransition(d,q,m.from.y,d.from);d.to=a.effects.setTransition(d,q,m.to.y,d.to)}}a.effects.save(d,j?o:n);d.show();a.effects.createWrapper(d);d.css("overflow","hidden").css(d.from);if(f=="content"||f=="both"){l=l.concat(["marginTop","marginBottom"]).concat(q);g=g.concat(["marginLeft","marginRight"]);k=o.concat(l).concat(g);d.find("*[width]").each(function(){child=a(this);if(j){a.effects.save(child,k)}var r={height:child.height(),width:child.width()};child.from={height:r.height*m.from.y,width:r.width*m.from.x};child.to={height:r.height*m.to.y,width:r.width*m.to.x};if(m.from.y!=m.to.y){child.from=a.effects.setTransition(child,l,m.from.y,child.from);child.to=a.effects.setTransition(child,l,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=a.effects.setTransition(child,g,m.from.x,child.from);child.to=a.effects.setTransition(child,g,m.to.x,child.to)}child.css(child.from);child.animate(child.to,c.duration,c.options.easing,function(){if(j){a.effects.restore(child,k)}})})}d.animate(d.to,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(d.to.opacity===0){d.css("opacity",d.from.opacity)}if(h=="hide"){d.hide()}a.effects.restore(d,j?o:n);a.effects.removeWrapper(d);if(c.callback){c.callback.apply(this,arguments)}d.dequeue()}})})}})(jQuery);(function(a,b){a.effects.shake=function(c){return this.queue(function(){var f=a(this),m=["position","top","bottom","left","right"];var l=a.effects.setMode(f,c.options.mode||"effect");var o=c.options.direction||"left";var d=c.options.distance||20;var e=c.options.times||3;var h=c.duration||c.options.duration||140;a.effects.save(f,m);f.show();a.effects.createWrapper(f);var g=(o=="up"||o=="down")?"top":"left";var q=(o=="up"||o=="left")?"pos":"neg";var j={},p={},n={};j[g]=(q=="pos"?"-=":"+=")+d;p[g]=(q=="pos"?"+=":"-=")+d*2;n[g]=(q=="pos"?"-=":"+=")+d*2;f.animate(j,h,c.options.easing);for(var k=1;k<e;k++){f.animate(p,h,c.options.easing).animate(n,h,c.options.easing)}f.animate(p,h,c.options.easing).animate(j,h/2,c.options.easing,function(){a.effects.restore(f,m);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}});f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery);(function(a,b){a.effects.slide=function(c){return this.queue(function(){var f=a(this),e=["position","top","bottom","left","right"];var j=a.effects.setMode(f,c.options.mode||"show");var i=c.options.direction||"left";a.effects.save(f,e);f.show();a.effects.createWrapper(f).css({overflow:"hidden"});var g=(i=="up"||i=="down")?"top":"left";var d=(i=="up"||i=="left")?"pos":"neg";var k=c.options.distance||(g=="top"?f.outerHeight({margin:true}):f.outerWidth({margin:true}));if(j=="show"){f.css(g,d=="pos"?(isNaN(k)?"-"+k:-k):k)}var h={};h[g]=(j=="show"?(d=="pos"?"+=":"-="):(d=="pos"?"-=":"+="))+k;f.animate(h,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){if(j=="hide"){f.hide()}a.effects.restore(f,e);a.effects.removeWrapper(f);if(c.callback){c.callback.apply(this,arguments)}f.dequeue()}})})}})(jQuery);(function(a,b){a.effects.transfer=function(c){return this.queue(function(){var g=a(this),i=a(c.options.to),f=i.offset(),h={top:f.top,left:f.left,height:i.innerHeight(),width:i.innerWidth()},e=g.offset(),d=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(c.options.className).css({top:e.top,left:e.left,height:g.innerHeight(),width:g.innerWidth(),position:"absolute"}).animate(h,c.duration,c.options.easing,function(){d.remove();(c.callback&&c.callback.apply(g[0],arguments));g.dequeue()})})}})(jQuery);
\ No newline at end of file
--- /dev/null
+/*
+ * jQuery Templating Plugin
+ * Copyright 2010, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ */
+(function( jQuery, undefined ){
+ var oldManip = jQuery.fn.domManip, tmplItmAtt = "_tmplitem", htmlExpr = /^[^<]*(<[\w\W]+>)[^>]*$|\{\{\! /,
+ newTmplItems = {}, wrappedItems = {}, appendToTmplItems, topTmplItem = { key: 0, data: {} }, itemKey = 0, cloneIndex = 0, stack = [];
+
+ function newTmplItem( options, parentItem, fn, data ) {
+ // Returns a template item data structure for a new rendered instance of a template (a 'template item').
+ // The content field is a hierarchical array of strings and nested items (to be
+ // removed and replaced by nodes field of dom elements, once inserted in DOM).
+ var newItem = {
+ data: data || (parentItem ? parentItem.data : {}),
+ _wrap: parentItem ? parentItem._wrap : null,
+ tmpl: null,
+ parent: parentItem || null,
+ nodes: [],
+ calls: tiCalls,
+ nest: tiNest,
+ wrap: tiWrap,
+ html: tiHtml,
+ update: tiUpdate
+ };
+ if ( options ) {
+ jQuery.extend( newItem, options, { nodes: [], parent: parentItem } );
+ }
+ if ( fn ) {
+ // Build the hierarchical content to be used during insertion into DOM
+ newItem.tmpl = fn;
+ newItem._ctnt = newItem._ctnt || newItem.tmpl( jQuery, newItem );
+ newItem.key = ++itemKey;
+ // Keep track of new template item, until it is stored as jQuery Data on DOM element
+ (stack.length ? wrappedItems : newTmplItems)[itemKey] = newItem;
+ }
+ return newItem;
+ }
+
+ // Override appendTo etc., in order to provide support for targeting multiple elements. (This code would disappear if integrated in jquery core).
+ jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+ }, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = [], insert = jQuery( selector ), elems, i, l, tmplItems,
+ parent = this.length === 1 && this[0].parentNode;
+
+ appendToTmplItems = newTmplItems || {};
+ if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+ insert[ original ]( this[0] );
+ ret = this;
+ } else {
+ for ( i = 0, l = insert.length; i < l; i++ ) {
+ cloneIndex = i;
+ elems = (i > 0 ? this.clone(true) : this).get();
+ jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
+ ret = ret.concat( elems );
+ }
+ cloneIndex = 0;
+ ret = this.pushStack( ret, name, insert.selector );
+ }
+ tmplItems = appendToTmplItems;
+ appendToTmplItems = null;
+ jQuery.tmpl.complete( tmplItems );
+ return ret;
+ };
+ });
+
+ jQuery.fn.extend({
+ // Use first wrapped element as template markup.
+ // Return wrapped set of template items, obtained by rendering template against data.
+ tmpl: function( data, options, parentItem ) {
+ return jQuery.tmpl( this[0], data, options, parentItem );
+ },
+
+ // Find which rendered template item the first wrapped DOM element belongs to
+ tmplItem: function() {
+ return jQuery.tmplItem( this[0] );
+ },
+
+ // Consider the first wrapped element as a template declaration, and get the compiled template or store it as a named template.
+ template: function( name ) {
+ return jQuery.template( name, this[0] );
+ },
+
+ domManip: function( args, table, callback, options ) {
+ // This appears to be a bug in the appendTo, etc. implementation
+ // it should be doing .call() instead of .apply(). See #6227
+ if ( args[0] && args[0].nodeType ) {
+ var dmArgs = jQuery.makeArray( arguments ), argsLength = args.length, i = 0, tmplItem;
+ while ( i < argsLength && !(tmplItem = jQuery.data( args[i++], "tmplItem" ))) {}
+ if ( argsLength > 1 ) {
+ dmArgs[0] = [jQuery.makeArray( args )];
+ }
+ if ( tmplItem && cloneIndex ) {
+ dmArgs[2] = function( fragClone ) {
+ // Handler called by oldManip when rendered template has been inserted into DOM.
+ jQuery.tmpl.afterManip( this, fragClone, callback );
+ };
+ }
+ oldManip.apply( this, dmArgs );
+ } else {
+ oldManip.apply( this, arguments );
+ }
+ cloneIndex = 0;
+ if ( !appendToTmplItems ) {
+ jQuery.tmpl.complete( newTmplItems );
+ }
+ return this;
+ }
+ });
+
+ jQuery.extend({
+ // Return wrapped set of template items, obtained by rendering template against data.
+ tmpl: function( tmpl, data, options, parentItem ) {
+ var ret, topLevel = !parentItem;
+ if ( topLevel ) {
+ // This is a top-level tmpl call (not from a nested template using {{tmpl}})
+ parentItem = topTmplItem;
+ tmpl = jQuery.template[tmpl] || jQuery.template( null, tmpl );
+ wrappedItems = {}; // Any wrapped items will be rebuilt, since this is top level
+ } else if ( !tmpl ) {
+ // The template item is already associated with DOM - this is a refresh.
+ // Re-evaluate rendered template for the parentItem
+ tmpl = parentItem.tmpl;
+ newTmplItems[parentItem.key] = parentItem;
+ parentItem.nodes = [];
+ if ( parentItem.wrapped ) {
+ updateWrapped( parentItem, parentItem.wrapped );
+ }
+ // Rebuild, without creating a new template item
+ return jQuery( build( parentItem, null, parentItem.tmpl( jQuery, parentItem ) ));
+ }
+ if ( !tmpl ) {
+ return []; // Could throw...
+ }
+ if ( typeof data === "function" ) {
+ data = data.call( parentItem || {} );
+ }
+ if ( options && options.wrapped ) {
+ updateWrapped( options, options.wrapped );
+ }
+ ret = jQuery.isArray( data ) ?
+ jQuery.map( data, function( dataItem ) {
+ return dataItem ? newTmplItem( options, parentItem, tmpl, dataItem ) : null;
+ }) :
+ [ newTmplItem( options, parentItem, tmpl, data ) ];
+ return topLevel ? jQuery( build( parentItem, null, ret ) ) : ret;
+ },
+
+ // Return rendered template item for an element.
+ tmplItem: function( elem ) {
+ var tmplItem;
+ if ( elem instanceof jQuery ) {
+ elem = elem[0];
+ }
+ while ( elem && elem.nodeType === 1 && !(tmplItem = jQuery.data( elem, "tmplItem" )) && (elem = elem.parentNode) ) {}
+ return tmplItem || topTmplItem;
+ },
+
+ // Set:
+ // Use $.template( name, tmpl ) to cache a named template,
+ // where tmpl is a template string, a script element or a jQuery instance wrapping a script element, etc.
+ // Use $( "selector" ).template( name ) to provide access by name to a script block template declaration.
+
+ // Get:
+ // Use $.template( name ) to access a cached template.
+ // Also $( selectorToScriptBlock ).template(), or $.template( null, templateString )
+ // will return the compiled template, without adding a name reference.
+ // If templateString includes at least one HTML tag, $.template( templateString ) is equivalent
+ // to $.template( null, templateString )
+ template: function( name, tmpl ) {
+ if (tmpl) {
+ // Compile template and associate with name
+ if ( typeof tmpl === "string" ) {
+ // This is an HTML string being passed directly in.
+ tmpl = buildTmplFn( tmpl )
+ } else if ( tmpl instanceof jQuery ) {
+ tmpl = tmpl[0] || {};
+ }
+ if ( tmpl.nodeType ) {
+ // If this is a template block, use cached copy, or generate tmpl function and cache.
+ tmpl = jQuery.data( tmpl, "tmpl" ) || jQuery.data( tmpl, "tmpl", buildTmplFn( tmpl.innerHTML ));
+ }
+ return typeof name === "string" ? (jQuery.template[name] = tmpl) : tmpl;
+ }
+ // Return named compiled template
+ return name ? (typeof name !== "string" ? jQuery.template( null, name ):
+ (jQuery.template[name] ||
+ // If not in map, treat as a selector. (If integrated with core, use quickExpr.exec)
+ jQuery.template( null, htmlExpr.test( name ) ? name : jQuery( name )))) : null;
+ },
+
+ encode: function( text ) {
+ // Do HTML encoding replacing < > & and ' and " by corresponding entities.
+ return ("" + text).split("<").join("<").split(">").join(">").split('"').join(""").split("'").join("'");
+ }
+ });
+
+ jQuery.extend( jQuery.tmpl, {
+ tag: {
+ "tmpl": {
+ _default: { $2: "null" },
+ open: "if($notnull_1){_=_.concat($item.nest($1,$2));}"
+ // tmpl target parameter can be of type function, so use $1, not $1a (so not auto detection of functions)
+ // This means that {{tmpl foo}} treats foo as a template (which IS a function).
+ // Explicit parens can be used if foo is a function that returns a template: {{tmpl foo()}}.
+ },
+ "wrap": {
+ _default: { $2: "null" },
+ open: "$item.calls(_,$1,$2);_=[];",
+ close: "call=$item.calls();_=call._.concat($item.wrap(call,_));"
+ },
+ "each": {
+ _default: { $2: "$index, $value" },
+ open: "if($notnull_1){$.each($1a,function($2){with(this){",
+ close: "}});}"
+ },
+ "if": {
+ open: "if(($notnull_1) && $1a){",
+ close: "}"
+ },
+ "else": {
+ _default: { $1: "true" },
+ open: "}else if(($notnull_1) && $1a){"
+ },
+ "html": {
+ // Unecoded expression evaluation.
+ open: "if($notnull_1){_.push($1a);}"
+ },
+ "=": {
+ // Encoded expression evaluation. Abbreviated form is ${}.
+ _default: { $1: "$data" },
+ open: "if($notnull_1){_.push($.encode($1a));}"
+ },
+ "!": {
+ // Comment tag. Skipped by parser
+ open: ""
+ }
+ },
+
+ // This stub can be overridden, e.g. in jquery.tmplPlus for providing rendered events
+ complete: function( items ) {
+ newTmplItems = {};
+ },
+
+ // Call this from code which overrides domManip, or equivalent
+ // Manage cloning/storing template items etc.
+ afterManip: function afterManip( elem, fragClone, callback ) {
+ // Provides cloned fragment ready for fixup prior to and after insertion into DOM
+ var content = fragClone.nodeType === 11 ?
+ jQuery.makeArray(fragClone.childNodes) :
+ fragClone.nodeType === 1 ? [fragClone] : [];
+
+ // Return fragment to original caller (e.g. append) for DOM insertion
+ callback.call( elem, fragClone );
+
+ // Fragment has been inserted:- Add inserted nodes to tmplItem data structure. Replace inserted element annotations by jQuery.data.
+ storeTmplItems( content );
+ cloneIndex++;
+ }
+ });
+
+ //========================== Private helper functions, used by code above ==========================
+
+ function build( tmplItem, nested, content ) {
+ // Convert hierarchical content into flat string array
+ // and finally return array of fragments ready for DOM insertion
+ var frag, ret = content ? jQuery.map( content, function( item ) {
+ return (typeof item === "string") ?
+ // Insert template item annotations, to be converted to jQuery.data( "tmplItem" ) when elems are inserted into DOM.
+ (tmplItem.key ? item.replace( /(<\w+)(?=[\s>])(?![^>]*_tmplitem)([^>]*)/g, "$1 " + tmplItmAtt + "=\"" + tmplItem.key + "\" $2" ) : item) :
+ // This is a child template item. Build nested template.
+ build( item, tmplItem, item._ctnt );
+ }) :
+ // If content is not defined, insert tmplItem directly. Not a template item. May be a string, or a string array, e.g. from {{html $item.html()}}.
+ tmplItem;
+ if ( nested ) {
+ return ret;
+ }
+
+ // top-level template
+ ret = ret.join("");
+
+ // Support templates which have initial or final text nodes, or consist only of text
+ // Also support HTML entities within the HTML markup.
+ ret.replace( /^\s*([^<\s][^<]*)?(<[\w\W]+>)([^>]*[^>\s])?\s*$/, function( all, before, middle, after) {
+ frag = jQuery( middle ).get();
+
+ storeTmplItems( frag );
+ if ( before ) {
+ frag = unencode( before ).concat(frag);
+ }
+ if ( after ) {
+ frag = frag.concat(unencode( after ));
+ }
+ });
+ return frag ? frag : unencode( ret );
+ }
+
+ function unencode( text ) {
+ // Use createElement, since createTextNode will not render HTML entities correctly
+ var el = document.createElement( "div" );
+ el.innerHTML = text;
+ return jQuery.makeArray(el.childNodes);
+ }
+
+ // Generate a reusable function that will serve to render a template against data
+ function buildTmplFn( markup ) {
+ return new Function("jQuery","$item",
+ "var $=jQuery,call,_=[],$data=$item.data;" +
+
+ // Introduce the data as local variables using with(){}
+ "with($data){_.push('" +
+
+ // Convert the template into pure JavaScript
+ jQuery.trim(markup)
+ .replace( /([\\'])/g, "\\$1" )
+ .replace( /[\r\t\n]/g, " " )
+ .replace( /\$\{([^\}]*)\}/g, "{{= $1}}" )
+ .replace( /\{\{(\/?)(\w+|.)(?:\(((?:[^\}]|\}(?!\}))*?)?\))?(?:\s+(.*?)?)?(\(((?:[^\}]|\}(?!\}))*?)\))?\s*\}\}/g,
+ function( all, slash, type, fnargs, target, parens, args ) {
+ var tag = jQuery.tmpl.tag[ type ], def, expr, exprAutoFnDetect;
+ if ( !tag ) {
+ throw "Template command not found: " + type;
+ }
+ def = tag._default || [];
+ if ( parens && !/\w$/.test(target)) {
+ target += parens;
+ parens = "";
+ }
+ if ( target ) {
+ target = unescape( target );
+ args = args ? ("," + unescape( args ) + ")") : (parens ? ")" : "");
+ // Support for target being things like a.toLowerCase();
+ // In that case don't call with template item as 'this' pointer. Just evaluate...
+ expr = parens ? (target.indexOf(".") > -1 ? target + parens : ("(" + target + ").call($item" + args)) : target;
+ exprAutoFnDetect = parens ? expr : "(typeof(" + target + ")==='function'?(" + target + ").call($item):(" + target + "))";
+ } else {
+ exprAutoFnDetect = expr = def.$1 || "null";
+ }
+ fnargs = unescape( fnargs );
+ return "');" +
+ tag[ slash ? "close" : "open" ]
+ .split( "$notnull_1" ).join( target ? "typeof(" + target + ")!=='undefined' && (" + target + ")!=null" : "true" )
+ .split( "$1a" ).join( exprAutoFnDetect )
+ .split( "$1" ).join( expr )
+ .split( "$2" ).join( fnargs ?
+ fnargs.replace( /\s*([^\(]+)\s*(\((.*?)\))?/g, function( all, name, parens, params ) {
+ params = params ? ("," + params + ")") : (parens ? ")" : "");
+ return params ? ("(" + name + ").call($item" + params) : all;
+ })
+ : (def.$2||"")
+ ) +
+ "_.push('";
+ }) +
+ "');}return _;"
+ );
+ }
+ function updateWrapped( options, wrapped ) {
+ // Build the wrapped content.
+ options._wrap = build( options, true,
+ // Suport imperative scenario in which options.wrapped can be set to a selector or an HTML string.
+ jQuery.isArray( wrapped ) ? wrapped : [htmlExpr.test( wrapped ) ? wrapped : jQuery( wrapped ).html()]
+ ).join("");
+ }
+
+ function unescape( args ) {
+ return args ? args.replace( /\\'/g, "'").replace(/\\\\/g, "\\" ) : null;
+ }
+ function outerHtml( elem ) {
+ var div = document.createElement("div");
+ div.appendChild( elem.cloneNode(true) );
+ return div.innerHTML;
+ }
+
+ // Store template items in jQuery.data(), ensuring a unique tmplItem data data structure for each rendered template instance.
+ function storeTmplItems( content ) {
+ var keySuffix = "_" + cloneIndex, elem, elems, newClonedItems = {}, i, l, m;
+ for ( i = 0, l = content.length; i < l; i++ ) {
+ if ( (elem = content[i]).nodeType !== 1 ) {
+ continue;
+ }
+ elems = elem.getElementsByTagName("*");
+ for ( m = elems.length - 1; m >= 0; m-- ) {
+ processItemKey( elems[m] );
+ }
+ processItemKey( elem );
+ }
+ function processItemKey( el ) {
+ var pntKey, pntNode = el, pntItem, tmplItem, key;
+ // Ensure that each rendered template inserted into the DOM has its own template item,
+ if ( (key = el.getAttribute( tmplItmAtt ))) {
+ while ( pntNode.parentNode && (pntNode = pntNode.parentNode).nodeType === 1 && !(pntKey = pntNode.getAttribute( tmplItmAtt ))) { }
+ if ( pntKey !== key ) {
+ // The next ancestor with a _tmplitem expando is on a different key than this one.
+ // So this is a top-level element within this template item
+ // Set pntNode to the key of the parentNode, or to 0 if pntNode.parentNode is null, or pntNode is a fragment.
+ pntNode = pntNode.parentNode ? (pntNode.nodeType === 11 ? 0 : (pntNode.getAttribute( tmplItmAtt ) || 0)) : 0;
+ if ( !(tmplItem = newTmplItems[key]) ) {
+ // The item is for wrapped content, and was copied from the temporary parent wrappedItem.
+ tmplItem = wrappedItems[key];
+ tmplItem = newTmplItem( tmplItem, newTmplItems[pntNode]||wrappedItems[pntNode], null, true );
+ tmplItem.key = ++itemKey;
+ newTmplItems[itemKey] = tmplItem;
+ }
+ if ( cloneIndex ) {
+ cloneTmplItem( key );
+ }
+ }
+ el.removeAttribute( tmplItmAtt );
+ } else if ( cloneIndex && (tmplItem = jQuery.data( el, "tmplItem" )) ) {
+ // This was a rendered element, cloned during append or appendTo etc.
+ // TmplItem stored in jQuery data has already been cloned in cloneCopyEvent. We must replace it with a fresh cloned tmplItem.
+ cloneTmplItem( tmplItem.key );
+ newTmplItems[tmplItem.key] = tmplItem;
+ pntNode = jQuery.data( el.parentNode, "tmplItem" );
+ pntNode = pntNode ? pntNode.key : 0;
+ }
+ if ( tmplItem ) {
+ pntItem = tmplItem;
+ // Find the template item of the parent element.
+ // (Using !=, not !==, since pntItem.key is number, and pntNode may be a string)
+ while ( pntItem && pntItem.key != pntNode ) {
+ // Add this element as a top-level node for this rendered template item, as well as for any
+ // ancestor items between this item and the item of its parent element
+ pntItem.nodes.push( el );
+ pntItem = pntItem.parent;
+ }
+ // Delete content built during rendering - reduce API surface area and memory use, and avoid exposing of stale data after rendering...
+ delete tmplItem._ctnt;
+ delete tmplItem._wrap;
+ // Store template item as jQuery data on the element
+ jQuery.data( el, "tmplItem", tmplItem );
+ }
+ function cloneTmplItem( key ) {
+ key = key + keySuffix;
+ tmplItem = newClonedItems[key] =
+ (newClonedItems[key] || newTmplItem( tmplItem, newTmplItems[tmplItem.parent.key + keySuffix] || tmplItem.parent, null, true ));
+ }
+ }
+ }
+
+ //---- Helper functions for template item ----
+
+ function tiCalls( content, tmpl, data, options ) {
+ if ( !content ) {
+ return stack.pop();
+ }
+ stack.push({ _: content, tmpl: tmpl, item:this, data: data, options: options });
+ }
+
+ function tiNest( tmpl, data, options ) {
+ // nested template, using {{tmpl}} tag
+ return jQuery.tmpl( jQuery.template( tmpl ), data, options, this );
+ }
+
+ function tiWrap( call, wrapped ) {
+ // nested template, using {{wrap}} tag
+ var options = call.options || {};
+ options.wrapped = wrapped;
+ // Apply the template, which may incorporate wrapped content,
+ return jQuery.tmpl( jQuery.template( call.tmpl ), call.data, options, call.item );
+ }
+
+ function tiHtml( filter, textOnly ) {
+ var wrapped = this._wrap;
+ return jQuery.map(
+ jQuery( jQuery.isArray( wrapped ) ? wrapped.join("") : wrapped ).filter( filter || "*" ),
+ function(e) {
+ return textOnly ?
+ e.innerText || e.textContent :
+ e.outerHTML || outerHtml(e);
+ });
+ }
+
+ function tiUpdate() {
+ var coll = this.nodes;
+ jQuery.tmpl( null, null, null, this).insertBefore( coll[0] );
+ jQuery( coll ).remove();
+ }
+})( jQuery );
--- /dev/null
+/*!
+ * jQuery JavaScript Library v1.6.2
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Thu Jun 30 14:16:56 2011 -0400
+ */
+(function( window, undefined ) {
+
+// Use the correct document accordingly with window argument (sandbox)
+var document = window.document,
+ navigator = window.navigator,
+ location = window.location;
+var jQuery = (function() {
+
+// Define a local copy of jQuery
+var jQuery = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context, rootjQuery );
+ },
+
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$,
+
+ // A central reference to the root jQuery(document)
+ rootjQuery,
+
+ // A simple way to check for HTML strings or ID strings
+ // (both of which we optimize for)
+ quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,
+
+ // Check if a string has a non-whitespace character in it
+ rnotwhite = /\S/,
+
+ // Used for trimming whitespace
+ trimLeft = /^\s+/,
+ trimRight = /\s+$/,
+
+ // Check for digits
+ rdigit = /\d/,
+
+ // Match a standalone tag
+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+
+ // JSON RegExp
+ rvalidchars = /^[\],:{}\s]*$/,
+ rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,
+ rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,
+ rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+
+ // Useragent RegExp
+ rwebkit = /(webkit)[ \/]([\w.]+)/,
+ ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
+ rmsie = /(msie) ([\w.]+)/,
+ rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
+
+ // Matches dashed string for camelizing
+ rdashAlpha = /-([a-z])/ig,
+
+ // Used by jQuery.camelCase as callback to replace()
+ fcamelCase = function( all, letter ) {
+ return letter.toUpperCase();
+ },
+
+ // Keep a UserAgent string for use with jQuery.browser
+ userAgent = navigator.userAgent,
+
+ // For matching the engine and version of the browser
+ browserMatch,
+
+ // The deferred used on DOM ready
+ readyList,
+
+ // The ready event handler
+ DOMContentLoaded,
+
+ // Save a reference to some core methods
+ toString = Object.prototype.toString,
+ hasOwn = Object.prototype.hasOwnProperty,
+ push = Array.prototype.push,
+ slice = Array.prototype.slice,
+ trim = String.prototype.trim,
+ indexOf = Array.prototype.indexOf,
+
+ // [[Class]] -> type pairs
+ class2type = {};
+
+jQuery.fn = jQuery.prototype = {
+ constructor: jQuery,
+ init: function( selector, context, rootjQuery ) {
+ var match, elem, ret, doc;
+
+ // Handle $(""), $(null), or $(undefined)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Handle $(DOMElement)
+ if ( selector.nodeType ) {
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+ }
+
+ // The body element only exists once, optimize finding it
+ if ( selector === "body" && !context && document.body ) {
+ this.context = document;
+ this[0] = document.body;
+ this.selector = selector;
+ this.length = 1;
+ return this;
+ }
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ // Are we dealing with HTML string or an ID?
+ if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = quickExpr.exec( selector );
+ }
+
+ // Verify a match, and that no context was specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] ) {
+ context = context instanceof jQuery ? context[0] : context;
+ doc = (context ? context.ownerDocument || context : document);
+
+ // If a single string is passed in and it's a single tag
+ // just do a createElement and skip the rest
+ ret = rsingleTag.exec( selector );
+
+ if ( ret ) {
+ if ( jQuery.isPlainObject( context ) ) {
+ selector = [ document.createElement( ret[1] ) ];
+ jQuery.fn.attr.call( selector, context, true );
+
+ } else {
+ selector = [ doc.createElement( ret[1] ) ];
+ }
+
+ } else {
+ ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
+ selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes;
+ }
+
+ return jQuery.merge( this, selector );
+
+ // HANDLE: $("#id")
+ } else {
+ elem = document.getElementById( match[2] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id !== match[2] ) {
+ return rootjQuery.find( selector );
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return (context || rootjQuery).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) ) {
+ return rootjQuery.ready( selector );
+ }
+
+ if (selector.selector !== undefined) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return jQuery.makeArray( selector, this );
+ },
+
+ // Start with an empty selector
+ selector: "",
+
+ // The current version of jQuery being used
+ jquery: "1.6.2",
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ // The number of elements contained in the matched element set
+ size: function() {
+ return this.length;
+ },
+
+ toArray: function() {
+ return slice.call( this, 0 );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num == null ?
+
+ // Return a 'clean' array
+ this.toArray() :
+
+ // Return just the object
+ ( num < 0 ? this[ this.length + num ] : this[ num ] );
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems, name, selector ) {
+ // Build a new jQuery matched element set
+ var ret = this.constructor();
+
+ if ( jQuery.isArray( elems ) ) {
+ push.apply( ret, elems );
+
+ } else {
+ jQuery.merge( ret, elems );
+ }
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ ret.context = this.context;
+
+ if ( name === "find" ) {
+ ret.selector = this.selector + (this.selector ? " " : "") + selector;
+ } else if ( name ) {
+ ret.selector = this.selector + "." + name + "(" + selector + ")";
+ }
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ ready: function( fn ) {
+ // Attach the listeners
+ jQuery.bindReady();
+
+ // Add the callback
+ readyList.done( fn );
+
+ return this;
+ },
+
+ eq: function( i ) {
+ return i === -1 ?
+ this.slice( i ) :
+ this.slice( i, +i + 1 );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ slice: function() {
+ return this.pushStack( slice.apply( this, arguments ),
+ "slice", slice.call(arguments).join(",") );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor(null);
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: push,
+ sort: [].sort,
+ splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+ target = {};
+ }
+
+ // extend jQuery itself if only one argument is passed
+ if ( length === i ) {
+ target = this;
+ --i;
+ }
+
+ for ( ; i < length; i++ ) {
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null ) {
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend({
+ noConflict: function( deep ) {
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
+
+ if ( deep && window.jQuery === jQuery ) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+ },
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+ },
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+ // Either a released hold or an DOMready/load event and not yet ready
+ if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( jQuery.ready, 1 );
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+
+ // Trigger any bound ready events
+ if ( jQuery.fn.trigger ) {
+ jQuery( document ).trigger( "ready" ).unbind( "ready" );
+ }
+ }
+ },
+
+ bindReady: function() {
+ if ( readyList ) {
+ return;
+ }
+
+ readyList = jQuery._Deferred();
+
+ // Catch cases where $(document).ready() is called after the
+ // browser event has already occurred.
+ if ( document.readyState === "complete" ) {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ return setTimeout( jQuery.ready, 1 );
+ }
+
+ // Mozilla, Opera and webkit nightlies currently support this event
+ if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", jQuery.ready, false );
+
+ // If IE event model is used
+ } else if ( document.attachEvent ) {
+ // ensure firing before onload,
+ // maybe late but safe also for iframes
+ document.attachEvent( "onreadystatechange", DOMContentLoaded );
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", jQuery.ready );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var toplevel = false;
+
+ try {
+ toplevel = window.frameElement == null;
+ } catch(e) {}
+
+ if ( document.documentElement.doScroll && toplevel ) {
+ doScrollCheck();
+ }
+ }
+ },
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function( obj ) {
+ return jQuery.type(obj) === "array";
+ },
+
+ // A crude way of determining if an object is a window
+ isWindow: function( obj ) {
+ return obj && typeof obj === "object" && "setInterval" in obj;
+ },
+
+ isNaN: function( obj ) {
+ return obj == null || !rdigit.test( obj ) || isNaN( obj );
+ },
+
+ type: function( obj ) {
+ return obj == null ?
+ String( obj ) :
+ class2type[ toString.call(obj) ] || "object";
+ },
+
+ isPlainObject: function( obj ) {
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ // Not own constructor property must be Object
+ if ( obj.constructor &&
+ !hasOwn.call(obj, "constructor") &&
+ !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ return false;
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+
+ var key;
+ for ( key in obj ) {}
+
+ return key === undefined || hasOwn.call( obj, key );
+ },
+
+ isEmptyObject: function( obj ) {
+ for ( var name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ error: function( msg ) {
+ throw msg;
+ },
+
+ parseJSON: function( data ) {
+ if ( typeof data !== "string" || !data ) {
+ return null;
+ }
+
+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
+ data = jQuery.trim( data );
+
+ // Attempt to parse using the native JSON parser first
+ if ( window.JSON && window.JSON.parse ) {
+ return window.JSON.parse( data );
+ }
+
+ // Make sure the incoming data is actual JSON
+ // Logic borrowed from http://json.org/json2.js
+ if ( rvalidchars.test( data.replace( rvalidescape, "@" )
+ .replace( rvalidtokens, "]" )
+ .replace( rvalidbraces, "")) ) {
+
+ return (new Function( "return " + data ))();
+
+ }
+ jQuery.error( "Invalid JSON: " + data );
+ },
+
+ // Cross-browser xml parsing
+ // (xml & tmp used internally)
+ parseXML: function( data , xml , tmp ) {
+
+ if ( window.DOMParser ) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString( data , "text/xml" );
+ } else { // IE
+ xml = new ActiveXObject( "Microsoft.XMLDOM" );
+ xml.async = "false";
+ xml.loadXML( data );
+ }
+
+ tmp = xml.documentElement;
+
+ if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+
+ return xml;
+ },
+
+ noop: function() {},
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function( data ) {
+ if ( data && rnotwhite.test( data ) ) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function( data ) {
+ window[ "eval" ].call( window, data );
+ } )( data );
+ }
+ },
+
+ // Converts a dashed string to camelCased string;
+ // Used by both the css and data modules
+ camelCase: function( string ) {
+ return string.replace( rdashAlpha, fcamelCase );
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+ },
+
+ // args is for internal usage only
+ each: function( object, callback, args ) {
+ var name, i = 0,
+ length = object.length,
+ isObj = length === undefined || jQuery.isFunction( object );
+
+ if ( args ) {
+ if ( isObj ) {
+ for ( name in object ) {
+ if ( callback.apply( object[ name ], args ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.apply( object[ i++ ], args ) === false ) {
+ break;
+ }
+ }
+ }
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( isObj ) {
+ for ( name in object ) {
+ if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) {
+ break;
+ }
+ }
+ }
+ }
+
+ return object;
+ },
+
+ // Use native String.trim function wherever possible
+ trim: trim ?
+ function( text ) {
+ return text == null ?
+ "" :
+ trim.call( text );
+ } :
+
+ // Otherwise use our own trimming functionality
+ function( text ) {
+ return text == null ?
+ "" :
+ text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
+ },
+
+ // results is for internal usage only
+ makeArray: function( array, results ) {
+ var ret = results || [];
+
+ if ( array != null ) {
+ // The window, strings (and functions) also have 'length'
+ // The extra typeof function check is to prevent crashes
+ // in Safari 2 (See: #3039)
+ // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
+ var type = jQuery.type( array );
+
+ if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) {
+ push.call( ret, array );
+ } else {
+ jQuery.merge( ret, array );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, array ) {
+
+ if ( indexOf ) {
+ return indexOf.call( array, elem );
+ }
+
+ for ( var i = 0, length = array.length; i < length; i++ ) {
+ if ( array[ i ] === elem ) {
+ return i;
+ }
+ }
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ var i = first.length,
+ j = 0;
+
+ if ( typeof second.length === "number" ) {
+ for ( var l = second.length; j < l; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+
+ } else {
+ while ( second[j] !== undefined ) {
+ first[ i++ ] = second[ j++ ];
+ }
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, inv ) {
+ var ret = [], retVal;
+ inv = !!inv;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( var i = 0, length = elems.length; i < length; i++ ) {
+ retVal = !!callback( elems[ i ], i );
+ if ( inv !== retVal ) {
+ ret.push( elems[ i ] );
+ }
+ }
+
+ return ret;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var value, key, ret = [],
+ i = 0,
+ length = elems.length,
+ // jquery objects are treated as arrays
+ isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ;
+
+ // Go through the array, translating each of the items to their
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( key in elems ) {
+ value = callback( elems[ key ], key, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return ret.concat.apply( [], ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function( fn, context ) {
+ if ( typeof context === "string" ) {
+ var tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !jQuery.isFunction( fn ) ) {
+ return undefined;
+ }
+
+ // Simulated bind
+ var args = slice.call( arguments, 2 ),
+ proxy = function() {
+ return fn.apply( context, args.concat( slice.call( arguments ) ) );
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+
+ return proxy;
+ },
+
+ // Mutifunctional method to get and set values to a collection
+ // The value/s can optionally be executed if it's a function
+ access: function( elems, key, value, exec, fn, pass ) {
+ var length = elems.length;
+
+ // Setting many attributes
+ if ( typeof key === "object" ) {
+ for ( var k in key ) {
+ jQuery.access( elems, k, key[k], exec, fn, value );
+ }
+ return elems;
+ }
+
+ // Setting one attribute
+ if ( value !== undefined ) {
+ // Optionally, function values get executed if exec is true
+ exec = !pass && exec && jQuery.isFunction(value);
+
+ for ( var i = 0; i < length; i++ ) {
+ fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+ }
+
+ return elems;
+ }
+
+ // Getting an attribute
+ return length ? fn( elems[0], key ) : undefined;
+ },
+
+ now: function() {
+ return (new Date()).getTime();
+ },
+
+ // Use of jQuery.browser is frowned upon.
+ // More details: http://docs.jquery.com/Utilities/jQuery.browser
+ uaMatch: function( ua ) {
+ ua = ua.toLowerCase();
+
+ var match = rwebkit.exec( ua ) ||
+ ropera.exec( ua ) ||
+ rmsie.exec( ua ) ||
+ ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) ||
+ [];
+
+ return { browser: match[1] || "", version: match[2] || "0" };
+ },
+
+ sub: function() {
+ function jQuerySub( selector, context ) {
+ return new jQuerySub.fn.init( selector, context );
+ }
+ jQuery.extend( true, jQuerySub, this );
+ jQuerySub.superclass = this;
+ jQuerySub.fn = jQuerySub.prototype = this();
+ jQuerySub.fn.constructor = jQuerySub;
+ jQuerySub.sub = this.sub;
+ jQuerySub.fn.init = function init( selector, context ) {
+ if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) {
+ context = jQuerySub( context );
+ }
+
+ return jQuery.fn.init.call( this, selector, context, rootjQuerySub );
+ };
+ jQuerySub.fn.init.prototype = jQuerySub.fn;
+ var rootjQuerySub = jQuerySub(document);
+ return jQuerySub;
+ },
+
+ browser: {}
+});
+
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
+browserMatch = jQuery.uaMatch( userAgent );
+if ( browserMatch.browser ) {
+ jQuery.browser[ browserMatch.browser ] = true;
+ jQuery.browser.version = browserMatch.version;
+}
+
+// Deprecated, use jQuery.browser.webkit instead
+if ( jQuery.browser.webkit ) {
+ jQuery.browser.safari = true;
+}
+
+// IE doesn't match non-breaking spaces with \s
+if ( rnotwhite.test( "\xA0" ) ) {
+ trimLeft = /^[\s\xA0]+/;
+ trimRight = /[\s\xA0]+$/;
+}
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+
+// Cleanup functions for the document ready method
+if ( document.addEventListener ) {
+ DOMContentLoaded = function() {
+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ jQuery.ready();
+ };
+
+} else if ( document.attachEvent ) {
+ DOMContentLoaded = function() {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( document.readyState === "complete" ) {
+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
+ jQuery.ready();
+ }
+ };
+}
+
+// The DOM ready check for Internet Explorer
+function doScrollCheck() {
+ if ( jQuery.isReady ) {
+ return;
+ }
+
+ try {
+ // If IE is used, use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ document.documentElement.doScroll("left");
+ } catch(e) {
+ setTimeout( doScrollCheck, 1 );
+ return;
+ }
+
+ // and execute any waiting functions
+ jQuery.ready();
+}
+
+return jQuery;
+
+})();
+
+
+var // Promise methods
+ promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ),
+ // Static reference to slice
+ sliceDeferred = [].slice;
+
+jQuery.extend({
+ // Create a simple deferred (one callbacks list)
+ _Deferred: function() {
+ var // callbacks list
+ callbacks = [],
+ // stored [ context , args ]
+ fired,
+ // to avoid firing when already doing so
+ firing,
+ // flag to know if the deferred has been cancelled
+ cancelled,
+ // the deferred itself
+ deferred = {
+
+ // done( f1, f2, ...)
+ done: function() {
+ if ( !cancelled ) {
+ var args = arguments,
+ i,
+ length,
+ elem,
+ type,
+ _fired;
+ if ( fired ) {
+ _fired = fired;
+ fired = 0;
+ }
+ for ( i = 0, length = args.length; i < length; i++ ) {
+ elem = args[ i ];
+ type = jQuery.type( elem );
+ if ( type === "array" ) {
+ deferred.done.apply( deferred, elem );
+ } else if ( type === "function" ) {
+ callbacks.push( elem );
+ }
+ }
+ if ( _fired ) {
+ deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] );
+ }
+ }
+ return this;
+ },
+
+ // resolve with given context and args
+ resolveWith: function( context, args ) {
+ if ( !cancelled && !fired && !firing ) {
+ // make sure args are available (#8421)
+ args = args || [];
+ firing = 1;
+ try {
+ while( callbacks[ 0 ] ) {
+ callbacks.shift().apply( context, args );
+ }
+ }
+ finally {
+ fired = [ context, args ];
+ firing = 0;
+ }
+ }
+ return this;
+ },
+
+ // resolve with this as context and given arguments
+ resolve: function() {
+ deferred.resolveWith( this, arguments );
+ return this;
+ },
+
+ // Has this deferred been resolved?
+ isResolved: function() {
+ return !!( firing || fired );
+ },
+
+ // Cancel
+ cancel: function() {
+ cancelled = 1;
+ callbacks = [];
+ return this;
+ }
+ };
+
+ return deferred;
+ },
+
+ // Full fledged deferred (two callbacks list)
+ Deferred: function( func ) {
+ var deferred = jQuery._Deferred(),
+ failDeferred = jQuery._Deferred(),
+ promise;
+ // Add errorDeferred methods, then and promise
+ jQuery.extend( deferred, {
+ then: function( doneCallbacks, failCallbacks ) {
+ deferred.done( doneCallbacks ).fail( failCallbacks );
+ return this;
+ },
+ always: function() {
+ return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments );
+ },
+ fail: failDeferred.done,
+ rejectWith: failDeferred.resolveWith,
+ reject: failDeferred.resolve,
+ isRejected: failDeferred.isResolved,
+ pipe: function( fnDone, fnFail ) {
+ return jQuery.Deferred(function( newDefer ) {
+ jQuery.each( {
+ done: [ fnDone, "resolve" ],
+ fail: [ fnFail, "reject" ]
+ }, function( handler, data ) {
+ var fn = data[ 0 ],
+ action = data[ 1 ],
+ returned;
+ if ( jQuery.isFunction( fn ) ) {
+ deferred[ handler ](function() {
+ returned = fn.apply( this, arguments );
+ if ( returned && jQuery.isFunction( returned.promise ) ) {
+ returned.promise().then( newDefer.resolve, newDefer.reject );
+ } else {
+ newDefer[ action ]( returned );
+ }
+ });
+ } else {
+ deferred[ handler ]( newDefer[ action ] );
+ }
+ });
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ if ( obj == null ) {
+ if ( promise ) {
+ return promise;
+ }
+ promise = obj = {};
+ }
+ var i = promiseMethods.length;
+ while( i-- ) {
+ obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ];
+ }
+ return obj;
+ }
+ });
+ // Make sure only one callback list will be used
+ deferred.done( failDeferred.cancel ).fail( deferred.cancel );
+ // Unexpose cancel
+ delete deferred.cancel;
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( firstParam ) {
+ var args = arguments,
+ i = 0,
+ length = args.length,
+ count = length,
+ deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ?
+ firstParam :
+ jQuery.Deferred();
+ function resolveFunc( i ) {
+ return function( value ) {
+ args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value;
+ if ( !( --count ) ) {
+ // Strange bug in FF4:
+ // Values changed onto the arguments object sometimes end up as undefined values
+ // outside the $.when method. Cloning the object into a fresh array solves the issue
+ deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) );
+ }
+ };
+ }
+ if ( length > 1 ) {
+ for( ; i < length; i++ ) {
+ if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) {
+ args[ i ].promise().then( resolveFunc(i), deferred.reject );
+ } else {
+ --count;
+ }
+ }
+ if ( !count ) {
+ deferred.resolveWith( deferred, args );
+ }
+ } else if ( deferred !== firstParam ) {
+ deferred.resolveWith( deferred, length ? [ firstParam ] : [] );
+ }
+ return deferred.promise();
+ }
+});
+
+
+
+jQuery.support = (function() {
+
+ var div = document.createElement( "div" ),
+ documentElement = document.documentElement,
+ all,
+ a,
+ select,
+ opt,
+ input,
+ marginDiv,
+ support,
+ fragment,
+ body,
+ testElementParent,
+ testElement,
+ testElementStyle,
+ tds,
+ events,
+ eventName,
+ i,
+ isSupported;
+
+ // Preliminary tests
+ div.setAttribute("className", "t");
+ div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+
+ all = div.getElementsByTagName( "*" );
+ a = div.getElementsByTagName( "a" )[ 0 ];
+
+ // Can't get basic test support
+ if ( !all || !all.length || !a ) {
+ return {};
+ }
+
+ // First batch of supports tests
+ select = document.createElement( "select" );
+ opt = select.appendChild( document.createElement("option") );
+ input = div.getElementsByTagName( "input" )[ 0 ];
+
+ support = {
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: ( div.firstChild.nodeType === 3 ),
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName( "tbody" ).length,
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName( "link" ).length,
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText instead)
+ style: /top/.test( a.getAttribute("style") ),
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: ( a.getAttribute( "href" ) === "/a" ),
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ opacity: /^0.55$/.test( a.style.opacity ),
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
+
+ // Make sure that if no value is specified for a checkbox
+ // that it defaults to "on".
+ // (WebKit defaults to "" instead)
+ checkOn: ( input.value === "on" ),
+
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ optSelected: opt.selected,
+
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ getSetAttribute: div.className !== "t",
+
+ // Will be defined later
+ submitBubbles: true,
+ changeBubbles: true,
+ focusinBubbles: false,
+ deleteExpando: true,
+ noCloneEvent: true,
+ inlineBlockNeedsLayout: false,
+ shrinkWrapBlocks: false,
+ reliableMarginRight: true
+ };
+
+ // Make sure checked status is properly cloned
+ input.checked = true;
+ support.noCloneChecked = input.cloneNode( true ).checked;
+
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
+
+ // Test to see if it's possible to delete an expando from an element
+ // Fails in Internet Explorer
+ try {
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
+ }
+
+ if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
+ div.attachEvent( "onclick", function() {
+ // Cloning a node shouldn't copy over any
+ // bound event handlers (IE does this)
+ support.noCloneEvent = false;
+ });
+ div.cloneNode( true ).fireEvent( "onclick" );
+ }
+
+ // Check if a radio maintains it's value
+ // after being appended to the DOM
+ input = document.createElement("input");
+ input.value = "t";
+ input.setAttribute("type", "radio");
+ support.radioValue = input.value === "t";
+
+ input.setAttribute("checked", "checked");
+ div.appendChild( input );
+ fragment = document.createDocumentFragment();
+ fragment.appendChild( div.firstChild );
+
+ // WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ div.innerHTML = "";
+
+ // Figure out if the W3C box model works as expected
+ div.style.width = div.style.paddingLeft = "1px";
+
+ body = document.getElementsByTagName( "body" )[ 0 ];
+ // We use our own, invisible, body unless the body is already present
+ // in which case we use a div (#9239)
+ testElement = document.createElement( body ? "div" : "body" );
+ testElementStyle = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0
+ };
+ if ( body ) {
+ jQuery.extend( testElementStyle, {
+ position: "absolute",
+ left: -1000,
+ top: -1000
+ });
+ }
+ for ( i in testElementStyle ) {
+ testElement.style[ i ] = testElementStyle[ i ];
+ }
+ testElement.appendChild( div );
+ testElementParent = body || documentElement;
+ testElementParent.insertBefore( testElement, testElementParent.firstChild );
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ support.appendChecked = input.checked;
+
+ support.boxModel = div.offsetWidth === 2;
+
+ if ( "zoom" in div.style ) {
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ // (IE < 8 does this)
+ div.style.display = "inline";
+ div.style.zoom = 1;
+ support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 );
+
+ // Check if elements with layout shrink-wrap their children
+ // (IE 6 does this)
+ div.style.display = "";
+ div.innerHTML = "<div style='width:4px;'></div>";
+ support.shrinkWrapBlocks = ( div.offsetWidth !== 2 );
+ }
+
+ div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName( "td" );
+
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ // (only IE 8 fails this test)
+ isSupported = ( tds[ 0 ].offsetHeight === 0 );
+
+ tds[ 0 ].style.display = "";
+ tds[ 1 ].style.display = "none";
+
+ // Check if empty table cells still have offsetWidth/Height
+ // (IE < 8 fail this test)
+ support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
+ div.innerHTML = "";
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. For more
+ // info see bug #3333
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ if ( document.defaultView && document.defaultView.getComputedStyle ) {
+ marginDiv = document.createElement( "div" );
+ marginDiv.style.width = "0";
+ marginDiv.style.marginRight = "0";
+ div.appendChild( marginDiv );
+ support.reliableMarginRight =
+ ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0;
+ }
+
+ // Remove the body element we added
+ testElement.innerHTML = "";
+ testElementParent.removeChild( testElement );
+
+ // Technique from Juriy Zaytsev
+ // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
+ // We only care about the case where non-standard event systems
+ // are used, namely in IE. Short-circuiting here helps us to
+ // avoid an eval call (in setAttribute) which can cause CSP
+ // to go haywire. See: https://developer.mozilla.org/en/Security/CSP
+ if ( div.attachEvent ) {
+ for( i in {
+ submit: 1,
+ change: 1,
+ focusin: 1
+ } ) {
+ eventName = "on" + i;
+ isSupported = ( eventName in div );
+ if ( !isSupported ) {
+ div.setAttribute( eventName, "return;" );
+ isSupported = ( typeof div[ eventName ] === "function" );
+ }
+ support[ i + "Bubbles" ] = isSupported;
+ }
+ }
+
+ // Null connected elements to avoid leaks in IE
+ testElement = fragment = select = opt = body = marginDiv = div = input = null;
+
+ return support;
+})();
+
+// Keep track of boxModel
+jQuery.boxModel = jQuery.support.boxModel;
+
+
+
+
+var rbrace = /^(?:\{.*\}|\[.*\])$/,
+ rmultiDash = /([a-z])([A-Z])/g;
+
+jQuery.extend({
+ cache: {},
+
+ // Please use with caution
+ uuid: 0,
+
+ // Unique for each copy of jQuery on the page
+ // Non-digits removed to match rinlinejQuery
+ expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
+
+ // The following elements throw uncatchable exceptions if you
+ // attempt to add expando properties to them.
+ noData: {
+ "embed": true,
+ // Ban all objects except for Flash (which handle expandos)
+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
+ "applet": true
+ },
+
+ hasData: function( elem ) {
+ elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+
+ return !!elem && !isEmptyDataObject( elem );
+ },
+
+ data: function( elem, name, data, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache,
+
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
+
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando;
+
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) {
+ return;
+ }
+
+ if ( !id ) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if ( isNode ) {
+ elem[ jQuery.expando ] = id = ++jQuery.uuid;
+ } else {
+ id = jQuery.expando;
+ }
+ }
+
+ if ( !cache[ id ] ) {
+ cache[ id ] = {};
+
+ // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery
+ // metadata on plain JS objects when the object is serialized using
+ // JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if ( typeof name === "object" || typeof name === "function" ) {
+ if ( pvt ) {
+ cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name);
+ } else {
+ cache[ id ] = jQuery.extend(cache[ id ], name);
+ }
+ }
+
+ thisCache = cache[ id ];
+
+ // Internal jQuery data is stored in a separate object inside the object's data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data
+ if ( pvt ) {
+ if ( !thisCache[ internalKey ] ) {
+ thisCache[ internalKey ] = {};
+ }
+
+ thisCache = thisCache[ internalKey ];
+ }
+
+ if ( data !== undefined ) {
+ thisCache[ jQuery.camelCase( name ) ] = data;
+ }
+
+ // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should
+ // not attempt to inspect the internal events object using jQuery.data, as this
+ // internal data object is undocumented and subject to change.
+ if ( name === "events" && !thisCache[name] ) {
+ return thisCache[ internalKey ] && thisCache[ internalKey ].events;
+ }
+
+ return getByName ?
+ // Check for both converted-to-camel and non-converted data property names
+ thisCache[ jQuery.camelCase( name ) ] || thisCache[ name ] :
+ thisCache;
+ },
+
+ removeData: function( elem, name, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var internalKey = jQuery.expando, isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
+
+ // See jQuery.data for more information
+ id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if ( !cache[ id ] ) {
+ return;
+ }
+
+ if ( name ) {
+ var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ];
+
+ if ( thisCache ) {
+ delete thisCache[ name ];
+
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if ( !isEmptyDataObject(thisCache) ) {
+ return;
+ }
+ }
+ }
+
+ // See jQuery.data for more information
+ if ( pvt ) {
+ delete cache[ id ][ internalKey ];
+
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if ( !isEmptyDataObject(cache[ id ]) ) {
+ return;
+ }
+ }
+
+ var internalCache = cache[ id ][ internalKey ];
+
+ // Browsers that fail expando deletion also refuse to delete expandos on
+ // the window, but it will allow it on all other JS objects; other browsers
+ // don't care
+ if ( jQuery.support.deleteExpando || cache != window ) {
+ delete cache[ id ];
+ } else {
+ cache[ id ] = null;
+ }
+
+ // We destroyed the entire user cache at once because it's faster than
+ // iterating through each key, but we need to continue to persist internal
+ // data if it existed
+ if ( internalCache ) {
+ cache[ id ] = {};
+ // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery
+ // metadata on plain JS objects when the object is serialized using
+ // JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+
+ cache[ id ][ internalKey ] = internalCache;
+
+ // Otherwise, we need to eliminate the expando on the node to avoid
+ // false lookups in the cache for entries that no longer exist
+ } else if ( isNode ) {
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
+ if ( jQuery.support.deleteExpando ) {
+ delete elem[ jQuery.expando ];
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( jQuery.expando );
+ } else {
+ elem[ jQuery.expando ] = null;
+ }
+ }
+ },
+
+ // For internal use only.
+ _data: function( elem, name, data ) {
+ return jQuery.data( elem, name, data, true );
+ },
+
+ // A method for determining if a DOM node can handle the data expando
+ acceptData: function( elem ) {
+ if ( elem.nodeName ) {
+ var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
+
+ if ( match ) {
+ return !(match === true || elem.getAttribute("classid") !== match);
+ }
+ }
+
+ return true;
+ }
+});
+
+jQuery.fn.extend({
+ data: function( key, value ) {
+ var data = null;
+
+ if ( typeof key === "undefined" ) {
+ if ( this.length ) {
+ data = jQuery.data( this[0] );
+
+ if ( this[0].nodeType === 1 ) {
+ var attr = this[0].attributes, name;
+ for ( var i = 0, l = attr.length; i < l; i++ ) {
+ name = attr[i].name;
+
+ if ( name.indexOf( "data-" ) === 0 ) {
+ name = jQuery.camelCase( name.substring(5) );
+
+ dataAttr( this[0], name, data[ name ] );
+ }
+ }
+ }
+ }
+
+ return data;
+
+ } else if ( typeof key === "object" ) {
+ return this.each(function() {
+ jQuery.data( this, key );
+ });
+ }
+
+ var parts = key.split(".");
+ parts[1] = parts[1] ? "." + parts[1] : "";
+
+ if ( value === undefined ) {
+ data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+
+ // Try to fetch any internally stored data first
+ if ( data === undefined && this.length ) {
+ data = jQuery.data( this[0], key );
+ data = dataAttr( this[0], key, data );
+ }
+
+ return data === undefined && parts[1] ?
+ this.data( parts[0] ) :
+ data;
+
+ } else {
+ return this.each(function() {
+ var $this = jQuery( this ),
+ args = [ parts[0], value ];
+
+ $this.triggerHandler( "setData" + parts[1] + "!", args );
+ jQuery.data( this, key, value );
+ $this.triggerHandler( "changeData" + parts[1] + "!", args );
+ });
+ }
+ },
+
+ removeData: function( key ) {
+ return this.each(function() {
+ jQuery.removeData( this, key );
+ });
+ }
+});
+
+function dataAttr( elem, key, data ) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+ var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase();
+
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ !jQuery.isNaN( data ) ? parseFloat( data ) :
+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
+ data;
+ } catch( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data( elem, key, data );
+
+ } else {
+ data = undefined;
+ }
+ }
+
+ return data;
+}
+
+// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON
+// property to be considered empty objects; this property always exists in
+// order to make sure JSON.stringify does not expose internal metadata
+function isEmptyDataObject( obj ) {
+ for ( var name in obj ) {
+ if ( name !== "toJSON" ) {
+ return false;
+ }
+ }
+
+ return true;
+}
+
+
+
+
+function handleQueueMarkDefer( elem, type, src ) {
+ var deferDataKey = type + "defer",
+ queueDataKey = type + "queue",
+ markDataKey = type + "mark",
+ defer = jQuery.data( elem, deferDataKey, undefined, true );
+ if ( defer &&
+ ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) &&
+ ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) {
+ // Give room for hard-coded callbacks to fire first
+ // and eventually mark/queue something else on the element
+ setTimeout( function() {
+ if ( !jQuery.data( elem, queueDataKey, undefined, true ) &&
+ !jQuery.data( elem, markDataKey, undefined, true ) ) {
+ jQuery.removeData( elem, deferDataKey, true );
+ defer.resolve();
+ }
+ }, 0 );
+ }
+}
+
+jQuery.extend({
+
+ _mark: function( elem, type ) {
+ if ( elem ) {
+ type = (type || "fx") + "mark";
+ jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true );
+ }
+ },
+
+ _unmark: function( force, elem, type ) {
+ if ( force !== true ) {
+ type = elem;
+ elem = force;
+ force = false;
+ }
+ if ( elem ) {
+ type = type || "fx";
+ var key = type + "mark",
+ count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 );
+ if ( count ) {
+ jQuery.data( elem, key, count, true );
+ } else {
+ jQuery.removeData( elem, key, true );
+ handleQueueMarkDefer( elem, type, "mark" );
+ }
+ }
+ },
+
+ queue: function( elem, type, data ) {
+ if ( elem ) {
+ type = (type || "fx") + "queue";
+ var q = jQuery.data( elem, type, undefined, true );
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !q || jQuery.isArray(data) ) {
+ q = jQuery.data( elem, type, jQuery.makeArray(data), true );
+ } else {
+ q.push( data );
+ }
+ }
+ return q || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ fn = queue.shift(),
+ defer;
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ }
+
+ if ( fn ) {
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift("inprogress");
+ }
+
+ fn.call(elem, function() {
+ jQuery.dequeue(elem, type);
+ });
+ }
+
+ if ( !queue.length ) {
+ jQuery.removeData( elem, type + "queue", true );
+ handleQueueMarkDefer( elem, type, "queue" );
+ }
+ }
+});
+
+jQuery.fn.extend({
+ queue: function( type, data ) {
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ }
+
+ if ( data === undefined ) {
+ return jQuery.queue( this[0], type );
+ }
+ return this.each(function() {
+ var queue = jQuery.queue( this, type, data );
+
+ if ( type === "fx" && queue[0] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ dequeue: function( type ) {
+ return this.each(function() {
+ jQuery.dequeue( this, type );
+ });
+ },
+ // Based off of the plugin by Clint Helfers, with permission.
+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
+ delay: function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function() {
+ var elem = this;
+ setTimeout(function() {
+ jQuery.dequeue( elem, type );
+ }, time );
+ });
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, object ) {
+ if ( typeof type !== "string" ) {
+ object = type;
+ type = undefined;
+ }
+ type = type || "fx";
+ var defer = jQuery.Deferred(),
+ elements = this,
+ i = elements.length,
+ count = 1,
+ deferDataKey = type + "defer",
+ queueDataKey = type + "queue",
+ markDataKey = type + "mark",
+ tmp;
+ function resolve() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ }
+ while( i-- ) {
+ if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) ||
+ ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) ||
+ jQuery.data( elements[ i ], markDataKey, undefined, true ) ) &&
+ jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) {
+ count++;
+ tmp.done( resolve );
+ }
+ }
+ resolve();
+ return defer.promise();
+ }
+});
+
+
+
+
+var rclass = /[\n\t\r]/g,
+ rspace = /\s+/,
+ rreturn = /\r/g,
+ rtype = /^(?:button|input)$/i,
+ rfocusable = /^(?:button|input|object|select|textarea)$/i,
+ rclickable = /^a(?:rea)?$/i,
+ rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
+ rinvalidChar = /\:|^on/,
+ formHook, boolHook;
+
+jQuery.fn.extend({
+ attr: function( name, value ) {
+ return jQuery.access( this, name, value, true, jQuery.attr );
+ },
+
+ removeAttr: function( name ) {
+ return this.each(function() {
+ jQuery.removeAttr( this, name );
+ });
+ },
+
+ prop: function( name, value ) {
+ return jQuery.access( this, name, value, true, jQuery.prop );
+ },
+
+ removeProp: function( name ) {
+ name = jQuery.propFix[ name ] || name;
+ return this.each(function() {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[ name ] = undefined;
+ delete this[ name ];
+ } catch( e ) {}
+ });
+ },
+
+ addClass: function( value ) {
+ var classNames, i, l, elem,
+ setClass, c, cl;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).addClass( value.call(this, j, this.className) );
+ });
+ }
+
+ if ( value && typeof value === "string" ) {
+ classNames = value.split( rspace );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.nodeType === 1 ) {
+ if ( !elem.className && classNames.length === 1 ) {
+ elem.className = value;
+
+ } else {
+ setClass = " " + elem.className + " ";
+
+ for ( c = 0, cl = classNames.length; c < cl; c++ ) {
+ if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) {
+ setClass += classNames[ c ] + " ";
+ }
+ }
+ elem.className = jQuery.trim( setClass );
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function( value ) {
+ var classNames, i, l, elem, className, c, cl;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).removeClass( value.call(this, j, this.className) );
+ });
+ }
+
+ if ( (value && typeof value === "string") || value === undefined ) {
+ classNames = (value || "").split( rspace );
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ elem = this[ i ];
+
+ if ( elem.nodeType === 1 && elem.className ) {
+ if ( value ) {
+ className = (" " + elem.className + " ").replace( rclass, " " );
+ for ( c = 0, cl = classNames.length; c < cl; c++ ) {
+ className = className.replace(" " + classNames[ c ] + " ", " ");
+ }
+ elem.className = jQuery.trim( className );
+
+ } else {
+ elem.className = "";
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value,
+ isBool = typeof stateVal === "boolean";
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( i ) {
+ jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
+ });
+ }
+
+ return this.each(function() {
+ if ( type === "string" ) {
+ // toggle individual class names
+ var className,
+ i = 0,
+ self = jQuery( this ),
+ state = stateVal,
+ classNames = value.split( rspace );
+
+ while ( (className = classNames[ i++ ]) ) {
+ // check each className given, space seperated list
+ state = isBool ? state : !self.hasClass( className );
+ self[ state ? "addClass" : "removeClass" ]( className );
+ }
+
+ } else if ( type === "undefined" || type === "boolean" ) {
+ if ( this.className ) {
+ // store className if set
+ jQuery._data( this, "__className__", this.className );
+ }
+
+ // toggle whole className
+ this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+ }
+ });
+ },
+
+ hasClass: function( selector ) {
+ var className = " " + selector + " ";
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+ return true;
+ }
+ }
+
+ return false;
+ },
+
+ val: function( value ) {
+ var hooks, ret,
+ elem = this[0];
+
+ if ( !arguments.length ) {
+ if ( elem ) {
+ hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ];
+
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ return typeof ret === "string" ?
+ // handle most common string cases
+ ret.replace(rreturn, "") :
+ // handle cases where value is null/undef or number
+ ret == null ? "" : ret;
+ }
+
+ return undefined;
+ }
+
+ var isFunction = jQuery.isFunction( value );
+
+ return this.each(function( i ) {
+ var self = jQuery(this), val;
+
+ if ( this.nodeType !== 1 ) {
+ return;
+ }
+
+ if ( isFunction ) {
+ val = value.call( this, i, self.val() );
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+ } else if ( typeof val === "number" ) {
+ val += "";
+ } else if ( jQuery.isArray( val ) ) {
+ val = jQuery.map(val, function ( value ) {
+ return value == null ? "" : value + "";
+ });
+ }
+
+ hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ valHooks: {
+ option: {
+ get: function( elem ) {
+ // attributes.value is undefined in Blackberry 4.7 but
+ // uses .value. See #6932
+ var val = elem.attributes.value;
+ return !val || val.specified ? elem.value : elem.text;
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value,
+ index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type === "select-one";
+
+ // Nothing was selected
+ if ( index < 0 ) {
+ return null;
+ }
+
+ // Loop through all the selected options
+ for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+ var option = options[ i ];
+
+ // Don't return options that are disabled or in a disabled optgroup
+ if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
+ (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
+
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ // Fixes Bug #2551 -- select.val() broken in IE after form.reset()
+ if ( one && !values.length && options.length ) {
+ return jQuery( options[ index ] ).val();
+ }
+
+ return values;
+ },
+
+ set: function( elem, value ) {
+ var values = jQuery.makeArray( value );
+
+ jQuery(elem).find("option").each(function() {
+ this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+ });
+
+ if ( !values.length ) {
+ elem.selectedIndex = -1;
+ }
+ return values;
+ }
+ }
+ },
+
+ attrFn: {
+ val: true,
+ css: true,
+ html: true,
+ text: true,
+ data: true,
+ width: true,
+ height: true,
+ offset: true
+ },
+
+ attrFix: {
+ // Always normalize to ensure hook usage
+ tabindex: "tabIndex"
+ },
+
+ attr: function( elem, name, value, pass ) {
+ var nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return undefined;
+ }
+
+ if ( pass && name in jQuery.attrFn ) {
+ return jQuery( elem )[ name ]( value );
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( !("getAttribute" in elem) ) {
+ return jQuery.prop( elem, name, value );
+ }
+
+ var ret, hooks,
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ // Normalize the name if needed
+ if ( notxml ) {
+ name = jQuery.attrFix[ name ] || name;
+
+ hooks = jQuery.attrHooks[ name ];
+
+ if ( !hooks ) {
+ // Use boolHook for boolean attributes
+ if ( rboolean.test( name ) ) {
+
+ hooks = boolHook;
+
+ // Use formHook for forms and if the name contains certain characters
+ } else if ( formHook && name !== "className" &&
+ (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ) {
+
+ hooks = formHook;
+ }
+ }
+ }
+
+ if ( value !== undefined ) {
+
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+ return undefined;
+
+ } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ elem.setAttribute( name, "" + value );
+ return value;
+ }
+
+ } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+
+ ret = elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret === null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function( elem, name ) {
+ var propName;
+ if ( elem.nodeType === 1 ) {
+ name = jQuery.attrFix[ name ] || name;
+
+ if ( jQuery.support.getSetAttribute ) {
+ // Use removeAttribute in browsers that support it
+ elem.removeAttribute( name );
+ } else {
+ jQuery.attr( elem, name, "" );
+ elem.removeAttributeNode( elem.getAttributeNode( name ) );
+ }
+
+ // Set corresponding property to false for boolean attributes
+ if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) {
+ elem[ propName ] = false;
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( rtype.test( elem.nodeName ) && elem.parentNode ) {
+ jQuery.error( "type property can't be changed" );
+ } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to it's default in case type is set after value
+ // This is for element creation
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ },
+ tabIndex: {
+ get: function( elem ) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ var attributeNode = elem.getAttributeNode("tabIndex");
+
+ return attributeNode && attributeNode.specified ?
+ parseInt( attributeNode.value, 10 ) :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ undefined;
+ }
+ },
+ // Use the value property for back compat
+ // Use the formHook for button elements in IE6/7 (#1954)
+ value: {
+ get: function( elem, name ) {
+ if ( formHook && jQuery.nodeName( elem, "button" ) ) {
+ return formHook.get( elem, name );
+ }
+ return name in elem ?
+ elem.value :
+ null;
+ },
+ set: function( elem, value, name ) {
+ if ( formHook && jQuery.nodeName( elem, "button" ) ) {
+ return formHook.set( elem, value, name );
+ }
+ // Does not return so that setAttribute is also used
+ elem.value = value;
+ }
+ }
+ },
+
+ propFix: {
+ tabindex: "tabIndex",
+ readonly: "readOnly",
+ "for": "htmlFor",
+ "class": "className",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ cellpadding: "cellPadding",
+ rowspan: "rowSpan",
+ colspan: "colSpan",
+ usemap: "useMap",
+ frameborder: "frameBorder",
+ contenteditable: "contentEditable"
+ },
+
+ prop: function( elem, name, value ) {
+ var nType = elem.nodeType;
+
+ // don't get/set properties on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return undefined;
+ }
+
+ var ret, hooks,
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ if ( notxml ) {
+ // Fix name and attach hooks
+ name = jQuery.propFix[ name ] || name;
+ hooks = jQuery.propHooks[ name ];
+ }
+
+ if ( value !== undefined ) {
+ if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ return (elem[ name ] = value);
+ }
+
+ } else {
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ return elem[ name ];
+ }
+ }
+ },
+
+ propHooks: {}
+});
+
+// Hook for boolean attributes
+boolHook = {
+ get: function( elem, name ) {
+ // Align boolean attributes with corresponding properties
+ return jQuery.prop( elem, name ) ?
+ name.toLowerCase() :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ var propName;
+ if ( value === false ) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else {
+ // value is true since we know at this point it's type boolean and not false
+ // Set boolean attributes to the same name and set the DOM property
+ propName = jQuery.propFix[ name ] || name;
+ if ( propName in elem ) {
+ // Only set the IDL specifically if it already exists on the element
+ elem[ propName ] = true;
+ }
+
+ elem.setAttribute( name, name.toLowerCase() );
+ }
+ return name;
+ }
+};
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !jQuery.support.getSetAttribute ) {
+
+ // propFix is more comprehensive and contains all fixes
+ jQuery.attrFix = jQuery.propFix;
+
+ // Use this for any attribute on a form in IE6/7
+ formHook = jQuery.attrHooks.name = jQuery.attrHooks.title = jQuery.valHooks.button = {
+ get: function( elem, name ) {
+ var ret;
+ ret = elem.getAttributeNode( name );
+ // Return undefined if nodeValue is empty string
+ return ret && ret.nodeValue !== "" ?
+ ret.nodeValue :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ // Check form objects in IE (multiple bugs related)
+ // Only use nodeValue if the attribute node exists on the form
+ var ret = elem.getAttributeNode( name );
+ if ( ret ) {
+ ret.nodeValue = value;
+ return value;
+ }
+ }
+ };
+
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each([ "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ set: function( elem, value ) {
+ if ( value === "" ) {
+ elem.setAttribute( name, "auto" );
+ return value;
+ }
+ }
+ });
+ });
+}
+
+
+// Some attributes require a special call on IE
+if ( !jQuery.support.hrefNormalized ) {
+ jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ get: function( elem ) {
+ var ret = elem.getAttribute( name, 2 );
+ return ret === null ? undefined : ret;
+ }
+ });
+ });
+}
+
+if ( !jQuery.support.style ) {
+ jQuery.attrHooks.style = {
+ get: function( elem ) {
+ // Return undefined in the case of empty string
+ // Normalize to lowercase since IE uppercases css property names
+ return elem.style.cssText.toLowerCase() || undefined;
+ },
+ set: function( elem, value ) {
+ return (elem.style.cssText = "" + value);
+ }
+ };
+}
+
+// Safari mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+if ( !jQuery.support.optSelected ) {
+ jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
+ get: function( elem ) {
+ var parent = elem.parentNode;
+
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ }
+ });
+}
+
+// Radios and checkboxes getter/setter
+if ( !jQuery.support.checkOn ) {
+ jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ get: function( elem ) {
+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ }
+ };
+ });
+}
+jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
+ set: function( elem, value ) {
+ if ( jQuery.isArray( value ) ) {
+ return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0);
+ }
+ }
+ });
+});
+
+
+
+
+var rnamespaces = /\.(.*)$/,
+ rformElems = /^(?:textarea|input|select)$/i,
+ rperiod = /\./g,
+ rspaces = / /g,
+ rescape = /[^\w\s.|`]/g,
+ fcleanup = function( nm ) {
+ return nm.replace(rescape, "\\$&");
+ };
+
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+ // Bind an event to an element
+ // Original by Dean Edwards
+ add: function( elem, types, handler, data ) {
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ if ( handler === false ) {
+ handler = returnFalse;
+ } else if ( !handler ) {
+ // Fixes bug #7229. Fix recommended by jdalton
+ return;
+ }
+
+ var handleObjIn, handleObj;
+
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ }
+
+ // Make sure that the function being executed has a unique ID
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure
+ var elemData = jQuery._data( elem );
+
+ // If no elemData is found then we must be trying to bind to one of the
+ // banned noData elements
+ if ( !elemData ) {
+ return;
+ }
+
+ var events = elemData.events,
+ eventHandle = elemData.handle;
+
+ if ( !events ) {
+ elemData.events = events = {};
+ }
+
+ if ( !eventHandle ) {
+ elemData.handle = eventHandle = function( e ) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
+ jQuery.event.handle.apply( eventHandle.elem, arguments ) :
+ undefined;
+ };
+ }
+
+ // Add elem as a property of the handle function
+ // This is to prevent a memory leak with non-native events in IE.
+ eventHandle.elem = elem;
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ types = types.split(" ");
+
+ var type, i = 0, namespaces;
+
+ while ( (type = types[ i++ ]) ) {
+ handleObj = handleObjIn ?
+ jQuery.extend({}, handleObjIn) :
+ { handler: handler, data: data };
+
+ // Namespaced event handlers
+ if ( type.indexOf(".") > -1 ) {
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ handleObj.namespace = namespaces.slice(0).sort().join(".");
+
+ } else {
+ namespaces = [];
+ handleObj.namespace = "";
+ }
+
+ handleObj.type = type;
+ if ( !handleObj.guid ) {
+ handleObj.guid = handler.guid;
+ }
+
+ // Get the current list of functions bound to this event
+ var handlers = events[ type ],
+ special = jQuery.event.special[ type ] || {};
+
+ // Init the event handler queue
+ if ( !handlers ) {
+ handlers = events[ type ] = [];
+
+ // Check for a special event handler
+ // Only use addEventListener/attachEvent if the special
+ // events handler returns false
+ if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+ // Bind the global event handler to the element
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle, false );
+
+ } else if ( elem.attachEvent ) {
+ elem.attachEvent( "on" + type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add the function to the element's handler list
+ handlers.push( handleObj );
+
+ // Keep track of which events have been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ global: {},
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, pos ) {
+ // don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ if ( handler === false ) {
+ handler = returnFalse;
+ }
+
+ var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
+ elemData = jQuery.hasData( elem ) && jQuery._data( elem ),
+ events = elemData && elemData.events;
+
+ if ( !elemData || !events ) {
+ return;
+ }
+
+ // types is actually an event object here
+ if ( types && types.type ) {
+ handler = types.handler;
+ types = types.type;
+ }
+
+ // Unbind all events for the element
+ if ( !types || typeof types === "string" && types.charAt(0) === "." ) {
+ types = types || "";
+
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types );
+ }
+
+ return;
+ }
+
+ // Handle multiple events separated by a space
+ // jQuery(...).unbind("mouseover mouseout", fn);
+ types = types.split(" ");
+
+ while ( (type = types[ i++ ]) ) {
+ origType = type;
+ handleObj = null;
+ all = type.indexOf(".") < 0;
+ namespaces = [];
+
+ if ( !all ) {
+ // Namespaced event handlers
+ namespaces = type.split(".");
+ type = namespaces.shift();
+
+ namespace = new RegExp("(^|\\.)" +
+ jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)");
+ }
+
+ eventType = events[ type ];
+
+ if ( !eventType ) {
+ continue;
+ }
+
+ if ( !handler ) {
+ for ( j = 0; j < eventType.length; j++ ) {
+ handleObj = eventType[ j ];
+
+ if ( all || namespace.test( handleObj.namespace ) ) {
+ jQuery.event.remove( elem, origType, handleObj.handler, j );
+ eventType.splice( j--, 1 );
+ }
+ }
+
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+
+ for ( j = pos || 0; j < eventType.length; j++ ) {
+ handleObj = eventType[ j ];
+
+ if ( handler.guid === handleObj.guid ) {
+ // remove the given handler for the given type
+ if ( all || namespace.test( handleObj.namespace ) ) {
+ if ( pos == null ) {
+ eventType.splice( j--, 1 );
+ }
+
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+
+ if ( pos != null ) {
+ break;
+ }
+ }
+ }
+
+ // remove generic event handler if no more handlers exist
+ if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
+ if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ ret = null;
+ delete events[ type ];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ var handle = elemData.handle;
+ if ( handle ) {
+ handle.elem = null;
+ }
+
+ delete elemData.events;
+ delete elemData.handle;
+
+ if ( jQuery.isEmptyObject( elemData ) ) {
+ jQuery.removeData( elem, undefined, true );
+ }
+ }
+ },
+
+ // Events that are safe to short-circuit if no handlers are attached.
+ // Native DOM events should not be added, they may have inline handlers.
+ customEvent: {
+ "getData": true,
+ "setData": true,
+ "changeData": true
+ },
+
+ trigger: function( event, data, elem, onlyHandlers ) {
+ // Event object or event type
+ var type = event.type || event,
+ namespaces = [],
+ exclusive;
+
+ if ( type.indexOf("!") >= 0 ) {
+ // Exclusive events trigger only for the exact event (no namespaces)
+ type = type.slice(0, -1);
+ exclusive = true;
+ }
+
+ if ( type.indexOf(".") >= 0 ) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+
+ if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) {
+ // No jQuery handlers for this event type, and it can't have inline handlers
+ return;
+ }
+
+ // Caller can pass in an Event, Object, or just an event type string
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[ jQuery.expando ] ? event :
+ // Object literal
+ new jQuery.Event( type, event ) :
+ // Just the event type (string)
+ new jQuery.Event( type );
+
+ event.type = type;
+ event.exclusive = exclusive;
+ event.namespace = namespaces.join(".");
+ event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)");
+
+ // triggerHandler() and global events don't bubble or run the default action
+ if ( onlyHandlers || !elem ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+
+ // Handle a global trigger
+ if ( !elem ) {
+ // TODO: Stop taunting the data cache; remove global events and always attach to document
+ jQuery.each( jQuery.cache, function() {
+ // internalKey variable is just used to make it easier to find
+ // and potentially change this stuff later; currently it just
+ // points to jQuery.expando
+ var internalKey = jQuery.expando,
+ internalCache = this[ internalKey ];
+ if ( internalCache && internalCache.events && internalCache.events[ type ] ) {
+ jQuery.event.trigger( event, data, internalCache.handle.elem );
+ }
+ });
+ return;
+ }
+
+ // Don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ event.target = elem;
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data != null ? jQuery.makeArray( data ) : [];
+ data.unshift( event );
+
+ var cur = elem,
+ // IE doesn't like method names with a colon (#3533, #8272)
+ ontype = type.indexOf(":") < 0 ? "on" + type : "";
+
+ // Fire event on the current element, then bubble up the DOM tree
+ do {
+ var handle = jQuery._data( cur, "handle" );
+
+ event.currentTarget = cur;
+ if ( handle ) {
+ handle.apply( cur, data );
+ }
+
+ // Trigger an inline bound script
+ if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) {
+ event.result = false;
+ event.preventDefault();
+ }
+
+ // Bubble up to document, then to window
+ cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window;
+ } while ( cur && !event.isPropagationStopped() );
+
+ // If nobody prevented the default action, do it now
+ if ( !event.isDefaultPrevented() ) {
+ var old,
+ special = jQuery.event.special[ type ] || {};
+
+ if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) &&
+ !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
+
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction)() check here because IE6/7 fails that test.
+ // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch.
+ try {
+ if ( ontype && elem[ type ] ) {
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ old = elem[ ontype ];
+
+ if ( old ) {
+ elem[ ontype ] = null;
+ }
+
+ jQuery.event.triggered = type;
+ elem[ type ]();
+ }
+ } catch ( ieError ) {}
+
+ if ( old ) {
+ elem[ ontype ] = old;
+ }
+
+ jQuery.event.triggered = undefined;
+ }
+ }
+
+ return event.result;
+ },
+
+ handle: function( event ) {
+ event = jQuery.event.fix( event || window.event );
+ // Snapshot the handlers list since a called handler may add/remove events.
+ var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0),
+ run_all = !event.exclusive && !event.namespace,
+ args = Array.prototype.slice.call( arguments, 0 );
+
+ // Use the fix-ed Event rather than the (read-only) native event
+ args[0] = event;
+ event.currentTarget = this;
+
+ for ( var j = 0, l = handlers.length; j < l; j++ ) {
+ var handleObj = handlers[ j ];
+
+ // Triggered event must 1) be non-exclusive and have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event.
+ if ( run_all || event.namespace_re.test( handleObj.namespace ) ) {
+ // Pass in a reference to the handler function itself
+ // So that we can later remove it
+ event.handler = handleObj.handler;
+ event.data = handleObj.data;
+ event.handleObj = handleObj;
+
+ var ret = handleObj.handler.apply( this, args );
+
+ if ( ret !== undefined ) {
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+
+ if ( event.isImmediatePropagationStopped() ) {
+ break;
+ }
+ }
+ }
+ return event.result;
+ },
+
+ props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+ fix: function( event ) {
+ if ( event[ jQuery.expando ] ) {
+ return event;
+ }
+
+ // store a copy of the original event object
+ // and "clone" to set read-only properties
+ var originalEvent = event;
+ event = jQuery.Event( originalEvent );
+
+ for ( var i = this.props.length, prop; i; ) {
+ prop = this.props[ --i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Fix target property, if necessary
+ if ( !event.target ) {
+ // Fixes #1925 where srcElement might not be defined either
+ event.target = event.srcElement || document;
+ }
+
+ // check if target is a textnode (safari)
+ if ( event.target.nodeType === 3 ) {
+ event.target = event.target.parentNode;
+ }
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && event.fromElement ) {
+ event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
+ }
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && event.clientX != null ) {
+ var eventDocument = event.target.ownerDocument || document,
+ doc = eventDocument.documentElement,
+ body = eventDocument.body;
+
+ event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
+ event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0);
+ }
+
+ // Add which for key events
+ if ( event.which == null && (event.charCode != null || event.keyCode != null) ) {
+ event.which = event.charCode != null ? event.charCode : event.keyCode;
+ }
+
+ // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+ if ( !event.metaKey && event.ctrlKey ) {
+ event.metaKey = event.ctrlKey;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && event.button !== undefined ) {
+ event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+ }
+
+ return event;
+ },
+
+ // Deprecated, use jQuery.guid instead
+ guid: 1E8,
+
+ // Deprecated, use jQuery.proxy instead
+ proxy: jQuery.proxy,
+
+ special: {
+ ready: {
+ // Make sure the ready event is setup
+ setup: jQuery.bindReady,
+ teardown: jQuery.noop
+ },
+
+ live: {
+ add: function( handleObj ) {
+ jQuery.event.add( this,
+ liveConvert( handleObj.origType, handleObj.selector ),
+ jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) );
+ },
+
+ remove: function( handleObj ) {
+ jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj );
+ }
+ },
+
+ beforeunload: {
+ setup: function( data, namespaces, eventHandle ) {
+ // We only want to do this special case on windows
+ if ( jQuery.isWindow( this ) ) {
+ this.onbeforeunload = eventHandle;
+ }
+ },
+
+ teardown: function( namespaces, eventHandle ) {
+ if ( this.onbeforeunload === eventHandle ) {
+ this.onbeforeunload = null;
+ }
+ }
+ }
+ }
+};
+
+jQuery.removeEvent = document.removeEventListener ?
+ function( elem, type, handle ) {
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle, false );
+ }
+ } :
+ function( elem, type, handle ) {
+ if ( elem.detachEvent ) {
+ elem.detachEvent( "on" + type, handle );
+ }
+ };
+
+jQuery.Event = function( src, props ) {
+ // Allow instantiation without the 'new' keyword
+ if ( !this.preventDefault ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false ||
+ src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // timeStamp is buggy for some events on Firefox(#3843)
+ // So we won't rely on the native value
+ this.timeStamp = jQuery.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+function returnFalse() {
+ return false;
+}
+function returnTrue() {
+ return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ preventDefault: function() {
+ this.isDefaultPrevented = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+
+ // if preventDefault exists run it on the original event
+ if ( e.preventDefault ) {
+ e.preventDefault();
+
+ // otherwise set the returnValue property of the original event to false (IE)
+ } else {
+ e.returnValue = false;
+ }
+ },
+ stopPropagation: function() {
+ this.isPropagationStopped = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+ // if stopPropagation exists run it on the original event
+ if ( e.stopPropagation ) {
+ e.stopPropagation();
+ }
+ // otherwise set the cancelBubble property of the original event to true (IE)
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function() {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ },
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse
+};
+
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function( event ) {
+
+ // Check if mouse(over|out) are still within the same parent element
+ var related = event.relatedTarget,
+ inside = false,
+ eventType = event.type;
+
+ event.type = event.data;
+
+ if ( related !== this ) {
+
+ if ( related ) {
+ inside = jQuery.contains( this, related );
+ }
+
+ if ( !inside ) {
+
+ jQuery.event.handle.apply( this, arguments );
+
+ event.type = eventType;
+ }
+ }
+},
+
+// In case of event delegation, we only need to rename the event.type,
+// liveHandler will take care of the rest.
+delegate = function( event ) {
+ event.type = event.data;
+ jQuery.event.handle.apply( this, arguments );
+};
+
+// Create mouseenter and mouseleave events
+jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ setup: function( data ) {
+ jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
+ },
+ teardown: function( data ) {
+ jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
+ }
+ };
+});
+
+// submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+ jQuery.event.special.submit = {
+ setup: function( data, namespaces ) {
+ if ( !jQuery.nodeName( this, "form" ) ) {
+ jQuery.event.add(this, "click.specialSubmit", function( e ) {
+ var elem = e.target,
+ type = elem.type;
+
+ if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
+ trigger( "submit", this, arguments );
+ }
+ });
+
+ jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
+ var elem = e.target,
+ type = elem.type;
+
+ if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
+ trigger( "submit", this, arguments );
+ }
+ });
+
+ } else {
+ return false;
+ }
+ },
+
+ teardown: function( namespaces ) {
+ jQuery.event.remove( this, ".specialSubmit" );
+ }
+ };
+
+}
+
+// change delegation, happens here so we have bind.
+if ( !jQuery.support.changeBubbles ) {
+
+ var changeFilters,
+
+ getVal = function( elem ) {
+ var type = elem.type, val = elem.value;
+
+ if ( type === "radio" || type === "checkbox" ) {
+ val = elem.checked;
+
+ } else if ( type === "select-multiple" ) {
+ val = elem.selectedIndex > -1 ?
+ jQuery.map( elem.options, function( elem ) {
+ return elem.selected;
+ }).join("-") :
+ "";
+
+ } else if ( jQuery.nodeName( elem, "select" ) ) {
+ val = elem.selectedIndex;
+ }
+
+ return val;
+ },
+
+ testChange = function testChange( e ) {
+ var elem = e.target, data, val;
+
+ if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) {
+ return;
+ }
+
+ data = jQuery._data( elem, "_change_data" );
+ val = getVal(elem);
+
+ // the current data will be also retrieved by beforeactivate
+ if ( e.type !== "focusout" || elem.type !== "radio" ) {
+ jQuery._data( elem, "_change_data", val );
+ }
+
+ if ( data === undefined || val === data ) {
+ return;
+ }
+
+ if ( data != null || val ) {
+ e.type = "change";
+ e.liveFired = undefined;
+ jQuery.event.trigger( e, arguments[1], elem );
+ }
+ };
+
+ jQuery.event.special.change = {
+ filters: {
+ focusout: testChange,
+
+ beforedeactivate: testChange,
+
+ click: function( e ) {
+ var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : "";
+
+ if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) {
+ testChange.call( this, e );
+ }
+ },
+
+ // Change has to be called before submit
+ // Keydown will be called before keypress, which is used in submit-event delegation
+ keydown: function( e ) {
+ var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : "";
+
+ if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) ||
+ (e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
+ type === "select-multiple" ) {
+ testChange.call( this, e );
+ }
+ },
+
+ // Beforeactivate happens also before the previous element is blurred
+ // with this event you can't trigger a change event, but you can store
+ // information
+ beforeactivate: function( e ) {
+ var elem = e.target;
+ jQuery._data( elem, "_change_data", getVal(elem) );
+ }
+ },
+
+ setup: function( data, namespaces ) {
+ if ( this.type === "file" ) {
+ return false;
+ }
+
+ for ( var type in changeFilters ) {
+ jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
+ }
+
+ return rformElems.test( this.nodeName );
+ },
+
+ teardown: function( namespaces ) {
+ jQuery.event.remove( this, ".specialChange" );
+
+ return rformElems.test( this.nodeName );
+ }
+ };
+
+ changeFilters = jQuery.event.special.change.filters;
+
+ // Handle when the input is .focus()'d
+ changeFilters.focus = changeFilters.beforeactivate;
+}
+
+function trigger( type, elem, args ) {
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ // Don't pass args or remember liveFired; they apply to the donor event.
+ var event = jQuery.extend( {}, args[ 0 ] );
+ event.type = type;
+ event.originalEvent = {};
+ event.liveFired = undefined;
+ jQuery.event.handle.call( elem, event );
+ if ( event.isDefaultPrevented() ) {
+ args[ 0 ].preventDefault();
+ }
+}
+
+// Create "bubbling" focus and blur events
+if ( !jQuery.support.focusinBubbles ) {
+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler while someone wants focusin/focusout
+ var attaches = 0;
+
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ if ( attaches++ === 0 ) {
+ document.addEventListener( orig, handler, true );
+ }
+ },
+ teardown: function() {
+ if ( --attaches === 0 ) {
+ document.removeEventListener( orig, handler, true );
+ }
+ }
+ };
+
+ function handler( donor ) {
+ // Donor event is always a native one; fix it and switch its type.
+ // Let focusin/out handler cancel the donor focus/blur event.
+ var e = jQuery.event.fix( donor );
+ e.type = fix;
+ e.originalEvent = {};
+ jQuery.event.trigger( e, null, e.target );
+ if ( e.isDefaultPrevented() ) {
+ donor.preventDefault();
+ }
+ }
+ });
+}
+
+jQuery.each(["bind", "one"], function( i, name ) {
+ jQuery.fn[ name ] = function( type, data, fn ) {
+ var handler;
+
+ // Handle object literals
+ if ( typeof type === "object" ) {
+ for ( var key in type ) {
+ this[ name ](key, data, type[key], fn);
+ }
+ return this;
+ }
+
+ if ( arguments.length === 2 || data === false ) {
+ fn = data;
+ data = undefined;
+ }
+
+ if ( name === "one" ) {
+ handler = function( event ) {
+ jQuery( this ).unbind( event, handler );
+ return fn.apply( this, arguments );
+ };
+ handler.guid = fn.guid || jQuery.guid++;
+ } else {
+ handler = fn;
+ }
+
+ if ( type === "unload" && name !== "one" ) {
+ this.one( type, data, fn );
+
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ jQuery.event.add( this[i], type, handler, data );
+ }
+ }
+
+ return this;
+ };
+});
+
+jQuery.fn.extend({
+ unbind: function( type, fn ) {
+ // Handle object literals
+ if ( typeof type === "object" && !type.preventDefault ) {
+ for ( var key in type ) {
+ this.unbind(key, type[key]);
+ }
+
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ jQuery.event.remove( this[i], type, fn );
+ }
+ }
+
+ return this;
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.live( types, data, fn, selector );
+ },
+
+ undelegate: function( selector, types, fn ) {
+ if ( arguments.length === 0 ) {
+ return this.unbind( "live" );
+
+ } else {
+ return this.die( types, null, fn, selector );
+ }
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function() {
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+
+ triggerHandler: function( type, data ) {
+ if ( this[0] ) {
+ return jQuery.event.trigger( type, data, this[0], true );
+ }
+ },
+
+ toggle: function( fn ) {
+ // Save reference to arguments for access in closure
+ var args = arguments,
+ guid = fn.guid || jQuery.guid++,
+ i = 0,
+ toggler = function( event ) {
+ // Figure out which function to execute
+ var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+ jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ lastToggle ].apply( this, arguments ) || false;
+ };
+
+ // link all the functions, so any of them can unbind this click handler
+ toggler.guid = guid;
+ while ( i < args.length ) {
+ args[ i++ ].guid = guid;
+ }
+
+ return this.click( toggler );
+ },
+
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ }
+});
+
+var liveMap = {
+ focus: "focusin",
+ blur: "focusout",
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+};
+
+jQuery.each(["live", "die"], function( i, name ) {
+ jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
+ var type, i = 0, match, namespaces, preType,
+ selector = origSelector || this.selector,
+ context = origSelector ? this : jQuery( this.context );
+
+ if ( typeof types === "object" && !types.preventDefault ) {
+ for ( var key in types ) {
+ context[ name ]( key, data, types[key], selector );
+ }
+
+ return this;
+ }
+
+ if ( name === "die" && !types &&
+ origSelector && origSelector.charAt(0) === "." ) {
+
+ context.unbind( origSelector );
+
+ return this;
+ }
+
+ if ( data === false || jQuery.isFunction( data ) ) {
+ fn = data || returnFalse;
+ data = undefined;
+ }
+
+ types = (types || "").split(" ");
+
+ while ( (type = types[ i++ ]) != null ) {
+ match = rnamespaces.exec( type );
+ namespaces = "";
+
+ if ( match ) {
+ namespaces = match[0];
+ type = type.replace( rnamespaces, "" );
+ }
+
+ if ( type === "hover" ) {
+ types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
+ continue;
+ }
+
+ preType = type;
+
+ if ( liveMap[ type ] ) {
+ types.push( liveMap[ type ] + namespaces );
+ type = type + namespaces;
+
+ } else {
+ type = (liveMap[ type ] || type) + namespaces;
+ }
+
+ if ( name === "live" ) {
+ // bind live handler
+ for ( var j = 0, l = context.length; j < l; j++ ) {
+ jQuery.event.add( context[j], "live." + liveConvert( type, selector ),
+ { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
+ }
+
+ } else {
+ // unbind live handler
+ context.unbind( "live." + liveConvert( type, selector ), fn );
+ }
+ }
+
+ return this;
+ };
+});
+
+function liveHandler( event ) {
+ var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret,
+ elems = [],
+ selectors = [],
+ events = jQuery._data( this, "events" );
+
+ // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911)
+ if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) {
+ return;
+ }
+
+ if ( event.namespace ) {
+ namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)");
+ }
+
+ event.liveFired = this;
+
+ var live = events.live.slice(0);
+
+ for ( j = 0; j < live.length; j++ ) {
+ handleObj = live[j];
+
+ if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
+ selectors.push( handleObj.selector );
+
+ } else {
+ live.splice( j--, 1 );
+ }
+ }
+
+ match = jQuery( event.target ).closest( selectors, event.currentTarget );
+
+ for ( i = 0, l = match.length; i < l; i++ ) {
+ close = match[i];
+
+ for ( j = 0; j < live.length; j++ ) {
+ handleObj = live[j];
+
+ if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) {
+ elem = close.elem;
+ related = null;
+
+ // Those two events require additional checking
+ if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
+ event.type = handleObj.preType;
+ related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
+
+ // Make sure not to accidentally match a child element with the same selector
+ if ( related && jQuery.contains( elem, related ) ) {
+ related = elem;
+ }
+ }
+
+ if ( !related || related !== elem ) {
+ elems.push({ elem: elem, handleObj: handleObj, level: close.level });
+ }
+ }
+ }
+ }
+
+ for ( i = 0, l = elems.length; i < l; i++ ) {
+ match = elems[i];
+
+ if ( maxLevel && match.level > maxLevel ) {
+ break;
+ }
+
+ event.currentTarget = match.elem;
+ event.data = match.handleObj.data;
+ event.handleObj = match.handleObj;
+
+ ret = match.handleObj.origHandler.apply( match.elem, arguments );
+
+ if ( ret === false || event.isPropagationStopped() ) {
+ maxLevel = match.level;
+
+ if ( ret === false ) {
+ stop = false;
+ }
+ if ( event.isImmediatePropagationStopped() ) {
+ break;
+ }
+ }
+ }
+
+ return stop;
+}
+
+function liveConvert( type, selector ) {
+ return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&");
+}
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error").split(" "), function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( data, fn ) {
+ if ( fn == null ) {
+ fn = data;
+ data = null;
+ }
+
+ return arguments.length > 0 ?
+ this.bind( name, data, fn ) :
+ this.trigger( name );
+ };
+
+ if ( jQuery.attrFn ) {
+ jQuery.attrFn[ name ] = true;
+ }
+});
+
+
+
+/*!
+ * Sizzle CSS Selector Engine
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+ done = 0,
+ toString = Object.prototype.toString,
+ hasDuplicate = false,
+ baseHasDuplicate = true,
+ rBackslash = /\\/g,
+ rNonWord = /\W/;
+
+// Here we check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+// Thus far that includes Google Chrome.
+[0, 0].sort(function() {
+ baseHasDuplicate = false;
+ return 0;
+});
+
+var Sizzle = function( selector, context, results, seed ) {
+ results = results || [];
+ context = context || document;
+
+ var origContext = context;
+
+ if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+ return [];
+ }
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ var m, set, checkSet, extra, ret, cur, pop, i,
+ prune = true,
+ contextXML = Sizzle.isXML( context ),
+ parts = [],
+ soFar = selector;
+
+ // Reset the position of the chunker regexp (start from head)
+ do {
+ chunker.exec( "" );
+ m = chunker.exec( soFar );
+
+ if ( m ) {
+ soFar = m[3];
+
+ parts.push( m[1] );
+
+ if ( m[2] ) {
+ extra = m[3];
+ break;
+ }
+ }
+ } while ( m );
+
+ if ( parts.length > 1 && origPOS.exec( selector ) ) {
+
+ if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+ set = posProcess( parts[0] + parts[1], context );
+
+ } else {
+ set = Expr.relative[ parts[0] ] ?
+ [ context ] :
+ Sizzle( parts.shift(), context );
+
+ while ( parts.length ) {
+ selector = parts.shift();
+
+ if ( Expr.relative[ selector ] ) {
+ selector += parts.shift();
+ }
+
+ set = posProcess( selector, set );
+ }
+ }
+
+ } else {
+ // Take a shortcut and set the context if the root selector is an ID
+ // (but not if it'll be faster if the inner selector is an ID)
+ if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+ Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+
+ ret = Sizzle.find( parts.shift(), context, contextXML );
+ context = ret.expr ?
+ Sizzle.filter( ret.expr, ret.set )[0] :
+ ret.set[0];
+ }
+
+ if ( context ) {
+ ret = seed ?
+ { expr: parts.pop(), set: makeArray(seed) } :
+ Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+
+ set = ret.expr ?
+ Sizzle.filter( ret.expr, ret.set ) :
+ ret.set;
+
+ if ( parts.length > 0 ) {
+ checkSet = makeArray( set );
+
+ } else {
+ prune = false;
+ }
+
+ while ( parts.length ) {
+ cur = parts.pop();
+ pop = cur;
+
+ if ( !Expr.relative[ cur ] ) {
+ cur = "";
+ } else {
+ pop = parts.pop();
+ }
+
+ if ( pop == null ) {
+ pop = context;
+ }
+
+ Expr.relative[ cur ]( checkSet, pop, contextXML );
+ }
+
+ } else {
+ checkSet = parts = [];
+ }
+ }
+
+ if ( !checkSet ) {
+ checkSet = set;
+ }
+
+ if ( !checkSet ) {
+ Sizzle.error( cur || selector );
+ }
+
+ if ( toString.call(checkSet) === "[object Array]" ) {
+ if ( !prune ) {
+ results.push.apply( results, checkSet );
+
+ } else if ( context && context.nodeType === 1 ) {
+ for ( i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
+ results.push( set[i] );
+ }
+ }
+
+ } else {
+ for ( i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+ results.push( set[i] );
+ }
+ }
+ }
+
+ } else {
+ makeArray( checkSet, results );
+ }
+
+ if ( extra ) {
+ Sizzle( extra, origContext, results, seed );
+ Sizzle.uniqueSort( results );
+ }
+
+ return results;
+};
+
+Sizzle.uniqueSort = function( results ) {
+ if ( sortOrder ) {
+ hasDuplicate = baseHasDuplicate;
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ for ( var i = 1; i < results.length; i++ ) {
+ if ( results[i] === results[ i - 1 ] ) {
+ results.splice( i--, 1 );
+ }
+ }
+ }
+ }
+
+ return results;
+};
+
+Sizzle.matches = function( expr, set ) {
+ return Sizzle( expr, null, null, set );
+};
+
+Sizzle.matchesSelector = function( node, expr ) {
+ return Sizzle( expr, null, null, [node] ).length > 0;
+};
+
+Sizzle.find = function( expr, context, isXML ) {
+ var set;
+
+ if ( !expr ) {
+ return [];
+ }
+
+ for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+ var match,
+ type = Expr.order[i];
+
+ if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+ var left = match[1];
+ match.splice( 1, 1 );
+
+ if ( left.substr( left.length - 1 ) !== "\\" ) {
+ match[1] = (match[1] || "").replace( rBackslash, "" );
+ set = Expr.find[ type ]( match, context, isXML );
+
+ if ( set != null ) {
+ expr = expr.replace( Expr.match[ type ], "" );
+ break;
+ }
+ }
+ }
+ }
+
+ if ( !set ) {
+ set = typeof context.getElementsByTagName !== "undefined" ?
+ context.getElementsByTagName( "*" ) :
+ [];
+ }
+
+ return { set: set, expr: expr };
+};
+
+Sizzle.filter = function( expr, set, inplace, not ) {
+ var match, anyFound,
+ old = expr,
+ result = [],
+ curLoop = set,
+ isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
+
+ while ( expr && set.length ) {
+ for ( var type in Expr.filter ) {
+ if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
+ var found, item,
+ filter = Expr.filter[ type ],
+ left = match[1];
+
+ anyFound = false;
+
+ match.splice(1,1);
+
+ if ( left.substr( left.length - 1 ) === "\\" ) {
+ continue;
+ }
+
+ if ( curLoop === result ) {
+ result = [];
+ }
+
+ if ( Expr.preFilter[ type ] ) {
+ match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+ if ( !match ) {
+ anyFound = found = true;
+
+ } else if ( match === true ) {
+ continue;
+ }
+ }
+
+ if ( match ) {
+ for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+ if ( item ) {
+ found = filter( item, match, i, curLoop );
+ var pass = not ^ !!found;
+
+ if ( inplace && found != null ) {
+ if ( pass ) {
+ anyFound = true;
+
+ } else {
+ curLoop[i] = false;
+ }
+
+ } else if ( pass ) {
+ result.push( item );
+ anyFound = true;
+ }
+ }
+ }
+ }
+
+ if ( found !== undefined ) {
+ if ( !inplace ) {
+ curLoop = result;
+ }
+
+ expr = expr.replace( Expr.match[ type ], "" );
+
+ if ( !anyFound ) {
+ return [];
+ }
+
+ break;
+ }
+ }
+ }
+
+ // Improper expression
+ if ( expr === old ) {
+ if ( anyFound == null ) {
+ Sizzle.error( expr );
+
+ } else {
+ break;
+ }
+ }
+
+ old = expr;
+ }
+
+ return curLoop;
+};
+
+Sizzle.error = function( msg ) {
+ throw "Syntax error, unrecognized expression: " + msg;
+};
+
+var Expr = Sizzle.selectors = {
+ order: [ "ID", "NAME", "TAG" ],
+
+ match: {
+ ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+ CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+ NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,
+ ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,
+ TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,
+ CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,
+ POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,
+ PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
+ },
+
+ leftMatch: {},
+
+ attrMap: {
+ "class": "className",
+ "for": "htmlFor"
+ },
+
+ attrHandle: {
+ href: function( elem ) {
+ return elem.getAttribute( "href" );
+ },
+ type: function( elem ) {
+ return elem.getAttribute( "type" );
+ }
+ },
+
+ relative: {
+ "+": function(checkSet, part){
+ var isPartStr = typeof part === "string",
+ isTag = isPartStr && !rNonWord.test( part ),
+ isPartStrNotTag = isPartStr && !isTag;
+
+ if ( isTag ) {
+ part = part.toLowerCase();
+ }
+
+ for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+ if ( (elem = checkSet[i]) ) {
+ while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+ checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
+ elem || false :
+ elem === part;
+ }
+ }
+
+ if ( isPartStrNotTag ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ },
+
+ ">": function( checkSet, part ) {
+ var elem,
+ isPartStr = typeof part === "string",
+ i = 0,
+ l = checkSet.length;
+
+ if ( isPartStr && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+
+ for ( ; i < l; i++ ) {
+ elem = checkSet[i];
+
+ if ( elem ) {
+ var parent = elem.parentNode;
+ checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
+ }
+ }
+
+ } else {
+ for ( ; i < l; i++ ) {
+ elem = checkSet[i];
+
+ if ( elem ) {
+ checkSet[i] = isPartStr ?
+ elem.parentNode :
+ elem.parentNode === part;
+ }
+ }
+
+ if ( isPartStr ) {
+ Sizzle.filter( part, checkSet, true );
+ }
+ }
+ },
+
+ "": function(checkSet, part, isXML){
+ var nodeCheck,
+ doneName = done++,
+ checkFn = dirCheck;
+
+ if ( typeof part === "string" && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+ nodeCheck = part;
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
+ },
+
+ "~": function( checkSet, part, isXML ) {
+ var nodeCheck,
+ doneName = done++,
+ checkFn = dirCheck;
+
+ if ( typeof part === "string" && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+ nodeCheck = part;
+ checkFn = dirNodeCheck;
+ }
+
+ checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
+ }
+ },
+
+ find: {
+ ID: function( match, context, isXML ) {
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ },
+
+ NAME: function( match, context ) {
+ if ( typeof context.getElementsByName !== "undefined" ) {
+ var ret = [],
+ results = context.getElementsByName( match[1] );
+
+ for ( var i = 0, l = results.length; i < l; i++ ) {
+ if ( results[i].getAttribute("name") === match[1] ) {
+ ret.push( results[i] );
+ }
+ }
+
+ return ret.length === 0 ? null : ret;
+ }
+ },
+
+ TAG: function( match, context ) {
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ return context.getElementsByTagName( match[1] );
+ }
+ }
+ },
+ preFilter: {
+ CLASS: function( match, curLoop, inplace, result, not, isXML ) {
+ match = " " + match[1].replace( rBackslash, "" ) + " ";
+
+ if ( isXML ) {
+ return match;
+ }
+
+ for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+ if ( elem ) {
+ if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) {
+ if ( !inplace ) {
+ result.push( elem );
+ }
+
+ } else if ( inplace ) {
+ curLoop[i] = false;
+ }
+ }
+ }
+
+ return false;
+ },
+
+ ID: function( match ) {
+ return match[1].replace( rBackslash, "" );
+ },
+
+ TAG: function( match, curLoop ) {
+ return match[1].replace( rBackslash, "" ).toLowerCase();
+ },
+
+ CHILD: function( match ) {
+ if ( match[1] === "nth" ) {
+ if ( !match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ match[2] = match[2].replace(/^\+|\s*/g, '');
+
+ // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+ var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec(
+ match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
+ !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+ // calculate the numbers (first)n+(last) including if they are negative
+ match[2] = (test[1] + (test[2] || 1)) - 0;
+ match[3] = test[3] - 0;
+ }
+ else if ( match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // TODO: Move to normal caching system
+ match[0] = done++;
+
+ return match;
+ },
+
+ ATTR: function( match, curLoop, inplace, result, not, isXML ) {
+ var name = match[1] = match[1].replace( rBackslash, "" );
+
+ if ( !isXML && Expr.attrMap[name] ) {
+ match[1] = Expr.attrMap[name];
+ }
+
+ // Handle if an un-quoted value was used
+ match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" );
+
+ if ( match[2] === "~=" ) {
+ match[4] = " " + match[4] + " ";
+ }
+
+ return match;
+ },
+
+ PSEUDO: function( match, curLoop, inplace, result, not ) {
+ if ( match[1] === "not" ) {
+ // If we're dealing with a complex expression, or a simple one
+ if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
+ match[3] = Sizzle(match[3], null, null, curLoop);
+
+ } else {
+ var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+
+ if ( !inplace ) {
+ result.push.apply( result, ret );
+ }
+
+ return false;
+ }
+
+ } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+ return true;
+ }
+
+ return match;
+ },
+
+ POS: function( match ) {
+ match.unshift( true );
+
+ return match;
+ }
+ },
+
+ filters: {
+ enabled: function( elem ) {
+ return elem.disabled === false && elem.type !== "hidden";
+ },
+
+ disabled: function( elem ) {
+ return elem.disabled === true;
+ },
+
+ checked: function( elem ) {
+ return elem.checked === true;
+ },
+
+ selected: function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ parent: function( elem ) {
+ return !!elem.firstChild;
+ },
+
+ empty: function( elem ) {
+ return !elem.firstChild;
+ },
+
+ has: function( elem, i, match ) {
+ return !!Sizzle( match[3], elem ).length;
+ },
+
+ header: function( elem ) {
+ return (/h\d/i).test( elem.nodeName );
+ },
+
+ text: function( elem ) {
+ var attr = elem.getAttribute( "type" ), type = elem.type;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null );
+ },
+
+ radio: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type;
+ },
+
+ checkbox: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type;
+ },
+
+ file: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "file" === elem.type;
+ },
+
+ password: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "password" === elem.type;
+ },
+
+ submit: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && "submit" === elem.type;
+ },
+
+ image: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "image" === elem.type;
+ },
+
+ reset: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && "reset" === elem.type;
+ },
+
+ button: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && "button" === elem.type || name === "button";
+ },
+
+ input: function( elem ) {
+ return (/input|select|textarea|button/i).test( elem.nodeName );
+ },
+
+ focus: function( elem ) {
+ return elem === elem.ownerDocument.activeElement;
+ }
+ },
+ setFilters: {
+ first: function( elem, i ) {
+ return i === 0;
+ },
+
+ last: function( elem, i, match, array ) {
+ return i === array.length - 1;
+ },
+
+ even: function( elem, i ) {
+ return i % 2 === 0;
+ },
+
+ odd: function( elem, i ) {
+ return i % 2 === 1;
+ },
+
+ lt: function( elem, i, match ) {
+ return i < match[3] - 0;
+ },
+
+ gt: function( elem, i, match ) {
+ return i > match[3] - 0;
+ },
+
+ nth: function( elem, i, match ) {
+ return match[3] - 0 === i;
+ },
+
+ eq: function( elem, i, match ) {
+ return match[3] - 0 === i;
+ }
+ },
+ filter: {
+ PSEUDO: function( elem, match, i, array ) {
+ var name = match[1],
+ filter = Expr.filters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+
+ } else if ( name === "contains" ) {
+ return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0;
+
+ } else if ( name === "not" ) {
+ var not = match[3];
+
+ for ( var j = 0, l = not.length; j < l; j++ ) {
+ if ( not[j] === elem ) {
+ return false;
+ }
+ }
+
+ return true;
+
+ } else {
+ Sizzle.error( name );
+ }
+ },
+
+ CHILD: function( elem, match ) {
+ var type = match[1],
+ node = elem;
+
+ switch ( type ) {
+ case "only":
+ case "first":
+ while ( (node = node.previousSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ if ( type === "first" ) {
+ return true;
+ }
+
+ node = elem;
+
+ case "last":
+ while ( (node = node.nextSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ return true;
+
+ case "nth":
+ var first = match[2],
+ last = match[3];
+
+ if ( first === 1 && last === 0 ) {
+ return true;
+ }
+
+ var doneName = match[0],
+ parent = elem.parentNode;
+
+ if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
+ var count = 0;
+
+ for ( node = parent.firstChild; node; node = node.nextSibling ) {
+ if ( node.nodeType === 1 ) {
+ node.nodeIndex = ++count;
+ }
+ }
+
+ parent.sizcache = doneName;
+ }
+
+ var diff = elem.nodeIndex - last;
+
+ if ( first === 0 ) {
+ return diff === 0;
+
+ } else {
+ return ( diff % first === 0 && diff / first >= 0 );
+ }
+ }
+ },
+
+ ID: function( elem, match ) {
+ return elem.nodeType === 1 && elem.getAttribute("id") === match;
+ },
+
+ TAG: function( elem, match ) {
+ return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
+ },
+
+ CLASS: function( elem, match ) {
+ return (" " + (elem.className || elem.getAttribute("class")) + " ")
+ .indexOf( match ) > -1;
+ },
+
+ ATTR: function( elem, match ) {
+ var name = match[1],
+ result = Expr.attrHandle[ name ] ?
+ Expr.attrHandle[ name ]( elem ) :
+ elem[ name ] != null ?
+ elem[ name ] :
+ elem.getAttribute( name ),
+ value = result + "",
+ type = match[2],
+ check = match[4];
+
+ return result == null ?
+ type === "!=" :
+ type === "=" ?
+ value === check :
+ type === "*=" ?
+ value.indexOf(check) >= 0 :
+ type === "~=" ?
+ (" " + value + " ").indexOf(check) >= 0 :
+ !check ?
+ value && result !== false :
+ type === "!=" ?
+ value !== check :
+ type === "^=" ?
+ value.indexOf(check) === 0 :
+ type === "$=" ?
+ value.substr(value.length - check.length) === check :
+ type === "|=" ?
+ value === check || value.substr(0, check.length + 1) === check + "-" :
+ false;
+ },
+
+ POS: function( elem, match, i, array ) {
+ var name = match[2],
+ filter = Expr.setFilters[ name ];
+
+ if ( filter ) {
+ return filter( elem, i, match, array );
+ }
+ }
+ }
+};
+
+var origPOS = Expr.match.POS,
+ fescape = function(all, num){
+ return "\\" + (num - 0 + 1);
+ };
+
+for ( var type in Expr.match ) {
+ Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) );
+ Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
+}
+
+var makeArray = function( array, results ) {
+ array = Array.prototype.slice.call( array, 0 );
+
+ if ( results ) {
+ results.push.apply( results, array );
+ return results;
+ }
+
+ return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+// Also verifies that the returned array holds DOM nodes
+// (which is not the case in the Blackberry browser)
+try {
+ Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
+
+// Provide a fallback method if it does not work
+} catch( e ) {
+ makeArray = function( array, results ) {
+ var i = 0,
+ ret = results || [];
+
+ if ( toString.call(array) === "[object Array]" ) {
+ Array.prototype.push.apply( ret, array );
+
+ } else {
+ if ( typeof array.length === "number" ) {
+ for ( var l = array.length; i < l; i++ ) {
+ ret.push( array[i] );
+ }
+
+ } else {
+ for ( ; array[i]; i++ ) {
+ ret.push( array[i] );
+ }
+ }
+ }
+
+ return ret;
+ };
+}
+
+var sortOrder, siblingCheck;
+
+if ( document.documentElement.compareDocumentPosition ) {
+ sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+ return a.compareDocumentPosition ? -1 : 1;
+ }
+
+ return a.compareDocumentPosition(b) & 4 ? -1 : 1;
+ };
+
+} else {
+ sortOrder = function( a, b ) {
+ // The nodes are identical, we can exit early
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+
+ // Fallback to using sourceIndex (in IE) if it's available on both nodes
+ } else if ( a.sourceIndex && b.sourceIndex ) {
+ return a.sourceIndex - b.sourceIndex;
+ }
+
+ var al, bl,
+ ap = [],
+ bp = [],
+ aup = a.parentNode,
+ bup = b.parentNode,
+ cur = aup;
+
+ // If the nodes are siblings (or identical) we can do a quick check
+ if ( aup === bup ) {
+ return siblingCheck( a, b );
+
+ // If no parents were found then the nodes are disconnected
+ } else if ( !aup ) {
+ return -1;
+
+ } else if ( !bup ) {
+ return 1;
+ }
+
+ // Otherwise they're somewhere else in the tree so we need
+ // to build up a full list of the parentNodes for comparison
+ while ( cur ) {
+ ap.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ cur = bup;
+
+ while ( cur ) {
+ bp.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ al = ap.length;
+ bl = bp.length;
+
+ // Start walking down the tree looking for a discrepancy
+ for ( var i = 0; i < al && i < bl; i++ ) {
+ if ( ap[i] !== bp[i] ) {
+ return siblingCheck( ap[i], bp[i] );
+ }
+ }
+
+ // We ended someplace up the tree so do a sibling check
+ return i === al ?
+ siblingCheck( a, bp[i], -1 ) :
+ siblingCheck( ap[i], b, 1 );
+ };
+
+ siblingCheck = function( a, b, ret ) {
+ if ( a === b ) {
+ return ret;
+ }
+
+ var cur = a.nextSibling;
+
+ while ( cur ) {
+ if ( cur === b ) {
+ return -1;
+ }
+
+ cur = cur.nextSibling;
+ }
+
+ return 1;
+ };
+}
+
+// Utility function for retreiving the text value of an array of DOM nodes
+Sizzle.getText = function( elems ) {
+ var ret = "", elem;
+
+ for ( var i = 0; elems[i]; i++ ) {
+ elem = elems[i];
+
+ // Get the text from text nodes and CDATA nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
+ ret += elem.nodeValue;
+
+ // Traverse everything else, except comment nodes
+ } else if ( elem.nodeType !== 8 ) {
+ ret += Sizzle.getText( elem.childNodes );
+ }
+ }
+
+ return ret;
+};
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+ // We're going to inject a fake input element with a specified name
+ var form = document.createElement("div"),
+ id = "script" + (new Date()).getTime(),
+ root = document.documentElement;
+
+ form.innerHTML = "<a name='" + id + "'/>";
+
+ // Inject it into the root element, check its status, and remove it quickly
+ root.insertBefore( form, root.firstChild );
+
+ // The workaround has to do additional checks after a getElementById
+ // Which slows things down for other browsers (hence the branching)
+ if ( document.getElementById( id ) ) {
+ Expr.find.ID = function( match, context, isXML ) {
+ if ( typeof context.getElementById !== "undefined" && !isXML ) {
+ var m = context.getElementById(match[1]);
+
+ return m ?
+ m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
+ [m] :
+ undefined :
+ [];
+ }
+ };
+
+ Expr.filter.ID = function( elem, match ) {
+ var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+
+ return elem.nodeType === 1 && node && node.nodeValue === match;
+ };
+ }
+
+ root.removeChild( form );
+
+ // release memory in IE
+ root = form = null;
+})();
+
+(function(){
+ // Check to see if the browser returns only elements
+ // when doing getElementsByTagName("*")
+
+ // Create a fake element
+ var div = document.createElement("div");
+ div.appendChild( document.createComment("") );
+
+ // Make sure no comments are found
+ if ( div.getElementsByTagName("*").length > 0 ) {
+ Expr.find.TAG = function( match, context ) {
+ var results = context.getElementsByTagName( match[1] );
+
+ // Filter out possible comments
+ if ( match[1] === "*" ) {
+ var tmp = [];
+
+ for ( var i = 0; results[i]; i++ ) {
+ if ( results[i].nodeType === 1 ) {
+ tmp.push( results[i] );
+ }
+ }
+
+ results = tmp;
+ }
+
+ return results;
+ };
+ }
+
+ // Check to see if an attribute returns normalized href attributes
+ div.innerHTML = "<a href='#'></a>";
+
+ if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+ div.firstChild.getAttribute("href") !== "#" ) {
+
+ Expr.attrHandle.href = function( elem ) {
+ return elem.getAttribute( "href", 2 );
+ };
+ }
+
+ // release memory in IE
+ div = null;
+})();
+
+if ( document.querySelectorAll ) {
+ (function(){
+ var oldSizzle = Sizzle,
+ div = document.createElement("div"),
+ id = "__sizzle__";
+
+ div.innerHTML = "<p class='TEST'></p>";
+
+ // Safari can't handle uppercase or unicode characters when
+ // in quirks mode.
+ if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+ return;
+ }
+
+ Sizzle = function( query, context, extra, seed ) {
+ context = context || document;
+
+ // Only use querySelectorAll on non-XML documents
+ // (ID selectors don't work in non-HTML documents)
+ if ( !seed && !Sizzle.isXML(context) ) {
+ // See if we find a selector to speed up
+ var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query );
+
+ if ( match && (context.nodeType === 1 || context.nodeType === 9) ) {
+ // Speed-up: Sizzle("TAG")
+ if ( match[1] ) {
+ return makeArray( context.getElementsByTagName( query ), extra );
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) {
+ return makeArray( context.getElementsByClassName( match[2] ), extra );
+ }
+ }
+
+ if ( context.nodeType === 9 ) {
+ // Speed-up: Sizzle("body")
+ // The body element only exists once, optimize finding it
+ if ( query === "body" && context.body ) {
+ return makeArray( [ context.body ], extra );
+
+ // Speed-up: Sizzle("#ID")
+ } else if ( match && match[3] ) {
+ var elem = context.getElementById( match[3] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id === match[3] ) {
+ return makeArray( [ elem ], extra );
+ }
+
+ } else {
+ return makeArray( [], extra );
+ }
+ }
+
+ try {
+ return makeArray( context.querySelectorAll(query), extra );
+ } catch(qsaError) {}
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ var oldContext = context,
+ old = context.getAttribute( "id" ),
+ nid = old || id,
+ hasParent = context.parentNode,
+ relativeHierarchySelector = /^\s*[+~]/.test( query );
+
+ if ( !old ) {
+ context.setAttribute( "id", nid );
+ } else {
+ nid = nid.replace( /'/g, "\\$&" );
+ }
+ if ( relativeHierarchySelector && hasParent ) {
+ context = context.parentNode;
+ }
+
+ try {
+ if ( !relativeHierarchySelector || hasParent ) {
+ return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra );
+ }
+
+ } catch(pseudoError) {
+ } finally {
+ if ( !old ) {
+ oldContext.removeAttribute( "id" );
+ }
+ }
+ }
+ }
+
+ return oldSizzle(query, context, extra, seed);
+ };
+
+ for ( var prop in oldSizzle ) {
+ Sizzle[ prop ] = oldSizzle[ prop ];
+ }
+
+ // release memory in IE
+ div = null;
+ })();
+}
+
+(function(){
+ var html = document.documentElement,
+ matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector;
+
+ if ( matches ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9 fails this)
+ var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ),
+ pseudoWorks = false;
+
+ try {
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( document.documentElement, "[test!='']:sizzle" );
+
+ } catch( pseudoError ) {
+ pseudoWorks = true;
+ }
+
+ Sizzle.matchesSelector = function( node, expr ) {
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']");
+
+ if ( !Sizzle.isXML( node ) ) {
+ try {
+ if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
+ var ret = matches.call( node, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || !disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9, so check for that
+ node.document && node.document.nodeType !== 11 ) {
+ return ret;
+ }
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle(expr, null, null, [node]).length > 0;
+ };
+ }
+})();
+
+(function(){
+ var div = document.createElement("div");
+
+ div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+ // Opera can't find a second classname (in 9.6)
+ // Also, make sure that getElementsByClassName actually exists
+ if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
+ return;
+ }
+
+ // Safari caches class attributes, doesn't catch changes (in 3.2)
+ div.lastChild.className = "e";
+
+ if ( div.getElementsByClassName("e").length === 1 ) {
+ return;
+ }
+
+ Expr.order.splice(1, 0, "CLASS");
+ Expr.find.CLASS = function( match, context, isXML ) {
+ if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+ return context.getElementsByClassName(match[1]);
+ }
+ };
+
+ // release memory in IE
+ div = null;
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+
+ if ( elem ) {
+ var match = false;
+
+ elem = elem[dir];
+
+ while ( elem ) {
+ if ( elem.sizcache === doneName ) {
+ match = checkSet[elem.sizset];
+ break;
+ }
+
+ if ( elem.nodeType === 1 && !isXML ){
+ elem.sizcache = doneName;
+ elem.sizset = i;
+ }
+
+ if ( elem.nodeName.toLowerCase() === cur ) {
+ match = elem;
+ break;
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+ for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+ var elem = checkSet[i];
+
+ if ( elem ) {
+ var match = false;
+
+ elem = elem[dir];
+
+ while ( elem ) {
+ if ( elem.sizcache === doneName ) {
+ match = checkSet[elem.sizset];
+ break;
+ }
+
+ if ( elem.nodeType === 1 ) {
+ if ( !isXML ) {
+ elem.sizcache = doneName;
+ elem.sizset = i;
+ }
+
+ if ( typeof cur !== "string" ) {
+ if ( elem === cur ) {
+ match = true;
+ break;
+ }
+
+ } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+ match = elem;
+ break;
+ }
+ }
+
+ elem = elem[dir];
+ }
+
+ checkSet[i] = match;
+ }
+ }
+}
+
+if ( document.documentElement.contains ) {
+ Sizzle.contains = function( a, b ) {
+ return a !== b && (a.contains ? a.contains(b) : true);
+ };
+
+} else if ( document.documentElement.compareDocumentPosition ) {
+ Sizzle.contains = function( a, b ) {
+ return !!(a.compareDocumentPosition(b) & 16);
+ };
+
+} else {
+ Sizzle.contains = function() {
+ return false;
+ };
+}
+
+Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+var posProcess = function( selector, context ) {
+ var match,
+ tmpSet = [],
+ later = "",
+ root = context.nodeType ? [context] : context;
+
+ // Position selectors must be done after the filter
+ // And so must :not(positional) so we move all PSEUDOs to the end
+ while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+ later += match[0];
+ selector = selector.replace( Expr.match.PSEUDO, "" );
+ }
+
+ selector = Expr.relative[selector] ? selector + "*" : selector;
+
+ for ( var i = 0, l = root.length; i < l; i++ ) {
+ Sizzle( selector, root[i], tmpSet );
+ }
+
+ return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+})();
+
+
+var runtil = /Until$/,
+ rparentsprev = /^(?:parents|prevUntil|prevAll)/,
+ // Note: This RegExp should be improved, or likely pulled from Sizzle
+ rmultiselector = /,/,
+ isSimple = /^.[^:#\[\.,]*$/,
+ slice = Array.prototype.slice,
+ POS = jQuery.expr.match.POS,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.fn.extend({
+ find: function( selector ) {
+ var self = this,
+ i, l;
+
+ if ( typeof selector !== "string" ) {
+ return jQuery( selector ).filter(function() {
+ for ( i = 0, l = self.length; i < l; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ });
+ }
+
+ var ret = this.pushStack( "", "find", selector ),
+ length, n, r;
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ length = ret.length;
+ jQuery.find( selector, this[i], ret );
+
+ if ( i > 0 ) {
+ // Make sure that the results are unique
+ for ( n = length; n < ret.length; n++ ) {
+ for ( r = 0; r < length; r++ ) {
+ if ( ret[r] === ret[n] ) {
+ ret.splice(n--, 1);
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ return ret;
+ },
+
+ has: function( target ) {
+ var targets = jQuery( target );
+ return this.filter(function() {
+ for ( var i = 0, l = targets.length; i < l; i++ ) {
+ if ( jQuery.contains( this, targets[i] ) ) {
+ return true;
+ }
+ }
+ });
+ },
+
+ not: function( selector ) {
+ return this.pushStack( winnow(this, selector, false), "not", selector);
+ },
+
+ filter: function( selector ) {
+ return this.pushStack( winnow(this, selector, true), "filter", selector );
+ },
+
+ is: function( selector ) {
+ return !!selector && ( typeof selector === "string" ?
+ jQuery.filter( selector, this ).length > 0 :
+ this.filter( selector ).length > 0 );
+ },
+
+ closest: function( selectors, context ) {
+ var ret = [], i, l, cur = this[0];
+
+ // Array
+ if ( jQuery.isArray( selectors ) ) {
+ var match, selector,
+ matches = {},
+ level = 1;
+
+ if ( cur && selectors.length ) {
+ for ( i = 0, l = selectors.length; i < l; i++ ) {
+ selector = selectors[i];
+
+ if ( !matches[ selector ] ) {
+ matches[ selector ] = POS.test( selector ) ?
+ jQuery( selector, context || this.context ) :
+ selector;
+ }
+ }
+
+ while ( cur && cur.ownerDocument && cur !== context ) {
+ for ( selector in matches ) {
+ match = matches[ selector ];
+
+ if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) {
+ ret.push({ selector: selector, elem: cur, level: level });
+ }
+ }
+
+ cur = cur.parentNode;
+ level++;
+ }
+ }
+
+ return ret;
+ }
+
+ // String
+ var pos = POS.test( selectors ) || typeof selectors !== "string" ?
+ jQuery( selectors, context || this.context ) :
+ 0;
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ cur = this[i];
+
+ while ( cur ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
+ ret.push( cur );
+ break;
+
+ } else {
+ cur = cur.parentNode;
+ if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) {
+ break;
+ }
+ }
+ }
+ }
+
+ ret = ret.length > 1 ? jQuery.unique( ret ) : ret;
+
+ return this.pushStack( ret, "closest", selectors );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+ if ( !elem || typeof elem === "string" ) {
+ return jQuery.inArray( this[0],
+ // If it receives a string, the selector is used
+ // If it receives nothing, the siblings are used
+ elem ? jQuery( elem ) : this.parent().children() );
+ }
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this );
+ },
+
+ add: function( selector, context ) {
+ var set = typeof selector === "string" ?
+ jQuery( selector, context ) :
+ jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
+ all = jQuery.merge( this.get(), set );
+
+ return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+ all :
+ jQuery.unique( all ) );
+ },
+
+ andSelf: function() {
+ return this.add( this.prevObject );
+ }
+});
+
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+ return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
+
+jQuery.each({
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return jQuery.dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return jQuery.nth( elem, 2, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return jQuery.nth( elem, 2, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return jQuery.dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return jQuery.dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return jQuery.sibling( elem.parentNode.firstChild, elem );
+ },
+ children: function( elem ) {
+ return jQuery.sibling( elem.firstChild );
+ },
+ contents: function( elem ) {
+ return jQuery.nodeName( elem, "iframe" ) ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.makeArray( elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var ret = jQuery.map( this, fn, until ),
+ // The variable 'args' was introduced in
+ // https://github.com/jquery/jquery/commit/52a0238
+ // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed.
+ // http://code.google.com/p/v8/issues/detail?id=1050
+ args = slice.call(arguments);
+
+ if ( !runtil.test( name ) ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ ret = jQuery.filter( selector, ret );
+ }
+
+ ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
+
+ if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
+ ret = ret.reverse();
+ }
+
+ return this.pushStack( ret, name, args.join(",") );
+ };
+});
+
+jQuery.extend({
+ filter: function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return elems.length === 1 ?
+ jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
+ jQuery.find.matches(expr, elems);
+ },
+
+ dir: function( elem, dir, until ) {
+ var matched = [],
+ cur = elem[ dir ];
+
+ while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+ if ( cur.nodeType === 1 ) {
+ matched.push( cur );
+ }
+ cur = cur[dir];
+ }
+ return matched;
+ },
+
+ nth: function( cur, result, dir, elem ) {
+ result = result || 1;
+ var num = 0;
+
+ for ( ; cur; cur = cur[dir] ) {
+ if ( cur.nodeType === 1 && ++num === result ) {
+ break;
+ }
+ }
+
+ return cur;
+ },
+
+ sibling: function( n, elem ) {
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ r.push( n );
+ }
+ }
+
+ return r;
+ }
+});
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, keep ) {
+
+ // Can't pass null or undefined to indexOf in Firefox 4
+ // Set to 0 to skip string check
+ qualifier = qualifier || 0;
+
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ var retVal = !!qualifier.call( elem, i, elem );
+ return retVal === keep;
+ });
+
+ } else if ( qualifier.nodeType ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ return (elem === qualifier) === keep;
+ });
+
+ } else if ( typeof qualifier === "string" ) {
+ var filtered = jQuery.grep(elements, function( elem ) {
+ return elem.nodeType === 1;
+ });
+
+ if ( isSimple.test( qualifier ) ) {
+ return jQuery.filter(qualifier, filtered, !keep);
+ } else {
+ qualifier = jQuery.filter( qualifier, filtered );
+ }
+ }
+
+ return jQuery.grep(elements, function( elem, i ) {
+ return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
+ });
+}
+
+
+
+
+var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnocache = /<(?:script|object|embed|option|style)/i,
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /\/(java|ecma)script/i,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/,
+ wrapMap = {
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+ legend: [ 1, "<fieldset>", "</fieldset>" ],
+ thead: [ 1, "<table>", "</table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+ area: [ 1, "<map>", "</map>" ],
+ _default: [ 0, "", "" ]
+ };
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// IE can't serialize <link> and <script> tags normally
+if ( !jQuery.support.htmlSerialize ) {
+ wrapMap._default = [ 1, "div<div>", "</div>" ];
+}
+
+jQuery.fn.extend({
+ text: function( text ) {
+ if ( jQuery.isFunction(text) ) {
+ return this.each(function(i) {
+ var self = jQuery( this );
+
+ self.text( text.call(this, i, self.text()) );
+ });
+ }
+
+ if ( typeof text !== "object" && text !== undefined ) {
+ return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+ }
+
+ return jQuery.text( this );
+ },
+
+ wrapAll: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapAll( html.call(this, i) );
+ });
+ }
+
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+ if ( this[0].parentNode ) {
+ wrap.insertBefore( this[0] );
+ }
+
+ wrap.map(function() {
+ var elem = this;
+
+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+ elem = elem.firstChild;
+ }
+
+ return elem;
+ }).append( this );
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapInner( html.call(this, i) );
+ });
+ }
+
+ return this.each(function() {
+ var self = jQuery( this ),
+ contents = self.contents();
+
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ });
+ },
+
+ wrap: function( html ) {
+ return this.each(function() {
+ jQuery( this ).wrapAll( html );
+ });
+ },
+
+ unwrap: function() {
+ return this.parent().each(function() {
+ if ( !jQuery.nodeName( this, "body" ) ) {
+ jQuery( this ).replaceWith( this.childNodes );
+ }
+ }).end();
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 ) {
+ this.appendChild( elem );
+ }
+ });
+ },
+
+ prepend: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 ) {
+ this.insertBefore( elem, this.firstChild );
+ }
+ });
+ },
+
+ before: function() {
+ if ( this[0] && this[0].parentNode ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this );
+ });
+ } else if ( arguments.length ) {
+ var set = jQuery(arguments[0]);
+ set.push.apply( set, this.toArray() );
+ return this.pushStack( set, "before", arguments );
+ }
+ },
+
+ after: function() {
+ if ( this[0] && this[0].parentNode ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ });
+ } else if ( arguments.length ) {
+ var set = this.pushStack( this, "after", arguments );
+ set.push.apply( set, jQuery(arguments[0]).toArray() );
+ return set;
+ }
+ },
+
+ // keepData is for internal use only--do not document
+ remove: function( selector, keepData ) {
+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+ if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+ if ( !keepData && elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ jQuery.cleanData( [ elem ] );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+ }
+ }
+
+ return this;
+ },
+
+ empty: function() {
+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ }
+
+ // Remove any remaining nodes
+ while ( elem.firstChild ) {
+ elem.removeChild( elem.firstChild );
+ }
+ }
+
+ return this;
+ },
+
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map( function () {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ });
+ },
+
+ html: function( value ) {
+ if ( value === undefined ) {
+ return this[0] && this[0].nodeType === 1 ?
+ this[0].innerHTML.replace(rinlinejQuery, "") :
+ null;
+
+ // See if we can take a shortcut and just use innerHTML
+ } else if ( typeof value === "string" && !rnocache.test( value ) &&
+ (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
+ !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
+
+ value = value.replace(rxhtmlTag, "<$1></$2>");
+
+ try {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( this[i].nodeType === 1 ) {
+ jQuery.cleanData( this[i].getElementsByTagName("*") );
+ this[i].innerHTML = value;
+ }
+ }
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch(e) {
+ this.empty().append( value );
+ }
+
+ } else if ( jQuery.isFunction( value ) ) {
+ this.each(function(i){
+ var self = jQuery( this );
+
+ self.html( value.call(this, i, self.html()) );
+ });
+
+ } else {
+ this.empty().append( value );
+ }
+
+ return this;
+ },
+
+ replaceWith: function( value ) {
+ if ( this[0] && this[0].parentNode ) {
+ // Make sure that the elements are removed from the DOM before they are inserted
+ // this can help fix replacing a parent with child elements
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function(i) {
+ var self = jQuery(this), old = self.html();
+ self.replaceWith( value.call( this, i, old ) );
+ });
+ }
+
+ if ( typeof value !== "string" ) {
+ value = jQuery( value ).detach();
+ }
+
+ return this.each(function() {
+ var next = this.nextSibling,
+ parent = this.parentNode;
+
+ jQuery( this ).remove();
+
+ if ( next ) {
+ jQuery(next).before( value );
+ } else {
+ jQuery(parent).append( value );
+ }
+ });
+ } else {
+ return this.length ?
+ this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) :
+ this;
+ }
+ },
+
+ detach: function( selector ) {
+ return this.remove( selector, true );
+ },
+
+ domManip: function( args, table, callback ) {
+ var results, first, fragment, parent,
+ value = args[0],
+ scripts = [];
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
+ return this.each(function() {
+ jQuery(this).domManip( args, table, callback, true );
+ });
+ }
+
+ if ( jQuery.isFunction(value) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ args[0] = value.call(this, i, table ? self.html() : undefined);
+ self.domManip( args, table, callback );
+ });
+ }
+
+ if ( this[0] ) {
+ parent = value && value.parentNode;
+
+ // If we're in a fragment, just use that instead of building a new one
+ if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
+ results = { fragment: parent };
+
+ } else {
+ results = jQuery.buildFragment( args, this, scripts );
+ }
+
+ fragment = results.fragment;
+
+ if ( fragment.childNodes.length === 1 ) {
+ first = fragment = fragment.firstChild;
+ } else {
+ first = fragment.firstChild;
+ }
+
+ if ( first ) {
+ table = table && jQuery.nodeName( first, "tr" );
+
+ for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) {
+ callback.call(
+ table ?
+ root(this[i], first) :
+ this[i],
+ // Make sure that we do not leak memory by inadvertently discarding
+ // the original fragment (which might have attached data) instead of
+ // using it; in addition, use the original fragment object for the last
+ // item instead of first because it can end up being emptied incorrectly
+ // in certain situations (Bug #8070).
+ // Fragments from the fragment cache must always be cloned and never used
+ // in place.
+ results.cacheable || (l > 1 && i < lastIndex) ?
+ jQuery.clone( fragment, true, true ) :
+ fragment
+ );
+ }
+ }
+
+ if ( scripts.length ) {
+ jQuery.each( scripts, evalScript );
+ }
+ }
+
+ return this;
+ }
+});
+
+function root( elem, cur ) {
+ return jQuery.nodeName(elem, "table") ?
+ (elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+ elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+
+ if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+ return;
+ }
+
+ var internalKey = jQuery.expando,
+ oldData = jQuery.data( src ),
+ curData = jQuery.data( dest, oldData );
+
+ // Switch to use the internal data object, if it exists, for the next
+ // stage of data copying
+ if ( (oldData = oldData[ internalKey ]) ) {
+ var events = oldData.events;
+ curData = curData[ internalKey ] = jQuery.extend({}, oldData);
+
+ if ( events ) {
+ delete curData.handle;
+ curData.events = {};
+
+ for ( var type in events ) {
+ for ( var i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data );
+ }
+ }
+ }
+ }
+}
+
+function cloneFixAttributes( src, dest ) {
+ var nodeName;
+
+ // We do not need to do anything for non-Elements
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ // clearAttributes removes the attributes, which we don't want,
+ // but also removes the attachEvent events, which we *do* want
+ if ( dest.clearAttributes ) {
+ dest.clearAttributes();
+ }
+
+ // mergeAttributes, in contrast, only merges back on the
+ // original attributes, not the events
+ if ( dest.mergeAttributes ) {
+ dest.mergeAttributes( src );
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ // IE6-8 fail to clone children inside object elements that use
+ // the proprietary classid attribute value (rather than the type
+ // attribute) to identify the type of content to display
+ if ( nodeName === "object" ) {
+ dest.outerHTML = src.outerHTML;
+
+ } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+ if ( src.checked ) {
+ dest.defaultChecked = dest.checked = src.checked;
+ }
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if ( dest.value !== src.value ) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if ( nodeName === "option" ) {
+ dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+ }
+
+ // Event data gets referenced instead of copied if the expando
+ // gets copied too
+ dest.removeAttribute( jQuery.expando );
+}
+
+jQuery.buildFragment = function( args, nodes, scripts ) {
+ var fragment, cacheable, cacheresults, doc;
+
+ // nodes may contain either an explicit document object,
+ // a jQuery collection or context object.
+ // If nodes[0] contains a valid object to assign to doc
+ if ( nodes && nodes[0] ) {
+ doc = nodes[0].ownerDocument || nodes[0];
+ }
+
+ // Ensure that an attr object doesn't incorrectly stand in as a document object
+ // Chrome and Firefox seem to allow this to occur and will throw exception
+ // Fixes #8950
+ if ( !doc.createDocumentFragment ) {
+ doc = document;
+ }
+
+ // Only cache "small" (1/2 KB) HTML strings that are associated with the main document
+ // Cloning options loses the selected state, so don't cache them
+ // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+ // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+ if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
+ args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
+
+ cacheable = true;
+
+ cacheresults = jQuery.fragments[ args[0] ];
+ if ( cacheresults && cacheresults !== 1 ) {
+ fragment = cacheresults;
+ }
+ }
+
+ if ( !fragment ) {
+ fragment = doc.createDocumentFragment();
+ jQuery.clean( args, doc, fragment, scripts );
+ }
+
+ if ( cacheable ) {
+ jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
+ }
+
+ return { fragment: fragment, cacheable: cacheable };
+};
+
+jQuery.fragments = {};
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = [],
+ insert = jQuery( selector ),
+ parent = this.length === 1 && this[0].parentNode;
+
+ if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+ insert[ original ]( this[0] );
+ return this;
+
+ } else {
+ for ( var i = 0, l = insert.length; i < l; i++ ) {
+ var elems = (i > 0 ? this.clone(true) : this).get();
+ jQuery( insert[i] )[ original ]( elems );
+ ret = ret.concat( elems );
+ }
+
+ return this.pushStack( ret, name, insert.selector );
+ }
+ };
+});
+
+function getAll( elem ) {
+ if ( "getElementsByTagName" in elem ) {
+ return elem.getElementsByTagName( "*" );
+
+ } else if ( "querySelectorAll" in elem ) {
+ return elem.querySelectorAll( "*" );
+
+ } else {
+ return [];
+ }
+}
+
+// Used in clean, fixes the defaultChecked property
+function fixDefaultChecked( elem ) {
+ if ( elem.type === "checkbox" || elem.type === "radio" ) {
+ elem.defaultChecked = elem.checked;
+ }
+}
+// Finds all inputs and passes them to fixDefaultChecked
+function findInputs( elem ) {
+ if ( jQuery.nodeName( elem, "input" ) ) {
+ fixDefaultChecked( elem );
+ } else if ( "getElementsByTagName" in elem ) {
+ jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked );
+ }
+}
+
+jQuery.extend({
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var clone = elem.cloneNode(true),
+ srcElements,
+ destElements,
+ i;
+
+ if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+ // IE copies events bound via attachEvent when using cloneNode.
+ // Calling detachEvent on the clone will also remove the events
+ // from the original. In order to get around this, we use some
+ // proprietary methods to clear the events. Thanks to MooTools
+ // guys for this hotness.
+
+ cloneFixAttributes( elem, clone );
+
+ // Using Sizzle here is crazy slow, so we use getElementsByTagName
+ // instead
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ // Weird iteration because IE will replace the length property
+ // with an element if you are cloning the body and one of the
+ // elements on the page has a name or id of "length"
+ for ( i = 0; srcElements[i]; ++i ) {
+ cloneFixAttributes( srcElements[i], destElements[i] );
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ cloneCopyEvent( elem, clone );
+
+ if ( deepDataAndEvents ) {
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ for ( i = 0; srcElements[i]; ++i ) {
+ cloneCopyEvent( srcElements[i], destElements[i] );
+ }
+ }
+ }
+
+ srcElements = destElements = null;
+
+ // Return the cloned set
+ return clone;
+ },
+
+ clean: function( elems, context, fragment, scripts ) {
+ var checkScriptType;
+
+ context = context || document;
+
+ // !context.createElement fails in IE with an error but returns typeof 'object'
+ if ( typeof context.createElement === "undefined" ) {
+ context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+ }
+
+ var ret = [], j;
+
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ if ( typeof elem === "number" ) {
+ elem += "";
+ }
+
+ if ( !elem ) {
+ continue;
+ }
+
+ // Convert html string into DOM nodes
+ if ( typeof elem === "string" ) {
+ if ( !rhtml.test( elem ) ) {
+ elem = context.createTextNode( elem );
+ } else {
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(rxhtmlTag, "<$1></$2>");
+
+ // Trim whitespace, otherwise indexOf won't work as expected
+ var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
+ wrap = wrapMap[ tag ] || wrapMap._default,
+ depth = wrap[0],
+ div = context.createElement("div");
+
+ // Go to html and back, then peel off extra wrappers
+ div.innerHTML = wrap[1] + elem + wrap[2];
+
+ // Move to the right depth
+ while ( depth-- ) {
+ div = div.lastChild;
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ var hasBody = rtbody.test(elem),
+ tbody = tag === "table" && !hasBody ?
+ div.firstChild && div.firstChild.childNodes :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !hasBody ?
+ div.childNodes :
+ [];
+
+ for ( j = tbody.length - 1; j >= 0 ; --j ) {
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ }
+ }
+ }
+
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+ }
+
+ elem = div.childNodes;
+ }
+ }
+
+ // Resets defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ var len;
+ if ( !jQuery.support.appendChecked ) {
+ if ( elem[0] && typeof (len = elem.length) === "number" ) {
+ for ( j = 0; j < len; j++ ) {
+ findInputs( elem[j] );
+ }
+ } else {
+ findInputs( elem );
+ }
+ }
+
+ if ( elem.nodeType ) {
+ ret.push( elem );
+ } else {
+ ret = jQuery.merge( ret, elem );
+ }
+ }
+
+ if ( fragment ) {
+ checkScriptType = function( elem ) {
+ return !elem.type || rscriptType.test( elem.type );
+ };
+ for ( i = 0; ret[i]; i++ ) {
+ if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+ scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+
+ } else {
+ if ( ret[i].nodeType === 1 ) {
+ var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType );
+
+ ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
+ }
+ fragment.appendChild( ret[i] );
+ }
+ }
+ }
+
+ return ret;
+ },
+
+ cleanData: function( elems ) {
+ var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special,
+ deleteExpando = jQuery.support.deleteExpando;
+
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ continue;
+ }
+
+ id = elem[ jQuery.expando ];
+
+ if ( id ) {
+ data = cache[ id ] && cache[ id ][ internalKey ];
+
+ if ( data && data.events ) {
+ for ( var type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent( elem, type, data.handle );
+ }
+ }
+
+ // Null the DOM reference to avoid IE6/7/8 leak (#7054)
+ if ( data.handle ) {
+ data.handle.elem = null;
+ }
+ }
+
+ if ( deleteExpando ) {
+ delete elem[ jQuery.expando ];
+
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( jQuery.expando );
+ }
+
+ delete cache[ id ];
+ }
+ }
+ }
+});
+
+function evalScript( i, elem ) {
+ if ( elem.src ) {
+ jQuery.ajax({
+ url: elem.src,
+ async: false,
+ dataType: "script"
+ });
+ } else {
+ jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+}
+
+
+
+var ralpha = /alpha\([^)]*\)/i,
+ ropacity = /opacity=([^)]*)/,
+ // fixed for IE9, see #8346
+ rupper = /([A-Z]|^ms)/g,
+ rnumpx = /^-?\d+(?:px)?$/i,
+ rnum = /^-?\d/,
+ rrelNum = /^[+\-]=/,
+ rrelNumFilter = /[^+\-\.\de]+/g,
+
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+ cssWidth = [ "Left", "Right" ],
+ cssHeight = [ "Top", "Bottom" ],
+ curCSS,
+
+ getComputedStyle,
+ currentStyle;
+
+jQuery.fn.css = function( name, value ) {
+ // Setting 'undefined' is a no-op
+ if ( arguments.length === 2 && value === undefined ) {
+ return this;
+ }
+
+ return jQuery.access( this, name, value, true, function( elem, name, value ) {
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
+ });
+};
+
+jQuery.extend({
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity", "opacity" );
+ return ret === "" ? "1" : ret;
+
+ } else {
+ return elem.style.opacity;
+ }
+ }
+ }
+ },
+
+ // Exclude the following css properties to add px
+ cssNumber: {
+ "fillOpacity": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, origName = jQuery.camelCase( name ),
+ style = elem.style, hooks = jQuery.cssHooks[ origName ];
+
+ name = jQuery.cssProps[ origName ] || origName;
+
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
+
+ // Make sure that NaN and null values aren't set. See: #7116
+ if ( type === "number" && isNaN( value ) || value == null ) {
+ return;
+ }
+
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if ( type === "string" && rrelNum.test( value ) ) {
+ value = +value.replace( rrelNumFilter, "" ) + parseFloat( jQuery.css( elem, name ) );
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
+ value += "px";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) {
+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+ // Fixes bug #5509
+ try {
+ style[ name ] = value;
+ } catch(e) {}
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
+ }
+ },
+
+ css: function( elem, name, extra ) {
+ var ret, hooks;
+
+ // Make sure that we're working with the right name
+ name = jQuery.camelCase( name );
+ hooks = jQuery.cssHooks[ name ];
+ name = jQuery.cssProps[ name ] || name;
+
+ // cssFloat needs a special treatment
+ if ( name === "cssFloat" ) {
+ name = "float";
+ }
+
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
+ return ret;
+
+ // Otherwise, if a way to get the computed value exists, use that
+ } else if ( curCSS ) {
+ return curCSS( elem, name );
+ }
+ },
+
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( var name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ callback.call( elem );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
+ }
+});
+
+// DEPRECATED, Use jQuery.css() instead
+jQuery.curCSS = jQuery.css;
+
+jQuery.each(["height", "width"], function( i, name ) {
+ jQuery.cssHooks[ name ] = {
+ get: function( elem, computed, extra ) {
+ var val;
+
+ if ( computed ) {
+ if ( elem.offsetWidth !== 0 ) {
+ return getWH( elem, name, extra );
+ } else {
+ jQuery.swap( elem, cssShow, function() {
+ val = getWH( elem, name, extra );
+ });
+ }
+
+ return val;
+ }
+ },
+
+ set: function( elem, value ) {
+ if ( rnumpx.test( value ) ) {
+ // ignore negative width and height values #1599
+ value = parseFloat( value );
+
+ if ( value >= 0 ) {
+ return value + "px";
+ }
+
+ } else {
+ return value;
+ }
+ }
+ };
+});
+
+if ( !jQuery.support.opacity ) {
+ jQuery.cssHooks.opacity = {
+ get: function( elem, computed ) {
+ // IE uses filters for opacity
+ return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
+ ( parseFloat( RegExp.$1 ) / 100 ) + "" :
+ computed ? "1" : "";
+ },
+
+ set: function( elem, value ) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle;
+
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
+
+ // Set the alpha filter to set the opacity
+ var opacity = jQuery.isNaN( value ) ?
+ "" :
+ "alpha(opacity=" + value * 100 + ")",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
+
+ style.filter = ralpha.test( filter ) ?
+ filter.replace( ralpha, opacity ) :
+ filter + " " + opacity;
+ }
+ };
+}
+
+jQuery(function() {
+ // This hook cannot be added until DOM ready because the support test
+ // for it is not run until after DOM ready
+ if ( !jQuery.support.reliableMarginRight ) {
+ jQuery.cssHooks.marginRight = {
+ get: function( elem, computed ) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ var ret;
+ jQuery.swap( elem, { "display": "inline-block" }, function() {
+ if ( computed ) {
+ ret = curCSS( elem, "margin-right", "marginRight" );
+ } else {
+ ret = elem.style.marginRight;
+ }
+ });
+ return ret;
+ }
+ };
+ }
+});
+
+if ( document.defaultView && document.defaultView.getComputedStyle ) {
+ getComputedStyle = function( elem, name ) {
+ var ret, defaultView, computedStyle;
+
+ name = name.replace( rupper, "-$1" ).toLowerCase();
+
+ if ( !(defaultView = elem.ownerDocument.defaultView) ) {
+ return undefined;
+ }
+
+ if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) {
+ ret = computedStyle.getPropertyValue( name );
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
+ ret = jQuery.style( elem, name );
+ }
+ }
+
+ return ret;
+ };
+}
+
+if ( document.documentElement.currentStyle ) {
+ currentStyle = function( elem, name ) {
+ var left,
+ ret = elem.currentStyle && elem.currentStyle[ name ],
+ rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ],
+ style = elem.style;
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+ // Remember the original values
+ left = style.left;
+
+ // Put in the new values to get a computed value out
+ if ( rsLeft ) {
+ elem.runtimeStyle.left = elem.currentStyle.left;
+ }
+ style.left = name === "fontSize" ? "1em" : (ret || 0);
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ if ( rsLeft ) {
+ elem.runtimeStyle.left = rsLeft;
+ }
+ }
+
+ return ret === "" ? "auto" : ret;
+ };
+}
+
+curCSS = getComputedStyle || currentStyle;
+
+function getWH( elem, name, extra ) {
+
+ // Start with offset property
+ var val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+ which = name === "width" ? cssWidth : cssHeight;
+
+ if ( val > 0 ) {
+ if ( extra !== "border" ) {
+ jQuery.each( which, function() {
+ if ( !extra ) {
+ val -= parseFloat( jQuery.css( elem, "padding" + this ) ) || 0;
+ }
+ if ( extra === "margin" ) {
+ val += parseFloat( jQuery.css( elem, extra + this ) ) || 0;
+ } else {
+ val -= parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0;
+ }
+ });
+ }
+
+ return val + "px";
+ }
+
+ // Fall back to computed then uncomputed css if necessary
+ val = curCSS( elem, name, name );
+ if ( val < 0 || val == null ) {
+ val = elem.style[ name ] || 0;
+ }
+ // Normalize "", auto, and prepare for extra
+ val = parseFloat( val ) || 0;
+
+ // Add padding, border, margin
+ if ( extra ) {
+ jQuery.each( which, function() {
+ val += parseFloat( jQuery.css( elem, "padding" + this ) ) || 0;
+ if ( extra !== "padding" ) {
+ val += parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0;
+ }
+ if ( extra === "margin" ) {
+ val += parseFloat( jQuery.css( elem, extra + this ) ) || 0;
+ }
+ });
+ }
+
+ return val + "px";
+}
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.hidden = function( elem ) {
+ var width = elem.offsetWidth,
+ height = elem.offsetHeight;
+
+ return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none");
+ };
+
+ jQuery.expr.filters.visible = function( elem ) {
+ return !jQuery.expr.filters.hidden( elem );
+ };
+}
+
+
+
+
+var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rhash = /#.*$/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+ rquery = /\?/,
+ rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
+ rselectTextarea = /^(?:select|textarea)/i,
+ rspacesAjax = /\s+/,
+ rts = /([?&])_=[^&]*/,
+ rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,
+
+ // Keep a copy of the old load method
+ _load = jQuery.fn.load,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Document location
+ ajaxLocation,
+
+ // Document location segments
+ ajaxLocParts;
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+try {
+ ajaxLocation = location.href;
+} catch( e ) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement( "a" );
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ if ( jQuery.isFunction( func ) ) {
+ var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ),
+ i = 0,
+ length = dataTypes.length,
+ dataType,
+ list,
+ placeBefore;
+
+ // For each dataType in the dataTypeExpression
+ for(; i < length; i++ ) {
+ dataType = dataTypes[ i ];
+ // We control if we're asked to add before
+ // any existing element
+ placeBefore = /^\+/.test( dataType );
+ if ( placeBefore ) {
+ dataType = dataType.substr( 1 ) || "*";
+ }
+ list = structure[ dataType ] = structure[ dataType ] || [];
+ // then we add to the structure accordingly
+ list[ placeBefore ? "unshift" : "push" ]( func );
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
+ dataType /* internal */, inspected /* internal */ ) {
+
+ dataType = dataType || options.dataTypes[ 0 ];
+ inspected = inspected || {};
+
+ inspected[ dataType ] = true;
+
+ var list = structure[ dataType ],
+ i = 0,
+ length = list ? list.length : 0,
+ executeOnly = ( structure === prefilters ),
+ selection;
+
+ for(; i < length && ( executeOnly || !selection ); i++ ) {
+ selection = list[ i ]( options, originalOptions, jqXHR );
+ // If we got redirected to another dataType
+ // we try there if executing only and not done already
+ if ( typeof selection === "string" ) {
+ if ( !executeOnly || inspected[ selection ] ) {
+ selection = undefined;
+ } else {
+ options.dataTypes.unshift( selection );
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, selection, inspected );
+ }
+ }
+ }
+ // If we're only executing or nothing was selected
+ // we try the catchall dataType if not done already
+ if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, "*", inspected );
+ }
+ // unnecessary when only executing (prefilters)
+ // but it'll be ignored by the caller in that case
+ return selection;
+}
+
+jQuery.fn.extend({
+ load: function( url, params, callback ) {
+ if ( typeof url !== "string" && _load ) {
+ return _load.apply( this, arguments );
+
+ // Don't do a request if no elements are being requested
+ } else if ( !this.length ) {
+ return this;
+ }
+
+ var off = url.indexOf( " " );
+ if ( off >= 0 ) {
+ var selector = url.slice( off, url.length );
+ url = url.slice( 0, off );
+ }
+
+ // Default to a GET request
+ var type = "GET";
+
+ // If the second parameter was provided
+ if ( params ) {
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if ( typeof params === "object" ) {
+ params = jQuery.param( params, jQuery.ajaxSettings.traditional );
+ type = "POST";
+ }
+ }
+
+ var self = this;
+
+ // Request the remote document
+ jQuery.ajax({
+ url: url,
+ type: type,
+ dataType: "html",
+ data: params,
+ // Complete callback (responseText is used internally)
+ complete: function( jqXHR, status, responseText ) {
+ // Store the response as specified by the jqXHR object
+ responseText = jqXHR.responseText;
+ // If successful, inject the HTML into all the matched elements
+ if ( jqXHR.isResolved() ) {
+ // #4825: Get the actual response in case
+ // a dataFilter is present in ajaxSettings
+ jqXHR.done(function( r ) {
+ responseText = r;
+ });
+ // See if a selector was specified
+ self.html( selector ?
+ // Create a dummy div to hold the results
+ jQuery("<div>")
+ // inject the contents of the document in, removing the scripts
+ // to avoid any 'Permission Denied' errors in IE
+ .append(responseText.replace(rscript, ""))
+
+ // Locate the specified elements
+ .find(selector) :
+
+ // If not, just inject the full result
+ responseText );
+ }
+
+ if ( callback ) {
+ self.each( callback, [ responseText, status, jqXHR ] );
+ }
+ }
+ });
+
+ return this;
+ },
+
+ serialize: function() {
+ return jQuery.param( this.serializeArray() );
+ },
+
+ serializeArray: function() {
+ return this.map(function(){
+ return this.elements ? jQuery.makeArray( this.elements ) : this;
+ })
+ .filter(function(){
+ return this.name && !this.disabled &&
+ ( this.checked || rselectTextarea.test( this.nodeName ) ||
+ rinput.test( this.type ) );
+ })
+ .map(function( i, elem ){
+ var val = jQuery( this ).val();
+
+ return val == null ?
+ null :
+ jQuery.isArray( val ) ?
+ jQuery.map( val, function( val, i ){
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }) :
+ { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }).get();
+ }
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
+ jQuery.fn[ o ] = function( f ){
+ return this.bind( o, f );
+ };
+});
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+ // shift arguments if data argument was omitted
+ if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ return jQuery.ajax({
+ type: method,
+ url: url,
+ data: data,
+ success: callback,
+ dataType: type
+ });
+ };
+});
+
+jQuery.extend({
+
+ getScript: function( url, callback ) {
+ return jQuery.get( url, undefined, callback, "script" );
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get( url, data, callback, "json" );
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function ( target, settings ) {
+ if ( !settings ) {
+ // Only one parameter, we extend ajaxSettings
+ settings = target;
+ target = jQuery.extend( true, jQuery.ajaxSettings, settings );
+ } else {
+ // target was provided, we extend into it
+ jQuery.extend( true, target, jQuery.ajaxSettings, settings );
+ }
+ // Flatten fields we don't want deep extended
+ for( var field in { context: 1, url: 1 } ) {
+ if ( field in settings ) {
+ target[ field ] = settings[ field ];
+ } else if( field in jQuery.ajaxSettings ) {
+ target[ field ] = jQuery.ajaxSettings[ field ];
+ }
+ }
+ return target;
+ },
+
+ ajaxSettings: {
+ url: ajaxLocation,
+ isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
+ global: true,
+ type: "GET",
+ contentType: "application/x-www-form-urlencoded",
+ processData: true,
+ async: true,
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ xml: "application/xml, text/xml",
+ html: "text/html",
+ text: "text/plain",
+ json: "application/json, text/javascript",
+ "*": "*/*"
+ },
+
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText"
+ },
+
+ // List of data converters
+ // 1) key format is "source_type destination_type" (a single space in-between)
+ // 2) the catchall symbol "*" can be used for source_type
+ converters: {
+
+ // Convert anything to text
+ "* text": window.String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ }
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events
+ // It's the callbackContext if one was provided in the options
+ // and if it's a DOM node or a jQuery collection
+ globalEventContext = callbackContext !== s &&
+ ( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
+ jQuery( callbackContext ) : jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery._Deferred(),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // ifModified key
+ ifModifiedKey,
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // Response headers
+ responseHeadersString,
+ responseHeaders,
+ // transport
+ transport,
+ // timeout handle
+ timeoutTimer,
+ // Cross-domain detection vars
+ parts,
+ // The jqXHR state
+ state = 0,
+ // To know if global events are to be dispatched
+ fireGlobals,
+ // Loop variable
+ i,
+ // Fake xhr
+ jqXHR = {
+
+ readyState: 0,
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ if ( !state ) {
+ var lname = name.toLowerCase();
+ name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( state === 2 ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while( ( match = rheaders.exec( responseHeadersString ) ) ) {
+ responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match === undefined ? null : match;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( !state ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ statusText = statusText || "abort";
+ if ( transport ) {
+ transport.abort( statusText );
+ }
+ done( 0, statusText );
+ return this;
+ }
+ };
+
+ // Callback for when everything is done
+ // It is defined here because jslint complains if it is declared
+ // at the end of the function (which would be more logical and readable)
+ function done( status, statusText, responses, headers ) {
+
+ // Called once
+ if ( state === 2 ) {
+ return;
+ }
+
+ // State is "done" now
+ state = 2;
+
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ clearTimeout( timeoutTimer );
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status ? 4 : 0;
+
+ var isSuccess,
+ success,
+ error,
+ response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined,
+ lastModified,
+ etag;
+
+ // If successful, handle type chaining
+ if ( status >= 200 && status < 300 || status === 304 ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+
+ if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) {
+ jQuery.lastModified[ ifModifiedKey ] = lastModified;
+ }
+ if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) {
+ jQuery.etag[ ifModifiedKey ] = etag;
+ }
+ }
+
+ // If not modified
+ if ( status === 304 ) {
+
+ statusText = "notmodified";
+ isSuccess = true;
+
+ // If we have data
+ } else {
+
+ try {
+ success = ajaxConvert( s, response );
+ statusText = "success";
+ isSuccess = true;
+ } catch(e) {
+ // We have a parsererror
+ statusText = "parsererror";
+ error = e;
+ }
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if( !statusText || status ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = statusText;
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] );
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ }
+ }
+
+ // Attach deferreds
+ deferred.promise( jqXHR );
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+ jqXHR.complete = completeDeferred.done;
+
+ // Status-dependent callbacks
+ jqXHR.statusCode = function( map ) {
+ if ( map ) {
+ var tmp;
+ if ( state < 2 ) {
+ for( tmp in map ) {
+ statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
+ }
+ } else {
+ tmp = map[ jqXHR.status ];
+ jqXHR.then( tmp, tmp );
+ }
+ }
+ return this;
+ };
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax );
+
+ // Determine if a cross-domain request is in order
+ if ( s.crossDomain == null ) {
+ parts = rurl.exec( s.url.toLowerCase() );
+ s.crossDomain = !!( parts &&
+ ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
+ ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
+ ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+ );
+ }
+
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefiler, stop there
+ if ( state === 2 ) {
+ return false;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
+ // Watch for a new set of requests
+ if ( fireGlobals && jQuery.active++ === 0 ) {
+ jQuery.event.trigger( "ajaxStart" );
+ }
+
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
+
+ // If data is available, append data to url
+ if ( s.data ) {
+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
+ }
+
+ // Get ifModifiedKey before adding the anti-cache parameter
+ ifModifiedKey = s.url;
+
+ // Add anti-cache in url if needed
+ if ( s.cache === false ) {
+
+ var ts = jQuery.now(),
+ // try replacing _= if it is there
+ ret = s.url.replace( rts, "$1_=" + ts );
+
+ // if nothing was replaced, add timestamp to the end
+ s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ ifModifiedKey = ifModifiedKey || s.url;
+ if ( jQuery.lastModified[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] );
+ }
+ if ( jQuery.etag[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] );
+ }
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+ s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+ // Abort if not done already
+ jqXHR.abort();
+ return false;
+
+ }
+
+ // Install callbacks on deferreds
+ for ( i in { success: 1, error: 1, complete: 1 } ) {
+ jqXHR[ i ]( s[ i ] );
+ }
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = setTimeout( function(){
+ jqXHR.abort( "timeout" );
+ }, s.timeout );
+ }
+
+ try {
+ state = 1;
+ transport.send( requestHeaders, done );
+ } catch (e) {
+ // Propagate exception as error if not done
+ if ( status < 2 ) {
+ done( -1, e );
+ // Simply rethrow otherwise
+ } else {
+ jQuery.error( e );
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ // Serialize an array of form elements or a set of
+ // key/values into a query string
+ param: function( a, traditional ) {
+ var s = [],
+ add = function( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction( value ) ? value() : value;
+ s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ });
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( var prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join( "&" ).replace( r20, "+" );
+ }
+});
+
+function buildParams( prefix, obj, traditional, add ) {
+ if ( jQuery.isArray( obj ) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+ // If array item is non-scalar (array or object), encode its
+ // numeric index to resolve deserialization ambiguity issues.
+ // Note that rack (as of 1.0.0) can't currently deserialize
+ // nested arrays properly, and attempting to do so may cause
+ // a server error. Possible fixes are to modify rack's
+ // deserialization algorithm or to provide an option or flag
+ // to force array serialization to be shallow.
+ buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add );
+ }
+ });
+
+ } else if ( !traditional && obj != null && typeof obj === "object" ) {
+ // Serialize object item.
+ for ( var name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+ }
+
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
+
+// This is still on the jQuery object... for now
+// Want to move this to jQuery.ajax some day
+jQuery.extend({
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {}
+
+});
+
+/* Handles responses to an ajax request:
+ * - sets all responseXXX fields accordingly
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+ var contents = s.contents,
+ dataTypes = s.dataTypes,
+ responseFields = s.responseFields,
+ ct,
+ type,
+ finalDataType,
+ firstDataType;
+
+ // Fill responseXXX fields
+ for( type in responseFields ) {
+ if ( type in responses ) {
+ jqXHR[ responseFields[type] ] = responses[ type ];
+ }
+ }
+
+ // Remove auto dataType and get content-type in the process
+ while( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+ finalDataType = type;
+ break;
+ }
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
+
+// Chain conversions given the request and the original response
+function ajaxConvert( s, response ) {
+
+ // Apply the dataFilter if provided
+ if ( s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ var dataTypes = s.dataTypes,
+ converters = {},
+ i,
+ key,
+ length = dataTypes.length,
+ tmp,
+ // Current and previous dataTypes
+ current = dataTypes[ 0 ],
+ prev,
+ // Conversion expression
+ conversion,
+ // Conversion function
+ conv,
+ // Conversion functions (transitive conversion)
+ conv1,
+ conv2;
+
+ // For each dataType in the chain
+ for( i = 1; i < length; i++ ) {
+
+ // Create converters map
+ // with lowercased keys
+ if ( i === 1 ) {
+ for( key in s.converters ) {
+ if( typeof key === "string" ) {
+ converters[ key.toLowerCase() ] = s.converters[ key ];
+ }
+ }
+ }
+
+ // Get the dataTypes
+ prev = current;
+ current = dataTypes[ i ];
+
+ // If current is auto dataType, update it to prev
+ if( current === "*" ) {
+ current = prev;
+ // If no auto and dataTypes are actually different
+ } else if ( prev !== "*" && prev !== current ) {
+
+ // Get the converter
+ conversion = prev + " " + current;
+ conv = converters[ conversion ] || converters[ "* " + current ];
+
+ // If there is no direct converter, search transitively
+ if ( !conv ) {
+ conv2 = undefined;
+ for( conv1 in converters ) {
+ tmp = conv1.split( " " );
+ if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) {
+ conv2 = converters[ tmp[1] + " " + current ];
+ if ( conv2 ) {
+ conv1 = converters[ conv1 ];
+ if ( conv1 === true ) {
+ conv = conv2;
+ } else if ( conv2 === true ) {
+ conv = conv1;
+ }
+ break;
+ }
+ }
+ }
+ }
+ // If we found no converter, dispatch an error
+ if ( !( conv || conv2 ) ) {
+ jQuery.error( "No conversion from " + conversion.replace(" "," to ") );
+ }
+ // If found converter is not an equivalence
+ if ( conv !== true ) {
+ // Convert with 1 or 2 converters accordingly
+ response = conv ? conv( response ) : conv2( conv1(response) );
+ }
+ }
+ }
+ return response;
+}
+
+
+
+
+var jsc = jQuery.now(),
+ jsre = /(\=)\?(&|$)|\?\?/i;
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function() {
+ return jQuery.expando + "_" + ( jsc++ );
+ }
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var inspectData = s.contentType === "application/x-www-form-urlencoded" &&
+ ( typeof s.data === "string" );
+
+ if ( s.dataTypes[ 0 ] === "jsonp" ||
+ s.jsonp !== false && ( jsre.test( s.url ) ||
+ inspectData && jsre.test( s.data ) ) ) {
+
+ var responseContainer,
+ jsonpCallback = s.jsonpCallback =
+ jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback,
+ previous = window[ jsonpCallback ],
+ url = s.url,
+ data = s.data,
+ replace = "$1" + jsonpCallback + "$2";
+
+ if ( s.jsonp !== false ) {
+ url = url.replace( jsre, replace );
+ if ( s.url === url ) {
+ if ( inspectData ) {
+ data = data.replace( jsre, replace );
+ }
+ if ( s.data === data ) {
+ // Add callback manually
+ url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback;
+ }
+ }
+ }
+
+ s.url = url;
+ s.data = data;
+
+ // Install callback
+ window[ jsonpCallback ] = function( response ) {
+ responseContainer = [ response ];
+ };
+
+ // Clean-up function
+ jqXHR.always(function() {
+ // Set callback back to previous value
+ window[ jsonpCallback ] = previous;
+ // Call if it was a function and we have a response
+ if ( responseContainer && jQuery.isFunction( previous ) ) {
+ window[ jsonpCallback ]( responseContainer[ 0 ] );
+ }
+ });
+
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( jsonpCallback + " was not called" );
+ }
+ return responseContainer[ 0 ];
+ };
+
+ // force json dataType
+ s.dataTypes[ 0 ] = "json";
+
+ // Delegate to script
+ return "script";
+ }
+});
+
+
+
+
+// Install script dataType
+jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /javascript|ecmascript/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+});
+
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ s.global = false;
+ }
+});
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
+
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
+
+ var script,
+ head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
+
+ return {
+
+ send: function( _, callback ) {
+
+ script = document.createElement( "script" );
+
+ script.async = "async";
+
+ if ( s.scriptCharset ) {
+ script.charset = s.scriptCharset;
+ }
+
+ script.src = s.url;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+ if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if ( head && script.parentNode ) {
+ head.removeChild( script );
+ }
+
+ // Dereference the script
+ script = undefined;
+
+ // Callback if not abort
+ if ( !isAbort ) {
+ callback( 200, "success" );
+ }
+ }
+ };
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709 and #4378).
+ head.insertBefore( script, head.firstChild );
+ },
+
+ abort: function() {
+ if ( script ) {
+ script.onload( 0, 1 );
+ }
+ }
+ };
+ }
+});
+
+
+
+
+var // #5280: Internet Explorer will keep connections alive if we don't abort on unload
+ xhrOnUnloadAbort = window.ActiveXObject ? function() {
+ // Abort all pending requests
+ for ( var key in xhrCallbacks ) {
+ xhrCallbacks[ key ]( 0, 1 );
+ }
+ } : false,
+ xhrId = 0,
+ xhrCallbacks;
+
+// Functions to create xhrs
+function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch( e ) {}
+}
+
+function createActiveXHR() {
+ try {
+ return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+ } catch( e ) {}
+}
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+ /* Microsoft failed to properly
+ * implement the XMLHttpRequest in IE7 (can't request local files),
+ * so we use the ActiveXObject when it is available
+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+ * we need a fallback.
+ */
+ function() {
+ return !this.isLocal && createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+// Determine support properties
+(function( xhr ) {
+ jQuery.extend( jQuery.support, {
+ ajax: !!xhr,
+ cors: !!xhr && ( "withCredentials" in xhr )
+ });
+})( jQuery.ajaxSettings.xhr() );
+
+// Create transport if the browser can provide an xhr
+if ( jQuery.support.ajax ) {
+
+ jQuery.ajaxTransport(function( s ) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( !s.crossDomain || jQuery.support.cors ) {
+
+ var callback;
+
+ return {
+ send: function( headers, complete ) {
+
+ // Get a new xhr
+ var xhr = s.xhr(),
+ handle,
+ i;
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if ( s.username ) {
+ xhr.open( s.type, s.url, s.async, s.username, s.password );
+ } else {
+ xhr.open( s.type, s.url, s.async );
+ }
+
+ // Apply custom fields if provided
+ if ( s.xhrFields ) {
+ for ( i in s.xhrFields ) {
+ xhr[ i ] = s.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( s.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( s.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !s.crossDomain && !headers["X-Requested-With"] ) {
+ headers[ "X-Requested-With" ] = "XMLHttpRequest";
+ }
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ for ( i in headers ) {
+ xhr.setRequestHeader( i, headers[ i ] );
+ }
+ } catch( _ ) {}
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send( ( s.hasContent && s.data ) || null );
+
+ // Listener
+ callback = function( _, isAbort ) {
+
+ var status,
+ statusText,
+ responseHeaders,
+ responses,
+ xml;
+
+ // Firefox throws exceptions when accessing properties
+ // of an xhr when a network error occured
+ // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+ try {
+
+ // Was never called and is aborted or complete
+ if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+
+ // Only called once
+ callback = undefined;
+
+ // Do not keep as active anymore
+ if ( handle ) {
+ xhr.onreadystatechange = jQuery.noop;
+ if ( xhrOnUnloadAbort ) {
+ delete xhrCallbacks[ handle ];
+ }
+ }
+
+ // If it's an abort
+ if ( isAbort ) {
+ // Abort it manually if needed
+ if ( xhr.readyState !== 4 ) {
+ xhr.abort();
+ }
+ } else {
+ status = xhr.status;
+ responseHeaders = xhr.getAllResponseHeaders();
+ responses = {};
+ xml = xhr.responseXML;
+
+ // Construct response list
+ if ( xml && xml.documentElement /* #4958 */ ) {
+ responses.xml = xml;
+ }
+ responses.text = xhr.responseText;
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch( e ) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if ( !status && s.isLocal && !s.crossDomain ) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if ( status === 1223 ) {
+ status = 204;
+ }
+ }
+ }
+ } catch( firefoxAccessException ) {
+ if ( !isAbort ) {
+ complete( -1, firefoxAccessException );
+ }
+ }
+
+ // Call complete if needed
+ if ( responses ) {
+ complete( status, statusText, responses, responseHeaders );
+ }
+ };
+
+ // if we're in sync mode or it's in cache
+ // and has been retrieved directly (IE6 & IE7)
+ // we need to manually fire the callback
+ if ( !s.async || xhr.readyState === 4 ) {
+ callback();
+ } else {
+ handle = ++xhrId;
+ if ( xhrOnUnloadAbort ) {
+ // Create the active xhrs callbacks list if needed
+ // and attach the unload handler
+ if ( !xhrCallbacks ) {
+ xhrCallbacks = {};
+ jQuery( window ).unload( xhrOnUnloadAbort );
+ }
+ // Add to list of active xhrs callbacks
+ xhrCallbacks[ handle ] = callback;
+ }
+ xhr.onreadystatechange = callback;
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback(0,1);
+ }
+ }
+ };
+ }
+ });
+}
+
+
+
+
+var elemdisplay = {},
+ iframe, iframeDoc,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,
+ timerId,
+ fxAttrs = [
+ // height animations
+ [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+ // width animations
+ [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+ // opacity animations
+ [ "opacity" ]
+ ],
+ fxNow,
+ requestAnimationFrame = window.webkitRequestAnimationFrame ||
+ window.mozRequestAnimationFrame ||
+ window.oRequestAnimationFrame;
+
+jQuery.fn.extend({
+ show: function( speed, easing, callback ) {
+ var elem, display;
+
+ if ( speed || speed === 0 ) {
+ return this.animate( genFx("show", 3), speed, easing, callback);
+
+ } else {
+ for ( var i = 0, j = this.length; i < j; i++ ) {
+ elem = this[i];
+
+ if ( elem.style ) {
+ display = elem.style.display;
+
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if ( !jQuery._data(elem, "olddisplay") && display === "none" ) {
+ display = elem.style.display = "";
+ }
+
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if ( display === "" && jQuery.css( elem, "display" ) === "none" ) {
+ jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName));
+ }
+ }
+ }
+
+ // Set the display of most of the elements in a second loop
+ // to avoid the constant reflow
+ for ( i = 0; i < j; i++ ) {
+ elem = this[i];
+
+ if ( elem.style ) {
+ display = elem.style.display;
+
+ if ( display === "" || display === "none" ) {
+ elem.style.display = jQuery._data(elem, "olddisplay") || "";
+ }
+ }
+ }
+
+ return this;
+ }
+ },
+
+ hide: function( speed, easing, callback ) {
+ if ( speed || speed === 0 ) {
+ return this.animate( genFx("hide", 3), speed, easing, callback);
+
+ } else {
+ for ( var i = 0, j = this.length; i < j; i++ ) {
+ if ( this[i].style ) {
+ var display = jQuery.css( this[i], "display" );
+
+ if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) {
+ jQuery._data( this[i], "olddisplay", display );
+ }
+ }
+ }
+
+ // Set the display of the elements in a second loop
+ // to avoid the constant reflow
+ for ( i = 0; i < j; i++ ) {
+ if ( this[i].style ) {
+ this[i].style.display = "none";
+ }
+ }
+
+ return this;
+ }
+ },
+
+ // Save the old toggle function
+ _toggle: jQuery.fn.toggle,
+
+ toggle: function( fn, fn2, callback ) {
+ var bool = typeof fn === "boolean";
+
+ if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
+ this._toggle.apply( this, arguments );
+
+ } else if ( fn == null || bool ) {
+ this.each(function() {
+ var state = bool ? fn : jQuery(this).is(":hidden");
+ jQuery(this)[ state ? "show" : "hide" ]();
+ });
+
+ } else {
+ this.animate(genFx("toggle", 3), fn, fn2, callback);
+ }
+
+ return this;
+ },
+
+ fadeTo: function( speed, to, easing, callback ) {
+ return this.filter(":hidden").css("opacity", 0).show().end()
+ .animate({opacity: to}, speed, easing, callback);
+ },
+
+ animate: function( prop, speed, easing, callback ) {
+ var optall = jQuery.speed(speed, easing, callback);
+
+ if ( jQuery.isEmptyObject( prop ) ) {
+ return this.each( optall.complete, [ false ] );
+ }
+
+ // Do not change referenced properties as per-property easing will be lost
+ prop = jQuery.extend( {}, prop );
+
+ return this[ optall.queue === false ? "each" : "queue" ](function() {
+ // XXX 'this' does not always have a nodeName when running the
+ // test suite
+
+ if ( optall.queue === false ) {
+ jQuery._mark( this );
+ }
+
+ var opt = jQuery.extend( {}, optall ),
+ isElement = this.nodeType === 1,
+ hidden = isElement && jQuery(this).is(":hidden"),
+ name, val, p,
+ display, e,
+ parts, start, end, unit;
+
+ // will store per property easing and be used to determine when an animation is complete
+ opt.animatedProperties = {};
+
+ for ( p in prop ) {
+
+ // property name normalization
+ name = jQuery.camelCase( p );
+ if ( p !== name ) {
+ prop[ name ] = prop[ p ];
+ delete prop[ p ];
+ }
+
+ val = prop[ name ];
+
+ // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default)
+ if ( jQuery.isArray( val ) ) {
+ opt.animatedProperties[ name ] = val[ 1 ];
+ val = prop[ name ] = val[ 0 ];
+ } else {
+ opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing';
+ }
+
+ if ( val === "hide" && hidden || val === "show" && !hidden ) {
+ return opt.complete.call( this );
+ }
+
+ if ( isElement && ( name === "height" || name === "width" ) ) {
+ // Make sure that nothing sneaks out
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height
+ // animated
+ if ( jQuery.css( this, "display" ) === "inline" &&
+ jQuery.css( this, "float" ) === "none" ) {
+ if ( !jQuery.support.inlineBlockNeedsLayout ) {
+ this.style.display = "inline-block";
+
+ } else {
+ display = defaultDisplay( this.nodeName );
+
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if ( display === "inline" ) {
+ this.style.display = "inline-block";
+
+ } else {
+ this.style.display = "inline";
+ this.style.zoom = 1;
+ }
+ }
+ }
+ }
+ }
+
+ if ( opt.overflow != null ) {
+ this.style.overflow = "hidden";
+ }
+
+ for ( p in prop ) {
+ e = new jQuery.fx( this, opt, p );
+ val = prop[ p ];
+
+ if ( rfxtypes.test(val) ) {
+ e[ val === "toggle" ? hidden ? "show" : "hide" : val ]();
+
+ } else {
+ parts = rfxnum.exec( val );
+ start = e.cur();
+
+ if ( parts ) {
+ end = parseFloat( parts[2] );
+ unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" );
+
+ // We need to compute starting value
+ if ( unit !== "px" ) {
+ jQuery.style( this, p, (end || 1) + unit);
+ start = ((end || 1) / e.cur()) * start;
+ jQuery.style( this, p, start + unit);
+ }
+
+ // If a +=/-= token was provided, we're doing a relative animation
+ if ( parts[1] ) {
+ end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start;
+ }
+
+ e.custom( start, end, unit );
+
+ } else {
+ e.custom( start, val, "" );
+ }
+ }
+ }
+
+ // For JS strict compliance
+ return true;
+ });
+ },
+
+ stop: function( clearQueue, gotoEnd ) {
+ if ( clearQueue ) {
+ this.queue([]);
+ }
+
+ this.each(function() {
+ var timers = jQuery.timers,
+ i = timers.length;
+ // clear marker counters if we know they won't be
+ if ( !gotoEnd ) {
+ jQuery._unmark( true, this );
+ }
+ while ( i-- ) {
+ if ( timers[i].elem === this ) {
+ if (gotoEnd) {
+ // force the next step to be the last
+ timers[i](true);
+ }
+
+ timers.splice(i, 1);
+ }
+ }
+ });
+
+ // start the next in the queue if the last step wasn't forced
+ if ( !gotoEnd ) {
+ this.dequeue();
+ }
+
+ return this;
+ }
+
+});
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ setTimeout( clearFxNow, 0 );
+ return ( fxNow = jQuery.now() );
+}
+
+function clearFxNow() {
+ fxNow = undefined;
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, num ) {
+ var obj = {};
+
+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
+ obj[ this ] = type;
+ });
+
+ return obj;
+}
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx("show", 1),
+ slideUp: genFx("hide", 1),
+ slideToggle: genFx("toggle", 1),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
+ };
+});
+
+jQuery.extend({
+ speed: function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
+
+ // Queueing
+ opt.old = opt.complete;
+ opt.complete = function( noUnmark ) {
+ if ( jQuery.isFunction( opt.old ) ) {
+ opt.old.call( this );
+ }
+
+ if ( opt.queue !== false ) {
+ jQuery.dequeue( this );
+ } else if ( noUnmark !== false ) {
+ jQuery._unmark( this );
+ }
+ };
+
+ return opt;
+ },
+
+ easing: {
+ linear: function( p, n, firstNum, diff ) {
+ return firstNum + diff * p;
+ },
+ swing: function( p, n, firstNum, diff ) {
+ return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+ }
+ },
+
+ timers: [],
+
+ fx: function( elem, options, prop ) {
+ this.options = options;
+ this.elem = elem;
+ this.prop = prop;
+
+ options.orig = options.orig || {};
+ }
+
+});
+
+jQuery.fx.prototype = {
+ // Simple function for setting a style value
+ update: function() {
+ if ( this.options.step ) {
+ this.options.step.call( this.elem, this.now, this );
+ }
+
+ (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+ },
+
+ // Get the current size
+ cur: function() {
+ if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
+ return this.elem[ this.prop ];
+ }
+
+ var parsed,
+ r = jQuery.css( this.elem, this.prop );
+ // Empty strings, null, undefined and "auto" are converted to 0,
+ // complex values such as "rotate(1rad)" are returned as is,
+ // simple values such as "10px" are parsed to Float.
+ return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed;
+ },
+
+ // Start an animation from one number to another
+ custom: function( from, to, unit ) {
+ var self = this,
+ fx = jQuery.fx,
+ raf;
+
+ this.startTime = fxNow || createFxNow();
+ this.start = from;
+ this.end = to;
+ this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" );
+ this.now = this.start;
+ this.pos = this.state = 0;
+
+ function t( gotoEnd ) {
+ return self.step(gotoEnd);
+ }
+
+ t.elem = this.elem;
+
+ if ( t() && jQuery.timers.push(t) && !timerId ) {
+ // Use requestAnimationFrame instead of setInterval if available
+ if ( requestAnimationFrame ) {
+ timerId = true;
+ raf = function() {
+ // When timerId gets set to null at any point, this stops
+ if ( timerId ) {
+ requestAnimationFrame( raf );
+ fx.tick();
+ }
+ };
+ requestAnimationFrame( raf );
+ } else {
+ timerId = setInterval( fx.tick, fx.interval );
+ }
+ }
+ },
+
+ // Simple 'show' function
+ show: function() {
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+ this.options.show = true;
+
+ // Begin the animation
+ // Make sure that we start at a small width/height to avoid any
+ // flash of content
+ this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur());
+
+ // Start by showing the element
+ jQuery( this.elem ).show();
+ },
+
+ // Simple 'hide' function
+ hide: function() {
+ // Remember where we started, so that we can go back to it later
+ this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+ this.options.hide = true;
+
+ // Begin the animation
+ this.custom(this.cur(), 0);
+ },
+
+ // Each step of an animation
+ step: function( gotoEnd ) {
+ var t = fxNow || createFxNow(),
+ done = true,
+ elem = this.elem,
+ options = this.options,
+ i, n;
+
+ if ( gotoEnd || t >= options.duration + this.startTime ) {
+ this.now = this.end;
+ this.pos = this.state = 1;
+ this.update();
+
+ options.animatedProperties[ this.prop ] = true;
+
+ for ( i in options.animatedProperties ) {
+ if ( options.animatedProperties[i] !== true ) {
+ done = false;
+ }
+ }
+
+ if ( done ) {
+ // Reset the overflow
+ if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
+
+ jQuery.each( [ "", "X", "Y" ], function (index, value) {
+ elem.style[ "overflow" + value ] = options.overflow[index];
+ });
+ }
+
+ // Hide the element if the "hide" operation was done
+ if ( options.hide ) {
+ jQuery(elem).hide();
+ }
+
+ // Reset the properties, if the item has been hidden or shown
+ if ( options.hide || options.show ) {
+ for ( var p in options.animatedProperties ) {
+ jQuery.style( elem, p, options.orig[p] );
+ }
+ }
+
+ // Execute the complete function
+ options.complete.call( elem );
+ }
+
+ return false;
+
+ } else {
+ // classical easing cannot be used with an Infinity duration
+ if ( options.duration == Infinity ) {
+ this.now = t;
+ } else {
+ n = t - this.startTime;
+ this.state = n / options.duration;
+
+ // Perform the easing function, defaults to swing
+ this.pos = jQuery.easing[ options.animatedProperties[ this.prop ] ]( this.state, n, 0, 1, options.duration );
+ this.now = this.start + ((this.end - this.start) * this.pos);
+ }
+ // Perform the next step of the animation
+ this.update();
+ }
+
+ return true;
+ }
+};
+
+jQuery.extend( jQuery.fx, {
+ tick: function() {
+ for ( var timers = jQuery.timers, i = 0 ; i < timers.length ; ++i ) {
+ if ( !timers[i]() ) {
+ timers.splice(i--, 1);
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+ },
+
+ interval: 13,
+
+ stop: function() {
+ clearInterval( timerId );
+ timerId = null;
+ },
+
+ speeds: {
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+ },
+
+ step: {
+ opacity: function( fx ) {
+ jQuery.style( fx.elem, "opacity", fx.now );
+ },
+
+ _default: function( fx ) {
+ if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
+ fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
+ } else {
+ fx.elem[ fx.prop ] = fx.now;
+ }
+ }
+ }
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.animated = function( elem ) {
+ return jQuery.grep(jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ }).length;
+ };
+}
+
+// Try to restore the default display value of an element
+function defaultDisplay( nodeName ) {
+
+ if ( !elemdisplay[ nodeName ] ) {
+
+ var body = document.body,
+ elem = jQuery( "<" + nodeName + ">" ).appendTo( body ),
+ display = elem.css( "display" );
+
+ elem.remove();
+
+ // If the simple way fails,
+ // get element's real default display by attaching it to a temp iframe
+ if ( display === "none" || display === "" ) {
+ // No iframe to use yet, so create it
+ if ( !iframe ) {
+ iframe = document.createElement( "iframe" );
+ iframe.frameBorder = iframe.width = iframe.height = 0;
+ }
+
+ body.appendChild( iframe );
+
+ // Create a cacheable copy of the iframe document on first call.
+ // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML
+ // document to it; WebKit & Firefox won't allow reusing the iframe document.
+ if ( !iframeDoc || !iframe.createElement ) {
+ iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document;
+ iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" );
+ iframeDoc.close();
+ }
+
+ elem = iframeDoc.createElement( nodeName );
+
+ iframeDoc.body.appendChild( elem );
+
+ display = jQuery.css( elem, "display" );
+
+ body.removeChild( iframe );
+ }
+
+ // Store the correct default display
+ elemdisplay[ nodeName ] = display;
+ }
+
+ return elemdisplay[ nodeName ];
+}
+
+
+
+
+var rtable = /^t(?:able|d|h)$/i,
+ rroot = /^(?:body|html)$/i;
+
+if ( "getBoundingClientRect" in document.documentElement ) {
+ jQuery.fn.offset = function( options ) {
+ var elem = this[0], box;
+
+ if ( options ) {
+ return this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ if ( !elem || !elem.ownerDocument ) {
+ return null;
+ }
+
+ if ( elem === elem.ownerDocument.body ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ try {
+ box = elem.getBoundingClientRect();
+ } catch(e) {}
+
+ var doc = elem.ownerDocument,
+ docElem = doc.documentElement;
+
+ // Make sure we're not dealing with a disconnected DOM node
+ if ( !box || !jQuery.contains( docElem, elem ) ) {
+ return box ? { top: box.top, left: box.left } : { top: 0, left: 0 };
+ }
+
+ var body = doc.body,
+ win = getWindow(doc),
+ clientTop = docElem.clientTop || body.clientTop || 0,
+ clientLeft = docElem.clientLeft || body.clientLeft || 0,
+ scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop,
+ scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft,
+ top = box.top + scrollTop - clientTop,
+ left = box.left + scrollLeft - clientLeft;
+
+ return { top: top, left: left };
+ };
+
+} else {
+ jQuery.fn.offset = function( options ) {
+ var elem = this[0];
+
+ if ( options ) {
+ return this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ if ( !elem || !elem.ownerDocument ) {
+ return null;
+ }
+
+ if ( elem === elem.ownerDocument.body ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ jQuery.offset.initialize();
+
+ var computedStyle,
+ offsetParent = elem.offsetParent,
+ prevOffsetParent = elem,
+ doc = elem.ownerDocument,
+ docElem = doc.documentElement,
+ body = doc.body,
+ defaultView = doc.defaultView,
+ prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
+ top = elem.offsetTop,
+ left = elem.offsetLeft;
+
+ while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+ if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+ break;
+ }
+
+ computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
+ top -= elem.scrollTop;
+ left -= elem.scrollLeft;
+
+ if ( elem === offsetParent ) {
+ top += elem.offsetTop;
+ left += elem.offsetLeft;
+
+ if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
+ top += parseFloat( computedStyle.borderTopWidth ) || 0;
+ left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+ }
+
+ prevOffsetParent = offsetParent;
+ offsetParent = elem.offsetParent;
+ }
+
+ if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
+ top += parseFloat( computedStyle.borderTopWidth ) || 0;
+ left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+ }
+
+ prevComputedStyle = computedStyle;
+ }
+
+ if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
+ top += body.offsetTop;
+ left += body.offsetLeft;
+ }
+
+ if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+ top += Math.max( docElem.scrollTop, body.scrollTop );
+ left += Math.max( docElem.scrollLeft, body.scrollLeft );
+ }
+
+ return { top: top, left: left };
+ };
+}
+
+jQuery.offset = {
+ initialize: function() {
+ var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0,
+ html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+
+ jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
+
+ container.innerHTML = html;
+ body.insertBefore( container, body.firstChild );
+ innerDiv = container.firstChild;
+ checkDiv = innerDiv.firstChild;
+ td = innerDiv.nextSibling.firstChild.firstChild;
+
+ this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
+ this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
+
+ checkDiv.style.position = "fixed";
+ checkDiv.style.top = "20px";
+
+ // safari subtracts parent border width here which is 5px
+ this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
+ checkDiv.style.position = checkDiv.style.top = "";
+
+ innerDiv.style.overflow = "hidden";
+ innerDiv.style.position = "relative";
+
+ this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
+
+ this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
+
+ body.removeChild( container );
+ jQuery.offset.initialize = jQuery.noop;
+ },
+
+ bodyOffset: function( body ) {
+ var top = body.offsetTop,
+ left = body.offsetLeft;
+
+ jQuery.offset.initialize();
+
+ if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
+ top += parseFloat( jQuery.css(body, "marginTop") ) || 0;
+ left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
+ }
+
+ return { top: top, left: left };
+ },
+
+ setOffset: function( elem, options, i ) {
+ var position = jQuery.css( elem, "position" );
+
+ // set position first, in-case top/left are set even on static elem
+ if ( position === "static" ) {
+ elem.style.position = "relative";
+ }
+
+ var curElem = jQuery( elem ),
+ curOffset = curElem.offset(),
+ curCSSTop = jQuery.css( elem, "top" ),
+ curCSSLeft = jQuery.css( elem, "left" ),
+ calculatePosition = (position === "absolute" || position === "fixed") && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
+ props = {}, curPosition = {}, curTop, curLeft;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
+
+ if ( jQuery.isFunction( options ) ) {
+ options = options.call( elem, i, curOffset );
+ }
+
+ if (options.top != null) {
+ props.top = (options.top - curOffset.top) + curTop;
+ }
+ if (options.left != null) {
+ props.left = (options.left - curOffset.left) + curLeft;
+ }
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ }
+};
+
+
+jQuery.fn.extend({
+ position: function() {
+ if ( !this[0] ) {
+ return null;
+ }
+
+ var elem = this[0],
+
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent(),
+
+ // Get correct offsets
+ offset = this.offset(),
+ parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+ // Subtract element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
+ offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
+
+ // Add offsetParent borders
+ parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
+ parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
+
+ // Subtract the two offsets
+ return {
+ top: offset.top - parentOffset.top,
+ left: offset.left - parentOffset.left
+ };
+ },
+
+ offsetParent: function() {
+ return this.map(function() {
+ var offsetParent = this.offsetParent || document.body;
+ while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent;
+ });
+ }
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ["Left", "Top"], function( i, name ) {
+ var method = "scroll" + name;
+
+ jQuery.fn[ method ] = function( val ) {
+ var elem, win;
+
+ if ( val === undefined ) {
+ elem = this[ 0 ];
+
+ if ( !elem ) {
+ return null;
+ }
+
+ win = getWindow( elem );
+
+ // Return the scroll offset
+ return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
+ jQuery.support.boxModel && win.document.documentElement[ method ] ||
+ win.document.body[ method ] :
+ elem[ method ];
+ }
+
+ // Set the scroll offset
+ return this.each(function() {
+ win = getWindow( this );
+
+ if ( win ) {
+ win.scrollTo(
+ !i ? val : jQuery( win ).scrollLeft(),
+ i ? val : jQuery( win ).scrollTop()
+ );
+
+ } else {
+ this[ method ] = val;
+ }
+ });
+ };
+});
+
+function getWindow( elem ) {
+ return jQuery.isWindow( elem ) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+}
+
+
+
+
+// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function( i, name ) {
+
+ var type = name.toLowerCase();
+
+ // innerHeight and innerWidth
+ jQuery.fn[ "inner" + name ] = function() {
+ var elem = this[0];
+ return elem && elem.style ?
+ parseFloat( jQuery.css( elem, type, "padding" ) ) :
+ null;
+ };
+
+ // outerHeight and outerWidth
+ jQuery.fn[ "outer" + name ] = function( margin ) {
+ var elem = this[0];
+ return elem && elem.style ?
+ parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) :
+ null;
+ };
+
+ jQuery.fn[ type ] = function( size ) {
+ // Get window width or height
+ var elem = this[0];
+ if ( !elem ) {
+ return size == null ? null : this;
+ }
+
+ if ( jQuery.isFunction( size ) ) {
+ return this.each(function( i ) {
+ var self = jQuery( this );
+ self[ type ]( size.call( this, i, self[ type ]() ) );
+ });
+ }
+
+ if ( jQuery.isWindow( elem ) ) {
+ // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+ // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat
+ var docElemProp = elem.document.documentElement[ "client" + name ];
+ return elem.document.compatMode === "CSS1Compat" && docElemProp ||
+ elem.document.body[ "client" + name ] || docElemProp;
+
+ // Get document width or height
+ } else if ( elem.nodeType === 9 ) {
+ // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+ return Math.max(
+ elem.documentElement["client" + name],
+ elem.body["scroll" + name], elem.documentElement["scroll" + name],
+ elem.body["offset" + name], elem.documentElement["offset" + name]
+ );
+
+ // Get or set width or height on the element
+ } else if ( size === undefined ) {
+ var orig = jQuery.css( elem, type ),
+ ret = parseFloat( orig );
+
+ return jQuery.isNaN( ret ) ? orig : ret;
+
+ // Set the width or height on the element (default to pixels if value is unitless)
+ } else {
+ return this.css( type, typeof size === "string" ? size : size + "px" );
+ }
+ };
+
+});
+
+
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+})(window);
/*
- * jQuery JavaScript Library v1.6.1
+ * jQuery JavaScript Library v1.6.2
* http://jquery.com/
*
* Copyright 2011, John Resig
* Copyright 2011, The Dojo Foundation
* Released under the MIT, BSD, and GPL Licenses.
*
- * Date: Thu May 12 15:04:36 2011 -0400
+ * Date: Thu Jun 30 14:16:56 2011 -0400
*/
-(function(bc,L){var ar=bc.document,bu=bc.navigator,bl=bc.location;var b=(function(){var bE=function(bY,bZ){return new bE.fn.init(bY,bZ,bC)},bT=bc.jQuery,bG=bc.$,bC,bX=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bD=/\s+$/,bH=/\d/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bV=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bW=bu.userAgent,bU,bB,e,bL=Object.prototype.toString,bF=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bE.fn=bE.prototype={constructor:bE,init:function(bY,b2,b1){var b0,b3,bZ,b4;if(!bY){return this}if(bY.nodeType){this.context=this[0]=bY;this.length=1;return this}if(bY==="body"&&!b2&&ar.body){this.context=ar;this[0]=ar.body;this.selector=bY;this.length=1;return this}if(typeof bY==="string"){if(bY.charAt(0)==="<"&&bY.charAt(bY.length-1)===">"&&bY.length>=3){b0=[null,bY,null]}else{b0=bX.exec(bY)}if(b0&&(b0[1]||!b2)){if(b0[1]){b2=b2 instanceof bE?b2[0]:b2;b4=(b2?b2.ownerDocument||b2:ar);bZ=bA.exec(bY);if(bZ){if(bE.isPlainObject(b2)){bY=[ar.createElement(bZ[1])];bE.fn.attr.call(bY,b2,true)}else{bY=[b4.createElement(bZ[1])]}}else{bZ=bE.buildFragment([b0[1]],[b4]);bY=(bZ.cacheable?bE.clone(bZ.fragment):bZ.fragment).childNodes}return bE.merge(this,bY)}else{b3=ar.getElementById(b0[2]);if(b3&&b3.parentNode){if(b3.id!==b0[2]){return b1.find(bY)}this.length=1;this[0]=b3}this.context=ar;this.selector=bY;return this}}else{if(!b2||b2.jquery){return(b2||b1).find(bY)}else{return this.constructor(b2).find(bY)}}}else{if(bE.isFunction(bY)){return b1.ready(bY)}}if(bY.selector!==L){this.selector=bY.selector;this.context=bY.context}return bE.makeArray(bY,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(bY){return bY==null?this.toArray():(bY<0?this[this.length+bY]:this[bY])},pushStack:function(bZ,b1,bY){var b0=this.constructor();if(bE.isArray(bZ)){bz.apply(b0,bZ)}else{bE.merge(b0,bZ)}b0.prevObject=this;b0.context=this.context;if(b1==="find"){b0.selector=this.selector+(this.selector?" ":"")+bY}else{if(b1){b0.selector=this.selector+"."+b1+"("+bY+")"}}return b0},each:function(bZ,bY){return bE.each(this,bZ,bY)},ready:function(bY){bE.bindReady();bB.done(bY);return this},eq:function(bY){return bY===-1?this.slice(bY):this.slice(bY,+bY+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(bY){return this.pushStack(bE.map(this,function(b0,bZ){return bY.call(b0,bZ,b0)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bE.fn.init.prototype=bE.fn;bE.extend=bE.fn.extend=function(){var b7,b0,bY,bZ,b4,b5,b3=arguments[0]||{},b2=1,b1=arguments.length,b6=false;if(typeof b3==="boolean"){b6=b3;b3=arguments[1]||{};b2=2}if(typeof b3!=="object"&&!bE.isFunction(b3)){b3={}}if(b1===b2){b3=this;--b2}for(;b2<b1;b2++){if((b7=arguments[b2])!=null){for(b0 in b7){bY=b3[b0];bZ=b7[b0];if(b3===bZ){continue}if(b6&&bZ&&(bE.isPlainObject(bZ)||(b4=bE.isArray(bZ)))){if(b4){b4=false;b5=bY&&bE.isArray(bY)?bY:[]}else{b5=bY&&bE.isPlainObject(bY)?bY:{}}b3[b0]=bE.extend(b6,b5,bZ)}else{if(bZ!==L){b3[b0]=bZ}}}}}return b3};bE.extend({noConflict:function(bY){if(bc.$===bE){bc.$=bG}if(bY&&bc.jQuery===bE){bc.jQuery=bT}return bE},isReady:false,readyWait:1,holdReady:function(bY){if(bY){bE.readyWait++}else{bE.ready(true)}},ready:function(bY){if((bY===true&&!--bE.readyWait)||(bY!==true&&!bE.isReady)){if(!ar.body){return setTimeout(bE.ready,1)}bE.isReady=true;if(bY!==true&&--bE.readyWait>0){return}bB.resolveWith(ar,[bE]);if(bE.fn.trigger){bE(ar).trigger("ready").unbind("ready")}}},bindReady:function(){if(bB){return}bB=bE._Deferred();if(ar.readyState==="complete"){return setTimeout(bE.ready,1)}if(ar.addEventListener){ar.addEventListener("DOMContentLoaded",e,false);bc.addEventListener("load",bE.ready,false)}else{if(ar.attachEvent){ar.attachEvent("onreadystatechange",e);bc.attachEvent("onload",bE.ready);var bY=false;try{bY=bc.frameElement==null}catch(bZ){}if(ar.documentElement.doScroll&&bY){bw()}}}},isFunction:function(bY){return bE.type(bY)==="function"},isArray:Array.isArray||function(bY){return bE.type(bY)==="array"},isWindow:function(bY){return bY&&typeof bY==="object"&&"setInterval" in bY},isNaN:function(bY){return bY==null||!bH.test(bY)||isNaN(bY)},type:function(bY){return bY==null?String(bY):bx[bL.call(bY)]||"object"},isPlainObject:function(bZ){if(!bZ||bE.type(bZ)!=="object"||bZ.nodeType||bE.isWindow(bZ)){return false}if(bZ.constructor&&!bF.call(bZ,"constructor")&&!bF.call(bZ.constructor.prototype,"isPrototypeOf")){return false}var bY;for(bY in bZ){}return bY===L||bF.call(bZ,bY)},isEmptyObject:function(bZ){for(var bY in bZ){return false}return true},error:function(bY){throw bY},parseJSON:function(bY){if(typeof bY!=="string"||!bY){return null}bY=bE.trim(bY);if(bc.JSON&&bc.JSON.parse){return bc.JSON.parse(bY)}if(bN.test(bY.replace(bV,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+bY))()}bE.error("Invalid JSON: "+bY)},parseXML:function(b0,bY,bZ){if(bc.DOMParser){bZ=new DOMParser();bY=bZ.parseFromString(b0,"text/xml")}else{bY=new ActiveXObject("Microsoft.XMLDOM");bY.async="false";bY.loadXML(b0)}bZ=bY.documentElement;if(!bZ||!bZ.nodeName||bZ.nodeName==="parsererror"){bE.error("Invalid XML: "+b0)}return bY},noop:function(){},globalEval:function(bY){if(bY&&bM.test(bY)){(bc.execScript||function(bZ){bc["eval"].call(bc,bZ)})(bY)}},nodeName:function(bZ,bY){return bZ.nodeName&&bZ.nodeName.toUpperCase()===bY.toUpperCase()},each:function(b1,b4,b0){var bZ,b2=0,b3=b1.length,bY=b3===L||bE.isFunction(b1);if(b0){if(bY){for(bZ in b1){if(b4.apply(b1[bZ],b0)===false){break}}}else{for(;b2<b3;){if(b4.apply(b1[b2++],b0)===false){break}}}}else{if(bY){for(bZ in b1){if(b4.call(b1[bZ],bZ,b1[bZ])===false){break}}}else{for(;b2<b3;){if(b4.call(b1[b2],b2,b1[b2++])===false){break}}}}return b1},trim:bO?function(bY){return bY==null?"":bO.call(bY)}:function(bY){return bY==null?"":bY.toString().replace(bI,"").replace(bD,"")},makeArray:function(b1,bZ){var bY=bZ||[];if(b1!=null){var b0=bE.type(b1);if(b1.length==null||b0==="string"||b0==="function"||b0==="regexp"||bE.isWindow(b1)){bz.call(bY,b1)}else{bE.merge(bY,b1)}}return bY},inArray:function(b0,b1){if(bv){return bv.call(b1,b0)}for(var bY=0,bZ=b1.length;bY<bZ;bY++){if(b1[bY]===b0){return bY}}return -1},merge:function(b2,b0){var b1=b2.length,bZ=0;if(typeof b0.length==="number"){for(var bY=b0.length;bZ<bY;bZ++){b2[b1++]=b0[bZ]}}else{while(b0[bZ]!==L){b2[b1++]=b0[bZ++]}}b2.length=b1;return b2},grep:function(bZ,b4,bY){var b0=[],b3;bY=!!bY;for(var b1=0,b2=bZ.length;b1<b2;b1++){b3=!!b4(bZ[b1],b1);if(bY!==b3){b0.push(bZ[b1])}}return b0},map:function(bY,b5,b6){var b3,b4,b2=[],b0=0,bZ=bY.length,b1=bY instanceof bE||bZ!==L&&typeof bZ==="number"&&((bZ>0&&bY[0]&&bY[bZ-1])||bZ===0||bE.isArray(bY));if(b1){for(;b0<bZ;b0++){b3=b5(bY[b0],b0,b6);if(b3!=null){b2[b2.length]=b3}}}else{for(b4 in bY){b3=b5(bY[b4],b4,b6);if(b3!=null){b2[b2.length]=b3}}}return b2.concat.apply([],b2)},guid:1,proxy:function(b2,b1){if(typeof b1==="string"){var b0=b2[b1];b1=b2;b2=b0}if(!bE.isFunction(b2)){return L}var bY=bK.call(arguments,2),bZ=function(){return b2.apply(b1,bY.concat(bK.call(arguments)))};bZ.guid=b2.guid=b2.guid||bZ.guid||bE.guid++;return bZ},access:function(bY,b6,b4,b0,b3,b5){var bZ=bY.length;if(typeof b6==="object"){for(var b1 in b6){bE.access(bY,b1,b6[b1],b0,b3,b4)}return bY}if(b4!==L){b0=!b5&&b0&&bE.isFunction(b4);for(var b2=0;b2<bZ;b2++){b3(bY[b2],b6,b0?b4.call(bY[b2],b2,b3(bY[b2],b6)):b4,b5)}return bY}return bZ?b3(bY[0],b6):L},now:function(){return(new Date()).getTime()},uaMatch:function(bZ){bZ=bZ.toLowerCase();var bY=by.exec(bZ)||bR.exec(bZ)||bQ.exec(bZ)||bZ.indexOf("compatible")<0&&bS.exec(bZ)||[];return{browser:bY[1]||"",version:bY[2]||"0"}},sub:function(){function bY(b1,b2){return new bY.fn.init(b1,b2)}bE.extend(true,bY,this);bY.superclass=this;bY.fn=bY.prototype=this();bY.fn.constructor=bY;bY.sub=this.sub;bY.fn.init=function b0(b1,b2){if(b2&&b2 instanceof bE&&!(b2 instanceof bY)){b2=bY(b2)}return bE.fn.init.call(this,b1,b2,bZ)};bY.fn.init.prototype=bY.fn;var bZ=bY(ar);return bY},browser:{}});bE.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(bZ,bY){bx["[object "+bY+"]"]=bY.toLowerCase()});bU=bE.uaMatch(bW);if(bU.browser){bE.browser[bU.browser]=true;bE.browser.version=bU.version}if(bE.browser.webkit){bE.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bD=/[\s\xA0]+$/}bC=bE(ar);if(ar.addEventListener){e=function(){ar.removeEventListener("DOMContentLoaded",e,false);bE.ready()}}else{if(ar.attachEvent){e=function(){if(ar.readyState==="complete"){ar.detachEvent("onreadystatechange",e);bE.ready()}}}}function bw(){if(bE.isReady){return}try{ar.documentElement.doScroll("left")}catch(bY){setTimeout(bw,1);return}bE.ready()}return bE})();var a="done fail isResolved isRejected promise then always pipe".split(" "),aH=[].slice;b.extend({_Deferred:function(){var bx=[],by,bv,bw,e={done:function(){if(!bw){var bA=arguments,bB,bE,bD,bC,bz;if(by){bz=by;by=0}for(bB=0,bE=bA.length;bB<bE;bB++){bD=bA[bB];bC=b.type(bD);if(bC==="array"){e.done.apply(e,bD)}else{if(bC==="function"){bx.push(bD)}}}if(bz){e.resolveWith(bz[0],bz[1])}}return this},resolveWith:function(bA,bz){if(!bw&&!by&&!bv){bz=bz||[];bv=1;try{while(bx[0]){bx.shift().apply(bA,bz)}}finally{by=[bA,bz];bv=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return !!(bv||by)},cancel:function(){bw=1;bx=[];return this}};return e},Deferred:function(bv){var e=b._Deferred(),bx=b._Deferred(),bw;b.extend(e,{then:function(bz,by){e.done(bz).fail(by);return this},always:function(){return e.done.apply(e,arguments).fail.apply(this,arguments)},fail:bx.done,rejectWith:bx.resolveWith,reject:bx.resolve,isRejected:bx.isResolved,pipe:function(bz,by){return b.Deferred(function(bA){b.each({done:[bz,"resolve"],fail:[by,"reject"]},function(bC,bF){var bB=bF[0],bE=bF[1],bD;if(b.isFunction(bB)){e[bC](function(){bD=bB.apply(this,arguments);if(bD&&b.isFunction(bD.promise)){bD.promise().then(bA.resolve,bA.reject)}else{bA[bE](bD)}})}else{e[bC](bA[bE])}})}).promise()},promise:function(bz){if(bz==null){if(bw){return bw}bw=bz={}}var by=a.length;while(by--){bz[a[by]]=e[a[by]]}return bz}});e.done(bx.cancel).fail(e.cancel);delete e.cancel;if(bv){bv.call(e,e)}return e},when:function(bA){var bv=arguments,bw=0,bz=bv.length,by=bz,e=bz<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred();function bx(bB){return function(bC){bv[bB]=arguments.length>1?aH.call(arguments,0):bC;if(!(--by)){e.resolveWith(e,aH.call(bv,0))}}}if(bz>1){for(;bw<bz;bw++){if(bv[bw]&&b.isFunction(bv[bw].promise)){bv[bw].promise().then(bx(bw),e.reject)}else{--by}}if(!by){e.resolveWith(e,bv)}}else{if(e!==bA){e.resolveWith(e,bz?[bA]:[])}}return e.promise()}});b.support=(function(){var bF=ar.createElement("div"),bL=ar.documentElement,bz,bM,bG,bx,bE,bA,bC,bw,bD,bv,bI,by,bB,bJ,bN;bF.setAttribute("className","t");bF.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bz=bF.getElementsByTagName("*");bM=bF.getElementsByTagName("a")[0];if(!bz||!bz.length||!bM){return{}}bG=ar.createElement("select");bx=bG.appendChild(ar.createElement("option"));bE=bF.getElementsByTagName("input")[0];bC={leadingWhitespace:(bF.firstChild.nodeType===3),tbody:!bF.getElementsByTagName("tbody").length,htmlSerialize:!!bF.getElementsByTagName("link").length,style:/top/.test(bM.getAttribute("style")),hrefNormalized:(bM.getAttribute("href")==="/a"),opacity:/^0.55$/.test(bM.style.opacity),cssFloat:!!bM.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bF.className!=="t",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bC.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bC.optDisabled=!bx.disabled;try{delete bF.test}catch(bK){bC.deleteExpando=false}if(!bF.addEventListener&&bF.attachEvent&&bF.fireEvent){bF.attachEvent("onclick",function bH(){bC.noCloneEvent=false;bF.detachEvent("onclick",bH)});bF.cloneNode(true).fireEvent("onclick")}bE=ar.createElement("input");bE.value="t";bE.setAttribute("type","radio");bC.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bF.appendChild(bE);bw=ar.createDocumentFragment();bw.appendChild(bF.firstChild);bC.checkClone=bw.cloneNode(true).cloneNode(true).lastChild.checked;bF.innerHTML="";bF.style.width=bF.style.paddingLeft="1px";bD=ar.createElement("body");bv={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(bJ in bv){bD.style[bJ]=bv[bJ]}bD.appendChild(bF);bL.insertBefore(bD,bL.firstChild);bC.appendChecked=bE.checked;bC.boxModel=bF.offsetWidth===2;if("zoom" in bF.style){bF.style.display="inline";bF.style.zoom=1;bC.inlineBlockNeedsLayout=(bF.offsetWidth===2);bF.style.display="";bF.innerHTML="<div style='width:4px;'></div>";bC.shrinkWrapBlocks=(bF.offsetWidth!==2)}bF.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";bI=bF.getElementsByTagName("td");bN=(bI[0].offsetHeight===0);bI[0].style.display="";bI[1].style.display="none";bC.reliableHiddenOffsets=bN&&(bI[0].offsetHeight===0);bF.innerHTML="";if(ar.defaultView&&ar.defaultView.getComputedStyle){bA=ar.createElement("div");bA.style.width="0";bA.style.marginRight="0";bF.appendChild(bA);bC.reliableMarginRight=(parseInt((ar.defaultView.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}bD.innerHTML="";bL.removeChild(bD);if(bF.attachEvent){for(bJ in {submit:1,change:1,focusin:1}){bB="on"+bJ;bN=(bB in bF);if(!bN){bF.setAttribute(bB,"return;");bN=(typeof bF[bB]==="function")}bC[bJ+"Bubbles"]=bN}}return bC})();b.boxModel=b.support.boxModel;var aO=/^(?:\{.*\}|\[.*\])$/,ax=/([a-z])([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!U(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bC=b.expando,bB=typeof bv==="string",bA,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[b.expando]:bx[b.expando]&&b.expando;if((!bw||(by&&bw&&!e[bw][bC]))&&bB&&bz===L){return}if(!bw){if(bD){bx[b.expando]=bw=++b.uuid}else{bw=b.expando}}if(!e[bw]){e[bw]={};if(!bD){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw][bC]=b.extend(e[bw][bC],bv)}else{e[bw]=b.extend(e[bw],bv)}}bA=e[bw];if(by){if(!bA[bC]){bA[bC]={}}bA=bA[bC]}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bv==="events"&&!bA[bv]){return bA[bC]&&bA[bC].events}return bB?bA[b.camelCase(bv)]:bA},removeData:function(by,bw,bz){if(!b.acceptData(by)){return}var bB=b.expando,bC=by.nodeType,bv=bC?b.cache:by,bx=bC?by[b.expando]:b.expando;if(!bv[bx]){return}if(bw){var bA=bz?bv[bx][bB]:bv[bx];if(bA){delete bA[bw];if(!U(bA)){return}}}if(bz){delete bv[bx][bB];if(!U(bv[bx])){return}}var e=bv[bx][bB];if(b.support.deleteExpando||bv!=bc){delete bv[bx]}else{bv[bx]=null}if(e){bv[bx]={};if(!bC){bv[bx].toJSON=b.noop}bv[bx][bB]=e}else{if(bC){if(b.support.deleteExpando){delete by[b.expando]}else{if(by.removeAttribute){by.removeAttribute(b.expando)}else{by[b.expando]=null}}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(by,bA){var bz=null;if(typeof by==="undefined"){if(this.length){bz=b.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,bw;for(var bx=0,bv=e.length;bx<bv;bx++){bw=e[bx].name;if(bw.indexOf("data-")===0){bw=b.camelCase(bw.substring(5));a5(this[0],bw,bz[bw])}}}}return bz}else{if(typeof by==="object"){return this.each(function(){b.data(this,by)})}}var bB=by.split(".");bB[1]=bB[1]?"."+bB[1]:"";if(bA===L){bz=this.triggerHandler("getData"+bB[1]+"!",[bB[0]]);if(bz===L&&this.length){bz=b.data(this[0],by);bz=a5(this[0],by,bz)}return bz===L&&bB[1]?this.data(bB[0]):bz}else{return this.each(function(){var bD=b(this),bC=[bB[0],bA];bD.triggerHandler("setData"+bB[1]+"!",bC);b.data(this,by,bA);bD.triggerHandler("changeData"+bB[1]+"!",bC)})}},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a5(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(ax,"$1-$2").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:!b.isNaN(by)?parseFloat(by):aO.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function U(bv){for(var e in bv){if(e!=="toJSON"){return false}}return true}function bh(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b.data(by,bw,L,true);if(bz&&(bA==="queue"||!b.data(by,bv,L,true))&&(bA==="mark"||!b.data(by,e,L,true))){setTimeout(function(){if(!b.data(by,bv,L,true)&&!b.data(by,e,L,true)){b.removeData(by,bw,true);bz.resolve()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b.data(bv,e,(b.data(bv,e,L,true)||0)+1,true)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b.data(bx,e,L,true)||1)-1);if(bw){b.data(bx,e,bw,true)}else{b.removeData(bx,e,true);bh(bx,bv,"mark")}}},queue:function(bv,e,bx){if(bv){e=(e||"fx")+"queue";var bw=b.data(bv,e,L,true);if(bx){if(!bw||b.isArray(bx)){bw=b.data(bv,e,b.makeArray(bx),true)}else{bw.push(bx)}}return bw||[]}},dequeue:function(bx,bw){bw=bw||"fx";var e=b.queue(bx,bw),bv=e.shift(),by;if(bv==="inprogress"){bv=e.shift()}if(bv){if(bw==="fx"){e.unshift("inprogress")}bv.call(bx,function(){b.dequeue(bx,bw)})}if(!e.length){b.removeData(bx,bw+"queue",true);bh(bx,bw,"queue")}}});b.fn.extend({queue:function(e,bv){if(typeof e!=="string"){bv=e;e="fx"}if(bv===L){return b.queue(this[0],e)}return this.each(function(){var bw=b.queue(this,e,bv);if(e==="fx"&&bw[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(){var bw=this;setTimeout(function(){b.dequeue(bw,e)},bv)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b._Deferred(),true))){bB++;bx.done(bE)}}bE();return e.promise()}});var aM=/[\n\t\r]/g,ad=/\s+/,aQ=/\r/g,g=/^(?:button|input)$/i,E=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,al=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,a8=/\:/,a3,aX;b.fn.extend({attr:function(e,bv){return b.access(this,e,bv,true,b.attr)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,e,bv,true,b.prop)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(bB){if(b.isFunction(bB)){return this.each(function(bE){var bD=b(this);bD.addClass(bB.call(this,bE,bD.attr("class")||""))})}if(bB&&typeof bB==="string"){var e=(bB||"").split(ad);for(var bx=0,bw=this.length;bx<bw;bx++){var bv=this[bx];if(bv.nodeType===1){if(!bv.className){bv.className=bB}else{var by=" "+bv.className+" ",bA=bv.className;for(var bz=0,bC=e.length;bz<bC;bz++){if(by.indexOf(" "+e[bz]+" ")<0){bA+=" "+e[bz]}}bv.className=b.trim(bA)}}}}return this},removeClass:function(bz){if(b.isFunction(bz)){return this.each(function(bD){var bC=b(this);bC.removeClass(bz.call(this,bD,bC.attr("class")))})}if((bz&&typeof bz==="string")||bz===L){var bA=(bz||"").split(ad);for(var bw=0,bv=this.length;bw<bv;bw++){var by=this[bw];if(by.nodeType===1&&by.className){if(bz){var bx=(" "+by.className+" ").replace(aM," ");for(var bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(bz){var by=b(this);by.toggleClass(bx.call(this,bz,by.attr("class"),bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(ad);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ";for(var bw=0,bv=this.length;bw<bv;bw++){if((" "+this[bw].className+" ").replace(aM," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}return(bw.value||"").replace(aQ,"")}return L}var by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,by=e.selectedIndex,bB=[],bC=e.options,bx=e.type==="select-one";if(by<0){return null}for(var bv=bx?by:0,bz=bx?by+1:bC.length;bv<bz;bv++){var bw=bC[bv];if(bw.selected&&(b.support.optDisabled?!bw.disabled:bw.getAttribute("disabled")===null)&&(!bw.parentNode.disabled||!b.nodeName(bw.parentNode,"optgroup"))){bA=b(bw).val();if(bx){return bA}bB.push(bA)}}if(bx&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attrFix:{tabindex:"tabIndex"},attr:function(bA,bx,bB,bz){var bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return L}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(!("getAttribute" in bA)){return b.prop(bA,bx,bB)}var bw,e,by=bv!==1||!b.isXMLDoc(bA);bx=by&&b.attrFix[bx]||bx;e=b.attrHooks[bx];if(!e){if(al.test(bx)&&(typeof bB==="boolean"||bB===L||bB.toLowerCase()===bx.toLowerCase())){e=aX}else{if(a3&&(b.nodeName(bA,"form")||a8.test(bx))){e=a3}}}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return L}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by){return e.get(bA,bx)}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bv,e){var bw;if(bv.nodeType===1){e=b.attrFix[e]||e;if(b.support.getSetAttribute){bv.removeAttribute(e)}else{b.attr(bv,e,"");bv.removeAttributeNode(bv.getAttributeNode(e))}if(al.test(e)&&(bw=b.propFix[e]||e) in bv){bv[bw]=false}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabIndex");return e&&e.specified?parseInt(e.value,10):E.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return L}var bw,e,by=bv!==1||!b.isXMLDoc(bz);bx=by&&b.propFix[bx]||bx;e=b.propHooks[bx];if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==L){return bw}else{return bz[bx]}}},propHooks:{}});aX={get:function(bv,e){return bv[b.propFix[e]||e]?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=bx}bv.setAttribute(e,e.toLowerCase())}return e}};b.attrHooks.value={get:function(bv,e){if(a3&&b.nodeName(bv,"button")){return a3.get(bv,e)}return bv.value},set:function(bv,bw,e){if(a3&&b.nodeName(bv,"button")){return a3.set(bv,bw,e)}bv.value=bw}};if(!b.support.getSetAttribute){b.attrFix=b.propFix;a3=b.attrHooks.name=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&e.nodeValue!==""?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(e){e.nodeValue=bx;return bx}}};b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})})}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}}})}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var aE=Object.prototype.hasOwnProperty,aZ=/\.(.*)$/,be=/^(?:textarea|input|select)$/i,O=/\./g,bi=/ /g,aD=/[^\w\s.|`]/g,H=function(e){return e.replace(aD,"\\$&")};b.event={add:function(bx,bB,bG,bz){if(bx.nodeType===3||bx.nodeType===8){return}if(bG===false){bG=bk}else{if(!bG){return}}var bv,bF;if(bG.handler){bv=bG;bG=bv.handler}if(!bG.guid){bG.guid=b.guid++}var bC=b._data(bx);if(!bC){return}var bH=bC.events,bA=bC.handle;if(!bH){bC.events=bH={}}if(!bA){bC.handle=bA=function(bI){return typeof b!=="undefined"&&(!bI||b.event.triggered!==bI.type)?b.event.handle.apply(bA.elem,arguments):L}}bA.elem=bx;bB=bB.split(" ");var bE,by=0,e;while((bE=bB[by++])){bF=bv?b.extend({},bv):{handler:bG,data:bz};if(bE.indexOf(".")>-1){e=bE.split(".");bE=e.shift();bF.namespace=e.slice(0).sort().join(".")}else{e=[];bF.namespace=""}bF.type=bE;if(!bF.guid){bF.guid=bG.guid}var bw=bH[bE],bD=b.event.special[bE]||{};if(!bw){bw=bH[bE]=[];if(!bD.setup||bD.setup.call(bx,bz,e,bA)===false){if(bx.addEventListener){bx.addEventListener(bE,bA,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bE,bA)}}}}if(bD.add){bD.add.call(bx,bF);if(!bF.handler.guid){bF.handler.guid=bG.guid}}bw.push(bF);b.event.global[bE]=true}bx=null},global:{},remove:function(bJ,bE,bw,bA){if(bJ.nodeType===3||bJ.nodeType===8){return}if(bw===false){bw=bk}var bM,bz,bB,bG,bH=0,bx,bC,bF,by,bD,e,bL,bI=b.hasData(bJ)&&b._data(bJ),bv=bI&&bI.events;if(!bI||!bv){return}if(bE&&bE.type){bw=bE.handler;bE=bE.type}if(!bE||typeof bE==="string"&&bE.charAt(0)==="."){bE=bE||"";for(bz in bv){b.event.remove(bJ,bz+bE)}return}bE=bE.split(" ");while((bz=bE[bH++])){bL=bz;e=null;bx=bz.indexOf(".")<0;bC=[];if(!bx){bC=bz.split(".");bz=bC.shift();bF=new RegExp("(^|\\.)"+b.map(bC.slice(0).sort(),H).join("\\.(?:.*\\.)?")+"(\\.|$)")}bD=bv[bz];if(!bD){continue}if(!bw){for(bG=0;bG<bD.length;bG++){e=bD[bG];if(bx||bF.test(e.namespace)){b.event.remove(bJ,bL,e.handler,bG);bD.splice(bG--,1)}}continue}by=b.event.special[bz]||{};for(bG=bA||0;bG<bD.length;bG++){e=bD[bG];if(bw.guid===e.guid){if(bx||bF.test(e.namespace)){if(bA==null){bD.splice(bG--,1)}if(by.remove){by.remove.call(bJ,e)}}if(bA!=null){break}}}if(bD.length===0||bA!=null&&bD.length===1){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}bM=null;delete bv[bz]}}if(b.isEmptyObject(bv)){var bK=bI.handle;if(bK){bK.elem=null}delete bI.events;delete bI.handle;if(b.isEmptyObject(bI)){b.removeData(bJ,L,true)}}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(e,bB,bz,bG){var bE=e.type||e,bw=[],bv;if(bE.indexOf("!")>=0){bE=bE.slice(0,-1);bv=true}if(bE.indexOf(".")>=0){bw=bE.split(".");bE=bw.shift();bw.sort()}if((!bz||b.event.customEvent[bE])&&!b.event.global[bE]){return}e=typeof e==="object"?e[b.expando]?e:new b.Event(bE,e):new b.Event(bE);e.type=bE;e.exclusive=bv;e.namespace=bw.join(".");e.namespace_re=new RegExp("(^|\\.)"+bw.join("\\.(?:.*\\.)?")+"(\\.|$)");if(bG||!bz){e.preventDefault();e.stopPropagation()}if(!bz){b.each(b.cache,function(){var bI=b.expando,bH=this[bI];if(bH&&bH.events&&bH.events[bE]){b.event.trigger(e,bB,bH.handle.elem)}});return}if(bz.nodeType===3||bz.nodeType===8){return}e.result=L;e.target=bz;bB=bB?b.makeArray(bB):[];bB.unshift(e);var bF=bz,bx=bE.indexOf(":")<0?"on"+bE:"";do{var bC=b._data(bF,"handle");e.currentTarget=bF;if(bC){bC.apply(bF,bB)}if(bx&&b.acceptData(bF)&&bF[bx]&&bF[bx].apply(bF,bB)===false){e.result=false;e.preventDefault()}bF=bF.parentNode||bF.ownerDocument||bF===e.target.ownerDocument&&bc}while(bF&&!e.isPropagationStopped());if(!e.isDefaultPrevented()){var by,bD=b.event.special[bE]||{};if((!bD._default||bD._default.call(bz.ownerDocument,e)===false)&&!(bE==="click"&&b.nodeName(bz,"a"))&&b.acceptData(bz)){try{if(bx&&bz[bE]){by=bz[bx];if(by){bz[bx]=null}b.event.triggered=bE;bz[bE]()}}catch(bA){}if(by){bz[bx]=by}b.event.triggered=L}}return e.result},handle:function(bB){bB=b.event.fix(bB||bc.event);var bv=((b._data(this,"events")||{})[bB.type]||[]).slice(0),bA=!bB.exclusive&&!bB.namespace,by=Array.prototype.slice.call(arguments,0);by[0]=bB;bB.currentTarget=this;for(var bx=0,e=bv.length;bx<e;bx++){var bz=bv[bx];if(bA||bB.namespace_re.test(bz.namespace)){bB.handler=bz.handler;bB.data=bz.data;bB.handleObj=bz;var bw=bz.handler.apply(this,by);if(bw!==L){bB.result=bw;if(bw===false){bB.preventDefault();bB.stopPropagation()}}if(bB.isImmediatePropagationStopped()){break}}}return bB.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(by){if(by[b.expando]){return by}var bv=by;by=b.Event(bv);for(var bw=this.props.length,bA;bw;){bA=this.props[--bw];by[bA]=bv[bA]}if(!by.target){by.target=by.srcElement||ar}if(by.target.nodeType===3){by.target=by.target.parentNode}if(!by.relatedTarget&&by.fromElement){by.relatedTarget=by.fromElement===by.target?by.toElement:by.fromElement}if(by.pageX==null&&by.clientX!=null){var bx=by.target.ownerDocument||ar,bz=bx.documentElement,e=bx.body;by.pageX=by.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);by.pageY=by.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(by.which==null&&(by.charCode!=null||by.keyCode!=null)){by.which=by.charCode!=null?by.charCode:by.keyCode}if(!by.metaKey&&by.ctrlKey){by.metaKey=by.ctrlKey}if(!by.which&&by.button!==L){by.which=(by.button&1?1:(by.button&2?3:(by.button&4?2:0)))}return by},guid:100000000,proxy:b.proxy,special:{ready:{setup:b.bindReady,teardown:b.noop},live:{add:function(e){b.event.add(this,q(e.origType,e.selector),b.extend({},e,{handler:aj,guid:e.handler.guid}))},remove:function(e){b.event.remove(this,q(e.origType,e.selector),e)}},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}}};b.removeEvent=ar.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!this.preventDefault){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bk}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=b.now();this[b.expando]=true};function bk(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bk,isPropagationStopped:bk,isImmediatePropagationStopped:bk};var ac=function(bw){var bv=bw.relatedTarget;bw.type=bw.data;try{if(bv&&bv!==ar&&!bv.parentNode){return}while(bv&&bv!==this){bv=bv.parentNode}if(bv!==this){b.event.handle.apply(this,arguments)}}catch(bx){}},aT=function(e){e.type=e.data;b.event.handle.apply(this,arguments)};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={setup:function(bw){b.event.add(this,e,bw&&bw.selector?aT:ac,bv)},teardown:function(bw){b.event.remove(this,e,bw&&bw.selector?aT:ac)}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(bv,e){if(!b.nodeName(this,"form")){b.event.add(this,"click.specialSubmit",function(by){var bx=by.target,bw=bx.type;if((bw==="submit"||bw==="image")&&b(bx).closest("form").length){aW("submit",this,arguments)}});b.event.add(this,"keypress.specialSubmit",function(by){var bx=by.target,bw=bx.type;if((bw==="text"||bw==="password")&&b(bx).closest("form").length&&by.keyCode===13){aW("submit",this,arguments)}})}else{return false}},teardown:function(e){b.event.remove(this,".specialSubmit")}}}if(!b.support.changeBubbles){var bn,k=function(bv){var e=bv.type,bw=bv.value;if(e==="radio"||e==="checkbox"){bw=bv.checked}else{if(e==="select-multiple"){bw=bv.selectedIndex>-1?b.map(bv.options,function(bx){return bx.selected}).join("-"):""}else{if(b.nodeName(bv,"select")){bw=bv.selectedIndex}}}return bw},aa=function aa(bx){var bv=bx.target,bw,by;if(!be.test(bv.nodeName)||bv.readOnly){return}bw=b._data(bv,"_change_data");by=k(bv);if(bx.type!=="focusout"||bv.type!=="radio"){b._data(bv,"_change_data",by)}if(bw===L||by===bw){return}if(bw!=null||by){bx.type="change";bx.liveFired=L;b.event.trigger(bx,arguments[1],bv)}};b.event.special.change={filters:{focusout:aa,beforedeactivate:aa,click:function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")?bw.type:"";if(bv==="radio"||bv==="checkbox"||b.nodeName(bw,"select")){aa.call(this,bx)}},keydown:function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")?bw.type:"";if((bx.keyCode===13&&!b.nodeName(bw,"textarea"))||(bx.keyCode===32&&(bv==="checkbox"||bv==="radio"))||bv==="select-multiple"){aa.call(this,bx)}},beforeactivate:function(bw){var bv=bw.target;b._data(bv,"_change_data",k(bv))}},setup:function(bw,bv){if(this.type==="file"){return false}for(var e in bn){b.event.add(this,e+".specialChange",bn[e])}return be.test(this.nodeName)},teardown:function(e){b.event.remove(this,".specialChange");return be.test(this.nodeName)}};bn=b.event.special.change.filters;bn.focus=bn.beforeactivate}function aW(bv,bx,e){var bw=b.extend({},e[0]);bw.type=bv;bw.originalEvent={};bw.liveFired=L;b.event.handle.call(bx,bw);if(bw.isDefaultPrevented()){e[0].preventDefault()}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0;b.event.special[e]={setup:function(){if(bv++===0){ar.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){ar.removeEventListener(bx,bw,true)}}};function bw(by){var bz=b.event.fix(by);bz.type=e;bz.originalEvent={};b.event.trigger(bz,null,bz.target);if(bz.isDefaultPrevented()){by.preventDefault()}}})}b.each(["bind","one"],function(bv,e){b.fn[e]=function(bB,bC,bA){var bz;if(typeof bB==="object"){for(var by in bB){this[e](by,bC,bB[by],bA)}return this}if(arguments.length===2||bC===false){bA=bC;bC=L}if(e==="one"){bz=function(bD){b(this).unbind(bD,bz);return bA.apply(this,arguments)};bz.guid=bA.guid||b.guid++}else{bz=bA}if(bB==="unload"&&e!=="one"){this.one(bB,bC,bA)}else{for(var bx=0,bw=this.length;bx<bw;bx++){b.event.add(this[bx],bB,bz,bC)}}return this}});b.fn.extend({unbind:function(by,bx){if(typeof by==="object"&&!by.preventDefault){for(var bw in by){this.unbind(bw,by[bw])}}else{for(var bv=0,e=this.length;bv<e;bv++){b.event.remove(this[bv],by,bx)}}return this},delegate:function(e,bv,bx,bw){return this.live(bv,bx,bw,e)},undelegate:function(e,bv,bw){if(arguments.length===0){return this.unbind("live")}else{return this.die(bv,null,bw,e)}},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b.data(this,"lastToggle"+bx.guid)||0)%bw;b.data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});var aR={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};b.each(["live","die"],function(bv,e){b.fn[e]=function(bF,bC,bH,by){var bG,bD=0,bE,bx,bJ,bA=by||this.selector,bw=by?this:b(this.context);if(typeof bF==="object"&&!bF.preventDefault){for(var bI in bF){bw[e](bI,bC,bF[bI],bA)}return this}if(e==="die"&&!bF&&by&&by.charAt(0)==="."){bw.unbind(by);return this}if(bC===false||b.isFunction(bC)){bH=bC||bk;bC=L}bF=(bF||"").split(" ");while((bG=bF[bD++])!=null){bE=aZ.exec(bG);bx="";if(bE){bx=bE[0];bG=bG.replace(aZ,"")}if(bG==="hover"){bF.push("mouseenter"+bx,"mouseleave"+bx);continue}bJ=bG;if(aR[bG]){bF.push(aR[bG]+bx);bG=bG+bx}else{bG=(aR[bG]||bG)+bx}if(e==="live"){for(var bB=0,bz=bw.length;bB<bz;bB++){b.event.add(bw[bB],"live."+q(bG,bA),{data:bC,selector:bA,handler:bH,origType:bG,origHandler:bH,preType:bJ})}}else{bw.unbind("live."+q(bG,bA),bH)}}return this}});function aj(bF){var bC,bx,bL,bz,e,bH,bE,bG,bD,bK,bB,bA,bJ,bI=[],by=[],bv=b._data(this,"events");if(bF.liveFired===this||!bv||!bv.live||bF.target.disabled||bF.button&&bF.type==="click"){return}if(bF.namespace){bA=new RegExp("(^|\\.)"+bF.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")}bF.liveFired=this;var bw=bv.live.slice(0);for(bE=0;bE<bw.length;bE++){e=bw[bE];if(e.origType.replace(aZ,"")===bF.type){by.push(e.selector)}else{bw.splice(bE--,1)}}bz=b(bF.target).closest(by,bF.currentTarget);for(bG=0,bD=bz.length;bG<bD;bG++){bB=bz[bG];for(bE=0;bE<bw.length;bE++){e=bw[bE];if(bB.selector===e.selector&&(!bA||bA.test(e.namespace))&&!bB.elem.disabled){bH=bB.elem;bL=null;if(e.preType==="mouseenter"||e.preType==="mouseleave"){bF.type=e.preType;bL=b(bF.relatedTarget).closest(e.selector)[0];if(bL&&b.contains(bH,bL)){bL=bH}}if(!bL||bL!==bH){bI.push({elem:bH,handleObj:e,level:bB.level})}}}}for(bG=0,bD=bI.length;bG<bD;bG++){bz=bI[bG];if(bx&&bz.level>bx){break}bF.currentTarget=bz.elem;bF.data=bz.handleObj.data;bF.handleObj=bz.handleObj;bJ=bz.handleObj.origHandler.apply(bz.elem,arguments);if(bJ===false||bF.isPropagationStopped()){bx=bz.level;if(bJ===false){bC=false}if(bF.isImmediatePropagationStopped()){break}}}return bC}function q(bv,e){return(bv&&bv!=="*"?bv+".":"")+e.replace(O,"`").replace(bi,"&")}b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.bind(e,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}});
+(function(a9,K){var aq=a9.document,br=a9.navigator,bi=a9.location;var b=(function(){var bC=function(bX,bY){return new bC.fn.init(bX,bY,bA)},bS=a9.jQuery,bE=a9.$,bA,bW=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bK=/\S/,bG=/^\s+/,bB=/\s+$/,bF=/\d/,bx=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bL=/^[\],:{}\s]*$/,bU=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bN=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bH=/(?:^|:|,)(?:\s*\[)+/g,bv=/(webkit)[ \/]([\w.]+)/,bP=/(opera)(?:.*version)?[ \/]([\w.]+)/,bO=/(msie) ([\w.]+)/,bQ=/(mozilla)(?:.*? rv:([\w.]+))?/,by=/-([a-z])/ig,bR=function(bX,bY){return bY.toUpperCase()},bV=br.userAgent,bT,bz,e,bJ=Object.prototype.toString,bD=Object.prototype.hasOwnProperty,bw=Array.prototype.push,bI=Array.prototype.slice,bM=String.prototype.trim,bs=Array.prototype.indexOf,bu={};bC.fn=bC.prototype={constructor:bC,init:function(bX,b1,b0){var bZ,b2,bY,b3;if(!bX){return this}if(bX.nodeType){this.context=this[0]=bX;this.length=1;return this}if(bX==="body"&&!b1&&aq.body){this.context=aq;this[0]=aq.body;this.selector=bX;this.length=1;return this}if(typeof bX==="string"){if(bX.charAt(0)==="<"&&bX.charAt(bX.length-1)===">"&&bX.length>=3){bZ=[null,bX,null]}else{bZ=bW.exec(bX)}if(bZ&&(bZ[1]||!b1)){if(bZ[1]){b1=b1 instanceof bC?b1[0]:b1;b3=(b1?b1.ownerDocument||b1:aq);bY=bx.exec(bX);if(bY){if(bC.isPlainObject(b1)){bX=[aq.createElement(bY[1])];bC.fn.attr.call(bX,b1,true)}else{bX=[b3.createElement(bY[1])]}}else{bY=bC.buildFragment([bZ[1]],[b3]);bX=(bY.cacheable?bC.clone(bY.fragment):bY.fragment).childNodes}return bC.merge(this,bX)}else{b2=aq.getElementById(bZ[2]);if(b2&&b2.parentNode){if(b2.id!==bZ[2]){return b0.find(bX)}this.length=1;this[0]=b2}this.context=aq;this.selector=bX;return this}}else{if(!b1||b1.jquery){return(b1||b0).find(bX)}else{return this.constructor(b1).find(bX)}}}else{if(bC.isFunction(bX)){return b0.ready(bX)}}if(bX.selector!==K){this.selector=bX.selector;this.context=bX.context}return bC.makeArray(bX,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return bI.call(this,0)},get:function(bX){return bX==null?this.toArray():(bX<0?this[this.length+bX]:this[bX])},pushStack:function(bY,b0,bX){var bZ=this.constructor();if(bC.isArray(bY)){bw.apply(bZ,bY)}else{bC.merge(bZ,bY)}bZ.prevObject=this;bZ.context=this.context;if(b0==="find"){bZ.selector=this.selector+(this.selector?" ":"")+bX}else{if(b0){bZ.selector=this.selector+"."+b0+"("+bX+")"}}return bZ},each:function(bY,bX){return bC.each(this,bY,bX)},ready:function(bX){bC.bindReady();bz.done(bX);return this},eq:function(bX){return bX===-1?this.slice(bX):this.slice(bX,+bX+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bI.apply(this,arguments),"slice",bI.call(arguments).join(","))},map:function(bX){return this.pushStack(bC.map(this,function(bZ,bY){return bX.call(bZ,bY,bZ)}))},end:function(){return this.prevObject||this.constructor(null)},push:bw,sort:[].sort,splice:[].splice};bC.fn.init.prototype=bC.fn;bC.extend=bC.fn.extend=function(){var b6,bZ,bX,bY,b3,b4,b2=arguments[0]||{},b1=1,b0=arguments.length,b5=false;if(typeof b2==="boolean"){b5=b2;b2=arguments[1]||{};b1=2}if(typeof b2!=="object"&&!bC.isFunction(b2)){b2={}}if(b0===b1){b2=this;--b1}for(;b1<b0;b1++){if((b6=arguments[b1])!=null){for(bZ in b6){bX=b2[bZ];bY=b6[bZ];if(b2===bY){continue}if(b5&&bY&&(bC.isPlainObject(bY)||(b3=bC.isArray(bY)))){if(b3){b3=false;b4=bX&&bC.isArray(bX)?bX:[]}else{b4=bX&&bC.isPlainObject(bX)?bX:{}}b2[bZ]=bC.extend(b5,b4,bY)}else{if(bY!==K){b2[bZ]=bY}}}}}return b2};bC.extend({noConflict:function(bX){if(a9.$===bC){a9.$=bE}if(bX&&a9.jQuery===bC){a9.jQuery=bS}return bC},isReady:false,readyWait:1,holdReady:function(bX){if(bX){bC.readyWait++}else{bC.ready(true)}},ready:function(bX){if((bX===true&&!--bC.readyWait)||(bX!==true&&!bC.isReady)){if(!aq.body){return setTimeout(bC.ready,1)}bC.isReady=true;if(bX!==true&&--bC.readyWait>0){return}bz.resolveWith(aq,[bC]);if(bC.fn.trigger){bC(aq).trigger("ready").unbind("ready")}}},bindReady:function(){if(bz){return}bz=bC._Deferred();if(aq.readyState==="complete"){return setTimeout(bC.ready,1)}if(aq.addEventListener){aq.addEventListener("DOMContentLoaded",e,false);a9.addEventListener("load",bC.ready,false)}else{if(aq.attachEvent){aq.attachEvent("onreadystatechange",e);a9.attachEvent("onload",bC.ready);var bX=false;try{bX=a9.frameElement==null}catch(bY){}if(aq.documentElement.doScroll&&bX){bt()}}}},isFunction:function(bX){return bC.type(bX)==="function"},isArray:Array.isArray||function(bX){return bC.type(bX)==="array"},isWindow:function(bX){return bX&&typeof bX==="object"&&"setInterval" in bX},isNaN:function(bX){return bX==null||!bF.test(bX)||isNaN(bX)},type:function(bX){return bX==null?String(bX):bu[bJ.call(bX)]||"object"},isPlainObject:function(bY){if(!bY||bC.type(bY)!=="object"||bY.nodeType||bC.isWindow(bY)){return false}if(bY.constructor&&!bD.call(bY,"constructor")&&!bD.call(bY.constructor.prototype,"isPrototypeOf")){return false}var bX;for(bX in bY){}return bX===K||bD.call(bY,bX)},isEmptyObject:function(bY){for(var bX in bY){return false}return true},error:function(bX){throw bX},parseJSON:function(bX){if(typeof bX!=="string"||!bX){return null}bX=bC.trim(bX);if(a9.JSON&&a9.JSON.parse){return a9.JSON.parse(bX)}if(bL.test(bX.replace(bU,"@").replace(bN,"]").replace(bH,""))){return(new Function("return "+bX))()}bC.error("Invalid JSON: "+bX)},parseXML:function(bZ,bX,bY){if(a9.DOMParser){bY=new DOMParser();bX=bY.parseFromString(bZ,"text/xml")}else{bX=new ActiveXObject("Microsoft.XMLDOM");bX.async="false";bX.loadXML(bZ)}bY=bX.documentElement;if(!bY||!bY.nodeName||bY.nodeName==="parsererror"){bC.error("Invalid XML: "+bZ)}return bX},noop:function(){},globalEval:function(bX){if(bX&&bK.test(bX)){(a9.execScript||function(bY){a9["eval"].call(a9,bY)})(bX)}},camelCase:function(bX){return bX.replace(by,bR)},nodeName:function(bY,bX){return bY.nodeName&&bY.nodeName.toUpperCase()===bX.toUpperCase()},each:function(b0,b3,bZ){var bY,b1=0,b2=b0.length,bX=b2===K||bC.isFunction(b0);if(bZ){if(bX){for(bY in b0){if(b3.apply(b0[bY],bZ)===false){break}}}else{for(;b1<b2;){if(b3.apply(b0[b1++],bZ)===false){break}}}}else{if(bX){for(bY in b0){if(b3.call(b0[bY],bY,b0[bY])===false){break}}}else{for(;b1<b2;){if(b3.call(b0[b1],b1,b0[b1++])===false){break}}}}return b0},trim:bM?function(bX){return bX==null?"":bM.call(bX)}:function(bX){return bX==null?"":bX.toString().replace(bG,"").replace(bB,"")},makeArray:function(b0,bY){var bX=bY||[];if(b0!=null){var bZ=bC.type(b0);if(b0.length==null||bZ==="string"||bZ==="function"||bZ==="regexp"||bC.isWindow(b0)){bw.call(bX,b0)}else{bC.merge(bX,b0)}}return bX},inArray:function(bZ,b0){if(bs){return bs.call(b0,bZ)}for(var bX=0,bY=b0.length;bX<bY;bX++){if(b0[bX]===bZ){return bX}}return -1},merge:function(b1,bZ){var b0=b1.length,bY=0;if(typeof bZ.length==="number"){for(var bX=bZ.length;bY<bX;bY++){b1[b0++]=bZ[bY]}}else{while(bZ[bY]!==K){b1[b0++]=bZ[bY++]}}b1.length=b0;return b1},grep:function(bY,b3,bX){var bZ=[],b2;bX=!!bX;for(var b0=0,b1=bY.length;b0<b1;b0++){b2=!!b3(bY[b0],b0);if(bX!==b2){bZ.push(bY[b0])}}return bZ},map:function(bX,b4,b5){var b2,b3,b1=[],bZ=0,bY=bX.length,b0=bX instanceof bC||bY!==K&&typeof bY==="number"&&((bY>0&&bX[0]&&bX[bY-1])||bY===0||bC.isArray(bX));if(b0){for(;bZ<bY;bZ++){b2=b4(bX[bZ],bZ,b5);if(b2!=null){b1[b1.length]=b2}}}else{for(b3 in bX){b2=b4(bX[b3],b3,b5);if(b2!=null){b1[b1.length]=b2}}}return b1.concat.apply([],b1)},guid:1,proxy:function(b1,b0){if(typeof b0==="string"){var bZ=b1[b0];b0=b1;b1=bZ}if(!bC.isFunction(b1)){return K}var bX=bI.call(arguments,2),bY=function(){return b1.apply(b0,bX.concat(bI.call(arguments)))};bY.guid=b1.guid=b1.guid||bY.guid||bC.guid++;return bY},access:function(bX,b5,b3,bZ,b2,b4){var bY=bX.length;if(typeof b5==="object"){for(var b0 in b5){bC.access(bX,b0,b5[b0],bZ,b2,b3)}return bX}if(b3!==K){bZ=!b4&&bZ&&bC.isFunction(b3);for(var b1=0;b1<bY;b1++){b2(bX[b1],b5,bZ?b3.call(bX[b1],b1,b2(bX[b1],b5)):b3,b4)}return bX}return bY?b2(bX[0],b5):K},now:function(){return(new Date()).getTime()},uaMatch:function(bY){bY=bY.toLowerCase();var bX=bv.exec(bY)||bP.exec(bY)||bO.exec(bY)||bY.indexOf("compatible")<0&&bQ.exec(bY)||[];return{browser:bX[1]||"",version:bX[2]||"0"}},sub:function(){function bX(b0,b1){return new bX.fn.init(b0,b1)}bC.extend(true,bX,this);bX.superclass=this;bX.fn=bX.prototype=this();bX.fn.constructor=bX;bX.sub=this.sub;bX.fn.init=function bZ(b0,b1){if(b1&&b1 instanceof bC&&!(b1 instanceof bX)){b1=bX(b1)}return bC.fn.init.call(this,b0,b1,bY)};bX.fn.init.prototype=bX.fn;var bY=bX(aq);return bX},browser:{}});bC.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(bY,bX){bu["[object "+bX+"]"]=bX.toLowerCase()});bT=bC.uaMatch(bV);if(bT.browser){bC.browser[bT.browser]=true;bC.browser.version=bT.version}if(bC.browser.webkit){bC.browser.safari=true}if(bK.test("\xA0")){bG=/^[\s\xA0]+/;bB=/[\s\xA0]+$/}bA=bC(aq);if(aq.addEventListener){e=function(){aq.removeEventListener("DOMContentLoaded",e,false);bC.ready()}}else{if(aq.attachEvent){e=function(){if(aq.readyState==="complete"){aq.detachEvent("onreadystatechange",e);bC.ready()}}}}function bt(){if(bC.isReady){return}try{aq.documentElement.doScroll("left")}catch(bX){setTimeout(bt,1);return}bC.ready()}return bC})();var a="done fail isResolved isRejected promise then always pipe".split(" "),aF=[].slice;b.extend({_Deferred:function(){var bu=[],bv,bs,bt,e={done:function(){if(!bt){var bx=arguments,by,bB,bA,bz,bw;if(bv){bw=bv;bv=0}for(by=0,bB=bx.length;by<bB;by++){bA=bx[by];bz=b.type(bA);if(bz==="array"){e.done.apply(e,bA)}else{if(bz==="function"){bu.push(bA)}}}if(bw){e.resolveWith(bw[0],bw[1])}}return this},resolveWith:function(bx,bw){if(!bt&&!bv&&!bs){bw=bw||[];bs=1;try{while(bu[0]){bu.shift().apply(bx,bw)}}finally{bv=[bx,bw];bs=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return !!(bs||bv)},cancel:function(){bt=1;bu=[];return this}};return e},Deferred:function(bs){var e=b._Deferred(),bu=b._Deferred(),bt;b.extend(e,{then:function(bw,bv){e.done(bw).fail(bv);return this},always:function(){return e.done.apply(e,arguments).fail.apply(this,arguments)},fail:bu.done,rejectWith:bu.resolveWith,reject:bu.resolve,isRejected:bu.isResolved,pipe:function(bw,bv){return b.Deferred(function(bx){b.each({done:[bw,"resolve"],fail:[bv,"reject"]},function(bz,bC){var by=bC[0],bB=bC[1],bA;if(b.isFunction(by)){e[bz](function(){bA=by.apply(this,arguments);if(bA&&b.isFunction(bA.promise)){bA.promise().then(bx.resolve,bx.reject)}else{bx[bB](bA)}})}else{e[bz](bx[bB])}})}).promise()},promise:function(bw){if(bw==null){if(bt){return bt}bt=bw={}}var bv=a.length;while(bv--){bw[a[bv]]=e[a[bv]]}return bw}});e.done(bu.cancel).fail(e.cancel);delete e.cancel;if(bs){bs.call(e,e)}return e},when:function(bx){var bs=arguments,bt=0,bw=bs.length,bv=bw,e=bw<=1&&bx&&b.isFunction(bx.promise)?bx:b.Deferred();function bu(by){return function(bz){bs[by]=arguments.length>1?aF.call(arguments,0):bz;if(!(--bv)){e.resolveWith(e,aF.call(bs,0))}}}if(bw>1){for(;bt<bw;bt++){if(bs[bt]&&b.isFunction(bs[bt].promise)){bs[bt].promise().then(bu(bt),e.reject)}else{--bv}}if(!bv){e.resolveWith(e,bs)}}else{if(e!==bx){e.resolveWith(e,bw?[bx]:[])}}return e.promise()}});b.support=(function(){var bC=aq.createElement("div"),bJ=aq.documentElement,bv,bK,bD,bt,bB,bw,bz,bs,bA,bE,by,bI,bG,bu,bx,bF,bL;bC.setAttribute("className","t");bC.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bv=bC.getElementsByTagName("*");bK=bC.getElementsByTagName("a")[0];if(!bv||!bv.length||!bK){return{}}bD=aq.createElement("select");bt=bD.appendChild(aq.createElement("option"));bB=bC.getElementsByTagName("input")[0];bz={leadingWhitespace:(bC.firstChild.nodeType===3),tbody:!bC.getElementsByTagName("tbody").length,htmlSerialize:!!bC.getElementsByTagName("link").length,style:/top/.test(bK.getAttribute("style")),hrefNormalized:(bK.getAttribute("href")==="/a"),opacity:/^0.55$/.test(bK.style.opacity),cssFloat:!!bK.style.cssFloat,checkOn:(bB.value==="on"),optSelected:bt.selected,getSetAttribute:bC.className!=="t",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bB.checked=true;bz.noCloneChecked=bB.cloneNode(true).checked;bD.disabled=true;bz.optDisabled=!bt.disabled;try{delete bC.test}catch(bH){bz.deleteExpando=false}if(!bC.addEventListener&&bC.attachEvent&&bC.fireEvent){bC.attachEvent("onclick",function(){bz.noCloneEvent=false});bC.cloneNode(true).fireEvent("onclick")}bB=aq.createElement("input");bB.value="t";bB.setAttribute("type","radio");bz.radioValue=bB.value==="t";bB.setAttribute("checked","checked");bC.appendChild(bB);bs=aq.createDocumentFragment();bs.appendChild(bC.firstChild);bz.checkClone=bs.cloneNode(true).cloneNode(true).lastChild.checked;bC.innerHTML="";bC.style.width=bC.style.paddingLeft="1px";bA=aq.getElementsByTagName("body")[0];by=aq.createElement(bA?"div":"body");bI={visibility:"hidden",width:0,height:0,border:0,margin:0};if(bA){b.extend(bI,{position:"absolute",left:-1000,top:-1000})}for(bF in bI){by.style[bF]=bI[bF]}by.appendChild(bC);bE=bA||bJ;bE.insertBefore(by,bE.firstChild);bz.appendChecked=bB.checked;bz.boxModel=bC.offsetWidth===2;if("zoom" in bC.style){bC.style.display="inline";bC.style.zoom=1;bz.inlineBlockNeedsLayout=(bC.offsetWidth===2);bC.style.display="";bC.innerHTML="<div style='width:4px;'></div>";bz.shrinkWrapBlocks=(bC.offsetWidth!==2)}bC.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";bG=bC.getElementsByTagName("td");bL=(bG[0].offsetHeight===0);bG[0].style.display="";bG[1].style.display="none";bz.reliableHiddenOffsets=bL&&(bG[0].offsetHeight===0);bC.innerHTML="";if(aq.defaultView&&aq.defaultView.getComputedStyle){bw=aq.createElement("div");bw.style.width="0";bw.style.marginRight="0";bC.appendChild(bw);bz.reliableMarginRight=(parseInt((aq.defaultView.getComputedStyle(bw,null)||{marginRight:0}).marginRight,10)||0)===0}by.innerHTML="";bE.removeChild(by);if(bC.attachEvent){for(bF in {submit:1,change:1,focusin:1}){bx="on"+bF;bL=(bx in bC);if(!bL){bC.setAttribute(bx,"return;");bL=(typeof bC[bx]==="function")}bz[bF+"Bubbles"]=bL}}by=bs=bD=bt=bA=bw=bC=bB=null;return bz})();b.boxModel=b.support.boxModel;var aM=/^(?:\{.*\}|\[.*\])$/,aw=/([a-z])([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!T(e)},data:function(bu,bs,bw,bv){if(!b.acceptData(bu)){return}var bz=b.expando,by=typeof bs==="string",bx,bA=bu.nodeType,e=bA?b.cache:bu,bt=bA?bu[b.expando]:bu[b.expando]&&b.expando;if((!bt||(bv&&bt&&!e[bt][bz]))&&by&&bw===K){return}if(!bt){if(bA){bu[b.expando]=bt=++b.uuid}else{bt=b.expando}}if(!e[bt]){e[bt]={};if(!bA){e[bt].toJSON=b.noop}}if(typeof bs==="object"||typeof bs==="function"){if(bv){e[bt][bz]=b.extend(e[bt][bz],bs)}else{e[bt]=b.extend(e[bt],bs)}}bx=e[bt];if(bv){if(!bx[bz]){bx[bz]={}}bx=bx[bz]}if(bw!==K){bx[b.camelCase(bs)]=bw}if(bs==="events"&&!bx[bs]){return bx[bz]&&bx[bz].events}return by?bx[b.camelCase(bs)]||bx[bs]:bx},removeData:function(bv,bt,bw){if(!b.acceptData(bv)){return}var by=b.expando,bz=bv.nodeType,bs=bz?b.cache:bv,bu=bz?bv[b.expando]:b.expando;if(!bs[bu]){return}if(bt){var bx=bw?bs[bu][by]:bs[bu];if(bx){delete bx[bt];if(!T(bx)){return}}}if(bw){delete bs[bu][by];if(!T(bs[bu])){return}}var e=bs[bu][by];if(b.support.deleteExpando||bs!=a9){delete bs[bu]}else{bs[bu]=null}if(e){bs[bu]={};if(!bz){bs[bu].toJSON=b.noop}bs[bu][by]=e}else{if(bz){if(b.support.deleteExpando){delete bv[b.expando]}else{if(bv.removeAttribute){bv.removeAttribute(b.expando)}else{bv[b.expando]=null}}}}},_data:function(bs,e,bt){return b.data(bs,e,bt,true)},acceptData:function(bs){if(bs.nodeName){var e=b.noData[bs.nodeName.toLowerCase()];if(e){return !(e===true||bs.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(bv,bx){var bw=null;if(typeof bv==="undefined"){if(this.length){bw=b.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,bt;for(var bu=0,bs=e.length;bu<bs;bu++){bt=e[bu].name;if(bt.indexOf("data-")===0){bt=b.camelCase(bt.substring(5));a2(this[0],bt,bw[bt])}}}}return bw}else{if(typeof bv==="object"){return this.each(function(){b.data(this,bv)})}}var by=bv.split(".");by[1]=by[1]?"."+by[1]:"";if(bx===K){bw=this.triggerHandler("getData"+by[1]+"!",[by[0]]);if(bw===K&&this.length){bw=b.data(this[0],bv);bw=a2(this[0],bv,bw)}return bw===K&&by[1]?this.data(by[0]):bw}else{return this.each(function(){var bA=b(this),bz=[by[0],bx];bA.triggerHandler("setData"+by[1]+"!",bz);b.data(this,bv,bx);bA.triggerHandler("changeData"+by[1]+"!",bz)})}},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a2(bu,bt,bv){if(bv===K&&bu.nodeType===1){var bs="data-"+bt.replace(aw,"$1-$2").toLowerCase();bv=bu.getAttribute(bs);if(typeof bv==="string"){try{bv=bv==="true"?true:bv==="false"?false:bv==="null"?null:!b.isNaN(bv)?parseFloat(bv):aM.test(bv)?b.parseJSON(bv):bv}catch(bw){}b.data(bu,bt,bv)}else{bv=K}}return bv}function T(bs){for(var e in bs){if(e!=="toJSON"){return false}}return true}function be(bv,bu,bx){var bt=bu+"defer",bs=bu+"queue",e=bu+"mark",bw=b.data(bv,bt,K,true);if(bw&&(bx==="queue"||!b.data(bv,bs,K,true))&&(bx==="mark"||!b.data(bv,e,K,true))){setTimeout(function(){if(!b.data(bv,bs,K,true)&&!b.data(bv,e,K,true)){b.removeData(bv,bt,true);bw.resolve()}},0)}}b.extend({_mark:function(bs,e){if(bs){e=(e||"fx")+"mark";b.data(bs,e,(b.data(bs,e,K,true)||0)+1,true)}},_unmark:function(bv,bu,bs){if(bv!==true){bs=bu;bu=bv;bv=false}if(bu){bs=bs||"fx";var e=bs+"mark",bt=bv?0:((b.data(bu,e,K,true)||1)-1);if(bt){b.data(bu,e,bt,true)}else{b.removeData(bu,e,true);be(bu,bs,"mark")}}},queue:function(bs,e,bu){if(bs){e=(e||"fx")+"queue";var bt=b.data(bs,e,K,true);if(bu){if(!bt||b.isArray(bu)){bt=b.data(bs,e,b.makeArray(bu),true)}else{bt.push(bu)}}return bt||[]}},dequeue:function(bu,bt){bt=bt||"fx";var e=b.queue(bu,bt),bs=e.shift(),bv;if(bs==="inprogress"){bs=e.shift()}if(bs){if(bt==="fx"){e.unshift("inprogress")}bs.call(bu,function(){b.dequeue(bu,bt)})}if(!e.length){b.removeData(bu,bt+"queue",true);be(bu,bt,"queue")}}});b.fn.extend({queue:function(e,bs){if(typeof e!=="string"){bs=e;e="fx"}if(bs===K){return b.queue(this[0],e)}return this.each(function(){var bt=b.queue(this,e,bs);if(e==="fx"&&bt[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bs,e){bs=b.fx?b.fx.speeds[bs]||bs:bs;e=e||"fx";return this.queue(e,function(){var bt=this;setTimeout(function(){b.dequeue(bt,e)},bs)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bA,bt){if(typeof bA!=="string"){bt=bA;bA=K}bA=bA||"fx";var e=b.Deferred(),bs=this,bv=bs.length,by=1,bw=bA+"defer",bx=bA+"queue",bz=bA+"mark",bu;function bB(){if(!(--by)){e.resolveWith(bs,[bs])}}while(bv--){if((bu=b.data(bs[bv],bw,K,true)||(b.data(bs[bv],bx,K,true)||b.data(bs[bv],bz,K,true))&&b.data(bs[bv],bw,b._Deferred(),true))){by++;bu.done(bB)}}bB();return e.promise()}});var aK=/[\n\t\r]/g,ac=/\s+/,aO=/\r/g,g=/^(?:button|input)$/i,D=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ak=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,a5=/\:|^on/,a0,aU;b.fn.extend({attr:function(e,bs){return b.access(this,e,bs,true,b.attr)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bs){return b.access(this,e,bs,true,b.prop)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=K;delete this[e]}catch(bs){}})},addClass:function(bv){var bx,bt,bs,bu,bw,by,e;if(b.isFunction(bv)){return this.each(function(bz){b(this).addClass(bv.call(this,bz,this.className))})}if(bv&&typeof bv==="string"){bx=bv.split(ac);for(bt=0,bs=this.length;bt<bs;bt++){bu=this[bt];if(bu.nodeType===1){if(!bu.className&&bx.length===1){bu.className=bv}else{bw=" "+bu.className+" ";for(by=0,e=bx.length;by<e;by++){if(!~bw.indexOf(" "+bx[by]+" ")){bw+=bx[by]+" "}}bu.className=b.trim(bw)}}}}return this},removeClass:function(bw){var bx,bt,bs,bv,bu,by,e;if(b.isFunction(bw)){return this.each(function(bz){b(this).removeClass(bw.call(this,bz,this.className))})}if((bw&&typeof bw==="string")||bw===K){bx=(bw||"").split(ac);for(bt=0,bs=this.length;bt<bs;bt++){bv=this[bt];if(bv.nodeType===1&&bv.className){if(bw){bu=(" "+bv.className+" ").replace(aK," ");for(by=0,e=bx.length;by<e;by++){bu=bu.replace(" "+bx[by]+" "," ")}bv.className=b.trim(bu)}else{bv.className=""}}}}return this},toggleClass:function(bu,bs){var bt=typeof bu,e=typeof bs==="boolean";if(b.isFunction(bu)){return this.each(function(bv){b(this).toggleClass(bu.call(this,bv,this.className,bs),bs)})}return this.each(function(){if(bt==="string"){var bx,bw=0,bv=b(this),by=bs,bz=bu.split(ac);while((bx=bz[bw++])){by=e?by:!bv.hasClass(bx);bv[by?"addClass":"removeClass"](bx)}}else{if(bt==="undefined"||bt==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bu===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bu=" "+e+" ";for(var bt=0,bs=this.length;bt<bs;bt++){if((" "+this[bt].className+" ").replace(aK," ").indexOf(bu)>-1){return true}}return false},val:function(bu){var e,bs,bt=this[0];if(!arguments.length){if(bt){e=b.valHooks[bt.nodeName.toLowerCase()]||b.valHooks[bt.type];if(e&&"get" in e&&(bs=e.get(bt,"value"))!==K){return bs}bs=bt.value;return typeof bs==="string"?bs.replace(aO,""):bs==null?"":bs}return K}var bv=b.isFunction(bu);return this.each(function(bx){var bw=b(this),by;if(this.nodeType!==1){return}if(bv){by=bu.call(this,bx,bw.val())}else{by=bu}if(by==null){by=""}else{if(typeof by==="number"){by+=""}else{if(b.isArray(by)){by=b.map(by,function(bz){return bz==null?"":bz+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,by,"value")===K){this.value=by}})}});b.extend({valHooks:{option:{get:function(e){var bs=e.attributes.value;return !bs||bs.specified?e.value:e.text}},select:{get:function(e){var bx,bv=e.selectedIndex,by=[],bz=e.options,bu=e.type==="select-one";if(bv<0){return null}for(var bs=bu?bv:0,bw=bu?bv+1:bz.length;bs<bw;bs++){var bt=bz[bs];if(bt.selected&&(b.support.optDisabled?!bt.disabled:bt.getAttribute("disabled")===null)&&(!bt.parentNode.disabled||!b.nodeName(bt.parentNode,"optgroup"))){bx=b(bt).val();if(bu){return bx}by.push(bx)}}if(bu&&!by.length&&bz.length){return b(bz[bv]).val()}return by},set:function(bs,bt){var e=b.makeArray(bt);b(bs).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bs.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attrFix:{tabindex:"tabIndex"},attr:function(bx,bu,by,bw){var bs=bx.nodeType;if(!bx||bs===3||bs===8||bs===2){return K}if(bw&&bu in b.attrFn){return b(bx)[bu](by)}if(!("getAttribute" in bx)){return b.prop(bx,bu,by)}var bt,e,bv=bs!==1||!b.isXMLDoc(bx);if(bv){bu=b.attrFix[bu]||bu;e=b.attrHooks[bu];if(!e){if(ak.test(bu)){e=aU}else{if(a0&&bu!=="className"&&(b.nodeName(bx,"form")||a5.test(bu))){e=a0}}}}if(by!==K){if(by===null){b.removeAttr(bx,bu);return K}else{if(e&&"set" in e&&bv&&(bt=e.set(bx,by,bu))!==K){return bt}else{bx.setAttribute(bu,""+by);return by}}}else{if(e&&"get" in e&&bv&&(bt=e.get(bx,bu))!==null){return bt}else{bt=bx.getAttribute(bu);return bt===null?K:bt}}},removeAttr:function(bs,e){var bt;if(bs.nodeType===1){e=b.attrFix[e]||e;if(b.support.getSetAttribute){bs.removeAttribute(e)}else{b.attr(bs,e,"");bs.removeAttributeNode(bs.getAttributeNode(e))}if(ak.test(e)&&(bt=b.propFix[e]||e) in bs){bs[bt]=false}}},attrHooks:{type:{set:function(e,bs){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bs==="radio"&&b.nodeName(e,"input")){var bt=e.value;e.setAttribute("type",bs);if(bt){e.value=bt}return bs}}}},tabIndex:{get:function(bs){var e=bs.getAttributeNode("tabIndex");return e&&e.specified?parseInt(e.value,10):D.test(bs.nodeName)||l.test(bs.nodeName)&&bs.href?0:K}},value:{get:function(bs,e){if(a0&&b.nodeName(bs,"button")){return a0.get(bs,e)}return e in bs?bs.value:null},set:function(bs,bt,e){if(a0&&b.nodeName(bs,"button")){return a0.set(bs,bt,e)}bs.value=bt}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bw,bu,bx){var bs=bw.nodeType;if(!bw||bs===3||bs===8||bs===2){return K}var bt,e,bv=bs!==1||!b.isXMLDoc(bw);if(bv){bu=b.propFix[bu]||bu;e=b.propHooks[bu]}if(bx!==K){if(e&&"set" in e&&(bt=e.set(bw,bx,bu))!==K){return bt}else{return(bw[bu]=bx)}}else{if(e&&"get" in e&&(bt=e.get(bw,bu))!==K){return bt}else{return bw[bu]}}},propHooks:{}});aU={get:function(bs,e){return b.prop(bs,e)?e.toLowerCase():K},set:function(bs,bu,e){var bt;if(bu===false){b.removeAttr(bs,e)}else{bt=b.propFix[e]||e;if(bt in bs){bs[bt]=true}bs.setAttribute(e,e.toLowerCase())}return e}};if(!b.support.getSetAttribute){b.attrFix=b.propFix;a0=b.attrHooks.name=b.attrHooks.title=b.valHooks.button={get:function(bt,bs){var e;e=bt.getAttributeNode(bs);return e&&e.nodeValue!==""?e.nodeValue:K},set:function(bt,bu,bs){var e=bt.getAttributeNode(bs);if(e){e.nodeValue=bu;return bu}}};b.each(["width","height"],function(bs,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bt,bu){if(bu===""){bt.setAttribute(e,"auto");return bu}}})})}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bs,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bu){var bt=bu.getAttribute(e,2);return bt===null?K:bt}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||K},set:function(e,bs){return(e.style.cssText=""+bs)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bs){var e=bs.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}}})}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bs){if(b.isArray(bs)){return(e.checked=b.inArray(b(e).val(),bs)>=0)}}})});var aW=/\.(.*)$/,bb=/^(?:textarea|input|select)$/i,N=/\./g,bf=/ /g,aC=/[^\w\s.|`]/g,G=function(e){return e.replace(aC,"\\$&")};b.event={add:function(bu,by,bD,bw){if(bu.nodeType===3||bu.nodeType===8){return}if(bD===false){bD=bh}else{if(!bD){return}}var bs,bC;if(bD.handler){bs=bD;bD=bs.handler}if(!bD.guid){bD.guid=b.guid++}var bz=b._data(bu);if(!bz){return}var bE=bz.events,bx=bz.handle;if(!bE){bz.events=bE={}}if(!bx){bz.handle=bx=function(bF){return typeof b!=="undefined"&&(!bF||b.event.triggered!==bF.type)?b.event.handle.apply(bx.elem,arguments):K}}bx.elem=bu;by=by.split(" ");var bB,bv=0,e;while((bB=by[bv++])){bC=bs?b.extend({},bs):{handler:bD,data:bw};if(bB.indexOf(".")>-1){e=bB.split(".");bB=e.shift();bC.namespace=e.slice(0).sort().join(".")}else{e=[];bC.namespace=""}bC.type=bB;if(!bC.guid){bC.guid=bD.guid}var bt=bE[bB],bA=b.event.special[bB]||{};if(!bt){bt=bE[bB]=[];if(!bA.setup||bA.setup.call(bu,bw,e,bx)===false){if(bu.addEventListener){bu.addEventListener(bB,bx,false)}else{if(bu.attachEvent){bu.attachEvent("on"+bB,bx)}}}}if(bA.add){bA.add.call(bu,bC);if(!bC.handler.guid){bC.handler.guid=bD.guid}}bt.push(bC);b.event.global[bB]=true}bu=null},global:{},remove:function(bG,bB,bt,bx){if(bG.nodeType===3||bG.nodeType===8){return}if(bt===false){bt=bh}var bJ,bw,by,bD,bE=0,bu,bz,bC,bv,bA,e,bI,bF=b.hasData(bG)&&b._data(bG),bs=bF&&bF.events;if(!bF||!bs){return}if(bB&&bB.type){bt=bB.handler;bB=bB.type}if(!bB||typeof bB==="string"&&bB.charAt(0)==="."){bB=bB||"";for(bw in bs){b.event.remove(bG,bw+bB)}return}bB=bB.split(" ");while((bw=bB[bE++])){bI=bw;e=null;bu=bw.indexOf(".")<0;bz=[];if(!bu){bz=bw.split(".");bw=bz.shift();bC=new RegExp("(^|\\.)"+b.map(bz.slice(0).sort(),G).join("\\.(?:.*\\.)?")+"(\\.|$)")}bA=bs[bw];if(!bA){continue}if(!bt){for(bD=0;bD<bA.length;bD++){e=bA[bD];if(bu||bC.test(e.namespace)){b.event.remove(bG,bI,e.handler,bD);bA.splice(bD--,1)}}continue}bv=b.event.special[bw]||{};for(bD=bx||0;bD<bA.length;bD++){e=bA[bD];if(bt.guid===e.guid){if(bu||bC.test(e.namespace)){if(bx==null){bA.splice(bD--,1)}if(bv.remove){bv.remove.call(bG,e)}}if(bx!=null){break}}}if(bA.length===0||bx!=null&&bA.length===1){if(!bv.teardown||bv.teardown.call(bG,bz)===false){b.removeEvent(bG,bw,bF.handle)}bJ=null;delete bs[bw]}}if(b.isEmptyObject(bs)){var bH=bF.handle;if(bH){bH.elem=null}delete bF.events;delete bF.handle;if(b.isEmptyObject(bF)){b.removeData(bG,K,true)}}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(e,by,bw,bD){var bB=e.type||e,bt=[],bs;if(bB.indexOf("!")>=0){bB=bB.slice(0,-1);bs=true}if(bB.indexOf(".")>=0){bt=bB.split(".");bB=bt.shift();bt.sort()}if((!bw||b.event.customEvent[bB])&&!b.event.global[bB]){return}e=typeof e==="object"?e[b.expando]?e:new b.Event(bB,e):new b.Event(bB);e.type=bB;e.exclusive=bs;e.namespace=bt.join(".");e.namespace_re=new RegExp("(^|\\.)"+bt.join("\\.(?:.*\\.)?")+"(\\.|$)");if(bD||!bw){e.preventDefault();e.stopPropagation()}if(!bw){b.each(b.cache,function(){var bF=b.expando,bE=this[bF];if(bE&&bE.events&&bE.events[bB]){b.event.trigger(e,by,bE.handle.elem)}});return}if(bw.nodeType===3||bw.nodeType===8){return}e.result=K;e.target=bw;by=by!=null?b.makeArray(by):[];by.unshift(e);var bC=bw,bu=bB.indexOf(":")<0?"on"+bB:"";do{var bz=b._data(bC,"handle");e.currentTarget=bC;if(bz){bz.apply(bC,by)}if(bu&&b.acceptData(bC)&&bC[bu]&&bC[bu].apply(bC,by)===false){e.result=false;e.preventDefault()}bC=bC.parentNode||bC.ownerDocument||bC===e.target.ownerDocument&&a9}while(bC&&!e.isPropagationStopped());if(!e.isDefaultPrevented()){var bv,bA=b.event.special[bB]||{};if((!bA._default||bA._default.call(bw.ownerDocument,e)===false)&&!(bB==="click"&&b.nodeName(bw,"a"))&&b.acceptData(bw)){try{if(bu&&bw[bB]){bv=bw[bu];if(bv){bw[bu]=null}b.event.triggered=bB;bw[bB]()}}catch(bx){}if(bv){bw[bu]=bv}b.event.triggered=K}}return e.result},handle:function(by){by=b.event.fix(by||a9.event);var bs=((b._data(this,"events")||{})[by.type]||[]).slice(0),bx=!by.exclusive&&!by.namespace,bv=Array.prototype.slice.call(arguments,0);bv[0]=by;by.currentTarget=this;for(var bu=0,e=bs.length;bu<e;bu++){var bw=bs[bu];if(bx||by.namespace_re.test(bw.namespace)){by.handler=bw.handler;by.data=bw.data;by.handleObj=bw;var bt=bw.handler.apply(this,bv);if(bt!==K){by.result=bt;if(bt===false){by.preventDefault();by.stopPropagation()}}if(by.isImmediatePropagationStopped()){break}}}return by.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(bv){if(bv[b.expando]){return bv}var bs=bv;bv=b.Event(bs);for(var bt=this.props.length,bx;bt;){bx=this.props[--bt];bv[bx]=bs[bx]}if(!bv.target){bv.target=bv.srcElement||aq}if(bv.target.nodeType===3){bv.target=bv.target.parentNode}if(!bv.relatedTarget&&bv.fromElement){bv.relatedTarget=bv.fromElement===bv.target?bv.toElement:bv.fromElement}if(bv.pageX==null&&bv.clientX!=null){var bu=bv.target.ownerDocument||aq,bw=bu.documentElement,e=bu.body;bv.pageX=bv.clientX+(bw&&bw.scrollLeft||e&&e.scrollLeft||0)-(bw&&bw.clientLeft||e&&e.clientLeft||0);bv.pageY=bv.clientY+(bw&&bw.scrollTop||e&&e.scrollTop||0)-(bw&&bw.clientTop||e&&e.clientTop||0)}if(bv.which==null&&(bv.charCode!=null||bv.keyCode!=null)){bv.which=bv.charCode!=null?bv.charCode:bv.keyCode}if(!bv.metaKey&&bv.ctrlKey){bv.metaKey=bv.ctrlKey}if(!bv.which&&bv.button!==K){bv.which=(bv.button&1?1:(bv.button&2?3:(bv.button&4?2:0)))}return bv},guid:100000000,proxy:b.proxy,special:{ready:{setup:b.bindReady,teardown:b.noop},live:{add:function(e){b.event.add(this,p(e.origType,e.selector),b.extend({},e,{handler:ai,guid:e.handler.guid}))},remove:function(e){b.event.remove(this,p(e.origType,e.selector),e)}},beforeunload:{setup:function(bt,bs,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bs,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}}};b.removeEvent=aq.removeEventListener?function(bs,e,bt){if(bs.removeEventListener){bs.removeEventListener(e,bt,false)}}:function(bs,e,bt){if(bs.detachEvent){bs.detachEvent("on"+e,bt)}};b.Event=function(bs,e){if(!this.preventDefault){return new b.Event(bs,e)}if(bs&&bs.type){this.originalEvent=bs;this.type=bs.type;this.isDefaultPrevented=(bs.defaultPrevented||bs.returnValue===false||bs.getPreventDefault&&bs.getPreventDefault())?i:bh}else{this.type=bs}if(e){b.extend(this,e)}this.timeStamp=b.now();this[b.expando]=true};function bh(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bs=this.originalEvent;if(!bs){return}if(bs.preventDefault){bs.preventDefault()}else{bs.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bs=this.originalEvent;if(!bs){return}if(bs.stopPropagation){bs.stopPropagation()}bs.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bh,isPropagationStopped:bh,isImmediatePropagationStopped:bh};var ab=function(bt){var bu=bt.relatedTarget,e=false,bs=bt.type;bt.type=bt.data;if(bu!==this){if(bu){e=b.contains(this,bu)}if(!e){b.event.handle.apply(this,arguments);bt.type=bs}}},aR=function(e){e.type=e.data;b.event.handle.apply(this,arguments)};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bs,e){b.event.special[bs]={setup:function(bt){b.event.add(this,e,bt&&bt.selector?aR:ab,bs)},teardown:function(bt){b.event.remove(this,e,bt&&bt.selector?aR:ab)}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(bs,e){if(!b.nodeName(this,"form")){b.event.add(this,"click.specialSubmit",function(bv){var bu=bv.target,bt=bu.type;if((bt==="submit"||bt==="image")&&b(bu).closest("form").length){aT("submit",this,arguments)}});b.event.add(this,"keypress.specialSubmit",function(bv){var bu=bv.target,bt=bu.type;if((bt==="text"||bt==="password")&&b(bu).closest("form").length&&bv.keyCode===13){aT("submit",this,arguments)}})}else{return false}},teardown:function(e){b.event.remove(this,".specialSubmit")}}}if(!b.support.changeBubbles){var bk,k=function(bs){var e=bs.type,bt=bs.value;if(e==="radio"||e==="checkbox"){bt=bs.checked}else{if(e==="select-multiple"){bt=bs.selectedIndex>-1?b.map(bs.options,function(bu){return bu.selected}).join("-"):""}else{if(b.nodeName(bs,"select")){bt=bs.selectedIndex}}}return bt},Z=function Z(bu){var bs=bu.target,bt,bv;if(!bb.test(bs.nodeName)||bs.readOnly){return}bt=b._data(bs,"_change_data");bv=k(bs);if(bu.type!=="focusout"||bs.type!=="radio"){b._data(bs,"_change_data",bv)}if(bt===K||bv===bt){return}if(bt!=null||bv){bu.type="change";bu.liveFired=K;b.event.trigger(bu,arguments[1],bs)}};b.event.special.change={filters:{focusout:Z,beforedeactivate:Z,click:function(bu){var bt=bu.target,bs=b.nodeName(bt,"input")?bt.type:"";if(bs==="radio"||bs==="checkbox"||b.nodeName(bt,"select")){Z.call(this,bu)}},keydown:function(bu){var bt=bu.target,bs=b.nodeName(bt,"input")?bt.type:"";if((bu.keyCode===13&&!b.nodeName(bt,"textarea"))||(bu.keyCode===32&&(bs==="checkbox"||bs==="radio"))||bs==="select-multiple"){Z.call(this,bu)}},beforeactivate:function(bt){var bs=bt.target;b._data(bs,"_change_data",k(bs))}},setup:function(bt,bs){if(this.type==="file"){return false}for(var e in bk){b.event.add(this,e+".specialChange",bk[e])}return bb.test(this.nodeName)},teardown:function(e){b.event.remove(this,".specialChange");return bb.test(this.nodeName)}};bk=b.event.special.change.filters;bk.focus=bk.beforeactivate}function aT(bs,bu,e){var bt=b.extend({},e[0]);bt.type=bs;bt.originalEvent={};bt.liveFired=K;b.event.handle.call(bu,bt);if(bt.isDefaultPrevented()){e[0].preventDefault()}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bu,e){var bs=0;b.event.special[e]={setup:function(){if(bs++===0){aq.addEventListener(bu,bt,true)}},teardown:function(){if(--bs===0){aq.removeEventListener(bu,bt,true)}}};function bt(bv){var bw=b.event.fix(bv);bw.type=e;bw.originalEvent={};b.event.trigger(bw,null,bw.target);if(bw.isDefaultPrevented()){bv.preventDefault()}}})}b.each(["bind","one"],function(bs,e){b.fn[e]=function(by,bz,bx){var bw;if(typeof by==="object"){for(var bv in by){this[e](bv,bz,by[bv],bx)}return this}if(arguments.length===2||bz===false){bx=bz;bz=K}if(e==="one"){bw=function(bA){b(this).unbind(bA,bw);return bx.apply(this,arguments)};bw.guid=bx.guid||b.guid++}else{bw=bx}if(by==="unload"&&e!=="one"){this.one(by,bz,bx)}else{for(var bu=0,bt=this.length;bu<bt;bu++){b.event.add(this[bu],by,bw,bz)}}return this}});b.fn.extend({unbind:function(bv,bu){if(typeof bv==="object"&&!bv.preventDefault){for(var bt in bv){this.unbind(bt,bv[bt])}}else{for(var bs=0,e=this.length;bs<e;bs++){b.event.remove(this[bs],bv,bu)}}return this},delegate:function(e,bs,bu,bt){return this.live(bs,bu,bt,e)},undelegate:function(e,bs,bt){if(arguments.length===0){return this.unbind("live")}else{return this.die(bs,null,bt,e)}},trigger:function(e,bs){return this.each(function(){b.event.trigger(e,bs,this)})},triggerHandler:function(e,bs){if(this[0]){return b.event.trigger(e,bs,this[0],true)}},toggle:function(bu){var bs=arguments,e=bu.guid||b.guid++,bt=0,bv=function(bw){var bx=(b.data(this,"lastToggle"+bu.guid)||0)%bt;b.data(this,"lastToggle"+bu.guid,bx+1);bw.preventDefault();return bs[bx].apply(this,arguments)||false};bv.guid=e;while(bt<bs.length){bs[bt++].guid=e}return this.click(bv)},hover:function(e,bs){return this.mouseenter(e).mouseleave(bs||e)}});var aP={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};b.each(["live","die"],function(bs,e){b.fn[e]=function(bC,bz,bE,bv){var bD,bA=0,bB,bu,bG,bx=bv||this.selector,bt=bv?this:b(this.context);if(typeof bC==="object"&&!bC.preventDefault){for(var bF in bC){bt[e](bF,bz,bC[bF],bx)}return this}if(e==="die"&&!bC&&bv&&bv.charAt(0)==="."){bt.unbind(bv);return this}if(bz===false||b.isFunction(bz)){bE=bz||bh;bz=K}bC=(bC||"").split(" ");while((bD=bC[bA++])!=null){bB=aW.exec(bD);bu="";if(bB){bu=bB[0];bD=bD.replace(aW,"")}if(bD==="hover"){bC.push("mouseenter"+bu,"mouseleave"+bu);continue}bG=bD;if(aP[bD]){bC.push(aP[bD]+bu);bD=bD+bu}else{bD=(aP[bD]||bD)+bu}if(e==="live"){for(var by=0,bw=bt.length;by<bw;by++){b.event.add(bt[by],"live."+p(bD,bx),{data:bz,selector:bx,handler:bE,origType:bD,origHandler:bE,preType:bG})}}else{bt.unbind("live."+p(bD,bx),bE)}}return this}});function ai(bC){var bz,bu,bI,bw,e,bE,bB,bD,bA,bH,by,bx,bG,bF=[],bv=[],bs=b._data(this,"events");if(bC.liveFired===this||!bs||!bs.live||bC.target.disabled||bC.button&&bC.type==="click"){return}if(bC.namespace){bx=new RegExp("(^|\\.)"+bC.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")}bC.liveFired=this;var bt=bs.live.slice(0);for(bB=0;bB<bt.length;bB++){e=bt[bB];if(e.origType.replace(aW,"")===bC.type){bv.push(e.selector)}else{bt.splice(bB--,1)}}bw=b(bC.target).closest(bv,bC.currentTarget);for(bD=0,bA=bw.length;bD<bA;bD++){by=bw[bD];for(bB=0;bB<bt.length;bB++){e=bt[bB];if(by.selector===e.selector&&(!bx||bx.test(e.namespace))&&!by.elem.disabled){bE=by.elem;bI=null;if(e.preType==="mouseenter"||e.preType==="mouseleave"){bC.type=e.preType;bI=b(bC.relatedTarget).closest(e.selector)[0];if(bI&&b.contains(bE,bI)){bI=bE}}if(!bI||bI!==bE){bF.push({elem:bE,handleObj:e,level:by.level})}}}}for(bD=0,bA=bF.length;bD<bA;bD++){bw=bF[bD];if(bu&&bw.level>bu){break}bC.currentTarget=bw.elem;bC.data=bw.handleObj.data;bC.handleObj=bw.handleObj;bG=bw.handleObj.origHandler.apply(bw.elem,arguments);if(bG===false||bC.isPropagationStopped()){bu=bw.level;if(bG===false){bz=false}if(bC.isImmediatePropagationStopped()){break}}}return bz}function p(bs,e){return(bs&&bs!=="*"?bs+".":"")+e.replace(N,"`").replace(bf,"&")}b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error").split(" "),function(bs,e){b.fn[e]=function(bu,bt){if(bt==null){bt=bu;bu=null}return arguments.length>0?this.bind(e,bu,bt):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}});
/*
* Sizzle CSS Selector Engine
* Copyright 2011, The Dojo Foundation
* Released under the MIT, BSD, and GPL Licenses.
* More information: http://sizzlejs.com/
*/
-(function(){var bF=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bG=0,bJ=Object.prototype.toString,bA=false,bz=true,bH=/\\/g,bN=/\W/;[0,0].sort(function(){bz=false;return 0});var bx=function(bS,e,bV,bW){bV=bV||[];e=e||ar;var bY=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bS||typeof bS!=="string"){return bV}var bP,b0,b3,bO,bZ,b2,b1,bU,bR=true,bQ=bx.isXML(e),bT=[],bX=bS;do{bF.exec("");bP=bF.exec(bX);if(bP){bX=bP[3];bT.push(bP[1]);if(bP[2]){bO=bP[3];break}}}while(bP);if(bT.length>1&&bB.exec(bS)){if(bT.length===2&&bC.relative[bT[0]]){b0=bK(bT[0]+bT[1],e)}else{b0=bC.relative[bT[0]]?[e]:bx(bT.shift(),e);while(bT.length){bS=bT.shift();if(bC.relative[bS]){bS+=bT.shift()}b0=bK(bS,b0)}}}else{if(!bW&&bT.length>1&&e.nodeType===9&&!bQ&&bC.match.ID.test(bT[0])&&!bC.match.ID.test(bT[bT.length-1])){bZ=bx.find(bT.shift(),e,bQ);e=bZ.expr?bx.filter(bZ.expr,bZ.set)[0]:bZ.set[0]}if(e){bZ=bW?{expr:bT.pop(),set:bD(bW)}:bx.find(bT.pop(),bT.length===1&&(bT[0]==="~"||bT[0]==="+")&&e.parentNode?e.parentNode:e,bQ);b0=bZ.expr?bx.filter(bZ.expr,bZ.set):bZ.set;if(bT.length>0){b3=bD(b0)}else{bR=false}while(bT.length){b2=bT.pop();b1=b2;if(!bC.relative[b2]){b2=""}else{b1=bT.pop()}if(b1==null){b1=e}bC.relative[b2](b3,b1,bQ)}}else{b3=bT=[]}}if(!b3){b3=b0}if(!b3){bx.error(b2||bS)}if(bJ.call(b3)==="[object Array]"){if(!bR){bV.push.apply(bV,b3)}else{if(e&&e.nodeType===1){for(bU=0;b3[bU]!=null;bU++){if(b3[bU]&&(b3[bU]===true||b3[bU].nodeType===1&&bx.contains(e,b3[bU]))){bV.push(b0[bU])}}}else{for(bU=0;b3[bU]!=null;bU++){if(b3[bU]&&b3[bU].nodeType===1){bV.push(b0[bU])}}}}}else{bD(b3,bV)}if(bO){bx(bO,bY,bV,bW);bx.uniqueSort(bV)}return bV};bx.uniqueSort=function(bO){if(bI){bA=bz;bO.sort(bI);if(bA){for(var e=1;e<bO.length;e++){if(bO[e]===bO[e-1]){bO.splice(e--,1)}}}}return bO};bx.matches=function(e,bO){return bx(e,null,null,bO)};bx.matchesSelector=function(e,bO){return bx(bO,null,null,[e]).length>0};bx.find=function(bU,e,bV){var bT;if(!bU){return[]}for(var bQ=0,bP=bC.order.length;bQ<bP;bQ++){var bR,bS=bC.order[bQ];if((bR=bC.leftMatch[bS].exec(bU))){var bO=bR[1];bR.splice(1,1);if(bO.substr(bO.length-1)!=="\\"){bR[1]=(bR[1]||"").replace(bH,"");bT=bC.find[bS](bR,e,bV);if(bT!=null){bU=bU.replace(bC.match[bS],"");break}}}}if(!bT){bT=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bT,expr:bU}};bx.filter=function(bY,bX,b1,bR){var bT,e,bP=bY,b3=[],bV=bX,bU=bX&&bX[0]&&bx.isXML(bX[0]);while(bY&&bX.length){for(var bW in bC.filter){if((bT=bC.leftMatch[bW].exec(bY))!=null&&bT[2]){var b2,b0,bO=bC.filter[bW],bQ=bT[1];e=false;bT.splice(1,1);if(bQ.substr(bQ.length-1)==="\\"){continue}if(bV===b3){b3=[]}if(bC.preFilter[bW]){bT=bC.preFilter[bW](bT,bV,b1,b3,bR,bU);if(!bT){e=b2=true}else{if(bT===true){continue}}}if(bT){for(var bS=0;(b0=bV[bS])!=null;bS++){if(b0){b2=bO(b0,bT,bS,bV);var bZ=bR^!!b2;if(b1&&b2!=null){if(bZ){e=true}else{bV[bS]=false}}else{if(bZ){b3.push(b0);e=true}}}}}if(b2!==L){if(!b1){bV=b3}bY=bY.replace(bC.match[bW],"");if(!e){return[]}break}}}if(bY===bP){if(e==null){bx.error(bY)}else{break}}bP=bY}return bV};bx.error=function(e){throw"Syntax error, unrecognized expression: "+e};var bC=bx.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bT,bO){var bQ=typeof bO==="string",bS=bQ&&!bN.test(bO),bU=bQ&&!bS;if(bS){bO=bO.toLowerCase()}for(var bP=0,e=bT.length,bR;bP<e;bP++){if((bR=bT[bP])){while((bR=bR.previousSibling)&&bR.nodeType!==1){}bT[bP]=bU||bR&&bR.nodeName.toLowerCase()===bO?bR||false:bR===bO}}if(bU){bx.filter(bO,bT,true)}},">":function(bT,bO){var bS,bR=typeof bO==="string",bP=0,e=bT.length;if(bR&&!bN.test(bO)){bO=bO.toLowerCase();for(;bP<e;bP++){bS=bT[bP];if(bS){var bQ=bS.parentNode;bT[bP]=bQ.nodeName.toLowerCase()===bO?bQ:false}}}else{for(;bP<e;bP++){bS=bT[bP];if(bS){bT[bP]=bR?bS.parentNode:bS.parentNode===bO}}if(bR){bx.filter(bO,bT,true)}}},"":function(bQ,bO,bS){var bR,bP=bG++,e=bL;if(typeof bO==="string"&&!bN.test(bO)){bO=bO.toLowerCase();bR=bO;e=bv}e("parentNode",bO,bP,bQ,bR,bS)},"~":function(bQ,bO,bS){var bR,bP=bG++,e=bL;if(typeof bO==="string"&&!bN.test(bO)){bO=bO.toLowerCase();bR=bO;e=bv}e("previousSibling",bO,bP,bQ,bR,bS)}},find:{ID:function(bO,bP,bQ){if(typeof bP.getElementById!=="undefined"&&!bQ){var e=bP.getElementById(bO[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bP,bS){if(typeof bS.getElementsByName!=="undefined"){var bO=[],bR=bS.getElementsByName(bP[1]);for(var bQ=0,e=bR.length;bQ<e;bQ++){if(bR[bQ].getAttribute("name")===bP[1]){bO.push(bR[bQ])}}return bO.length===0?null:bO}},TAG:function(e,bO){if(typeof bO.getElementsByTagName!=="undefined"){return bO.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bQ,bO,bP,e,bT,bU){bQ=" "+bQ[1].replace(bH,"")+" ";if(bU){return bQ}for(var bR=0,bS;(bS=bO[bR])!=null;bR++){if(bS){if(bT^(bS.className&&(" "+bS.className+" ").replace(/[\t\n\r]/g," ").indexOf(bQ)>=0)){if(!bP){e.push(bS)}}else{if(bP){bO[bR]=false}}}}return false},ID:function(e){return e[1].replace(bH,"")},TAG:function(bO,e){return bO[1].replace(bH,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){bx.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bO=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bO[1]+(bO[2]||1))-0;e[3]=bO[3]-0}else{if(e[2]){bx.error(e[0])}}e[0]=bG++;return e},ATTR:function(bR,bO,bP,e,bS,bT){var bQ=bR[1]=bR[1].replace(bH,"");if(!bT&&bC.attrMap[bQ]){bR[1]=bC.attrMap[bQ]}bR[4]=(bR[4]||bR[5]||"").replace(bH,"");if(bR[2]==="~="){bR[4]=" "+bR[4]+" "}return bR},PSEUDO:function(bR,bO,bP,e,bS){if(bR[1]==="not"){if((bF.exec(bR[3])||"").length>1||/^\w/.test(bR[3])){bR[3]=bx(bR[3],null,null,bO)}else{var bQ=bx.filter(bR[3],bO,bP,true^bS);if(!bP){e.push.apply(e,bQ)}return false}}else{if(bC.match.POS.test(bR[0])||bC.match.CHILD.test(bR[0])){return true}}return bR},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bP,bO,e){return !!bx(e[3],bP).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bP){var e=bP.getAttribute("type"),bO=bP.type;return bP.nodeName.toLowerCase()==="input"&&"text"===bO&&(e===bO||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bO){var e=bO.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bO.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bO){var e=bO.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bO.type},button:function(bO){var e=bO.nodeName.toLowerCase();return e==="input"&&"button"===bO.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bO,e){return e===0},last:function(bP,bO,e,bQ){return bO===bQ.length-1},even:function(bO,e){return e%2===0},odd:function(bO,e){return e%2===1},lt:function(bP,bO,e){return bO<e[3]-0},gt:function(bP,bO,e){return bO>e[3]-0},nth:function(bP,bO,e){return e[3]-0===bO},eq:function(bP,bO,e){return e[3]-0===bO}},filter:{PSEUDO:function(bP,bU,bT,bV){var e=bU[1],bO=bC.filters[e];if(bO){return bO(bP,bT,bU,bV)}else{if(e==="contains"){return(bP.textContent||bP.innerText||bx.getText([bP])||"").indexOf(bU[3])>=0}else{if(e==="not"){var bQ=bU[3];for(var bS=0,bR=bQ.length;bS<bR;bS++){if(bQ[bS]===bP){return false}}return true}else{bx.error(e)}}}},CHILD:function(e,bQ){var bT=bQ[1],bO=e;switch(bT){case"only":case"first":while((bO=bO.previousSibling)){if(bO.nodeType===1){return false}}if(bT==="first"){return true}bO=e;case"last":while((bO=bO.nextSibling)){if(bO.nodeType===1){return false}}return true;case"nth":var bP=bQ[2],bW=bQ[3];if(bP===1&&bW===0){return true}var bS=bQ[0],bV=e.parentNode;if(bV&&(bV.sizcache!==bS||!e.nodeIndex)){var bR=0;for(bO=bV.firstChild;bO;bO=bO.nextSibling){if(bO.nodeType===1){bO.nodeIndex=++bR}}bV.sizcache=bS}var bU=e.nodeIndex-bW;if(bP===0){return bU===0}else{return(bU%bP===0&&bU/bP>=0)}}},ID:function(bO,e){return bO.nodeType===1&&bO.getAttribute("id")===e},TAG:function(bO,e){return(e==="*"&&bO.nodeType===1)||bO.nodeName.toLowerCase()===e},CLASS:function(bO,e){return(" "+(bO.className||bO.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bS,bQ){var bP=bQ[1],e=bC.attrHandle[bP]?bC.attrHandle[bP](bS):bS[bP]!=null?bS[bP]:bS.getAttribute(bP),bT=e+"",bR=bQ[2],bO=bQ[4];return e==null?bR==="!=":bR==="="?bT===bO:bR==="*="?bT.indexOf(bO)>=0:bR==="~="?(" "+bT+" ").indexOf(bO)>=0:!bO?bT&&e!==false:bR==="!="?bT!==bO:bR==="^="?bT.indexOf(bO)===0:bR==="$="?bT.substr(bT.length-bO.length)===bO:bR==="|="?bT===bO||bT.substr(0,bO.length+1)===bO+"-":false},POS:function(bR,bO,bP,bS){var e=bO[2],bQ=bC.setFilters[e];if(bQ){return bQ(bR,bP,bO,bS)}}}};var bB=bC.match.POS,bw=function(bO,e){return"\\"+(e-0+1)};for(var by in bC.match){bC.match[by]=new RegExp(bC.match[by].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bC.leftMatch[by]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bC.match[by].source.replace(/\\(\d+)/g,bw))}var bD=function(bO,e){bO=Array.prototype.slice.call(bO,0);if(e){e.push.apply(e,bO);return e}return bO};try{Array.prototype.slice.call(ar.documentElement.childNodes,0)[0].nodeType}catch(bM){bD=function(bR,bQ){var bP=0,bO=bQ||[];if(bJ.call(bR)==="[object Array]"){Array.prototype.push.apply(bO,bR)}else{if(typeof bR.length==="number"){for(var e=bR.length;bP<e;bP++){bO.push(bR[bP])}}else{for(;bR[bP];bP++){bO.push(bR[bP])}}}return bO}}var bI,bE;if(ar.documentElement.compareDocumentPosition){bI=function(bO,e){if(bO===e){bA=true;return 0}if(!bO.compareDocumentPosition||!e.compareDocumentPosition){return bO.compareDocumentPosition?-1:1}return bO.compareDocumentPosition(e)&4?-1:1}}else{bI=function(bV,bU){if(bV===bU){bA=true;return 0}else{if(bV.sourceIndex&&bU.sourceIndex){return bV.sourceIndex-bU.sourceIndex}}var bS,bO,bP=[],e=[],bR=bV.parentNode,bT=bU.parentNode,bW=bR;if(bR===bT){return bE(bV,bU)}else{if(!bR){return -1}else{if(!bT){return 1}}}while(bW){bP.unshift(bW);bW=bW.parentNode}bW=bT;while(bW){e.unshift(bW);bW=bW.parentNode}bS=bP.length;bO=e.length;for(var bQ=0;bQ<bS&&bQ<bO;bQ++){if(bP[bQ]!==e[bQ]){return bE(bP[bQ],e[bQ])}}return bQ===bS?bE(bV,e[bQ],-1):bE(bP[bQ],bU,1)};bE=function(bO,e,bP){if(bO===e){return bP}var bQ=bO.nextSibling;while(bQ){if(bQ===e){return -1}bQ=bQ.nextSibling}return 1}}bx.getText=function(e){var bO="",bQ;for(var bP=0;e[bP];bP++){bQ=e[bP];if(bQ.nodeType===3||bQ.nodeType===4){bO+=bQ.nodeValue}else{if(bQ.nodeType!==8){bO+=bx.getText(bQ.childNodes)}}}return bO};(function(){var bO=ar.createElement("div"),bP="script"+(new Date()).getTime(),e=ar.documentElement;bO.innerHTML="<a name='"+bP+"'/>";e.insertBefore(bO,e.firstChild);if(ar.getElementById(bP)){bC.find.ID=function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var bQ=bS.getElementById(bR[1]);return bQ?bQ.id===bR[1]||typeof bQ.getAttributeNode!=="undefined"&&bQ.getAttributeNode("id").nodeValue===bR[1]?[bQ]:L:[]}};bC.filter.ID=function(bS,bQ){var bR=typeof bS.getAttributeNode!=="undefined"&&bS.getAttributeNode("id");return bS.nodeType===1&&bR&&bR.nodeValue===bQ}}e.removeChild(bO);e=bO=null})();(function(){var e=ar.createElement("div");e.appendChild(ar.createComment(""));if(e.getElementsByTagName("*").length>0){bC.find.TAG=function(bO,bS){var bR=bS.getElementsByTagName(bO[1]);if(bO[1]==="*"){var bQ=[];for(var bP=0;bR[bP];bP++){if(bR[bP].nodeType===1){bQ.push(bR[bP])}}bR=bQ}return bR}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bC.attrHandle.href=function(bO){return bO.getAttribute("href",2)}}e=null})();if(ar.querySelectorAll){(function(){var e=bx,bQ=ar.createElement("div"),bP="__sizzle__";bQ.innerHTML="<p class='TEST'></p>";if(bQ.querySelectorAll&&bQ.querySelectorAll(".TEST").length===0){return}bx=function(b1,bS,bW,b0){bS=bS||ar;if(!b0&&!bx.isXML(bS)){var bZ=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b1);if(bZ&&(bS.nodeType===1||bS.nodeType===9)){if(bZ[1]){return bD(bS.getElementsByTagName(b1),bW)}else{if(bZ[2]&&bC.find.CLASS&&bS.getElementsByClassName){return bD(bS.getElementsByClassName(bZ[2]),bW)}}}if(bS.nodeType===9){if(b1==="body"&&bS.body){return bD([bS.body],bW)}else{if(bZ&&bZ[3]){var bV=bS.getElementById(bZ[3]);if(bV&&bV.parentNode){if(bV.id===bZ[3]){return bD([bV],bW)}}else{return bD([],bW)}}}try{return bD(bS.querySelectorAll(b1),bW)}catch(bX){}}else{if(bS.nodeType===1&&bS.nodeName.toLowerCase()!=="object"){var bT=bS,bU=bS.getAttribute("id"),bR=bU||bP,b3=bS.parentNode,b2=/^\s*[+~]/.test(b1);if(!bU){bS.setAttribute("id",bR)}else{bR=bR.replace(/'/g,"\\$&")}if(b2&&b3){bS=bS.parentNode}try{if(!b2||b3){return bD(bS.querySelectorAll("[id='"+bR+"'] "+b1),bW)}}catch(bY){}finally{if(!bU){bT.removeAttribute("id")}}}}}return e(b1,bS,bW,b0)};for(var bO in e){bx[bO]=e[bO]}bQ=null})()}(function(){var e=ar.documentElement,bP=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bP){var bR=!bP.call(ar.createElement("div"),"div"),bO=false;try{bP.call(ar.documentElement,"[test!='']:sizzle")}catch(bQ){bO=true}bx.matchesSelector=function(bT,bV){bV=bV.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!bx.isXML(bT)){try{if(bO||!bC.match.PSEUDO.test(bV)&&!/!=/.test(bV)){var bS=bP.call(bT,bV);if(bS||!bR||bT.document&&bT.document.nodeType!==11){return bS}}}catch(bU){}}return bx(bV,null,null,[bT]).length>0}}})();(function(){var e=ar.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bC.order.splice(1,0,"CLASS");bC.find.CLASS=function(bO,bP,bQ){if(typeof bP.getElementsByClassName!=="undefined"&&!bQ){return bP.getElementsByClassName(bO[1])}};e=null})();function bv(bO,bT,bS,bW,bU,bV){for(var bQ=0,bP=bW.length;bQ<bP;bQ++){var e=bW[bQ];if(e){var bR=false;e=e[bO];while(e){if(e.sizcache===bS){bR=bW[e.sizset];break}if(e.nodeType===1&&!bV){e.sizcache=bS;e.sizset=bQ}if(e.nodeName.toLowerCase()===bT){bR=e;break}e=e[bO]}bW[bQ]=bR}}}function bL(bO,bT,bS,bW,bU,bV){for(var bQ=0,bP=bW.length;bQ<bP;bQ++){var e=bW[bQ];if(e){var bR=false;e=e[bO];while(e){if(e.sizcache===bS){bR=bW[e.sizset];break}if(e.nodeType===1){if(!bV){e.sizcache=bS;e.sizset=bQ}if(typeof bT!=="string"){if(e===bT){bR=true;break}}else{if(bx.filter(bT,[e]).length>0){bR=e;break}}}e=e[bO]}bW[bQ]=bR}}}if(ar.documentElement.contains){bx.contains=function(bO,e){return bO!==e&&(bO.contains?bO.contains(e):true)}}else{if(ar.documentElement.compareDocumentPosition){bx.contains=function(bO,e){return !!(bO.compareDocumentPosition(e)&16)}}else{bx.contains=function(){return false}}}bx.isXML=function(e){var bO=(e?e.ownerDocument||e:0).documentElement;return bO?bO.nodeName!=="HTML":false};var bK=function(e,bU){var bS,bQ=[],bR="",bP=bU.nodeType?[bU]:bU;while((bS=bC.match.PSEUDO.exec(e))){bR+=bS[0];e=e.replace(bC.match.PSEUDO,"")}e=bC.relative[e]?e+"*":e;for(var bT=0,bO=bP.length;bT<bO;bT++){bx(e,bP[bT],bQ)}return bx.filter(bR,bQ)};b.find=bx;b.expr=bx.selectors;b.expr[":"]=b.expr.filters;b.unique=bx.uniqueSort;b.text=bx.getText;b.isXMLDoc=bx.isXML;b.contains=bx.contains})();var Z=/Until$/,an=/^(?:parents|prevUntil|prevAll)/,ba=/,/,bq=/^.[^:#\[\.,]*$/,Q=Array.prototype.slice,I=b.expr.match.POS,av={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aC(this,e,false),"not",e)},filter:function(e){return this.pushStack(aC(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(bE,bv){var bB=[],by,bw,bD=this[0];if(b.isArray(bE)){var bA,bx,bz={},e=1;if(bD&&bE.length){for(by=0,bw=bE.length;by<bw;by++){bx=bE[by];if(!bz[bx]){bz[bx]=I.test(bx)?b(bx,bv||this.context):bx}}while(bD&&bD.ownerDocument&&bD!==bv){for(bx in bz){bA=bz[bx];if(bA.jquery?bA.index(bD)>-1:b(bD).is(bA)){bB.push({selector:bx,elem:bD,level:e})}}bD=bD.parentNode;e++}}return bB}var bC=I.test(bE)||typeof bE!=="string"?b(bE,bv||this.context):0;for(by=0,bw=this.length;by<bw;by++){bD=this[by];while(bD){if(bC?bC.index(bD)>-1:b.find.matchesSelector(bD,bE)){bB.push(bD);break}else{bD=bD.parentNode;if(!bD||!bD.ownerDocument||bD===bv||bD.nodeType===11){break}}}}bB=bB.length>1?b.unique(bB):bB;return this.pushStack(bB,"closest",bE)},index:function(e){if(!e||typeof e==="string"){return b.inArray(this[0],e?b(e):this.parent().children())}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(D(bx[0])||D(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function D(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(bz,bw){var by=b.map(this,bv,bz),bx=Q.call(arguments);if(!Z.test(e)){bw=bz}if(bw&&typeof bw==="string"){by=b.filter(bw,by)}by=this.length>1&&!av[e]?b.unique(by):by;if((this.length>1||ba.test(bw))&&an.test(e)){by=by.reverse()}return this.pushStack(by,e,bx.join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aC(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bq.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}var ae=/ jQuery\d+="(?:\d+|null)"/g,ao=/^\s+/,T=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,x=/<tbody/i,W=/<|&#?\w+;/,P=/<(?:script|object|embed|option|style)/i,o=/checked\s*(?:[^=]|=\s*.checked.)/i,bm=/\/(java|ecma)script/i,aL=/^\s*<!(?:\[CDATA\[|\-\-)/,au={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};au.optgroup=au.option;au.tbody=au.tfoot=au.colgroup=au.caption=au.thead;au.th=au.td;if(!b.support.htmlSerialize){au._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||ar).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){return this.each(function(){b(this).wrapAll(e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b(arguments[0]);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b(arguments[0]).toArray());return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ae,""):null}else{if(typeof bx==="string"&&!P.test(bx)&&(b.support.leadingWhitespace||!ao.test(bx))&&!au[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(T,"<$1></$2>");try{for(var bw=0,bv=this.length;bw<bv;bw++){if(this[bw].nodeType===1){b.cleanData(this[bw].getElementsByTagName("*"));this[bw].innerHTML=bx}}}catch(by){this.empty().append(bx)}}else{if(b.isFunction(bx)){this.each(function(bz){var e=b(this);e.html(bx.call(this,bz,e.html()))})}else{this.empty().append(bx)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?bb(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,bp)}}return this}});function bb(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function u(e,bB){if(bB.nodeType!==1||!b.hasData(e)){return}var bA=b.expando,bx=b.data(e),by=b.data(bB,bx);if((bx=bx[bA])){var bC=bx.events;by=by[bA]=b.extend({},bx);if(bC){delete by.handle;by.events={};for(var bz in bC){for(var bw=0,bv=bC[bz].length;bw<bv;bw++){b.event.add(bB,bz+(bC[bz][bw].namespace?".":"")+bC[bz][bw].namespace,bC[bz][bw],bC[bz][bw].data)}}}}}function af(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}}}}e.removeAttribute(b.expando)}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA=(bx&&bx[0]?bx[0].ownerDocument||bx[0]:ar);if(bz.length===1&&typeof bz[0]==="string"&&bz[0].length<512&&bA===ar&&bz[0].charAt(0)==="<"&&!P.test(bz[0])&&(b.support.checkClone||!o.test(bz[0]))){e=true;bw=b.fragments[bz[0]];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bz[0]]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bf(e){if("getElementsByTagName" in e){return e.getElementsByTagName("*")}else{if("querySelectorAll" in e){return e.querySelectorAll("*")}else{return[]}}}function aw(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function F(e){if(b.nodeName(e,"input")){aw(e)}else{if(e.getElementsByTagName){b.grep(e.getElementsByTagName("input"),aw)}}}b.extend({clone:function(by,bA,bw){var bz=by.cloneNode(true),e,bv,bx;if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){af(by,bz);e=bf(by);bv=bf(bz);for(bx=0;e[bx];++bx){af(e[bx],bv[bx])}}if(bA){u(by,bz);if(bw){e=bf(by);bv=bf(bz);for(bx=0;e[bx];++bx){u(e[bx],bv[bx])}}}return bz},clean:function(bw,by,bH,bA){var bF;by=by||ar;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||ar}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(T,"<$1></$2>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=au[bK]||au._default,bD=bx[0],bv=by.createElement("div");bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=x.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]==="<table>"&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ao.test(bz)){bv.insertBefore(by.createTextNode(ao.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB<bG;bB++){F(bz[bB])}}else{F(bz)}}if(bz.nodeType){bI.push(bz)}else{bI=b.merge(bI,bz)}}if(bH){bF=function(bL){return !bL.type||bm.test(bL.type)};for(bE=0;bI[bE];bE++){if(bA&&b.nodeName(bI[bE],"script")&&(!bI[bE].type||bI[bE].type.toLowerCase()==="text/javascript")){bA.push(bI[bE].parentNode?bI[bE].parentNode.removeChild(bI[bE]):bI[bE])}else{if(bI[bE].nodeType===1){var bJ=b.grep(bI[bE].getElementsByTagName("script"),bF);bI.splice.apply(bI,[bE+1,0].concat(bJ))}bH.appendChild(bI[bE])}}}return bI},cleanData:function(bv){var by,bw,e=b.cache,bD=b.expando,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw]&&e[bw][bD];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});function bp(e,bv){if(bv.src){b.ajax({url:bv.src,async:false,dataType:"script"})}else{b.globalEval((bv.text||bv.textContent||bv.innerHTML||"").replace(aL,"/*$0*/"))}if(bv.parentNode){bv.parentNode.removeChild(bv)}}var ai=/alpha\([^)]*\)/i,aq=/opacity=([^)]*)/,aV=/-([a-z])/ig,A=/([A-Z]|^ms)/g,bd=/^-?\d+(?:px)?$/i,bo=/^-?\d/,J=/^[+\-]=/,ah=/[^+\-\.\de]+/g,a7={position:"absolute",visibility:"hidden",display:"block"},ak=["Left","Right"],a1=["Top","Bottom"],X,aG,aU,n=function(e,bv){return bv.toUpperCase()};b.fn.css=function(e,bv){if(arguments.length===2&&bv===L){return this}return b.access(this,e,bv,true,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)})};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=X(bw,"opacity","opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{zIndex:true,fontWeight:true,opacity:true,zoom:true,lineHeight:true,widows:true,orphans:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="number"&&isNaN(bD)||bD==null){return}if(bC==="string"&&J.test(bD)){bD=+bD.replace(ah,"")+parseFloat(b.css(bx,bw))}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(X){return X(by,bx)}}},swap:function(bx,bw,by){var e={};for(var bv in bw){e[bv]=bx.style[bv];bx.style[bv]=bw[bv]}by.call(bx);for(bv in bw){bx.style[bv]=e[bv]}},camelCase:function(e){return e.replace(aV,n)}});b.curCSS=b.css;b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){var bz;if(bx){if(by.offsetWidth!==0){bz=p(by,e,bw)}else{b.swap(by,a7,function(){bz=p(by,e,bw)})}if(bz<=0){bz=X(by,e,e);if(bz==="0px"&&aU){bz=aU(by,e,e)}if(bz!=null){return bz===""||bz==="auto"?"0px":bz}}if(bz<0||bz==null){bz=by.style[e];return bz===""||bz==="auto"?"0px":bz}return typeof bz==="string"?bz:bz+"px"}},set:function(bw,bx){if(bd.test(bx)){bx=parseFloat(bx);if(bx>=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return aq.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle;bx.zoom=1;var e=b.isNaN(bz)?"":"alpha(opacity="+bz*100+")",bw=bv&&bv.filter||bx.filter||"";bx.filter=ai.test(bw)?bw.replace(ai,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=X(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(ar.defaultView&&ar.defaultView.getComputedStyle){aG=function(by,bw){var bv,bx,e;bw=bw.replace(A,"-$1").toLowerCase();if(!(bx=by.ownerDocument.defaultView)){return L}if((e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(ar.documentElement.currentStyle){aU=function(by,bw){var bz,bv=by.currentStyle&&by.currentStyle[bw],e=by.runtimeStyle&&by.runtimeStyle[bw],bx=by.style;if(!bd.test(bv)&&bo.test(bv)){bz=bx.left;if(e){by.runtimeStyle.left=by.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bz;if(e){by.runtimeStyle.left=e}}return bv===""?"auto":bv}}X=aG||aU;function p(bw,bv,e){var by=bv==="width"?ak:a1,bx=bv==="width"?bw.offsetWidth:bw.offsetHeight;if(e==="border"){return bx}b.each(by,function(){if(!e){bx-=parseFloat(b.css(bw,"padding"+this))||0}if(e==="margin"){bx+=parseFloat(b.css(bw,"margin"+this))||0}else{bx-=parseFloat(b.css(bw,"border"+this+"Width"))||0}});return bx}if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&(bw.style.display||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}var j=/%20/g,am=/\[\]$/,bt=/\r?\n/g,br=/#.*$/,aA=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aY=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,aN=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a6=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,r=/^(?:select|textarea)/i,h=/\s+/,bs=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,B=b.fn.load,Y={},s={},aB,t;try{aB=bl.href}catch(at){aB=ar.createElement("a");aB.href="";aB=aB.href}t=K.exec(aB.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aS(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===Y),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aS(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aS(bv,bE,bz,bD,"*",bx)}return bC}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&B){return B.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||r.test(this.nodeName)||aY.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bt,"\r\n")}}):{name:bv.name,value:bw.replace(bt,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.bind(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bw,e){if(!e){e=bw;bw=b.extend(true,b.ajaxSettings,e)}else{b.extend(true,bw,b.ajaxSettings,e)}for(var bv in {context:1,url:1}){if(bv in e){bw[bv]=e[bv]}else{if(bv in b.ajaxSettings){bw[bv]=b.ajaxSettings[bv]}}}return bw},ajaxSettings:{url:aB,isLocal:aK.test(t[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bc.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML}},ajaxPrefilter:f(Y),ajaxTransport:f(s),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b._Deferred(),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aA.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bY,bW,bZ,bV){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bV||"";bJ.readyState=bY?4:0;var bT,b3,b2,bX=bZ?bj(bD,bJ,bZ):L,bU,b1;if(bY>=200&&bY<300||bY===304){if(bD.ifModified){if((bU=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bU}if((b1=bJ.getResponseHeader("Etag"))){b.etag[bC]=b1}}if(bY===304){bW="notmodified";bT=true}else{try{b3=G(bD,bX);bW="success";bT=true}catch(b0){bW="parsererror";b2=b0}}}else{b2=bW;if(!bW||bY){bW="error";if(bY<0){bY=0}}}bJ.status=bY;bJ.statusText=bW;if(bT){bR.resolveWith(bS,[b3,bW,bJ])}else{bR.rejectWith(bS,[bJ,bW,b2])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b3:b2])}bN.resolveWith(bS,[bJ,bW]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.done;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(br,"").replace(c,t[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=t[1]||bI[2]!=t[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(t[3]||(t[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aS(Y,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aN.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(bs,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", */*; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aS(s,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(status<2){bF(-1,bM)}else{b.error(bM)}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){w(bx,e[bx],bw,by)}}return bv.join("&").replace(j,"+")}});function w(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||am.test(bw)){bx(bw,bz)}else{w(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){w(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var az=b.now(),v=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(az++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=bD.contentType==="application/x-www-form-urlencoded"&&(typeof bD.data==="string");if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(v.test(bD.url)||bx&&v.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bc[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(v,bv);if(bD.url===e){if(bx){by=by.replace(v,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bc[bw]=function(bE){bB=[bE]};bC.always(function(){bc[bw]=bz;if(bB&&b.isFunction(bz)){bc[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=ar.head||ar.getElementsByTagName("head")[0]||ar.documentElement;return{send:function(bx,by){e=ar.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var C=bc.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,z=0,N;function aJ(){try{return new bc.XMLHttpRequest()}catch(bv){}}function ag(){try{return new bc.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bc.ActiveXObject?function(){return !this.isLocal&&aJ()||ag()}:aJ;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(C){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}bI.text=bA.responseText;try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++z;if(C){if(!N){N={};b(bc).unload(C)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var R={},a9,m,ay=/^(?:toggle|show|hide)$/,aP=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a2,aF=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a4,S=bc.webkitRequestAnimationFrame||bc.mozRequestAnimationFrame||bc.oRequestAnimationFrame;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a0("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if(by===""&&b.css(bw,"display")==="none"){b._data(bw,"olddisplay",y(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bw,bz,by){if(bw||bw===0){return this.animate(a0("hide",3),bw,bz,by)}else{for(var bv=0,e=this.length;bv<e;bv++){if(this[bv].style){var bx=b.css(this[bv],"display");if(bx!=="none"&&!b._data(this[bv],"olddisplay")){b._data(this[bv],"olddisplay",bx)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a0("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(by,bv,bx,bw){var e=b.speed(bv,bx,bw);if(b.isEmptyObject(by)){return this.each(e.complete,[false])}by=b.extend({},by);return this[e.queue===false?"each":"queue"](function(){if(e.queue===false){b._mark(this)}var bC=b.extend({},e),bJ=this.nodeType===1,bG=bJ&&b(this).is(":hidden"),bz,bD,bB,bI,bH,bF,bA,bE,bK;bC.animatedProperties={};for(bB in by){bz=b.camelCase(bB);if(bB!==bz){by[bz]=by[bB];delete by[bB]}bD=by[bz];if(b.isArray(bD)){bC.animatedProperties[bz]=bD[1];bD=by[bz]=bD[0]}else{bC.animatedProperties[bz]=bC.specialEasing&&bC.specialEasing[bz]||bC.easing||"swing"}if(bD==="hide"&&bG||bD==="show"&&!bG){return bC.complete.call(this)}if(bJ&&(bz==="height"||bz==="width")){bC.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout){this.style.display="inline-block"}else{bI=y(this.nodeName);if(bI==="inline"){this.style.display="inline-block"}else{this.style.display="inline";this.style.zoom=1}}}}}if(bC.overflow!=null){this.style.overflow="hidden"}for(bB in by){bH=new b.fx(this,bC,bB);bD=by[bB];if(ay.test(bD)){bH[bD==="toggle"?bG?"show":"hide":bD]()}else{bF=aP.exec(bD);bA=bH.cur();if(bF){bE=parseFloat(bF[2]);bK=bF[3]||(b.cssNumber[bB]?"":"px");if(bK!=="px"){b.style(this,bB,(bE||1)+bK);bA=((bE||1)/bH.cur())*bA;b.style(this,bB,bA+bK)}if(bF[1]){bE=((bF[1]==="-="?-1:1)*bE)+bA}bH.custom(bA,bE,bK)}else{bH.custom(bA,bD,"")}}}return true})},stop:function(bv,e){if(bv){this.queue([])}this.each(function(){var bx=b.timers,bw=bx.length;if(!e){b._unmark(true,this)}while(bw--){if(bx[bw].elem===this){if(e){bx[bw](true)}bx.splice(bw,1)}}});if(!e){this.dequeue()}return this}});function bg(){setTimeout(ap,0);return(a4=b.now())}function ap(){a4=L}function a0(bv,e){var bw={};b.each(aF.concat.apply([],aF.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a0("show",1),slideUp:a0("hide",1),slideToggle:a0("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;e.old=e.complete;e.complete=function(by){if(e.queue!==false){b.dequeue(this)}else{if(by!==false){b._unmark(this)}}if(b.isFunction(e.old)){e.old.call(this)}};return e},easing:{linear:function(bw,bx,e,bv){return e+bv*bw},swing:function(bw,bx,e,bv){return((-Math.cos(bw*Math.PI)/2)+0.5)*bv+e}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bA,bz,bx){var e=this,bw=b.fx,by;this.startTime=a4||bg();this.start=bA;this.end=bz;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");this.now=this.start;this.pos=this.state=0;function bv(bB){return e.step(bB)}bv.elem=this.elem;if(bv()&&b.timers.push(bv)&&!a2){if(S){a2=1;by=function(){if(a2){S(by);bw.tick()}};S(by)}else{a2=setInterval(bw.tick,bw.interval)}}},show:function(){this.options.orig[this.prop]=b.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bx=a4||bg(),e=true,bz=this.elem,bv=this.options,bw,bB;if(by||bx>=bv.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bv.animatedProperties[this.prop]=true;for(bw in bv.animatedProperties){if(bv.animatedProperties[bw]!==true){e=false}}if(e){if(bv.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bv.overflow[bC]})}if(bv.hide){b(bz).hide()}if(bv.hide||bv.show){for(var bA in bv.animatedProperties){b.style(bz,bA,bv.orig[bA])}}bv.complete.call(bz)}return false}else{if(bv.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bv.duration;this.pos=b.easing[bv.animatedProperties[this.prop]](this.state,bB,0,1,bv.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){for(var bv=b.timers,e=0;e<bv.length;++e){if(!bv[e]()){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a2);a2=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=(e.prop==="width"||e.prop==="height"?Math.max(0,e.now):e.now)+e.unit}else{e.elem[e.prop]=e.now}}}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function y(bw){if(!R[bw]){var e=b("<"+bw+">").appendTo("body"),bv=e.css("display");e.remove();if(bv==="none"||bv===""){if(!a9){a9=ar.createElement("iframe");a9.frameBorder=a9.width=a9.height=0}ar.body.appendChild(a9);if(!m||!a9.createElement){m=(a9.contentWindow||a9.contentDocument).document;m.write("<!doctype><html><body></body></html>")}e=m.createElement(bw);m.body.appendChild(e);bv=b.css(e,"display");ar.body.removeChild(a9)}R[bw]=bv}return R[bw]}var V=/^t(?:able|d|h)$/i,ab=/^(?:body|html)$/i;if("getBoundingClientRect" in ar.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aI(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}b.offset.initialize();var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.offset.supportsFixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.offset.doesNotAddBorder&&!(b.offset.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.offset.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.offset.supportsFixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={initialize:function(){var e=ar.body,bv=ar.createElement("div"),by,bA,bz,bB,bw=parseFloat(b.css(e,"marginTop"))||0,bx="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";b.extend(bv.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});bv.innerHTML=bx;e.insertBefore(bv,e.firstChild);by=bv.firstChild;bA=by.firstChild;bB=by.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(bA.offsetTop!==5);this.doesAddBorderForTableAndCells=(bB.offsetTop===5);bA.style.position="fixed";bA.style.top="20px";this.supportsFixedPosition=(bA.offsetTop===20||bA.offsetTop===15);bA.style.position=bA.style.top="";by.style.overflow="hidden";by.style.position="relative";this.subtractsBorderForOverflowNotVisible=(bA.offsetTop===-5);this.doesNotIncludeMarginInBodyOffset=(e.offsetTop!==bw);e.removeChild(bv);b.offset.initialize=b.noop},bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;b.offset.initialize();if(b.offset.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ab.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||ar.body;while(e&&(!ab.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aI(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aI(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aI(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){return this[0]?parseFloat(b.css(this[0],bw,"padding")):null};b.fn["outer"+e]=function(bx){return this[0]?parseFloat(b.css(this[0],bw,bx?"margin":"border")):null};b.fn[bw]=function(by){var bz=this[0];if(!bz){return by==null?null:this}if(b.isFunction(by)){return this.each(function(bD){var bC=b(this);bC[bw](by.call(this,bD,bC[bw]()))})}if(b.isWindow(bz)){var bA=bz.document.documentElement["client"+e];return bz.document.compatMode==="CSS1Compat"&&bA||bz.document.body["client"+e]||bA}else{if(bz.nodeType===9){return Math.max(bz.documentElement["client"+e],bz.body["scroll"+e],bz.documentElement["scroll"+e],bz.body["offset"+e],bz.documentElement["offset"+e])}else{if(by===L){var bB=b.css(bz,bw),bx=parseFloat(bB);return b.isNaN(bx)?bB:bx}else{return this.css(bw,typeof by==="string"?by:by+"px")}}}}});bc.jQuery=bc.$=b})(window);
\ No newline at end of file
+(function(){var bC=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bD=0,bG=Object.prototype.toString,bx=false,bw=true,bE=/\\/g,bK=/\W/;[0,0].sort(function(){bw=false;return 0});var bu=function(bP,e,bS,bT){bS=bS||[];e=e||aq;var bV=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bP||typeof bP!=="string"){return bS}var bM,bX,b0,bL,bW,bZ,bY,bR,bO=true,bN=bu.isXML(e),bQ=[],bU=bP;do{bC.exec("");bM=bC.exec(bU);if(bM){bU=bM[3];bQ.push(bM[1]);if(bM[2]){bL=bM[3];break}}}while(bM);if(bQ.length>1&&by.exec(bP)){if(bQ.length===2&&bz.relative[bQ[0]]){bX=bH(bQ[0]+bQ[1],e)}else{bX=bz.relative[bQ[0]]?[e]:bu(bQ.shift(),e);while(bQ.length){bP=bQ.shift();if(bz.relative[bP]){bP+=bQ.shift()}bX=bH(bP,bX)}}}else{if(!bT&&bQ.length>1&&e.nodeType===9&&!bN&&bz.match.ID.test(bQ[0])&&!bz.match.ID.test(bQ[bQ.length-1])){bW=bu.find(bQ.shift(),e,bN);e=bW.expr?bu.filter(bW.expr,bW.set)[0]:bW.set[0]}if(e){bW=bT?{expr:bQ.pop(),set:bA(bT)}:bu.find(bQ.pop(),bQ.length===1&&(bQ[0]==="~"||bQ[0]==="+")&&e.parentNode?e.parentNode:e,bN);bX=bW.expr?bu.filter(bW.expr,bW.set):bW.set;if(bQ.length>0){b0=bA(bX)}else{bO=false}while(bQ.length){bZ=bQ.pop();bY=bZ;if(!bz.relative[bZ]){bZ=""}else{bY=bQ.pop()}if(bY==null){bY=e}bz.relative[bZ](b0,bY,bN)}}else{b0=bQ=[]}}if(!b0){b0=bX}if(!b0){bu.error(bZ||bP)}if(bG.call(b0)==="[object Array]"){if(!bO){bS.push.apply(bS,b0)}else{if(e&&e.nodeType===1){for(bR=0;b0[bR]!=null;bR++){if(b0[bR]&&(b0[bR]===true||b0[bR].nodeType===1&&bu.contains(e,b0[bR]))){bS.push(bX[bR])}}}else{for(bR=0;b0[bR]!=null;bR++){if(b0[bR]&&b0[bR].nodeType===1){bS.push(bX[bR])}}}}}else{bA(b0,bS)}if(bL){bu(bL,bV,bS,bT);bu.uniqueSort(bS)}return bS};bu.uniqueSort=function(bL){if(bF){bx=bw;bL.sort(bF);if(bx){for(var e=1;e<bL.length;e++){if(bL[e]===bL[e-1]){bL.splice(e--,1)}}}}return bL};bu.matches=function(e,bL){return bu(e,null,null,bL)};bu.matchesSelector=function(e,bL){return bu(bL,null,null,[e]).length>0};bu.find=function(bR,e,bS){var bQ;if(!bR){return[]}for(var bN=0,bM=bz.order.length;bN<bM;bN++){var bO,bP=bz.order[bN];if((bO=bz.leftMatch[bP].exec(bR))){var bL=bO[1];bO.splice(1,1);if(bL.substr(bL.length-1)!=="\\"){bO[1]=(bO[1]||"").replace(bE,"");bQ=bz.find[bP](bO,e,bS);if(bQ!=null){bR=bR.replace(bz.match[bP],"");break}}}}if(!bQ){bQ=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bQ,expr:bR}};bu.filter=function(bV,bU,bY,bO){var bQ,e,bM=bV,b0=[],bS=bU,bR=bU&&bU[0]&&bu.isXML(bU[0]);while(bV&&bU.length){for(var bT in bz.filter){if((bQ=bz.leftMatch[bT].exec(bV))!=null&&bQ[2]){var bZ,bX,bL=bz.filter[bT],bN=bQ[1];e=false;bQ.splice(1,1);if(bN.substr(bN.length-1)==="\\"){continue}if(bS===b0){b0=[]}if(bz.preFilter[bT]){bQ=bz.preFilter[bT](bQ,bS,bY,b0,bO,bR);if(!bQ){e=bZ=true}else{if(bQ===true){continue}}}if(bQ){for(var bP=0;(bX=bS[bP])!=null;bP++){if(bX){bZ=bL(bX,bQ,bP,bS);var bW=bO^!!bZ;if(bY&&bZ!=null){if(bW){e=true}else{bS[bP]=false}}else{if(bW){b0.push(bX);e=true}}}}}if(bZ!==K){if(!bY){bS=b0}bV=bV.replace(bz.match[bT],"");if(!e){return[]}break}}}if(bV===bM){if(e==null){bu.error(bV)}else{break}}bM=bV}return bS};bu.error=function(e){throw"Syntax error, unrecognized expression: "+e};var bz=bu.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bQ,bL){var bN=typeof bL==="string",bP=bN&&!bK.test(bL),bR=bN&&!bP;if(bP){bL=bL.toLowerCase()}for(var bM=0,e=bQ.length,bO;bM<e;bM++){if((bO=bQ[bM])){while((bO=bO.previousSibling)&&bO.nodeType!==1){}bQ[bM]=bR||bO&&bO.nodeName.toLowerCase()===bL?bO||false:bO===bL}}if(bR){bu.filter(bL,bQ,true)}},">":function(bQ,bL){var bP,bO=typeof bL==="string",bM=0,e=bQ.length;if(bO&&!bK.test(bL)){bL=bL.toLowerCase();for(;bM<e;bM++){bP=bQ[bM];if(bP){var bN=bP.parentNode;bQ[bM]=bN.nodeName.toLowerCase()===bL?bN:false}}}else{for(;bM<e;bM++){bP=bQ[bM];if(bP){bQ[bM]=bO?bP.parentNode:bP.parentNode===bL}}if(bO){bu.filter(bL,bQ,true)}}},"":function(bN,bL,bP){var bO,bM=bD++,e=bI;if(typeof bL==="string"&&!bK.test(bL)){bL=bL.toLowerCase();bO=bL;e=bs}e("parentNode",bL,bM,bN,bO,bP)},"~":function(bN,bL,bP){var bO,bM=bD++,e=bI;if(typeof bL==="string"&&!bK.test(bL)){bL=bL.toLowerCase();bO=bL;e=bs}e("previousSibling",bL,bM,bN,bO,bP)}},find:{ID:function(bL,bM,bN){if(typeof bM.getElementById!=="undefined"&&!bN){var e=bM.getElementById(bL[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bM,bP){if(typeof bP.getElementsByName!=="undefined"){var bL=[],bO=bP.getElementsByName(bM[1]);for(var bN=0,e=bO.length;bN<e;bN++){if(bO[bN].getAttribute("name")===bM[1]){bL.push(bO[bN])}}return bL.length===0?null:bL}},TAG:function(e,bL){if(typeof bL.getElementsByTagName!=="undefined"){return bL.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bN,bL,bM,e,bQ,bR){bN=" "+bN[1].replace(bE,"")+" ";if(bR){return bN}for(var bO=0,bP;(bP=bL[bO])!=null;bO++){if(bP){if(bQ^(bP.className&&(" "+bP.className+" ").replace(/[\t\n\r]/g," ").indexOf(bN)>=0)){if(!bM){e.push(bP)}}else{if(bM){bL[bO]=false}}}}return false},ID:function(e){return e[1].replace(bE,"")},TAG:function(bL,e){return bL[1].replace(bE,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){bu.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bL=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bL[1]+(bL[2]||1))-0;e[3]=bL[3]-0}else{if(e[2]){bu.error(e[0])}}e[0]=bD++;return e},ATTR:function(bO,bL,bM,e,bP,bQ){var bN=bO[1]=bO[1].replace(bE,"");if(!bQ&&bz.attrMap[bN]){bO[1]=bz.attrMap[bN]}bO[4]=(bO[4]||bO[5]||"").replace(bE,"");if(bO[2]==="~="){bO[4]=" "+bO[4]+" "}return bO},PSEUDO:function(bO,bL,bM,e,bP){if(bO[1]==="not"){if((bC.exec(bO[3])||"").length>1||/^\w/.test(bO[3])){bO[3]=bu(bO[3],null,null,bL)}else{var bN=bu.filter(bO[3],bL,bM,true^bP);if(!bM){e.push.apply(e,bN)}return false}}else{if(bz.match.POS.test(bO[0])||bz.match.CHILD.test(bO[0])){return true}}return bO},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bM,bL,e){return !!bu(e[3],bM).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bM){var e=bM.getAttribute("type"),bL=bM.type;return bM.nodeName.toLowerCase()==="input"&&"text"===bL&&(e===bL||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bL){var e=bL.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bL.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bL){var e=bL.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bL.type},button:function(bL){var e=bL.nodeName.toLowerCase();return e==="input"&&"button"===bL.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bL,e){return e===0},last:function(bM,bL,e,bN){return bL===bN.length-1},even:function(bL,e){return e%2===0},odd:function(bL,e){return e%2===1},lt:function(bM,bL,e){return bL<e[3]-0},gt:function(bM,bL,e){return bL>e[3]-0},nth:function(bM,bL,e){return e[3]-0===bL},eq:function(bM,bL,e){return e[3]-0===bL}},filter:{PSEUDO:function(bM,bR,bQ,bS){var e=bR[1],bL=bz.filters[e];if(bL){return bL(bM,bQ,bR,bS)}else{if(e==="contains"){return(bM.textContent||bM.innerText||bu.getText([bM])||"").indexOf(bR[3])>=0}else{if(e==="not"){var bN=bR[3];for(var bP=0,bO=bN.length;bP<bO;bP++){if(bN[bP]===bM){return false}}return true}else{bu.error(e)}}}},CHILD:function(e,bN){var bQ=bN[1],bL=e;switch(bQ){case"only":case"first":while((bL=bL.previousSibling)){if(bL.nodeType===1){return false}}if(bQ==="first"){return true}bL=e;case"last":while((bL=bL.nextSibling)){if(bL.nodeType===1){return false}}return true;case"nth":var bM=bN[2],bT=bN[3];if(bM===1&&bT===0){return true}var bP=bN[0],bS=e.parentNode;if(bS&&(bS.sizcache!==bP||!e.nodeIndex)){var bO=0;for(bL=bS.firstChild;bL;bL=bL.nextSibling){if(bL.nodeType===1){bL.nodeIndex=++bO}}bS.sizcache=bP}var bR=e.nodeIndex-bT;if(bM===0){return bR===0}else{return(bR%bM===0&&bR/bM>=0)}}},ID:function(bL,e){return bL.nodeType===1&&bL.getAttribute("id")===e},TAG:function(bL,e){return(e==="*"&&bL.nodeType===1)||bL.nodeName.toLowerCase()===e},CLASS:function(bL,e){return(" "+(bL.className||bL.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bP,bN){var bM=bN[1],e=bz.attrHandle[bM]?bz.attrHandle[bM](bP):bP[bM]!=null?bP[bM]:bP.getAttribute(bM),bQ=e+"",bO=bN[2],bL=bN[4];return e==null?bO==="!=":bO==="="?bQ===bL:bO==="*="?bQ.indexOf(bL)>=0:bO==="~="?(" "+bQ+" ").indexOf(bL)>=0:!bL?bQ&&e!==false:bO==="!="?bQ!==bL:bO==="^="?bQ.indexOf(bL)===0:bO==="$="?bQ.substr(bQ.length-bL.length)===bL:bO==="|="?bQ===bL||bQ.substr(0,bL.length+1)===bL+"-":false},POS:function(bO,bL,bM,bP){var e=bL[2],bN=bz.setFilters[e];if(bN){return bN(bO,bM,bL,bP)}}}};var by=bz.match.POS,bt=function(bL,e){return"\\"+(e-0+1)};for(var bv in bz.match){bz.match[bv]=new RegExp(bz.match[bv].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bz.leftMatch[bv]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bz.match[bv].source.replace(/\\(\d+)/g,bt))}var bA=function(bL,e){bL=Array.prototype.slice.call(bL,0);if(e){e.push.apply(e,bL);return e}return bL};try{Array.prototype.slice.call(aq.documentElement.childNodes,0)[0].nodeType}catch(bJ){bA=function(bO,bN){var bM=0,bL=bN||[];if(bG.call(bO)==="[object Array]"){Array.prototype.push.apply(bL,bO)}else{if(typeof bO.length==="number"){for(var e=bO.length;bM<e;bM++){bL.push(bO[bM])}}else{for(;bO[bM];bM++){bL.push(bO[bM])}}}return bL}}var bF,bB;if(aq.documentElement.compareDocumentPosition){bF=function(bL,e){if(bL===e){bx=true;return 0}if(!bL.compareDocumentPosition||!e.compareDocumentPosition){return bL.compareDocumentPosition?-1:1}return bL.compareDocumentPosition(e)&4?-1:1}}else{bF=function(bS,bR){if(bS===bR){bx=true;return 0}else{if(bS.sourceIndex&&bR.sourceIndex){return bS.sourceIndex-bR.sourceIndex}}var bP,bL,bM=[],e=[],bO=bS.parentNode,bQ=bR.parentNode,bT=bO;if(bO===bQ){return bB(bS,bR)}else{if(!bO){return -1}else{if(!bQ){return 1}}}while(bT){bM.unshift(bT);bT=bT.parentNode}bT=bQ;while(bT){e.unshift(bT);bT=bT.parentNode}bP=bM.length;bL=e.length;for(var bN=0;bN<bP&&bN<bL;bN++){if(bM[bN]!==e[bN]){return bB(bM[bN],e[bN])}}return bN===bP?bB(bS,e[bN],-1):bB(bM[bN],bR,1)};bB=function(bL,e,bM){if(bL===e){return bM}var bN=bL.nextSibling;while(bN){if(bN===e){return -1}bN=bN.nextSibling}return 1}}bu.getText=function(e){var bL="",bN;for(var bM=0;e[bM];bM++){bN=e[bM];if(bN.nodeType===3||bN.nodeType===4){bL+=bN.nodeValue}else{if(bN.nodeType!==8){bL+=bu.getText(bN.childNodes)}}}return bL};(function(){var bL=aq.createElement("div"),bM="script"+(new Date()).getTime(),e=aq.documentElement;bL.innerHTML="<a name='"+bM+"'/>";e.insertBefore(bL,e.firstChild);if(aq.getElementById(bM)){bz.find.ID=function(bO,bP,bQ){if(typeof bP.getElementById!=="undefined"&&!bQ){var bN=bP.getElementById(bO[1]);return bN?bN.id===bO[1]||typeof bN.getAttributeNode!=="undefined"&&bN.getAttributeNode("id").nodeValue===bO[1]?[bN]:K:[]}};bz.filter.ID=function(bP,bN){var bO=typeof bP.getAttributeNode!=="undefined"&&bP.getAttributeNode("id");return bP.nodeType===1&&bO&&bO.nodeValue===bN}}e.removeChild(bL);e=bL=null})();(function(){var e=aq.createElement("div");e.appendChild(aq.createComment(""));if(e.getElementsByTagName("*").length>0){bz.find.TAG=function(bL,bP){var bO=bP.getElementsByTagName(bL[1]);if(bL[1]==="*"){var bN=[];for(var bM=0;bO[bM];bM++){if(bO[bM].nodeType===1){bN.push(bO[bM])}}bO=bN}return bO}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bz.attrHandle.href=function(bL){return bL.getAttribute("href",2)}}e=null})();if(aq.querySelectorAll){(function(){var e=bu,bN=aq.createElement("div"),bM="__sizzle__";bN.innerHTML="<p class='TEST'></p>";if(bN.querySelectorAll&&bN.querySelectorAll(".TEST").length===0){return}bu=function(bY,bP,bT,bX){bP=bP||aq;if(!bX&&!bu.isXML(bP)){var bW=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(bY);if(bW&&(bP.nodeType===1||bP.nodeType===9)){if(bW[1]){return bA(bP.getElementsByTagName(bY),bT)}else{if(bW[2]&&bz.find.CLASS&&bP.getElementsByClassName){return bA(bP.getElementsByClassName(bW[2]),bT)}}}if(bP.nodeType===9){if(bY==="body"&&bP.body){return bA([bP.body],bT)}else{if(bW&&bW[3]){var bS=bP.getElementById(bW[3]);if(bS&&bS.parentNode){if(bS.id===bW[3]){return bA([bS],bT)}}else{return bA([],bT)}}}try{return bA(bP.querySelectorAll(bY),bT)}catch(bU){}}else{if(bP.nodeType===1&&bP.nodeName.toLowerCase()!=="object"){var bQ=bP,bR=bP.getAttribute("id"),bO=bR||bM,b0=bP.parentNode,bZ=/^\s*[+~]/.test(bY);if(!bR){bP.setAttribute("id",bO)}else{bO=bO.replace(/'/g,"\\$&")}if(bZ&&b0){bP=bP.parentNode}try{if(!bZ||b0){return bA(bP.querySelectorAll("[id='"+bO+"'] "+bY),bT)}}catch(bV){}finally{if(!bR){bQ.removeAttribute("id")}}}}}return e(bY,bP,bT,bX)};for(var bL in e){bu[bL]=e[bL]}bN=null})()}(function(){var e=aq.documentElement,bM=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bM){var bO=!bM.call(aq.createElement("div"),"div"),bL=false;try{bM.call(aq.documentElement,"[test!='']:sizzle")}catch(bN){bL=true}bu.matchesSelector=function(bQ,bS){bS=bS.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!bu.isXML(bQ)){try{if(bL||!bz.match.PSEUDO.test(bS)&&!/!=/.test(bS)){var bP=bM.call(bQ,bS);if(bP||!bO||bQ.document&&bQ.document.nodeType!==11){return bP}}}catch(bR){}}return bu(bS,null,null,[bQ]).length>0}}})();(function(){var e=aq.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bz.order.splice(1,0,"CLASS");bz.find.CLASS=function(bL,bM,bN){if(typeof bM.getElementsByClassName!=="undefined"&&!bN){return bM.getElementsByClassName(bL[1])}};e=null})();function bs(bL,bQ,bP,bT,bR,bS){for(var bN=0,bM=bT.length;bN<bM;bN++){var e=bT[bN];if(e){var bO=false;e=e[bL];while(e){if(e.sizcache===bP){bO=bT[e.sizset];break}if(e.nodeType===1&&!bS){e.sizcache=bP;e.sizset=bN}if(e.nodeName.toLowerCase()===bQ){bO=e;break}e=e[bL]}bT[bN]=bO}}}function bI(bL,bQ,bP,bT,bR,bS){for(var bN=0,bM=bT.length;bN<bM;bN++){var e=bT[bN];if(e){var bO=false;e=e[bL];while(e){if(e.sizcache===bP){bO=bT[e.sizset];break}if(e.nodeType===1){if(!bS){e.sizcache=bP;e.sizset=bN}if(typeof bQ!=="string"){if(e===bQ){bO=true;break}}else{if(bu.filter(bQ,[e]).length>0){bO=e;break}}}e=e[bL]}bT[bN]=bO}}}if(aq.documentElement.contains){bu.contains=function(bL,e){return bL!==e&&(bL.contains?bL.contains(e):true)}}else{if(aq.documentElement.compareDocumentPosition){bu.contains=function(bL,e){return !!(bL.compareDocumentPosition(e)&16)}}else{bu.contains=function(){return false}}}bu.isXML=function(e){var bL=(e?e.ownerDocument||e:0).documentElement;return bL?bL.nodeName!=="HTML":false};var bH=function(e,bR){var bP,bN=[],bO="",bM=bR.nodeType?[bR]:bR;while((bP=bz.match.PSEUDO.exec(e))){bO+=bP[0];e=e.replace(bz.match.PSEUDO,"")}e=bz.relative[e]?e+"*":e;for(var bQ=0,bL=bM.length;bQ<bL;bQ++){bu(e,bM[bQ],bN)}return bu.filter(bO,bN)};b.find=bu;b.expr=bu.selectors;b.expr[":"]=b.expr.filters;b.unique=bu.uniqueSort;b.text=bu.getText;b.isXMLDoc=bu.isXML;b.contains=bu.contains})();var Y=/Until$/,am=/^(?:parents|prevUntil|prevAll)/,a7=/,/,bn=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.POS,au={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bt=this,bv,bs;if(typeof e!=="string"){return b(e).filter(function(){for(bv=0,bs=bt.length;bv<bs;bv++){if(b.contains(bt[bv],this)){return true}}})}var bu=this.pushStack("","find",e),bx,by,bw;for(bv=0,bs=this.length;bv<bs;bv++){bx=bu.length;b.find(e,this[bv],bu);if(bv>0){for(by=bx;by<bu.length;by++){for(bw=0;bw<bx;bw++){if(bu[bw]===bu[by]){bu.splice(by--,1);break}}}}}return bu},has:function(bs){var e=b(bs);return this.filter(function(){for(var bu=0,bt=e.length;bu<bt;bu++){if(b.contains(this,e[bu])){return true}}})},not:function(e){return this.pushStack(aB(this,e,false),"not",e)},filter:function(e){return this.pushStack(aB(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(bB,bs){var by=[],bv,bt,bA=this[0];if(b.isArray(bB)){var bx,bu,bw={},e=1;if(bA&&bB.length){for(bv=0,bt=bB.length;bv<bt;bv++){bu=bB[bv];if(!bw[bu]){bw[bu]=H.test(bu)?b(bu,bs||this.context):bu}}while(bA&&bA.ownerDocument&&bA!==bs){for(bu in bw){bx=bw[bu];if(bx.jquery?bx.index(bA)>-1:b(bA).is(bx)){by.push({selector:bu,elem:bA,level:e})}}bA=bA.parentNode;e++}}return by}var bz=H.test(bB)||typeof bB!=="string"?b(bB,bs||this.context):0;for(bv=0,bt=this.length;bv<bt;bv++){bA=this[bv];while(bA){if(bz?bz.index(bA)>-1:b.find.matchesSelector(bA,bB)){by.push(bA);break}else{bA=bA.parentNode;if(!bA||!bA.ownerDocument||bA===bs||bA.nodeType===11){break}}}}by=by.length>1?b.unique(by):by;return this.pushStack(by,"closest",bB)},index:function(e){if(!e||typeof e==="string"){return b.inArray(this[0],e?b(e):this.parent().children())}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bs){var bu=typeof e==="string"?b(e,bs):b.makeArray(e&&e.nodeType?[e]:e),bt=b.merge(this.get(),bu);return this.pushStack(C(bu[0])||C(bt[0])?bt:b.unique(bt))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bs){var e=bs.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bs,e,bt){return b.dir(bs,"parentNode",bt)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bs,e,bt){return b.dir(bs,"nextSibling",bt)},prevUntil:function(bs,e,bt){return b.dir(bs,"previousSibling",bt)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bs){b.fn[e]=function(bw,bt){var bv=b.map(this,bs,bw),bu=P.call(arguments);if(!Y.test(e)){bt=bw}if(bt&&typeof bt==="string"){bv=b.filter(bt,bv)}bv=this.length>1&&!au[e]?b.unique(bv):bv;if((this.length>1||a7.test(bt))&&am.test(e)){bv=bv.reverse()}return this.pushStack(bv,e,bu.join(","))}});b.extend({filter:function(bt,e,bs){if(bs){bt=":not("+bt+")"}return e.length===1?b.find.matchesSelector(e[0],bt)?[e[0]]:[]:b.find.matches(bt,e)},dir:function(bt,bs,bv){var e=[],bu=bt[bs];while(bu&&bu.nodeType!==9&&(bv===K||bu.nodeType!==1||!b(bu).is(bv))){if(bu.nodeType===1){e.push(bu)}bu=bu[bs]}return e},nth:function(bv,e,bt,bu){e=e||1;var bs=0;for(;bv;bv=bv[bt]){if(bv.nodeType===1&&++bs===e){break}}return bv},sibling:function(bt,bs){var e=[];for(;bt;bt=bt.nextSibling){if(bt.nodeType===1&&bt!==bs){e.push(bt)}}return e}});function aB(bu,bt,e){bt=bt||0;if(b.isFunction(bt)){return b.grep(bu,function(bw,bv){var bx=!!bt.call(bw,bv,bw);return bx===e})}else{if(bt.nodeType){return b.grep(bu,function(bw,bv){return(bw===bt)===e})}else{if(typeof bt==="string"){var bs=b.grep(bu,function(bv){return bv.nodeType===1});if(bn.test(bt)){return b.filter(bt,bs,!e)}else{bt=b.filter(bt,bs)}}}}return b.grep(bu,function(bw,bv){return(b.inArray(bw,bt)>=0)===e})}var ad=/ jQuery\d+="(?:\d+|null)"/g,an=/^\s+/,S=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/<tbody/i,V=/<|&#?\w+;/,O=/<(?:script|object|embed|option|style)/i,n=/checked\s*(?:[^=]|=\s*.checked.)/i,bj=/\/(java|ecma)script/i,aJ=/^\s*<!(?:\[CDATA\[|\-\-)/,at={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};at.optgroup=at.option;at.tbody=at.tfoot=at.colgroup=at.caption=at.thead;at.th=at.td;if(!b.support.htmlSerialize){at._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bt){var bs=b(this);bs.text(e.call(this,bt,bs.text()))})}if(typeof e!=="object"&&e!==K){return this.empty().append((this[0]&&this[0].ownerDocument||aq).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bt){b(this).wrapAll(e.call(this,bt))})}if(this[0]){var bs=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bs.insertBefore(this[0])}bs.map(function(){var bt=this;while(bt.firstChild&&bt.firstChild.nodeType===1){bt=bt.firstChild}return bt}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bs){b(this).wrapInner(e.call(this,bs))})}return this.each(function(){var bs=b(this),bt=bs.contents();if(bt.length){bt.wrapAll(e)}else{bs.append(e)}})},wrap:function(e){return this.each(function(){b(this).wrapAll(e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bs){this.parentNode.insertBefore(bs,this)})}else{if(arguments.length){var e=b(arguments[0]);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bs){this.parentNode.insertBefore(bs,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b(arguments[0]).toArray());return e}}},remove:function(e,bu){for(var bs=0,bt;(bt=this[bs])!=null;bs++){if(!e||b.filter(e,[bt]).length){if(!bu&&bt.nodeType===1){b.cleanData(bt.getElementsByTagName("*"));b.cleanData([bt])}if(bt.parentNode){bt.parentNode.removeChild(bt)}}}return this},empty:function(){for(var e=0,bs;(bs=this[e])!=null;e++){if(bs.nodeType===1){b.cleanData(bs.getElementsByTagName("*"))}while(bs.firstChild){bs.removeChild(bs.firstChild)}}return this},clone:function(bs,e){bs=bs==null?false:bs;e=e==null?bs:e;return this.map(function(){return b.clone(this,bs,e)})},html:function(bu){if(bu===K){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ad,""):null}else{if(typeof bu==="string"&&!O.test(bu)&&(b.support.leadingWhitespace||!an.test(bu))&&!at[(d.exec(bu)||["",""])[1].toLowerCase()]){bu=bu.replace(S,"<$1></$2>");try{for(var bt=0,bs=this.length;bt<bs;bt++){if(this[bt].nodeType===1){b.cleanData(this[bt].getElementsByTagName("*"));this[bt].innerHTML=bu}}}catch(bv){this.empty().append(bu)}}else{if(b.isFunction(bu)){this.each(function(bw){var e=b(this);e.html(bu.call(this,bw,e.html()))})}else{this.empty().append(bu)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bu){var bt=b(this),bs=bt.html();bt.replaceWith(e.call(this,bu,bs))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bt=this.nextSibling,bs=this.parentNode;b(this).remove();if(bt){b(bt).before(e)}else{b(bs).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(by,bC,bB){var bu,bv,bx,bA,bz=by[0],bs=[];if(!b.support.checkClone&&arguments.length===3&&typeof bz==="string"&&n.test(bz)){return this.each(function(){b(this).domManip(by,bC,bB,true)})}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);by[0]=bz.call(this,bE,bC?bD.html():K);bD.domManip(by,bC,bB)})}if(this[0]){bA=bz&&bz.parentNode;if(b.support.parentNode&&bA&&bA.nodeType===11&&bA.childNodes.length===this.length){bu={fragment:bA}}else{bu=b.buildFragment(by,this,bs)}bx=bu.fragment;if(bx.childNodes.length===1){bv=bx=bx.firstChild}else{bv=bx.firstChild}if(bv){bC=bC&&b.nodeName(bv,"tr");for(var bt=0,e=this.length,bw=e-1;bt<e;bt++){bB.call(bC?a8(this[bt],bv):this[bt],bu.cacheable||(e>1&&bt<bw)?b.clone(bx,true,true):bx)}}if(bs.length){b.each(bs,bm)}}return this}});function a8(e,bs){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function t(e,by){if(by.nodeType!==1||!b.hasData(e)){return}var bx=b.expando,bu=b.data(e),bv=b.data(by,bu);if((bu=bu[bx])){var bz=bu.events;bv=bv[bx]=b.extend({},bu);if(bz){delete bv.handle;bv.events={};for(var bw in bz){for(var bt=0,bs=bz[bw].length;bt<bs;bt++){b.event.add(by,bw+(bz[bw][bt].namespace?".":"")+bz[bw][bt].namespace,bz[bw][bt],bz[bw][bt].data)}}}}}function ae(bs,e){var bt;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bs)}bt=e.nodeName.toLowerCase();if(bt==="object"){e.outerHTML=bs.outerHTML}else{if(bt==="input"&&(bs.type==="checkbox"||bs.type==="radio")){if(bs.checked){e.defaultChecked=e.checked=bs.checked}if(e.value!==bs.value){e.value=bs.value}}else{if(bt==="option"){e.selected=bs.defaultSelected}else{if(bt==="input"||bt==="textarea"){e.defaultValue=bs.defaultValue}}}}e.removeAttribute(b.expando)}b.buildFragment=function(bw,bu,bs){var bv,e,bt,bx;if(bu&&bu[0]){bx=bu[0].ownerDocument||bu[0]}if(!bx.createDocumentFragment){bx=aq}if(bw.length===1&&typeof bw[0]==="string"&&bw[0].length<512&&bx===aq&&bw[0].charAt(0)==="<"&&!O.test(bw[0])&&(b.support.checkClone||!n.test(bw[0]))){e=true;bt=b.fragments[bw[0]];if(bt&&bt!==1){bv=bt}}if(!bv){bv=bx.createDocumentFragment();b.clean(bw,bx,bv,bs)}if(e){b.fragments[bw[0]]=bt?bv:1}return{fragment:bv,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bs){b.fn[e]=function(bt){var bw=[],bz=b(bt),by=this.length===1&&this[0].parentNode;if(by&&by.nodeType===11&&by.childNodes.length===1&&bz.length===1){bz[bs](this[0]);return this}else{for(var bx=0,bu=bz.length;bx<bu;bx++){var bv=(bx>0?this.clone(true):this).get();b(bz[bx])[bs](bv);bw=bw.concat(bv)}return this.pushStack(bw,e,bz.selector)}}});function bc(e){if("getElementsByTagName" in e){return e.getElementsByTagName("*")}else{if("querySelectorAll" in e){return e.querySelectorAll("*")}else{return[]}}}function av(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){if(b.nodeName(e,"input")){av(e)}else{if("getElementsByTagName" in e){b.grep(e.getElementsByTagName("input"),av)}}}b.extend({clone:function(bv,bx,bt){var bw=bv.cloneNode(true),e,bs,bu;if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(bv.nodeType===1||bv.nodeType===11)&&!b.isXMLDoc(bv)){ae(bv,bw);e=bc(bv);bs=bc(bw);for(bu=0;e[bu];++bu){ae(e[bu],bs[bu])}}if(bx){t(bv,bw);if(bt){e=bc(bv);bs=bc(bw);for(bu=0;e[bu];++bu){t(e[bu],bs[bu])}}}e=bs=null;return bw},clean:function(bt,bv,bE,bx){var bC;bv=bv||aq;if(typeof bv.createElement==="undefined"){bv=bv.ownerDocument||bv[0]&&bv[0].ownerDocument||aq}var bF=[],by;for(var bB=0,bw;(bw=bt[bB])!=null;bB++){if(typeof bw==="number"){bw+=""}if(!bw){continue}if(typeof bw==="string"){if(!V.test(bw)){bw=bv.createTextNode(bw)}else{bw=bw.replace(S,"<$1></$2>");var bH=(d.exec(bw)||["",""])[1].toLowerCase(),bu=at[bH]||at._default,bA=bu[0],bs=bv.createElement("div");bs.innerHTML=bu[1]+bw+bu[2];while(bA--){bs=bs.lastChild}if(!b.support.tbody){var e=w.test(bw),bz=bH==="table"&&!e?bs.firstChild&&bs.firstChild.childNodes:bu[1]==="<table>"&&!e?bs.childNodes:[];for(by=bz.length-1;by>=0;--by){if(b.nodeName(bz[by],"tbody")&&!bz[by].childNodes.length){bz[by].parentNode.removeChild(bz[by])}}}if(!b.support.leadingWhitespace&&an.test(bw)){bs.insertBefore(bv.createTextNode(an.exec(bw)[0]),bs.firstChild)}bw=bs.childNodes}}var bD;if(!b.support.appendChecked){if(bw[0]&&typeof(bD=bw.length)==="number"){for(by=0;by<bD;by++){E(bw[by])}}else{E(bw)}}if(bw.nodeType){bF.push(bw)}else{bF=b.merge(bF,bw)}}if(bE){bC=function(bI){return !bI.type||bj.test(bI.type)};for(bB=0;bF[bB];bB++){if(bx&&b.nodeName(bF[bB],"script")&&(!bF[bB].type||bF[bB].type.toLowerCase()==="text/javascript")){bx.push(bF[bB].parentNode?bF[bB].parentNode.removeChild(bF[bB]):bF[bB])}else{if(bF[bB].nodeType===1){var bG=b.grep(bF[bB].getElementsByTagName("script"),bC);bF.splice.apply(bF,[bB+1,0].concat(bG))}bE.appendChild(bF[bB])}}}return bF},cleanData:function(bs){var bv,bt,e=b.cache,bA=b.expando,by=b.event.special,bx=b.support.deleteExpando;for(var bw=0,bu;(bu=bs[bw])!=null;bw++){if(bu.nodeName&&b.noData[bu.nodeName.toLowerCase()]){continue}bt=bu[b.expando];if(bt){bv=e[bt]&&e[bt][bA];if(bv&&bv.events){for(var bz in bv.events){if(by[bz]){b.event.remove(bu,bz)}else{b.removeEvent(bu,bz,bv.handle)}}if(bv.handle){bv.handle.elem=null}}if(bx){delete bu[b.expando]}else{if(bu.removeAttribute){bu.removeAttribute(b.expando)}}delete e[bt]}}}});function bm(e,bs){if(bs.src){b.ajax({url:bs.src,async:false,dataType:"script"})}else{b.globalEval((bs.text||bs.textContent||bs.innerHTML||"").replace(aJ,"/*$0*/"))}if(bs.parentNode){bs.parentNode.removeChild(bs)}}var ah=/alpha\([^)]*\)/i,ap=/opacity=([^)]*)/,z=/([A-Z]|^ms)/g,ba=/^-?\d+(?:px)?$/i,bl=/^-?\d/,I=/^[+\-]=/,ag=/[^+\-\.\de]+/g,a4={position:"absolute",visibility:"hidden",display:"block"},aj=["Left","Right"],aY=["Top","Bottom"],W,aE,aS;b.fn.css=function(e,bs){if(arguments.length===2&&bs===K){return this}return b.access(this,e,bs,true,function(bu,bt,bv){return bv!==K?b.style(bu,bt,bv):b.css(bu,bt)})};b.extend({cssHooks:{opacity:{get:function(bt,bs){if(bs){var e=W(bt,"opacity","opacity");return e===""?"1":e}else{return bt.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bu,bt,bA,bv){if(!bu||bu.nodeType===3||bu.nodeType===8||!bu.style){return}var by,bz,bw=b.camelCase(bt),bs=bu.style,bB=b.cssHooks[bw];bt=b.cssProps[bw]||bw;if(bA!==K){bz=typeof bA;if(bz==="number"&&isNaN(bA)||bA==null){return}if(bz==="string"&&I.test(bA)){bA=+bA.replace(ag,"")+parseFloat(b.css(bu,bt));bz="number"}if(bz==="number"&&!b.cssNumber[bw]){bA+="px"}if(!bB||!("set" in bB)||(bA=bB.set(bu,bA))!==K){try{bs[bt]=bA}catch(bx){}}}else{if(bB&&"get" in bB&&(by=bB.get(bu,false,bv))!==K){return by}return bs[bt]}},css:function(bv,bu,bs){var bt,e;bu=b.camelCase(bu);e=b.cssHooks[bu];bu=b.cssProps[bu]||bu;if(bu==="cssFloat"){bu="float"}if(e&&"get" in e&&(bt=e.get(bv,true,bs))!==K){return bt}else{if(W){return W(bv,bu)}}},swap:function(bu,bt,bv){var e={};for(var bs in bt){e[bs]=bu.style[bs];bu.style[bs]=bt[bs]}bv.call(bu);for(bs in bt){bu.style[bs]=e[bs]}}});b.curCSS=b.css;b.each(["height","width"],function(bs,e){b.cssHooks[e]={get:function(bv,bu,bt){var bw;if(bu){if(bv.offsetWidth!==0){return o(bv,e,bt)}else{b.swap(bv,a4,function(){bw=o(bv,e,bt)})}return bw}},set:function(bt,bu){if(ba.test(bu)){bu=parseFloat(bu);if(bu>=0){return bu+"px"}}else{return bu}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bs,e){return ap.test((e&&bs.currentStyle?bs.currentStyle.filter:bs.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(bv,bw){var bu=bv.style,bs=bv.currentStyle;bu.zoom=1;var e=b.isNaN(bw)?"":"alpha(opacity="+bw*100+")",bt=bs&&bs.filter||bu.filter||"";bu.filter=ah.test(bt)?bt.replace(ah,e):bt+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bt,bs){var e;b.swap(bt,{display:"inline-block"},function(){if(bs){e=W(bt,"margin-right","marginRight")}else{e=bt.style.marginRight}});return e}}}});if(aq.defaultView&&aq.defaultView.getComputedStyle){aE=function(bv,bt){var bs,bu,e;bt=bt.replace(z,"-$1").toLowerCase();if(!(bu=bv.ownerDocument.defaultView)){return K}if((e=bu.getComputedStyle(bv,null))){bs=e.getPropertyValue(bt);if(bs===""&&!b.contains(bv.ownerDocument.documentElement,bv)){bs=b.style(bv,bt)}}return bs}}if(aq.documentElement.currentStyle){aS=function(bv,bt){var bw,bs=bv.currentStyle&&bv.currentStyle[bt],e=bv.runtimeStyle&&bv.runtimeStyle[bt],bu=bv.style;if(!ba.test(bs)&&bl.test(bs)){bw=bu.left;if(e){bv.runtimeStyle.left=bv.currentStyle.left}bu.left=bt==="fontSize"?"1em":(bs||0);bs=bu.pixelLeft+"px";bu.left=bw;if(e){bv.runtimeStyle.left=e}}return bs===""?"auto":bs}}W=aE||aS;function o(bt,bs,e){var bv=bs==="width"?bt.offsetWidth:bt.offsetHeight,bu=bs==="width"?aj:aY;if(bv>0){if(e!=="border"){b.each(bu,function(){if(!e){bv-=parseFloat(b.css(bt,"padding"+this))||0}if(e==="margin"){bv+=parseFloat(b.css(bt,e+this))||0}else{bv-=parseFloat(b.css(bt,"border"+this+"Width"))||0}})}return bv+"px"}bv=W(bt,bs,bs);if(bv<0||bv==null){bv=bt.style[bs]||0}bv=parseFloat(bv)||0;if(e){b.each(bu,function(){bv+=parseFloat(b.css(bt,"padding"+this))||0;if(e!=="padding"){bv+=parseFloat(b.css(bt,"border"+this+"Width"))||0}if(e==="margin"){bv+=parseFloat(b.css(bt,e+this))||0}})}return bv+"px"}if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bt){var bs=bt.offsetWidth,e=bt.offsetHeight;return(bs===0&&e===0)||(!b.support.reliableHiddenOffsets&&(bt.style.display||b.css(bt,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}var j=/%20/g,al=/\[\]$/,bq=/\r?\n/g,bo=/#.*$/,az=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aV=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aI=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,aL=/^(?:GET|HEAD)$/,c=/^\/\//,L=/\?/,a3=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,bp=/([?&])_=[^&]*/,J=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,X={},r={},aA,s;try{aA=bi.href}catch(ar){aA=aq.createElement("a");aA.href="";aA=aA.href}s=J.exec(aA.toLowerCase())||[];function f(e){return function(bv,bx){if(typeof bv!=="string"){bx=bv;bv="*"}if(b.isFunction(bx)){var bu=bv.toLowerCase().split(h),bt=0,bw=bu.length,bs,by,bz;for(;bt<bw;bt++){bs=bu[bt];bz=/^\+/.test(bs);if(bz){bs=bs.substr(1)||"*"}by=e[bs]=e[bs]||[];by[bz?"unshift":"push"](bx)}}}}function aQ(bs,bB,bw,bA,by,bu){by=by||bB.dataTypes[0];bu=bu||{};bu[by]=true;var bx=bs[by],bt=0,e=bx?bx.length:0,bv=(bs===X),bz;for(;bt<e&&(bv||!bz);bt++){bz=bx[bt](bB,bw,bA);if(typeof bz==="string"){if(!bv||bu[bz]){bz=K}else{bB.dataTypes.unshift(bz);bz=aQ(bs,bB,bw,bA,bz,bu)}}}if((bv||!bz)&&!bu["*"]){bz=aQ(bs,bB,bw,bA,"*",bu)}return bz}b.fn.extend({load:function(bt,bw,bx){if(typeof bt!=="string"&&A){return A.apply(this,arguments)}else{if(!this.length){return this}}var bv=bt.indexOf(" ");if(bv>=0){var e=bt.slice(bv,bt.length);bt=bt.slice(0,bv)}var bu="GET";if(bw){if(b.isFunction(bw)){bx=bw;bw=K}else{if(typeof bw==="object"){bw=b.param(bw,b.ajaxSettings.traditional);bu="POST"}}}var bs=this;b.ajax({url:bt,type:bu,dataType:"html",data:bw,complete:function(bz,by,bA){bA=bz.responseText;if(bz.isResolved()){bz.done(function(bB){bA=bB});bs.html(e?b("<div>").append(bA.replace(a3,"")).find(e):bA)}if(bx){bs.each(bx,[bA,by,bz])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aV.test(this.type))}).map(function(e,bs){var bt=b(this).val();return bt==null?null:b.isArray(bt)?b.map(bt,function(bv,bu){return{name:bs.name,value:bv.replace(bq,"\r\n")}}):{name:bs.name,value:bt.replace(bq,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bs){b.fn[bs]=function(bt){return this.bind(bs,bt)}});b.each(["get","post"],function(e,bs){b[bs]=function(bt,bv,bw,bu){if(b.isFunction(bv)){bu=bu||bw;bw=bv;bv=K}return b.ajax({type:bs,url:bt,data:bv,success:bw,dataType:bu})}});b.extend({getScript:function(e,bs){return b.get(e,K,bs,"script")},getJSON:function(e,bs,bt){return b.get(e,bs,bt,"json")},ajaxSetup:function(bt,e){if(!e){e=bt;bt=b.extend(true,b.ajaxSettings,e)}else{b.extend(true,bt,b.ajaxSettings,e)}for(var bs in {context:1,url:1}){if(bs in e){bt[bs]=e[bs]}else{if(bs in b.ajaxSettings){bt[bs]=b.ajaxSettings[bs]}}}return bt},ajaxSettings:{url:aA,isLocal:aI.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a9.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML}},ajaxPrefilter:f(X),ajaxTransport:f(r),ajax:function(bw,bu){if(typeof bw==="object"){bu=bw;bw=K}bu=bu||{};var bA=b.ajaxSetup({},bu),bP=bA.context||bA,bD=bP!==bA&&(bP.nodeType||bP instanceof b)?b(bP):b.event,bO=b.Deferred(),bK=b._Deferred(),by=bA.statusCode||{},bz,bE={},bL={},bN,bv,bI,bB,bF,bx=0,bt,bH,bG={readyState:0,setRequestHeader:function(bQ,bR){if(!bx){var e=bQ.toLowerCase();bQ=bL[e]=bL[e]||bQ;bE[bQ]=bR}return this},getAllResponseHeaders:function(){return bx===2?bN:null},getResponseHeader:function(bQ){var e;if(bx===2){if(!bv){bv={};while((e=az.exec(bN))){bv[e[1].toLowerCase()]=e[2]}}e=bv[bQ.toLowerCase()]}return e===K?null:e},overrideMimeType:function(e){if(!bx){bA.mimeType=e}return this},abort:function(e){e=e||"abort";if(bI){bI.abort(e)}bC(0,e);return this}};function bC(bV,bT,bW,bS){if(bx===2){return}bx=2;if(bB){clearTimeout(bB)}bI=K;bN=bS||"";bG.readyState=bV?4:0;var bQ,b0,bZ,bU=bW?bg(bA,bG,bW):K,bR,bY;if(bV>=200&&bV<300||bV===304){if(bA.ifModified){if((bR=bG.getResponseHeader("Last-Modified"))){b.lastModified[bz]=bR}if((bY=bG.getResponseHeader("Etag"))){b.etag[bz]=bY}}if(bV===304){bT="notmodified";bQ=true}else{try{b0=F(bA,bU);bT="success";bQ=true}catch(bX){bT="parsererror";bZ=bX}}}else{bZ=bT;if(!bT||bV){bT="error";if(bV<0){bV=0}}}bG.status=bV;bG.statusText=bT;if(bQ){bO.resolveWith(bP,[b0,bT,bG])}else{bO.rejectWith(bP,[bG,bT,bZ])}bG.statusCode(by);by=K;if(bt){bD.trigger("ajax"+(bQ?"Success":"Error"),[bG,bA,bQ?b0:bZ])}bK.resolveWith(bP,[bG,bT]);if(bt){bD.trigger("ajaxComplete",[bG,bA]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bO.promise(bG);bG.success=bG.done;bG.error=bG.fail;bG.complete=bK.done;bG.statusCode=function(bQ){if(bQ){var e;if(bx<2){for(e in bQ){by[e]=[by[e],bQ[e]]}}else{e=bQ[bG.status];bG.then(e,e)}}return this};bA.url=((bw||bA.url)+"").replace(bo,"").replace(c,s[1]+"//");bA.dataTypes=b.trim(bA.dataType||"*").toLowerCase().split(h);if(bA.crossDomain==null){bF=J.exec(bA.url.toLowerCase());bA.crossDomain=!!(bF&&(bF[1]!=s[1]||bF[2]!=s[2]||(bF[3]||(bF[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bA.data&&bA.processData&&typeof bA.data!=="string"){bA.data=b.param(bA.data,bA.traditional)}aQ(X,bA,bu,bG);if(bx===2){return false}bt=bA.global;bA.type=bA.type.toUpperCase();bA.hasContent=!aL.test(bA.type);if(bt&&b.active++===0){b.event.trigger("ajaxStart")}if(!bA.hasContent){if(bA.data){bA.url+=(L.test(bA.url)?"&":"?")+bA.data}bz=bA.url;if(bA.cache===false){var bs=b.now(),bM=bA.url.replace(bp,"$1_="+bs);bA.url=bM+((bM===bA.url)?(L.test(bA.url)?"&":"?")+"_="+bs:"")}}if(bA.data&&bA.hasContent&&bA.contentType!==false||bu.contentType){bG.setRequestHeader("Content-Type",bA.contentType)}if(bA.ifModified){bz=bz||bA.url;if(b.lastModified[bz]){bG.setRequestHeader("If-Modified-Since",b.lastModified[bz])}if(b.etag[bz]){bG.setRequestHeader("If-None-Match",b.etag[bz])}}bG.setRequestHeader("Accept",bA.dataTypes[0]&&bA.accepts[bA.dataTypes[0]]?bA.accepts[bA.dataTypes[0]]+(bA.dataTypes[0]!=="*"?", */*; q=0.01":""):bA.accepts["*"]);for(bH in bA.headers){bG.setRequestHeader(bH,bA.headers[bH])}if(bA.beforeSend&&(bA.beforeSend.call(bP,bG,bA)===false||bx===2)){bG.abort();return false}for(bH in {success:1,error:1,complete:1}){bG[bH](bA[bH])}bI=aQ(r,bA,bu,bG);if(!bI){bC(-1,"No Transport")}else{bG.readyState=1;if(bt){bD.trigger("ajaxSend",[bG,bA])}if(bA.async&&bA.timeout>0){bB=setTimeout(function(){bG.abort("timeout")},bA.timeout)}try{bx=1;bI.send(bE,bC)}catch(bJ){if(status<2){bC(-1,bJ)}else{b.error(bJ)}}}return bG},param:function(e,bt){var bs=[],bv=function(bw,bx){bx=b.isFunction(bx)?bx():bx;bs[bs.length]=encodeURIComponent(bw)+"="+encodeURIComponent(bx)};if(bt===K){bt=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){bv(this.name,this.value)})}else{for(var bu in e){v(bu,e[bu],bt,bv)}}return bs.join("&").replace(j,"+")}});function v(bt,bv,bs,bu){if(b.isArray(bv)){b.each(bv,function(bx,bw){if(bs||al.test(bt)){bu(bt,bw)}else{v(bt+"["+(typeof bw==="object"||b.isArray(bw)?bx:"")+"]",bw,bs,bu)}})}else{if(!bs&&bv!=null&&typeof bv==="object"){for(var e in bv){v(bt+"["+e+"]",bv[e],bs,bu)}}else{bu(bt,bv)}}}b.extend({active:0,lastModified:{},etag:{}});function bg(bA,bz,bw){var bs=bA.contents,by=bA.dataTypes,bt=bA.responseFields,bv,bx,bu,e;for(bx in bt){if(bx in bw){bz[bt[bx]]=bw[bx]}}while(by[0]==="*"){by.shift();if(bv===K){bv=bA.mimeType||bz.getResponseHeader("content-type")}}if(bv){for(bx in bs){if(bs[bx]&&bs[bx].test(bv)){by.unshift(bx);break}}}if(by[0] in bw){bu=by[0]}else{for(bx in bw){if(!by[0]||bA.converters[bx+" "+by[0]]){bu=bx;break}if(!e){e=bx}}bu=bu||e}if(bu){if(bu!==by[0]){by.unshift(bu)}return bw[bu]}}function F(bE,bw){if(bE.dataFilter){bw=bE.dataFilter(bw,bE.dataType)}var bA=bE.dataTypes,bD={},bx,bB,bt=bA.length,by,bz=bA[0],bu,bv,bC,bs,e;for(bx=1;bx<bt;bx++){if(bx===1){for(bB in bE.converters){if(typeof bB==="string"){bD[bB.toLowerCase()]=bE.converters[bB]}}}bu=bz;bz=bA[bx];if(bz==="*"){bz=bu}else{if(bu!=="*"&&bu!==bz){bv=bu+" "+bz;bC=bD[bv]||bD["* "+bz];if(!bC){e=K;for(bs in bD){by=bs.split(" ");if(by[0]===bu||by[0]==="*"){e=bD[by[1]+" "+bz];if(e){bs=bD[bs];if(bs===true){bC=e}else{if(e===true){bC=bs}}break}}}}if(!(bC||e)){b.error("No conversion from "+bv.replace(" "," to "))}if(bC!==true){bw=bC?bC(bw):e(bs(bw))}}}}return bw}var ay=b.now(),u=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(ay++)}});b.ajaxPrefilter("json jsonp",function(bA,bx,bz){var bu=bA.contentType==="application/x-www-form-urlencoded"&&(typeof bA.data==="string");if(bA.dataTypes[0]==="jsonp"||bA.jsonp!==false&&(u.test(bA.url)||bu&&u.test(bA.data))){var by,bt=bA.jsonpCallback=b.isFunction(bA.jsonpCallback)?bA.jsonpCallback():bA.jsonpCallback,bw=a9[bt],e=bA.url,bv=bA.data,bs="$1"+bt+"$2";if(bA.jsonp!==false){e=e.replace(u,bs);if(bA.url===e){if(bu){bv=bv.replace(u,bs)}if(bA.data===bv){e+=(/\?/.test(e)?"&":"?")+bA.jsonp+"="+bt}}}bA.url=e;bA.data=bv;a9[bt]=function(bB){by=[bB]};bz.always(function(){a9[bt]=bw;if(by&&b.isFunction(bw)){a9[bt](by[0])}});bA.converters["script json"]=function(){if(!by){b.error(bt+" was not called")}return by[0]};bA.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===K){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bt){if(bt.crossDomain){var e,bs=aq.head||aq.getElementsByTagName("head")[0]||aq.documentElement;return{send:function(bu,bv){e=aq.createElement("script");e.async="async";if(bt.scriptCharset){e.charset=bt.scriptCharset}e.src=bt.url;e.onload=e.onreadystatechange=function(bx,bw){if(bw||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bs&&e.parentNode){bs.removeChild(e)}e=K;if(!bw){bv(200,"success")}}};bs.insertBefore(e,bs.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var B=a9.ActiveXObject?function(){for(var e in M){M[e](0,1)}}:false,y=0,M;function aH(){try{return new a9.XMLHttpRequest()}catch(bs){}}function af(){try{return new a9.ActiveXObject("Microsoft.XMLHTTP")}catch(bs){}}b.ajaxSettings.xhr=a9.ActiveXObject?function(){return !this.isLocal&&aH()||af()}:aH;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bs;return{send:function(by,bt){var bx=e.xhr(),bw,bv;if(e.username){bx.open(e.type,e.url,e.async,e.username,e.password)}else{bx.open(e.type,e.url,e.async)}if(e.xhrFields){for(bv in e.xhrFields){bx[bv]=e.xhrFields[bv]}}if(e.mimeType&&bx.overrideMimeType){bx.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!by["X-Requested-With"]){by["X-Requested-With"]="XMLHttpRequest"}try{for(bv in by){bx.setRequestHeader(bv,by[bv])}}catch(bu){}bx.send((e.hasContent&&e.data)||null);bs=function(bH,bB){var bC,bA,bz,bF,bE;try{if(bs&&(bB||bx.readyState===4)){bs=K;if(bw){bx.onreadystatechange=b.noop;if(B){delete M[bw]}}if(bB){if(bx.readyState!==4){bx.abort()}}else{bC=bx.status;bz=bx.getAllResponseHeaders();bF={};bE=bx.responseXML;if(bE&&bE.documentElement){bF.xml=bE}bF.text=bx.responseText;try{bA=bx.statusText}catch(bG){bA=""}if(!bC&&e.isLocal&&!e.crossDomain){bC=bF.text?200:404}else{if(bC===1223){bC=204}}}}}catch(bD){if(!bB){bt(-1,bD)}}if(bF){bt(bC,bA,bF,bz)}};if(!e.async||bx.readyState===4){bs()}else{bw=++y;if(B){if(!M){M={};b(a9).unload(B)}M[bw]=bs}bx.onreadystatechange=bs}},abort:function(){if(bs){bs(0,1)}}}}})}var Q={},a6,m,ax=/^(?:toggle|show|hide)$/,aN=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,aZ,aD=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a1,R=a9.webkitRequestAnimationFrame||a9.mozRequestAnimationFrame||a9.oRequestAnimationFrame;b.fn.extend({show:function(bu,bx,bw){var bt,bv;if(bu||bu===0){return this.animate(aX("show",3),bu,bx,bw)}else{for(var bs=0,e=this.length;bs<e;bs++){bt=this[bs];if(bt.style){bv=bt.style.display;if(!b._data(bt,"olddisplay")&&bv==="none"){bv=bt.style.display=""}if(bv===""&&b.css(bt,"display")==="none"){b._data(bt,"olddisplay",x(bt.nodeName))}}}for(bs=0;bs<e;bs++){bt=this[bs];if(bt.style){bv=bt.style.display;if(bv===""||bv==="none"){bt.style.display=b._data(bt,"olddisplay")||""}}}return this}},hide:function(bt,bw,bv){if(bt||bt===0){return this.animate(aX("hide",3),bt,bw,bv)}else{for(var bs=0,e=this.length;bs<e;bs++){if(this[bs].style){var bu=b.css(this[bs],"display");if(bu!=="none"&&!b._data(this[bs],"olddisplay")){b._data(this[bs],"olddisplay",bu)}}}for(bs=0;bs<e;bs++){if(this[bs].style){this[bs].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bt,bs,bu){var e=typeof bt==="boolean";if(b.isFunction(bt)&&b.isFunction(bs)){this._toggle.apply(this,arguments)}else{if(bt==null||e){this.each(function(){var bv=e?bt:b(this).is(":hidden");b(this)[bv?"show":"hide"]()})}else{this.animate(aX("toggle",3),bt,bs,bu)}}return this},fadeTo:function(e,bu,bt,bs){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bu},e,bt,bs)},animate:function(bv,bs,bu,bt){var e=b.speed(bs,bu,bt);if(b.isEmptyObject(bv)){return this.each(e.complete,[false])}bv=b.extend({},bv);return this[e.queue===false?"each":"queue"](function(){if(e.queue===false){b._mark(this)}var bz=b.extend({},e),bG=this.nodeType===1,bD=bG&&b(this).is(":hidden"),bw,bA,by,bF,bE,bC,bx,bB,bH;bz.animatedProperties={};for(by in bv){bw=b.camelCase(by);if(by!==bw){bv[bw]=bv[by];delete bv[by]}bA=bv[bw];if(b.isArray(bA)){bz.animatedProperties[bw]=bA[1];bA=bv[bw]=bA[0]}else{bz.animatedProperties[bw]=bz.specialEasing&&bz.specialEasing[bw]||bz.easing||"swing"}if(bA==="hide"&&bD||bA==="show"&&!bD){return bz.complete.call(this)}if(bG&&(bw==="height"||bw==="width")){bz.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout){this.style.display="inline-block"}else{bF=x(this.nodeName);if(bF==="inline"){this.style.display="inline-block"}else{this.style.display="inline";this.style.zoom=1}}}}}if(bz.overflow!=null){this.style.overflow="hidden"}for(by in bv){bE=new b.fx(this,bz,by);bA=bv[by];if(ax.test(bA)){bE[bA==="toggle"?bD?"show":"hide":bA]()}else{bC=aN.exec(bA);bx=bE.cur();if(bC){bB=parseFloat(bC[2]);bH=bC[3]||(b.cssNumber[by]?"":"px");if(bH!=="px"){b.style(this,by,(bB||1)+bH);bx=((bB||1)/bE.cur())*bx;b.style(this,by,bx+bH)}if(bC[1]){bB=((bC[1]==="-="?-1:1)*bB)+bx}bE.custom(bx,bB,bH)}else{bE.custom(bx,bA,"")}}}return true})},stop:function(bs,e){if(bs){this.queue([])}this.each(function(){var bu=b.timers,bt=bu.length;if(!e){b._unmark(true,this)}while(bt--){if(bu[bt].elem===this){if(e){bu[bt](true)}bu.splice(bt,1)}}});if(!e){this.dequeue()}return this}});function bd(){setTimeout(ao,0);return(a1=b.now())}function ao(){a1=K}function aX(bs,e){var bt={};b.each(aD.concat.apply([],aD.slice(0,e)),function(){bt[this]=bs});return bt}b.each({slideDown:aX("show",1),slideUp:aX("hide",1),slideToggle:aX("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bs){b.fn[e]=function(bt,bv,bu){return this.animate(bs,bt,bv,bu)}});b.extend({speed:function(bt,bu,bs){var e=bt&&typeof bt==="object"?b.extend({},bt):{complete:bs||!bs&&bu||b.isFunction(bt)&&bt,duration:bt,easing:bs&&bu||bu&&!b.isFunction(bu)&&bu};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;e.old=e.complete;e.complete=function(bv){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue!==false){b.dequeue(this)}else{if(bv!==false){b._unmark(this)}}};return e},easing:{linear:function(bt,bu,e,bs){return e+bs*bt},swing:function(bt,bu,e,bs){return((-Math.cos(bt*Math.PI)/2)+0.5)*bs+e}},timers:[],fx:function(bs,e,bt){this.options=e;this.elem=bs;this.prop=bt;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bs=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bs))?!bs||bs==="auto"?0:bs:e},custom:function(bx,bw,bu){var e=this,bt=b.fx,bv;this.startTime=a1||bd();this.start=bx;this.end=bw;this.unit=bu||this.unit||(b.cssNumber[this.prop]?"":"px");this.now=this.start;this.pos=this.state=0;function bs(by){return e.step(by)}bs.elem=this.elem;if(bs()&&b.timers.push(bs)&&!aZ){if(R){aZ=true;bv=function(){if(aZ){R(bv);bt.tick()}};R(bv)}else{aZ=setInterval(bt.tick,bt.interval)}}},show:function(){this.options.orig[this.prop]=b.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(bv){var bu=a1||bd(),e=true,bw=this.elem,bs=this.options,bt,by;if(bv||bu>=bs.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bs.animatedProperties[this.prop]=true;for(bt in bs.animatedProperties){if(bs.animatedProperties[bt]!==true){e=false}}if(e){if(bs.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bz,bA){bw.style["overflow"+bA]=bs.overflow[bz]})}if(bs.hide){b(bw).hide()}if(bs.hide||bs.show){for(var bx in bs.animatedProperties){b.style(bw,bx,bs.orig[bx])}}bs.complete.call(bw)}return false}else{if(bs.duration==Infinity){this.now=bu}else{by=bu-this.startTime;this.state=by/bs.duration;this.pos=b.easing[bs.animatedProperties[this.prop]](this.state,by,0,1,bs.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){for(var bs=b.timers,e=0;e<bs.length;++e){if(!bs[e]()){bs.splice(e--,1)}}if(!bs.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(aZ);aZ=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=(e.prop==="width"||e.prop==="height"?Math.max(0,e.now):e.now)+e.unit}else{e.elem[e.prop]=e.now}}}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bs){return e===bs.elem}).length}}function x(bu){if(!Q[bu]){var e=aq.body,bs=b("<"+bu+">").appendTo(e),bt=bs.css("display");bs.remove();if(bt==="none"||bt===""){if(!a6){a6=aq.createElement("iframe");a6.frameBorder=a6.width=a6.height=0}e.appendChild(a6);if(!m||!a6.createElement){m=(a6.contentWindow||a6.contentDocument).document;m.write((aq.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>");m.close()}bs=m.createElement(bu);m.body.appendChild(bs);bt=b.css(bs,"display");e.removeChild(a6)}Q[bu]=bt}return Q[bu]}var U=/^t(?:able|d|h)$/i,aa=/^(?:body|html)$/i;if("getBoundingClientRect" in aq.documentElement){b.fn.offset=function(bF){var bv=this[0],by;if(bF){return this.each(function(e){b.offset.setOffset(this,bF,e)})}if(!bv||!bv.ownerDocument){return null}if(bv===bv.ownerDocument.body){return b.offset.bodyOffset(bv)}try{by=bv.getBoundingClientRect()}catch(bC){}var bE=bv.ownerDocument,bt=bE.documentElement;if(!by||!b.contains(bt,bv)){return by?{top:by.top,left:by.left}:{top:0,left:0}}var bz=bE.body,bA=aG(bE),bx=bt.clientTop||bz.clientTop||0,bB=bt.clientLeft||bz.clientLeft||0,bs=bA.pageYOffset||b.support.boxModel&&bt.scrollTop||bz.scrollTop,bw=bA.pageXOffset||b.support.boxModel&&bt.scrollLeft||bz.scrollLeft,bD=by.top+bs-bx,bu=by.left+bw-bB;return{top:bD,left:bu}}}else{b.fn.offset=function(bC){var bw=this[0];if(bC){return this.each(function(bD){b.offset.setOffset(this,bC,bD)})}if(!bw||!bw.ownerDocument){return null}if(bw===bw.ownerDocument.body){return b.offset.bodyOffset(bw)}b.offset.initialize();var bz,bt=bw.offsetParent,bs=bw,bB=bw.ownerDocument,bu=bB.documentElement,bx=bB.body,by=bB.defaultView,e=by?by.getComputedStyle(bw,null):bw.currentStyle,bA=bw.offsetTop,bv=bw.offsetLeft;while((bw=bw.parentNode)&&bw!==bx&&bw!==bu){if(b.offset.supportsFixedPosition&&e.position==="fixed"){break}bz=by?by.getComputedStyle(bw,null):bw.currentStyle;bA-=bw.scrollTop;bv-=bw.scrollLeft;if(bw===bt){bA+=bw.offsetTop;bv+=bw.offsetLeft;if(b.offset.doesNotAddBorder&&!(b.offset.doesAddBorderForTableAndCells&&U.test(bw.nodeName))){bA+=parseFloat(bz.borderTopWidth)||0;bv+=parseFloat(bz.borderLeftWidth)||0}bs=bt;bt=bw.offsetParent}if(b.offset.subtractsBorderForOverflowNotVisible&&bz.overflow!=="visible"){bA+=parseFloat(bz.borderTopWidth)||0;bv+=parseFloat(bz.borderLeftWidth)||0}e=bz}if(e.position==="relative"||e.position==="static"){bA+=bx.offsetTop;bv+=bx.offsetLeft}if(b.offset.supportsFixedPosition&&e.position==="fixed"){bA+=Math.max(bu.scrollTop,bx.scrollTop);bv+=Math.max(bu.scrollLeft,bx.scrollLeft)}return{top:bA,left:bv}}}b.offset={initialize:function(){var e=aq.body,bs=aq.createElement("div"),bv,bx,bw,by,bt=parseFloat(b.css(e,"marginTop"))||0,bu="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";b.extend(bs.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});bs.innerHTML=bu;e.insertBefore(bs,e.firstChild);bv=bs.firstChild;bx=bv.firstChild;by=bv.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(bx.offsetTop!==5);this.doesAddBorderForTableAndCells=(by.offsetTop===5);bx.style.position="fixed";bx.style.top="20px";this.supportsFixedPosition=(bx.offsetTop===20||bx.offsetTop===15);bx.style.position=bx.style.top="";bv.style.overflow="hidden";bv.style.position="relative";this.subtractsBorderForOverflowNotVisible=(bx.offsetTop===-5);this.doesNotIncludeMarginInBodyOffset=(e.offsetTop!==bt);e.removeChild(bs);b.offset.initialize=b.noop},bodyOffset:function(e){var bt=e.offsetTop,bs=e.offsetLeft;b.offset.initialize();if(b.offset.doesNotIncludeMarginInBodyOffset){bt+=parseFloat(b.css(e,"marginTop"))||0;bs+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bt,left:bs}},setOffset:function(bu,bD,bx){var by=b.css(bu,"position");if(by==="static"){bu.style.position="relative"}var bw=b(bu),bs=bw.offset(),e=b.css(bu,"top"),bB=b.css(bu,"left"),bC=(by==="absolute"||by==="fixed")&&b.inArray("auto",[e,bB])>-1,bA={},bz={},bt,bv;if(bC){bz=bw.position();bt=bz.top;bv=bz.left}else{bt=parseFloat(e)||0;bv=parseFloat(bB)||0}if(b.isFunction(bD)){bD=bD.call(bu,bx,bs)}if(bD.top!=null){bA.top=(bD.top-bs.top)+bt}if(bD.left!=null){bA.left=(bD.left-bs.left)+bv}if("using" in bD){bD.using.call(bu,bA)}else{bw.css(bA)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bt=this[0],bs=this.offsetParent(),bu=this.offset(),e=aa.test(bs[0].nodeName)?{top:0,left:0}:bs.offset();bu.top-=parseFloat(b.css(bt,"marginTop"))||0;bu.left-=parseFloat(b.css(bt,"marginLeft"))||0;e.top+=parseFloat(b.css(bs[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bs[0],"borderLeftWidth"))||0;return{top:bu.top-e.top,left:bu.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||aq.body;while(e&&(!aa.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bs,e){var bt="scroll"+e;b.fn[bt]=function(bw){var bu,bv;if(bw===K){bu=this[0];if(!bu){return null}bv=aG(bu);return bv?("pageXOffset" in bv)?bv[bs?"pageYOffset":"pageXOffset"]:b.support.boxModel&&bv.document.documentElement[bt]||bv.document.body[bt]:bu[bt]}return this.each(function(){bv=aG(this);if(bv){bv.scrollTo(!bs?bw:b(bv).scrollLeft(),bs?bw:b(bv).scrollTop())}else{this[bt]=bw}})}});function aG(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bs,e){var bt=e.toLowerCase();b.fn["inner"+e]=function(){var bu=this[0];return bu&&bu.style?parseFloat(b.css(bu,bt,"padding")):null};b.fn["outer"+e]=function(bv){var bu=this[0];return bu&&bu.style?parseFloat(b.css(bu,bt,bv?"margin":"border")):null};b.fn[bt]=function(bv){var bw=this[0];if(!bw){return bv==null?null:this}if(b.isFunction(bv)){return this.each(function(bA){var bz=b(this);bz[bt](bv.call(this,bA,bz[bt]()))})}if(b.isWindow(bw)){var bx=bw.document.documentElement["client"+e];return bw.document.compatMode==="CSS1Compat"&&bx||bw.document.body["client"+e]||bx}else{if(bw.nodeType===9){return Math.max(bw.documentElement["client"+e],bw.body["scroll"+e],bw.documentElement["scroll"+e],bw.body["offset"+e],bw.documentElement["offset"+e])}else{if(bv===K){var by=b.css(bw,bt),bu=parseFloat(by);return b.isNaN(bu)?by:bu}else{return this.css(bt,typeof bv==="string"?bv:bv+"px")}}}}});a9.jQuery=a9.$=b})(window);
\ No newline at end of file